diff --git a/index.html b/index.html new file mode 100644 index 00000000..ae542c20 --- /dev/null +++ b/index.html @@ -0,0 +1,63 @@ + + + + + Trek (Not Shrek) Travel + + + + + + + + + +
+

TREK

+ +
+
+ +
+ + +
+ +
+ +
+
+
+
+ +
+

Reserve A Trip

+
+ + +
+ +
+ + +
+ +
+ + +
+ + +
+
+
+
+ + + + + diff --git a/node_modules/axios/CHANGELOG.md b/node_modules/axios/CHANGELOG.md new file mode 100644 index 00000000..d336ec10 --- /dev/null +++ b/node_modules/axios/CHANGELOG.md @@ -0,0 +1,245 @@ +# Changelog + +### 0.18.0 (Feb 19, 2018) + +- Adding support for UNIX Sockets when running with Node.js ([#1070](https://github.com/axios/axios/pull/1070)) +- Fixing typings ([#1177](https://github.com/axios/axios/pull/1177)): + - AxiosRequestConfig.proxy: allows type false + - AxiosProxyConfig: added auth field +- Adding function signature in AxiosInstance interface so AxiosInstance can be invoked ([#1192](https://github.com/axios/axios/pull/1192), [#1254](https://github.com/axios/axios/pull/1254)) +- Allowing maxContentLength to pass through to redirected calls as maxBodyLength in follow-redirects config ([#1287](https://github.com/axios/axios/pull/1287)) +- Fixing configuration when using an instance - method can now be set ([#1342](https://github.com/axios/axios/pull/1342)) + + +### 0.17.1 (Nov 11, 2017) + +- Fixing issue with web workers ([#1160](https://github.com/axios/axios/pull/1160)) +- Allowing overriding transport ([#1080](https://github.com/axios/axios/pull/1080)) +- Updating TypeScript typings ([#1165](https://github.com/axios/axios/pull/1165), [#1125](https://github.com/axios/axios/pull/1125), [#1131](https://github.com/axios/axios/pull/1131)) + +### 0.17.0 (Oct 21, 2017) + +- **BREAKING** Fixing issue with `baseURL` and interceptors ([#950](https://github.com/axios/axios/pull/950)) +- **BREAKING** Improving handing of duplicate headers ([#874](https://github.com/axios/axios/pull/874)) +- Adding support for disabling proxies ([#691](https://github.com/axios/axios/pull/691)) +- Updating TypeScript typings with generic type parameters ([#1061](https://github.com/axios/axios/pull/1061)) + +### 0.16.2 (Jun 3, 2017) + +- Fixing issue with including `buffer` in bundle ([#887](https://github.com/axios/axios/pull/887)) +- Including underlying request in errors ([#830](https://github.com/axios/axios/pull/830)) +- Convert `method` to lowercase ([#930](https://github.com/axios/axios/pull/930)) + +### 0.16.1 (Apr 8, 2017) + +- Improving HTTP adapter to return last request in case of redirects ([#828](https://github.com/axios/axios/pull/828)) +- Updating `follow-redirects` dependency ([#829](https://github.com/axios/axios/pull/829)) +- Adding support for passing `Buffer` in node ([#773](https://github.com/axios/axios/pull/773)) + +### 0.16.0 (Mar 31, 2017) + +- **BREAKING** Removing `Promise` from axios typings in favor of built-in type declarations ([#480](https://github.com/axios/axios/issues/480)) +- Adding `options` shortcut method ([#461](https://github.com/axios/axios/pull/461)) +- Fixing issue with using `responseType: 'json'` in browsers incompatible with XHR Level 2 ([#654](https://github.com/axios/axios/pull/654)) +- Improving React Native detection ([#731](https://github.com/axios/axios/pull/731)) +- Fixing `combineURLs` to support empty `relativeURL` ([#581](https://github.com/axios/axios/pull/581)) +- Removing `PROTECTION_PREFIX` support ([#561](https://github.com/axios/axios/pull/561)) + +### 0.15.3 (Nov 27, 2016) + +- Fixing issue with custom instances and global defaults ([#443](https://github.com/axios/axios/issues/443)) +- Renaming `axios.d.ts` to `index.d.ts` ([#519](https://github.com/axios/axios/issues/519)) +- Adding `get`, `head`, and `delete` to `defaults.headers` ([#509](https://github.com/axios/axios/issues/509)) +- Fixing issue with `btoa` and IE ([#507](https://github.com/axios/axios/issues/507)) +- Adding support for proxy authentication ([#483](https://github.com/axios/axios/pull/483)) +- Improving HTTP adapter to use `http` protocol by default ([#493](https://github.com/axios/axios/pull/493)) +- Fixing proxy issues ([#491](https://github.com/axios/axios/pull/491)) + +### 0.15.2 (Oct 17, 2016) + +- Fixing issue with calling `cancel` after response has been received ([#482](https://github.com/axios/axios/issues/482)) + +### 0.15.1 (Oct 14, 2016) + +- Fixing issue with UMD ([#485](https://github.com/axios/axios/issues/485)) + +### 0.15.0 (Oct 10, 2016) + +- Adding cancellation support ([#452](https://github.com/axios/axios/pull/452)) +- Moving default adapter to global defaults ([#437](https://github.com/axios/axios/pull/437)) +- Fixing issue with `file` URI scheme ([#440](https://github.com/axios/axios/pull/440)) +- Fixing issue with `params` objects that have no prototype ([#445](https://github.com/axios/axios/pull/445)) + +### 0.14.0 (Aug 27, 2016) + +- **BREAKING** Updating TypeScript definitions ([#419](https://github.com/axios/axios/pull/419)) +- **BREAKING** Replacing `agent` option with `httpAgent` and `httpsAgent` ([#387](https://github.com/axios/axios/pull/387)) +- **BREAKING** Splitting `progress` event handlers into `onUploadProgress` and `onDownloadProgress` ([#423](https://github.com/axios/axios/pull/423)) +- Adding support for `http_proxy` and `https_proxy` environment variables ([#366](https://github.com/axios/axios/pull/366)) +- Fixing issue with `auth` config option and `Authorization` header ([#397](https://github.com/axios/axios/pull/397)) +- Don't set XSRF header if `xsrfCookieName` is `null` ([#406](https://github.com/axios/axios/pull/406)) + +### 0.13.1 (Jul 16, 2016) + +- Fixing issue with response data not being transformed on error ([#378](https://github.com/axios/axios/issues/378)) + +### 0.13.0 (Jul 13, 2016) + +- **BREAKING** Improved error handling ([#345](https://github.com/axios/axios/pull/345)) +- **BREAKING** Response transformer now invoked in dispatcher not adapter ([10eb238](https://github.com/axios/axios/commit/10eb23865101f9347570552c04e9d6211376e25e)) +- **BREAKING** Request adapters now return a `Promise` ([157efd5](https://github.com/axios/axios/commit/157efd5615890301824e3121cc6c9d2f9b21f94a)) +- Fixing issue with `withCredentials` not being overwritten ([#343](https://github.com/axios/axios/issues/343)) +- Fixing regression with request transformer being called before request interceptor ([#352](https://github.com/axios/axios/issues/352)) +- Fixing custom instance defaults ([#341](https://github.com/axios/axios/issues/341)) +- Fixing instances created from `axios.create` to have same API as default axios ([#217](https://github.com/axios/axios/issues/217)) + +### 0.12.0 (May 31, 2016) + +- Adding support for `URLSearchParams` ([#317](https://github.com/axios/axios/pull/317)) +- Adding `maxRedirects` option ([#307](https://github.com/axios/axios/pull/307)) + +### 0.11.1 (May 17, 2016) + +- Fixing IE CORS support ([#313](https://github.com/axios/axios/pull/313)) +- Fixing detection of `FormData` ([#325](https://github.com/axios/axios/pull/325)) +- Adding `Axios` class to exports ([#321](https://github.com/axios/axios/pull/321)) + +### 0.11.0 (Apr 26, 2016) + +- Adding support for Stream with HTTP adapter ([#296](https://github.com/axios/axios/pull/296)) +- Adding support for custom HTTP status code error ranges ([#308](https://github.com/axios/axios/pull/308)) +- Fixing issue with ArrayBuffer ([#299](https://github.com/axios/axios/pull/299)) + +### 0.10.0 (Apr 20, 2016) + +- Fixing issue with some requests sending `undefined` instead of `null` ([#250](https://github.com/axios/axios/pull/250)) +- Fixing basic auth for HTTP adapter ([#252](https://github.com/axios/axios/pull/252)) +- Fixing request timeout for XHR adapter ([#227](https://github.com/axios/axios/pull/227)) +- Fixing IE8 support by using `onreadystatechange` instead of `onload` ([#249](https://github.com/axios/axios/pull/249)) +- Fixing IE9 cross domain requests ([#251](https://github.com/axios/axios/pull/251)) +- Adding `maxContentLength` option ([#275](https://github.com/axios/axios/pull/275)) +- Fixing XHR support for WebWorker environment ([#279](https://github.com/axios/axios/pull/279)) +- Adding request instance to response ([#200](https://github.com/axios/axios/pull/200)) + +### 0.9.1 (Jan 24, 2016) + +- Improving handling of request timeout in node ([#124](https://github.com/axios/axios/issues/124)) +- Fixing network errors not rejecting ([#205](https://github.com/axios/axios/pull/205)) +- Fixing issue with IE rejecting on HTTP 204 ([#201](https://github.com/axios/axios/issues/201)) +- Fixing host/port when following redirects ([#198](https://github.com/axios/axios/pull/198)) + +### 0.9.0 (Jan 18, 2016) + +- Adding support for custom adapters +- Fixing Content-Type header being removed when data is false ([#195](https://github.com/axios/axios/pull/195)) +- Improving XDomainRequest implementation ([#185](https://github.com/axios/axios/pull/185)) +- Improving config merging and order of precedence ([#183](https://github.com/axios/axios/pull/183)) +- Fixing XDomainRequest support for only <= IE9 ([#182](https://github.com/axios/axios/pull/182)) + +### 0.8.1 (Dec 14, 2015) + +- Adding support for passing XSRF token for cross domain requests when using `withCredentials` ([#168](https://github.com/axios/axios/pull/168)) +- Fixing error with format of basic auth header ([#178](https://github.com/axios/axios/pull/173)) +- Fixing error with JSON payloads throwing `InvalidStateError` in some cases ([#174](https://github.com/axios/axios/pull/174)) + +### 0.8.0 (Dec 11, 2015) + +- Adding support for creating instances of axios ([#123](https://github.com/axios/axios/pull/123)) +- Fixing http adapter to use `Buffer` instead of `String` in case of `responseType === 'arraybuffer'` ([#128](https://github.com/axios/axios/pull/128)) +- Adding support for using custom parameter serializer with `paramsSerializer` option ([#121](https://github.com/axios/axios/pull/121)) +- Fixing issue in IE8 caused by `forEach` on `arguments` ([#127](https://github.com/axios/axios/pull/127)) +- Adding support for following redirects in node ([#146](https://github.com/axios/axios/pull/146)) +- Adding support for transparent decompression if `content-encoding` is set ([#149](https://github.com/axios/axios/pull/149)) +- Adding support for transparent XDomainRequest to handle cross domain requests in IE9 ([#140](https://github.com/axios/axios/pull/140)) +- Adding support for HTTP basic auth via Authorization header ([#167](https://github.com/axios/axios/pull/167)) +- Adding support for baseURL option ([#160](https://github.com/axios/axios/pull/160)) + +### 0.7.0 (Sep 29, 2015) + +- Fixing issue with minified bundle in IE8 ([#87](https://github.com/axios/axios/pull/87)) +- Adding support for passing agent in node ([#102](https://github.com/axios/axios/pull/102)) +- Adding support for returning result from `axios.spread` for chaining ([#106](https://github.com/axios/axios/pull/106)) +- Fixing typescript definition ([#105](https://github.com/axios/axios/pull/105)) +- Fixing default timeout config for node ([#112](https://github.com/axios/axios/pull/112)) +- Adding support for use in web workers, and react-native ([#70](https://github.com/axios/axios/issue/70)), ([#98](https://github.com/axios/axios/pull/98)) +- Adding support for fetch like API `axios(url[, config])` ([#116](https://github.com/axios/axios/issues/116)) + +### 0.6.0 (Sep 21, 2015) + +- Removing deprecated success/error aliases +- Fixing issue with array params not being properly encoded ([#49](https://github.com/axios/axios/pull/49)) +- Fixing issue with User-Agent getting overridden ([#69](https://github.com/axios/axios/issues/69)) +- Adding support for timeout config ([#56](https://github.com/axios/axios/issues/56)) +- Removing es6-promise dependency +- Fixing issue preventing `length` to be used as a parameter ([#91](https://github.com/axios/axios/pull/91)) +- Fixing issue with IE8 ([#85](https://github.com/axios/axios/pull/85)) +- Converting build to UMD + +### 0.5.4 (Apr 08, 2015) + +- Fixing issue with FormData not being sent ([#53](https://github.com/axios/axios/issues/53)) + +### 0.5.3 (Apr 07, 2015) + +- Using JSON.parse unconditionally when transforming response string ([#55](https://github.com/axios/axios/issues/55)) + +### 0.5.2 (Mar 13, 2015) + +- Adding support for `statusText` in response ([#46](https://github.com/axios/axios/issues/46)) + +### 0.5.1 (Mar 10, 2015) + +- Fixing issue using strict mode ([#45](https://github.com/axios/axios/issues/45)) +- Fixing issue with standalone build ([#47](https://github.com/axios/axios/issues/47)) + +### 0.5.0 (Jan 23, 2015) + +- Adding support for intercepetors ([#14](https://github.com/axios/axios/issues/14)) +- Updating es6-promise dependency + +### 0.4.2 (Dec 10, 2014) + +- Fixing issue with `Content-Type` when using `FormData` ([#22](https://github.com/axios/axios/issues/22)) +- Adding support for TypeScript ([#25](https://github.com/axios/axios/issues/25)) +- Fixing issue with standalone build ([#29](https://github.com/axios/axios/issues/29)) +- Fixing issue with verbs needing to be capitalized in some browsers ([#30](https://github.com/axios/axios/issues/30)) + +### 0.4.1 (Oct 15, 2014) + +- Adding error handling to request for node.js ([#18](https://github.com/axios/axios/issues/18)) + +### 0.4.0 (Oct 03, 2014) + +- Adding support for `ArrayBuffer` and `ArrayBufferView` ([#10](https://github.com/axios/axios/issues/10)) +- Adding support for utf-8 for node.js ([#13](https://github.com/axios/axios/issues/13)) +- Adding support for SSL for node.js ([#12](https://github.com/axios/axios/issues/12)) +- Fixing incorrect `Content-Type` header ([#9](https://github.com/axios/axios/issues/9)) +- Adding standalone build without bundled es6-promise ([#11](https://github.com/axios/axios/issues/11)) +- Deprecating `success`/`error` in favor of `then`/`catch` + +### 0.3.1 (Sep 16, 2014) + +- Fixing missing post body when using node.js ([#3](https://github.com/axios/axios/issues/3)) + +### 0.3.0 (Sep 16, 2014) + +- Fixing `success` and `error` to properly receive response data as individual arguments ([#8](https://github.com/axios/axios/issues/8)) +- Updating `then` and `catch` to receive response data as a single object ([#6](https://github.com/axios/axios/issues/6)) +- Fixing issue with `all` not working ([#7](https://github.com/axios/axios/issues/7)) + +### 0.2.2 (Sep 14, 2014) + +- Fixing bundling with browserify ([#4](https://github.com/axios/axios/issues/4)) + +### 0.2.1 (Sep 12, 2014) + +- Fixing build problem causing ridiculous file sizes + +### 0.2.0 (Sep 12, 2014) + +- Adding support for `all` and `spread` +- Adding support for node.js ([#1](https://github.com/axios/axios/issues/1)) + +### 0.1.0 (Aug 29, 2014) + +- Initial release diff --git a/node_modules/axios/LICENSE b/node_modules/axios/LICENSE new file mode 100644 index 00000000..d36c80ef --- /dev/null +++ b/node_modules/axios/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2014-present Matt Zabriskie + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/axios/README.md b/node_modules/axios/README.md new file mode 100755 index 00000000..ec78817c --- /dev/null +++ b/node_modules/axios/README.md @@ -0,0 +1,625 @@ +# axios + +[![npm version](https://img.shields.io/npm/v/axios.svg?style=flat-square)](https://www.npmjs.org/package/axios) +[![build status](https://img.shields.io/travis/axios/axios.svg?style=flat-square)](https://travis-ci.org/axios/axios) +[![code coverage](https://img.shields.io/coveralls/mzabriskie/axios.svg?style=flat-square)](https://coveralls.io/r/mzabriskie/axios) +[![npm downloads](https://img.shields.io/npm/dm/axios.svg?style=flat-square)](http://npm-stat.com/charts.html?package=axios) +[![gitter chat](https://img.shields.io/gitter/room/mzabriskie/axios.svg?style=flat-square)](https://gitter.im/mzabriskie/axios) +[![code helpers](https://www.codetriage.com/axios/axios/badges/users.svg)](https://www.codetriage.com/axios/axios) + +Promise based HTTP client for the browser and node.js + +## Features + +- Make [XMLHttpRequests](https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest) from the browser +- Make [http](http://nodejs.org/api/http.html) requests from node.js +- Supports the [Promise](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise) API +- Intercept request and response +- Transform request and response data +- Cancel requests +- Automatic transforms for JSON data +- Client side support for protecting against [XSRF](http://en.wikipedia.org/wiki/Cross-site_request_forgery) + +## Browser Support + +![Chrome](https://raw.github.com/alrra/browser-logos/master/src/chrome/chrome_48x48.png) | ![Firefox](https://raw.github.com/alrra/browser-logos/master/src/firefox/firefox_48x48.png) | ![Safari](https://raw.github.com/alrra/browser-logos/master/src/safari/safari_48x48.png) | ![Opera](https://raw.github.com/alrra/browser-logos/master/src/opera/opera_48x48.png) | ![Edge](https://raw.github.com/alrra/browser-logos/master/src/edge/edge_48x48.png) | ![IE](https://raw.github.com/alrra/browser-logos/master/src/archive/internet-explorer_9-11/internet-explorer_9-11_48x48.png) | +--- | --- | --- | --- | --- | --- | +Latest ✔ | Latest ✔ | Latest ✔ | Latest ✔ | Latest ✔ | 8+ ✔ | + +[![Browser Matrix](https://saucelabs.com/open_sauce/build_matrix/axios.svg)](https://saucelabs.com/u/axios) + +## Installing + +Using npm: + +```bash +$ npm install axios +``` + +Using bower: + +```bash +$ bower install axios +``` + +Using cdn: + +```html + +``` + +## Example + +Performing a `GET` request + +```js +// Make a request for a user with a given ID +axios.get('/user?ID=12345') + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }); + +// Optionally the request above could also be done as +axios.get('/user', { + params: { + ID: 12345 + } + }) + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }); +``` + +Performing a `POST` request + +```js +axios.post('/user', { + firstName: 'Fred', + lastName: 'Flintstone' + }) + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }); +``` + +Performing multiple concurrent requests + +```js +function getUserAccount() { + return axios.get('/user/12345'); +} + +function getUserPermissions() { + return axios.get('/user/12345/permissions'); +} + +axios.all([getUserAccount(), getUserPermissions()]) + .then(axios.spread(function (acct, perms) { + // Both requests are now complete + })); +``` + +## axios API + +Requests can be made by passing the relevant config to `axios`. + +##### axios(config) + +```js +// Send a POST request +axios({ + method: 'post', + url: '/user/12345', + data: { + firstName: 'Fred', + lastName: 'Flintstone' + } +}); +``` + +```js +// GET request for remote image +axios({ + method:'get', + url:'http://bit.ly/2mTM3nY', + responseType:'stream' +}) + .then(function(response) { + response.data.pipe(fs.createWriteStream('ada_lovelace.jpg')) +}); +``` + +##### axios(url[, config]) + +```js +// Send a GET request (default method) +axios('/user/12345'); +``` + +### Request method aliases + +For convenience aliases have been provided for all supported request methods. + +##### axios.request(config) +##### axios.get(url[, config]) +##### axios.delete(url[, config]) +##### axios.head(url[, config]) +##### axios.options(url[, config]) +##### axios.post(url[, data[, config]]) +##### axios.put(url[, data[, config]]) +##### axios.patch(url[, data[, config]]) + +###### NOTE +When using the alias methods `url`, `method`, and `data` properties don't need to be specified in config. + +### Concurrency + +Helper functions for dealing with concurrent requests. + +##### axios.all(iterable) +##### axios.spread(callback) + +### Creating an instance + +You can create a new instance of axios with a custom config. + +##### axios.create([config]) + +```js +var instance = axios.create({ + baseURL: 'https://some-domain.com/api/', + timeout: 1000, + headers: {'X-Custom-Header': 'foobar'} +}); +``` + +### Instance methods + +The available instance methods are listed below. The specified config will be merged with the instance config. + +##### axios#request(config) +##### axios#get(url[, config]) +##### axios#delete(url[, config]) +##### axios#head(url[, config]) +##### axios#options(url[, config]) +##### axios#post(url[, data[, config]]) +##### axios#put(url[, data[, config]]) +##### axios#patch(url[, data[, config]]) + +## Request Config + +These are the available config options for making requests. Only the `url` is required. Requests will default to `GET` if `method` is not specified. + +```js +{ + // `url` is the server URL that will be used for the request + url: '/user', + + // `method` is the request method to be used when making the request + method: 'get', // default + + // `baseURL` will be prepended to `url` unless `url` is absolute. + // It can be convenient to set `baseURL` for an instance of axios to pass relative URLs + // to methods of that instance. + baseURL: 'https://some-domain.com/api/', + + // `transformRequest` allows changes to the request data before it is sent to the server + // This is only applicable for request methods 'PUT', 'POST', and 'PATCH' + // The last function in the array must return a string or an instance of Buffer, ArrayBuffer, + // FormData or Stream + // You may modify the headers object. + transformRequest: [function (data, headers) { + // Do whatever you want to transform the data + + return data; + }], + + // `transformResponse` allows changes to the response data to be made before + // it is passed to then/catch + transformResponse: [function (data) { + // Do whatever you want to transform the data + + return data; + }], + + // `headers` are custom headers to be sent + headers: {'X-Requested-With': 'XMLHttpRequest'}, + + // `params` are the URL parameters to be sent with the request + // Must be a plain object or a URLSearchParams object + params: { + ID: 12345 + }, + + // `paramsSerializer` is an optional function in charge of serializing `params` + // (e.g. https://www.npmjs.com/package/qs, http://api.jquery.com/jquery.param/) + paramsSerializer: function(params) { + return Qs.stringify(params, {arrayFormat: 'brackets'}) + }, + + // `data` is the data to be sent as the request body + // Only applicable for request methods 'PUT', 'POST', and 'PATCH' + // When no `transformRequest` is set, must be of one of the following types: + // - string, plain object, ArrayBuffer, ArrayBufferView, URLSearchParams + // - Browser only: FormData, File, Blob + // - Node only: Stream, Buffer + data: { + firstName: 'Fred' + }, + + // `timeout` specifies the number of milliseconds before the request times out. + // If the request takes longer than `timeout`, the request will be aborted. + timeout: 1000, + + // `withCredentials` indicates whether or not cross-site Access-Control requests + // should be made using credentials + withCredentials: false, // default + + // `adapter` allows custom handling of requests which makes testing easier. + // Return a promise and supply a valid response (see lib/adapters/README.md). + adapter: function (config) { + /* ... */ + }, + + // `auth` indicates that HTTP Basic auth should be used, and supplies credentials. + // This will set an `Authorization` header, overwriting any existing + // `Authorization` custom headers you have set using `headers`. + auth: { + username: 'janedoe', + password: 's00pers3cret' + }, + + // `responseType` indicates the type of data that the server will respond with + // options are 'arraybuffer', 'blob', 'document', 'json', 'text', 'stream' + responseType: 'json', // default + + // `xsrfCookieName` is the name of the cookie to use as a value for xsrf token + xsrfCookieName: 'XSRF-TOKEN', // default + + // `xsrfHeaderName` is the name of the http header that carries the xsrf token value + xsrfHeaderName: 'X-XSRF-TOKEN', // default + + // `onUploadProgress` allows handling of progress events for uploads + onUploadProgress: function (progressEvent) { + // Do whatever you want with the native progress event + }, + + // `onDownloadProgress` allows handling of progress events for downloads + onDownloadProgress: function (progressEvent) { + // Do whatever you want with the native progress event + }, + + // `maxContentLength` defines the max size of the http response content allowed + maxContentLength: 2000, + + // `validateStatus` defines whether to resolve or reject the promise for a given + // HTTP response status code. If `validateStatus` returns `true` (or is set to `null` + // or `undefined`), the promise will be resolved; otherwise, the promise will be + // rejected. + validateStatus: function (status) { + return status >= 200 && status < 300; // default + }, + + // `maxRedirects` defines the maximum number of redirects to follow in node.js. + // If set to 0, no redirects will be followed. + maxRedirects: 5, // default + + // `socketPath` defines a UNIX Socket to be used in node.js. + // e.g. '/var/run/docker.sock' to send requests to the docker daemon. + // Only either `socketPath` or `proxy` can be specified. + // If both are specified, `socketPath` is used. + socketPath: null, // default + + // `httpAgent` and `httpsAgent` define a custom agent to be used when performing http + // and https requests, respectively, in node.js. This allows options to be added like + // `keepAlive` that are not enabled by default. + httpAgent: new http.Agent({ keepAlive: true }), + httpsAgent: new https.Agent({ keepAlive: true }), + + // 'proxy' defines the hostname and port of the proxy server + // Use `false` to disable proxies, ignoring environment variables. + // `auth` indicates that HTTP Basic auth should be used to connect to the proxy, and + // supplies credentials. + // This will set an `Proxy-Authorization` header, overwriting any existing + // `Proxy-Authorization` custom headers you have set using `headers`. + proxy: { + host: '127.0.0.1', + port: 9000, + auth: { + username: 'mikeymike', + password: 'rapunz3l' + } + }, + + // `cancelToken` specifies a cancel token that can be used to cancel the request + // (see Cancellation section below for details) + cancelToken: new CancelToken(function (cancel) { + }) +} +``` + +## Response Schema + +The response for a request contains the following information. + +```js +{ + // `data` is the response that was provided by the server + data: {}, + + // `status` is the HTTP status code from the server response + status: 200, + + // `statusText` is the HTTP status message from the server response + statusText: 'OK', + + // `headers` the headers that the server responded with + // All header names are lower cased + headers: {}, + + // `config` is the config that was provided to `axios` for the request + config: {}, + + // `request` is the request that generated this response + // It is the last ClientRequest instance in node.js (in redirects) + // and an XMLHttpRequest instance the browser + request: {} +} +``` + +When using `then`, you will receive the response as follows: + +```js +axios.get('/user/12345') + .then(function(response) { + console.log(response.data); + console.log(response.status); + console.log(response.statusText); + console.log(response.headers); + console.log(response.config); + }); +``` + +When using `catch`, or passing a [rejection callback](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise/then) as second parameter of `then`, the response will be available through the `error` object as explained in the [Handling Errors](#handling-errors) section. + +## Config Defaults + +You can specify config defaults that will be applied to every request. + +### Global axios defaults + +```js +axios.defaults.baseURL = 'https://api.example.com'; +axios.defaults.headers.common['Authorization'] = AUTH_TOKEN; +axios.defaults.headers.post['Content-Type'] = 'application/x-www-form-urlencoded'; +``` + +### Custom instance defaults + +```js +// Set config defaults when creating the instance +var instance = axios.create({ + baseURL: 'https://api.example.com' +}); + +// Alter defaults after instance has been created +instance.defaults.headers.common['Authorization'] = AUTH_TOKEN; +``` + +### Config order of precedence + +Config will be merged with an order of precedence. The order is library defaults found in [lib/defaults.js](https://github.com/axios/axios/blob/master/lib/defaults.js#L28), then `defaults` property of the instance, and finally `config` argument for the request. The latter will take precedence over the former. Here's an example. + +```js +// Create an instance using the config defaults provided by the library +// At this point the timeout config value is `0` as is the default for the library +var instance = axios.create(); + +// Override timeout default for the library +// Now all requests will wait 2.5 seconds before timing out +instance.defaults.timeout = 2500; + +// Override timeout for this request as it's known to take a long time +instance.get('/longRequest', { + timeout: 5000 +}); +``` + +## Interceptors + +You can intercept requests or responses before they are handled by `then` or `catch`. + +```js +// Add a request interceptor +axios.interceptors.request.use(function (config) { + // Do something before request is sent + return config; + }, function (error) { + // Do something with request error + return Promise.reject(error); + }); + +// Add a response interceptor +axios.interceptors.response.use(function (response) { + // Do something with response data + return response; + }, function (error) { + // Do something with response error + return Promise.reject(error); + }); +``` + +If you may need to remove an interceptor later you can. + +```js +var myInterceptor = axios.interceptors.request.use(function () {/*...*/}); +axios.interceptors.request.eject(myInterceptor); +``` + +You can add interceptors to a custom instance of axios. + +```js +var instance = axios.create(); +instance.interceptors.request.use(function () {/*...*/}); +``` + +## Handling Errors + +```js +axios.get('/user/12345') + .catch(function (error) { + if (error.response) { + // The request was made and the server responded with a status code + // that falls out of the range of 2xx + console.log(error.response.data); + console.log(error.response.status); + console.log(error.response.headers); + } else if (error.request) { + // The request was made but no response was received + // `error.request` is an instance of XMLHttpRequest in the browser and an instance of + // http.ClientRequest in node.js + console.log(error.request); + } else { + // Something happened in setting up the request that triggered an Error + console.log('Error', error.message); + } + console.log(error.config); + }); +``` + +You can define a custom HTTP status code error range using the `validateStatus` config option. + +```js +axios.get('/user/12345', { + validateStatus: function (status) { + return status < 500; // Reject only if the status code is greater than or equal to 500 + } +}) +``` + +## Cancellation + +You can cancel a request using a *cancel token*. + +> The axios cancel token API is based on the withdrawn [cancelable promises proposal](https://github.com/tc39/proposal-cancelable-promises). + +You can create a cancel token using the `CancelToken.source` factory as shown below: + +```js +var CancelToken = axios.CancelToken; +var source = CancelToken.source(); + +axios.get('/user/12345', { + cancelToken: source.token +}).catch(function(thrown) { + if (axios.isCancel(thrown)) { + console.log('Request canceled', thrown.message); + } else { + // handle error + } +}); + +axios.post('/user/12345', { + name: 'new name' +}, { + cancelToken: source.token +}) + +// cancel the request (the message parameter is optional) +source.cancel('Operation canceled by the user.'); +``` + +You can also create a cancel token by passing an executor function to the `CancelToken` constructor: + +```js +var CancelToken = axios.CancelToken; +var cancel; + +axios.get('/user/12345', { + cancelToken: new CancelToken(function executor(c) { + // An executor function receives a cancel function as a parameter + cancel = c; + }) +}); + +// cancel the request +cancel(); +``` + +> Note: you can cancel several requests with the same cancel token. + +## Using application/x-www-form-urlencoded format + +By default, axios serializes JavaScript objects to `JSON`. To send data in the `application/x-www-form-urlencoded` format instead, you can use one of the following options. + +### Browser + +In a browser, you can use the [`URLSearchParams`](https://developer.mozilla.org/en-US/docs/Web/API/URLSearchParams) API as follows: + +```js +var params = new URLSearchParams(); +params.append('param1', 'value1'); +params.append('param2', 'value2'); +axios.post('/foo', params); +``` + +> Note that `URLSearchParams` is not supported by all browsers (see [caniuse.com](http://www.caniuse.com/#feat=urlsearchparams)), but there is a [polyfill](https://github.com/WebReflection/url-search-params) available (make sure to polyfill the global environment). + +Alternatively, you can encode data using the [`qs`](https://github.com/ljharb/qs) library: + +```js +var qs = require('qs'); +axios.post('/foo', qs.stringify({ 'bar': 123 })); +``` + +### Node.js + +In node.js, you can use the [`querystring`](https://nodejs.org/api/querystring.html) module as follows: + +```js +var querystring = require('querystring'); +axios.post('http://something.com/', querystring.stringify({ foo: 'bar' })); +``` + +You can also use the [`qs`](https://github.com/ljharb/qs) library. + +## Semver + +Until axios reaches a `1.0` release, breaking changes will be released with a new minor version. For example `0.5.1`, and `0.5.4` will have the same API, but `0.6.0` will have breaking changes. + +## Promises + +axios depends on a native ES6 Promise implementation to be [supported](http://caniuse.com/promises). +If your environment doesn't support ES6 Promises, you can [polyfill](https://github.com/jakearchibald/es6-promise). + +## TypeScript +axios includes [TypeScript](http://typescriptlang.org) definitions. +```typescript +import axios from 'axios'; +axios.get('/user?ID=12345'); +``` + +## Resources + +* [Changelog](https://github.com/axios/axios/blob/master/CHANGELOG.md) +* [Upgrade Guide](https://github.com/axios/axios/blob/master/UPGRADE_GUIDE.md) +* [Ecosystem](https://github.com/axios/axios/blob/master/ECOSYSTEM.md) +* [Contributing Guide](https://github.com/axios/axios/blob/master/CONTRIBUTING.md) +* [Code of Conduct](https://github.com/axios/axios/blob/master/CODE_OF_CONDUCT.md) + +## Credits + +axios is heavily inspired by the [$http service](https://docs.angularjs.org/api/ng/service/$http) provided in [Angular](https://angularjs.org/). Ultimately axios is an effort to provide a standalone `$http`-like service for use outside of Angular. + +## License + +MIT diff --git a/node_modules/axios/UPGRADE_GUIDE.md b/node_modules/axios/UPGRADE_GUIDE.md new file mode 100644 index 00000000..eedb0492 --- /dev/null +++ b/node_modules/axios/UPGRADE_GUIDE.md @@ -0,0 +1,162 @@ +# Upgrade Guide + +### 0.15.x -> 0.16.0 + +#### `Promise` Type Declarations + +The `Promise` type declarations have been removed from the axios typings in favor of the built-in type declarations. If you use axios in a TypeScript project that targets `ES5`, please make sure to include the `es2015.promise` lib. Please see [this post](https://blog.mariusschulz.com/2016/11/25/typescript-2-0-built-in-type-declarations) for details. + +### 0.13.x -> 0.14.0 + +#### TypeScript Definitions + +The axios TypeScript definitions have been updated to match the axios API and use the ES2015 module syntax. + +Please use the following `import` statement to import axios in TypeScript: + +```typescript +import axios from 'axios'; + +axios.get('/foo') + .then(response => console.log(response)) + .catch(error => console.log(error)); +``` + +#### `agent` Config Option + +The `agent` config option has been replaced with two new options: `httpAgent` and `httpsAgent`. Please use them instead. + +```js +{ + // Define a custom agent for HTTP + httpAgent: new http.Agent({ keepAlive: true }), + // Define a custom agent for HTTPS + httpsAgent: new https.Agent({ keepAlive: true }) +} +``` + +#### `progress` Config Option + +The `progress` config option has been replaced with the `onUploadProgress` and `onDownloadProgress` options. + +```js +{ + // Define a handler for upload progress events + onUploadProgress: function (progressEvent) { + // ... + }, + + // Define a handler for download progress events + onDownloadProgress: function (progressEvent) { + // ... + } +} +``` + +### 0.12.x -> 0.13.0 + +The `0.13.0` release contains several changes to custom adapters and error handling. + +#### Error Handling + +Previous to this release an error could either be a server response with bad status code or an actual `Error`. With this release Promise will always reject with an `Error`. In the case that a response was received, the `Error` will also include the response. + +```js +axios.get('/user/12345') + .catch((error) => { + console.log(error.message); + console.log(error.code); // Not always specified + console.log(error.config); // The config that was used to make the request + console.log(error.response); // Only available if response was received from the server + }); +``` + +#### Request Adapters + +This release changes a few things about how request adapters work. Please take note if you are using your own custom adapter. + +1. Response transformer is now called outside of adapter. +2. Request adapter returns a `Promise`. + +This means that you no longer need to invoke `transformData` on response data. You will also no longer receive `resolve` and `reject` as arguments in your adapter. + +Previous code: + +```js +function myAdapter(resolve, reject, config) { + var response = { + data: transformData( + responseData, + responseHeaders, + config.transformResponse + ), + status: request.status, + statusText: request.statusText, + headers: responseHeaders + }; + settle(resolve, reject, response); +} +``` + +New code: + +```js +function myAdapter(config) { + return new Promise(function (resolve, reject) { + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders + }; + settle(resolve, reject, response); + }); +} +``` + +See the related commits for more details: +- [Response transformers](https://github.com/axios/axios/commit/10eb23865101f9347570552c04e9d6211376e25e) +- [Request adapter Promise](https://github.com/axios/axios/commit/157efd5615890301824e3121cc6c9d2f9b21f94a) + +### 0.5.x -> 0.6.0 + +The `0.6.0` release contains mostly bug fixes, but there are a couple things to be aware of when upgrading. + +#### ES6 Promise Polyfill + +Up until the `0.6.0` release ES6 `Promise` was being polyfilled using [es6-promise](https://github.com/jakearchibald/es6-promise). With this release, the polyfill has been removed, and you will need to supply it yourself if your environment needs it. + +```js +require('es6-promise').polyfill(); +var axios = require('axios'); +``` + +This will polyfill the global environment, and only needs to be done once. + +#### `axios.success`/`axios.error` + +The `success`, and `error` aliases were deprectated in [0.4.0](https://github.com/axios/axios/blob/master/CHANGELOG.md#040-oct-03-2014). As of this release they have been removed entirely. Instead please use `axios.then`, and `axios.catch` respectively. + +```js +axios.get('some/url') + .then(function (res) { + /* ... */ + }) + .catch(function (err) { + /* ... */ + }); +``` + +#### UMD + +Previous versions of axios shipped with an AMD, CommonJS, and Global build. This has all been rolled into a single UMD build. + +```js +// AMD +require(['bower_components/axios/dist/axios'], function (axios) { + /* ... */ +}); + +// CommonJS +var axios = require('axios/dist/axios'); +``` diff --git a/node_modules/axios/dist/axios.js b/node_modules/axios/dist/axios.js new file mode 100644 index 00000000..cf8b39db --- /dev/null +++ b/node_modules/axios/dist/axios.js @@ -0,0 +1,1603 @@ +/* axios v0.18.0 | (c) 2018 by Matt Zabriskie */ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else if(typeof exports === 'object') + exports["axios"] = factory(); + else + root["axios"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; +/******/ +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.loaded = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + + module.exports = __webpack_require__(1); + +/***/ }), +/* 1 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var bind = __webpack_require__(3); + var Axios = __webpack_require__(5); + var defaults = __webpack_require__(6); + + /** + * Create an instance of Axios + * + * @param {Object} defaultConfig The default config for the instance + * @return {Axios} A new instance of Axios + */ + function createInstance(defaultConfig) { + var context = new Axios(defaultConfig); + var instance = bind(Axios.prototype.request, context); + + // Copy axios.prototype to instance + utils.extend(instance, Axios.prototype, context); + + // Copy context to instance + utils.extend(instance, context); + + return instance; + } + + // Create the default instance to be exported + var axios = createInstance(defaults); + + // Expose Axios class to allow class inheritance + axios.Axios = Axios; + + // Factory for creating new instances + axios.create = function create(instanceConfig) { + return createInstance(utils.merge(defaults, instanceConfig)); + }; + + // Expose Cancel & CancelToken + axios.Cancel = __webpack_require__(23); + axios.CancelToken = __webpack_require__(24); + axios.isCancel = __webpack_require__(20); + + // Expose all/spread + axios.all = function all(promises) { + return Promise.all(promises); + }; + axios.spread = __webpack_require__(25); + + module.exports = axios; + + // Allow use of default import syntax in TypeScript + module.exports.default = axios; + + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var bind = __webpack_require__(3); + var isBuffer = __webpack_require__(4); + + /*global toString:true*/ + + // utils is a library of generic helper functions non-specific to axios + + var toString = Object.prototype.toString; + + /** + * Determine if a value is an Array + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Array, otherwise false + */ + function isArray(val) { + return toString.call(val) === '[object Array]'; + } + + /** + * Determine if a value is an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an ArrayBuffer, otherwise false + */ + function isArrayBuffer(val) { + return toString.call(val) === '[object ArrayBuffer]'; + } + + /** + * Determine if a value is a FormData + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an FormData, otherwise false + */ + function isFormData(val) { + return (typeof FormData !== 'undefined') && (val instanceof FormData); + } + + /** + * Determine if a value is a view on an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false + */ + function isArrayBufferView(val) { + var result; + if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { + result = ArrayBuffer.isView(val); + } else { + result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer); + } + return result; + } + + /** + * Determine if a value is a String + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a String, otherwise false + */ + function isString(val) { + return typeof val === 'string'; + } + + /** + * Determine if a value is a Number + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Number, otherwise false + */ + function isNumber(val) { + return typeof val === 'number'; + } + + /** + * Determine if a value is undefined + * + * @param {Object} val The value to test + * @returns {boolean} True if the value is undefined, otherwise false + */ + function isUndefined(val) { + return typeof val === 'undefined'; + } + + /** + * Determine if a value is an Object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Object, otherwise false + */ + function isObject(val) { + return val !== null && typeof val === 'object'; + } + + /** + * Determine if a value is a Date + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Date, otherwise false + */ + function isDate(val) { + return toString.call(val) === '[object Date]'; + } + + /** + * Determine if a value is a File + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ + function isFile(val) { + return toString.call(val) === '[object File]'; + } + + /** + * Determine if a value is a Blob + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Blob, otherwise false + */ + function isBlob(val) { + return toString.call(val) === '[object Blob]'; + } + + /** + * Determine if a value is a Function + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Function, otherwise false + */ + function isFunction(val) { + return toString.call(val) === '[object Function]'; + } + + /** + * Determine if a value is a Stream + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Stream, otherwise false + */ + function isStream(val) { + return isObject(val) && isFunction(val.pipe); + } + + /** + * Determine if a value is a URLSearchParams object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a URLSearchParams object, otherwise false + */ + function isURLSearchParams(val) { + return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams; + } + + /** + * Trim excess whitespace off the beginning and end of a string + * + * @param {String} str The String to trim + * @returns {String} The String freed of excess whitespace + */ + function trim(str) { + return str.replace(/^\s*/, '').replace(/\s*$/, ''); + } + + /** + * Determine if we're running in a standard browser environment + * + * This allows axios to run in a web worker, and react-native. + * Both environments support XMLHttpRequest, but not fully standard globals. + * + * web workers: + * typeof window -> undefined + * typeof document -> undefined + * + * react-native: + * navigator.product -> 'ReactNative' + */ + function isStandardBrowserEnv() { + if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') { + return false; + } + return ( + typeof window !== 'undefined' && + typeof document !== 'undefined' + ); + } + + /** + * Iterate over an Array or an Object invoking a function for each item. + * + * If `obj` is an Array callback will be called passing + * the value, index, and complete array for each item. + * + * If 'obj' is an Object callback will be called passing + * the value, key, and complete object for each property. + * + * @param {Object|Array} obj The object to iterate + * @param {Function} fn The callback to invoke for each item + */ + function forEach(obj, fn) { + // Don't bother if no value provided + if (obj === null || typeof obj === 'undefined') { + return; + } + + // Force an array if not already something iterable + if (typeof obj !== 'object') { + /*eslint no-param-reassign:0*/ + obj = [obj]; + } + + if (isArray(obj)) { + // Iterate over array values + for (var i = 0, l = obj.length; i < l; i++) { + fn.call(null, obj[i], i, obj); + } + } else { + // Iterate over object keys + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) { + fn.call(null, obj[key], key, obj); + } + } + } + } + + /** + * Accepts varargs expecting each argument to be an object, then + * immutably merges the properties of each object and returns result. + * + * When multiple objects contain the same key the later object in + * the arguments list will take precedence. + * + * Example: + * + * ```js + * var result = merge({foo: 123}, {foo: 456}); + * console.log(result.foo); // outputs 456 + * ``` + * + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ + function merge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (typeof result[key] === 'object' && typeof val === 'object') { + result[key] = merge(result[key], val); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; + } + + /** + * Extends object a by mutably adding to it the properties of object b. + * + * @param {Object} a The object to be extended + * @param {Object} b The object to copy properties from + * @param {Object} thisArg The object to bind function to + * @return {Object} The resulting value of object a + */ + function extend(a, b, thisArg) { + forEach(b, function assignValue(val, key) { + if (thisArg && typeof val === 'function') { + a[key] = bind(val, thisArg); + } else { + a[key] = val; + } + }); + return a; + } + + module.exports = { + isArray: isArray, + isArrayBuffer: isArrayBuffer, + isBuffer: isBuffer, + isFormData: isFormData, + isArrayBufferView: isArrayBufferView, + isString: isString, + isNumber: isNumber, + isObject: isObject, + isUndefined: isUndefined, + isDate: isDate, + isFile: isFile, + isBlob: isBlob, + isFunction: isFunction, + isStream: isStream, + isURLSearchParams: isURLSearchParams, + isStandardBrowserEnv: isStandardBrowserEnv, + forEach: forEach, + merge: merge, + extend: extend, + trim: trim + }; + + +/***/ }), +/* 3 */ +/***/ (function(module, exports) { + + 'use strict'; + + module.exports = function bind(fn, thisArg) { + return function wrap() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + return fn.apply(thisArg, args); + }; + }; + + +/***/ }), +/* 4 */ +/***/ (function(module, exports) { + + /*! + * Determine if an object is a Buffer + * + * @author Feross Aboukhadijeh + * @license MIT + */ + + // The _isBuffer check is for Safari 5-7 support, because it's missing + // Object.prototype.constructor. Remove this eventually + module.exports = function (obj) { + return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer) + } + + function isBuffer (obj) { + return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj) + } + + // For Node v0.10 support. Remove this eventually. + function isSlowBuffer (obj) { + return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0)) + } + + +/***/ }), +/* 5 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var defaults = __webpack_require__(6); + var utils = __webpack_require__(2); + var InterceptorManager = __webpack_require__(17); + var dispatchRequest = __webpack_require__(18); + + /** + * Create a new instance of Axios + * + * @param {Object} instanceConfig The default config for the instance + */ + function Axios(instanceConfig) { + this.defaults = instanceConfig; + this.interceptors = { + request: new InterceptorManager(), + response: new InterceptorManager() + }; + } + + /** + * Dispatch a request + * + * @param {Object} config The config specific for this request (merged with this.defaults) + */ + Axios.prototype.request = function request(config) { + /*eslint no-param-reassign:0*/ + // Allow for axios('example/url'[, config]) a la fetch API + if (typeof config === 'string') { + config = utils.merge({ + url: arguments[0] + }, arguments[1]); + } + + config = utils.merge(defaults, {method: 'get'}, this.defaults, config); + config.method = config.method.toLowerCase(); + + // Hook up interceptors middleware + var chain = [dispatchRequest, undefined]; + var promise = Promise.resolve(config); + + this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { + chain.unshift(interceptor.fulfilled, interceptor.rejected); + }); + + this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { + chain.push(interceptor.fulfilled, interceptor.rejected); + }); + + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; + }; + + // Provide aliases for supported request methods + utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url + })); + }; + }); + + utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, data, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url, + data: data + })); + }; + }); + + module.exports = Axios; + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var normalizeHeaderName = __webpack_require__(7); + + var DEFAULT_CONTENT_TYPE = { + 'Content-Type': 'application/x-www-form-urlencoded' + }; + + function setContentTypeIfUnset(headers, value) { + if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { + headers['Content-Type'] = value; + } + } + + function getDefaultAdapter() { + var adapter; + if (typeof XMLHttpRequest !== 'undefined') { + // For browsers use XHR adapter + adapter = __webpack_require__(8); + } else if (typeof process !== 'undefined') { + // For node use HTTP adapter + adapter = __webpack_require__(8); + } + return adapter; + } + + var defaults = { + adapter: getDefaultAdapter(), + + transformRequest: [function transformRequest(data, headers) { + normalizeHeaderName(headers, 'Content-Type'); + if (utils.isFormData(data) || + utils.isArrayBuffer(data) || + utils.isBuffer(data) || + utils.isStream(data) || + utils.isFile(data) || + utils.isBlob(data) + ) { + return data; + } + if (utils.isArrayBufferView(data)) { + return data.buffer; + } + if (utils.isURLSearchParams(data)) { + setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); + return data.toString(); + } + if (utils.isObject(data)) { + setContentTypeIfUnset(headers, 'application/json;charset=utf-8'); + return JSON.stringify(data); + } + return data; + }], + + transformResponse: [function transformResponse(data) { + /*eslint no-param-reassign:0*/ + if (typeof data === 'string') { + try { + data = JSON.parse(data); + } catch (e) { /* Ignore */ } + } + return data; + }], + + /** + * A timeout in milliseconds to abort a request. If set to 0 (default) a + * timeout is not created. + */ + timeout: 0, + + xsrfCookieName: 'XSRF-TOKEN', + xsrfHeaderName: 'X-XSRF-TOKEN', + + maxContentLength: -1, + + validateStatus: function validateStatus(status) { + return status >= 200 && status < 300; + } + }; + + defaults.headers = { + common: { + 'Accept': 'application/json, text/plain, */*' + } + }; + + utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { + defaults.headers[method] = {}; + }); + + utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); + }); + + module.exports = defaults; + + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + module.exports = function normalizeHeaderName(headers, normalizedName) { + utils.forEach(headers, function processHeader(value, name) { + if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { + headers[normalizedName] = value; + delete headers[name]; + } + }); + }; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var settle = __webpack_require__(9); + var buildURL = __webpack_require__(12); + var parseHeaders = __webpack_require__(13); + var isURLSameOrigin = __webpack_require__(14); + var createError = __webpack_require__(10); + var btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || __webpack_require__(15); + + module.exports = function xhrAdapter(config) { + return new Promise(function dispatchXhrRequest(resolve, reject) { + var requestData = config.data; + var requestHeaders = config.headers; + + if (utils.isFormData(requestData)) { + delete requestHeaders['Content-Type']; // Let the browser set it + } + + var request = new XMLHttpRequest(); + var loadEvent = 'onreadystatechange'; + var xDomain = false; + + // For IE 8/9 CORS support + // Only supports POST and GET calls and doesn't returns the response headers. + // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest. + if (("production") !== 'test' && + typeof window !== 'undefined' && + window.XDomainRequest && !('withCredentials' in request) && + !isURLSameOrigin(config.url)) { + request = new window.XDomainRequest(); + loadEvent = 'onload'; + xDomain = true; + request.onprogress = function handleProgress() {}; + request.ontimeout = function handleTimeout() {}; + } + + // HTTP basic authentication + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); + } + + request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true); + + // Set the request timeout in MS + request.timeout = config.timeout; + + // Listen for ready state + request[loadEvent] = function handleLoad() { + if (!request || (request.readyState !== 4 && !xDomain)) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + + // Prepare the response + var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; + var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response; + var response = { + data: responseData, + // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201) + status: request.status === 1223 ? 204 : request.status, + statusText: request.status === 1223 ? 'No Content' : request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // Clean up request + request = null; + }; + + // Handle low level network errors + request.onerror = function handleError() { + // Real errors are hidden from us by the browser + // onerror should only fire if it's a network error + reject(createError('Network Error', config, null, request)); + + // Clean up request + request = null; + }; + + // Handle timeout + request.ontimeout = function handleTimeout() { + reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', + request)); + + // Clean up request + request = null; + }; + + // Add xsrf header + // This is only done if running in a standard browser environment. + // Specifically not if we're in a web worker, or react-native. + if (utils.isStandardBrowserEnv()) { + var cookies = __webpack_require__(16); + + // Add xsrf header + var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ? + cookies.read(config.xsrfCookieName) : + undefined; + + if (xsrfValue) { + requestHeaders[config.xsrfHeaderName] = xsrfValue; + } + } + + // Add headers to the request + if ('setRequestHeader' in request) { + utils.forEach(requestHeaders, function setRequestHeader(val, key) { + if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { + // Remove Content-Type if data is undefined + delete requestHeaders[key]; + } else { + // Otherwise add header to the request + request.setRequestHeader(key, val); + } + }); + } + + // Add withCredentials to request if needed + if (config.withCredentials) { + request.withCredentials = true; + } + + // Add responseType to request if needed + if (config.responseType) { + try { + request.responseType = config.responseType; + } catch (e) { + // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2. + // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function. + if (config.responseType !== 'json') { + throw e; + } + } + } + + // Handle progress if needed + if (typeof config.onDownloadProgress === 'function') { + request.addEventListener('progress', config.onDownloadProgress); + } + + // Not all browsers support upload events + if (typeof config.onUploadProgress === 'function' && request.upload) { + request.upload.addEventListener('progress', config.onUploadProgress); + } + + if (config.cancelToken) { + // Handle cancellation + config.cancelToken.promise.then(function onCanceled(cancel) { + if (!request) { + return; + } + + request.abort(); + reject(cancel); + // Clean up request + request = null; + }); + } + + if (requestData === undefined) { + requestData = null; + } + + // Send the request + request.send(requestData); + }); + }; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var createError = __webpack_require__(10); + + /** + * Resolve or reject a Promise based on response status. + * + * @param {Function} resolve A function that resolves the promise. + * @param {Function} reject A function that rejects the promise. + * @param {object} response The response. + */ + module.exports = function settle(resolve, reject, response) { + var validateStatus = response.config.validateStatus; + // Note: status is not exposed by XDomainRequest + if (!response.status || !validateStatus || validateStatus(response.status)) { + resolve(response); + } else { + reject(createError( + 'Request failed with status code ' + response.status, + response.config, + null, + response.request, + response + )); + } + }; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var enhanceError = __webpack_require__(11); + + /** + * Create an Error with the specified message, config, error code, request and response. + * + * @param {string} message The error message. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The created error. + */ + module.exports = function createError(message, config, code, request, response) { + var error = new Error(message); + return enhanceError(error, config, code, request, response); + }; + + +/***/ }), +/* 11 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Update an Error with the specified config, error code, and response. + * + * @param {Error} error The error to update. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The error. + */ + module.exports = function enhanceError(error, config, code, request, response) { + error.config = config; + if (code) { + error.code = code; + } + error.request = request; + error.response = response; + return error; + }; + + +/***/ }), +/* 12 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + function encode(val) { + return encodeURIComponent(val). + replace(/%40/gi, '@'). + replace(/%3A/gi, ':'). + replace(/%24/g, '$'). + replace(/%2C/gi, ','). + replace(/%20/g, '+'). + replace(/%5B/gi, '['). + replace(/%5D/gi, ']'); + } + + /** + * Build a URL by appending params to the end + * + * @param {string} url The base of the url (e.g., http://www.google.com) + * @param {object} [params] The params to be appended + * @returns {string} The formatted url + */ + module.exports = function buildURL(url, params, paramsSerializer) { + /*eslint no-param-reassign:0*/ + if (!params) { + return url; + } + + var serializedParams; + if (paramsSerializer) { + serializedParams = paramsSerializer(params); + } else if (utils.isURLSearchParams(params)) { + serializedParams = params.toString(); + } else { + var parts = []; + + utils.forEach(params, function serialize(val, key) { + if (val === null || typeof val === 'undefined') { + return; + } + + if (utils.isArray(val)) { + key = key + '[]'; + } else { + val = [val]; + } + + utils.forEach(val, function parseValue(v) { + if (utils.isDate(v)) { + v = v.toISOString(); + } else if (utils.isObject(v)) { + v = JSON.stringify(v); + } + parts.push(encode(key) + '=' + encode(v)); + }); + }); + + serializedParams = parts.join('&'); + } + + if (serializedParams) { + url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; + } + + return url; + }; + + +/***/ }), +/* 13 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + // Headers whose duplicates are ignored by node + // c.f. https://nodejs.org/api/http.html#http_message_headers + var ignoreDuplicateOf = [ + 'age', 'authorization', 'content-length', 'content-type', 'etag', + 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', + 'last-modified', 'location', 'max-forwards', 'proxy-authorization', + 'referer', 'retry-after', 'user-agent' + ]; + + /** + * Parse headers into an object + * + * ``` + * Date: Wed, 27 Aug 2014 08:58:49 GMT + * Content-Type: application/json + * Connection: keep-alive + * Transfer-Encoding: chunked + * ``` + * + * @param {String} headers Headers needing to be parsed + * @returns {Object} Headers parsed into an object + */ + module.exports = function parseHeaders(headers) { + var parsed = {}; + var key; + var val; + var i; + + if (!headers) { return parsed; } + + utils.forEach(headers.split('\n'), function parser(line) { + i = line.indexOf(':'); + key = utils.trim(line.substr(0, i)).toLowerCase(); + val = utils.trim(line.substr(i + 1)); + + if (key) { + if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { + return; + } + if (key === 'set-cookie') { + parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); + } else { + parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; + } + } + }); + + return parsed; + }; + + +/***/ }), +/* 14 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs have full support of the APIs needed to test + // whether the request URL is of the same origin as current location. + (function standardBrowserEnv() { + var msie = /(msie|trident)/i.test(navigator.userAgent); + var urlParsingNode = document.createElement('a'); + var originURL; + + /** + * Parse a URL to discover it's components + * + * @param {String} url The URL to be parsed + * @returns {Object} + */ + function resolveURL(url) { + var href = url; + + if (msie) { + // IE needs attribute set twice to normalize properties + urlParsingNode.setAttribute('href', href); + href = urlParsingNode.href; + } + + urlParsingNode.setAttribute('href', href); + + // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils + return { + href: urlParsingNode.href, + protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', + host: urlParsingNode.host, + search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', + hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', + hostname: urlParsingNode.hostname, + port: urlParsingNode.port, + pathname: (urlParsingNode.pathname.charAt(0) === '/') ? + urlParsingNode.pathname : + '/' + urlParsingNode.pathname + }; + } + + originURL = resolveURL(window.location.href); + + /** + * Determine if a URL shares the same origin as the current location + * + * @param {String} requestURL The URL to test + * @returns {boolean} True if URL shares the same origin, otherwise false + */ + return function isURLSameOrigin(requestURL) { + var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; + return (parsed.protocol === originURL.protocol && + parsed.host === originURL.host); + }; + })() : + + // Non standard browser envs (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return function isURLSameOrigin() { + return true; + }; + })() + ); + + +/***/ }), +/* 15 */ +/***/ (function(module, exports) { + + 'use strict'; + + // btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js + + var chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/='; + + function E() { + this.message = 'String contains an invalid character'; + } + E.prototype = new Error; + E.prototype.code = 5; + E.prototype.name = 'InvalidCharacterError'; + + function btoa(input) { + var str = String(input); + var output = ''; + for ( + // initialize result and counter + var block, charCode, idx = 0, map = chars; + // if the next str index does not exist: + // change the mapping table to "=" + // check if d has no fractional digits + str.charAt(idx | 0) || (map = '=', idx % 1); + // "8 - idx % 1 * 8" generates the sequence 2, 4, 6, 8 + output += map.charAt(63 & block >> 8 - idx % 1 * 8) + ) { + charCode = str.charCodeAt(idx += 3 / 4); + if (charCode > 0xFF) { + throw new E(); + } + block = block << 8 | charCode; + } + return output; + } + + module.exports = btoa; + + +/***/ }), +/* 16 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs support document.cookie + (function standardBrowserEnv() { + return { + write: function write(name, value, expires, path, domain, secure) { + var cookie = []; + cookie.push(name + '=' + encodeURIComponent(value)); + + if (utils.isNumber(expires)) { + cookie.push('expires=' + new Date(expires).toGMTString()); + } + + if (utils.isString(path)) { + cookie.push('path=' + path); + } + + if (utils.isString(domain)) { + cookie.push('domain=' + domain); + } + + if (secure === true) { + cookie.push('secure'); + } + + document.cookie = cookie.join('; '); + }, + + read: function read(name) { + var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); + return (match ? decodeURIComponent(match[3]) : null); + }, + + remove: function remove(name) { + this.write(name, '', Date.now() - 86400000); + } + }; + })() : + + // Non standard browser env (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return { + write: function write() {}, + read: function read() { return null; }, + remove: function remove() {} + }; + })() + ); + + +/***/ }), +/* 17 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + function InterceptorManager() { + this.handlers = []; + } + + /** + * Add a new interceptor to the stack + * + * @param {Function} fulfilled The function to handle `then` for a `Promise` + * @param {Function} rejected The function to handle `reject` for a `Promise` + * + * @return {Number} An ID used to remove interceptor later + */ + InterceptorManager.prototype.use = function use(fulfilled, rejected) { + this.handlers.push({ + fulfilled: fulfilled, + rejected: rejected + }); + return this.handlers.length - 1; + }; + + /** + * Remove an interceptor from the stack + * + * @param {Number} id The ID that was returned by `use` + */ + InterceptorManager.prototype.eject = function eject(id) { + if (this.handlers[id]) { + this.handlers[id] = null; + } + }; + + /** + * Iterate over all the registered interceptors + * + * This method is particularly useful for skipping over any + * interceptors that may have become `null` calling `eject`. + * + * @param {Function} fn The function to call for each interceptor + */ + InterceptorManager.prototype.forEach = function forEach(fn) { + utils.forEach(this.handlers, function forEachHandler(h) { + if (h !== null) { + fn(h); + } + }); + }; + + module.exports = InterceptorManager; + + +/***/ }), +/* 18 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var transformData = __webpack_require__(19); + var isCancel = __webpack_require__(20); + var defaults = __webpack_require__(6); + var isAbsoluteURL = __webpack_require__(21); + var combineURLs = __webpack_require__(22); + + /** + * Throws a `Cancel` if cancellation has been requested. + */ + function throwIfCancellationRequested(config) { + if (config.cancelToken) { + config.cancelToken.throwIfRequested(); + } + } + + /** + * Dispatch a request to the server using the configured adapter. + * + * @param {object} config The config that is to be used for the request + * @returns {Promise} The Promise to be fulfilled + */ + module.exports = function dispatchRequest(config) { + throwIfCancellationRequested(config); + + // Support baseURL config + if (config.baseURL && !isAbsoluteURL(config.url)) { + config.url = combineURLs(config.baseURL, config.url); + } + + // Ensure headers exist + config.headers = config.headers || {}; + + // Transform request data + config.data = transformData( + config.data, + config.headers, + config.transformRequest + ); + + // Flatten headers + config.headers = utils.merge( + config.headers.common || {}, + config.headers[config.method] || {}, + config.headers || {} + ); + + utils.forEach( + ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], + function cleanHeaderConfig(method) { + delete config.headers[method]; + } + ); + + var adapter = config.adapter || defaults.adapter; + + return adapter(config).then(function onAdapterResolution(response) { + throwIfCancellationRequested(config); + + // Transform response data + response.data = transformData( + response.data, + response.headers, + config.transformResponse + ); + + return response; + }, function onAdapterRejection(reason) { + if (!isCancel(reason)) { + throwIfCancellationRequested(config); + + // Transform response data + if (reason && reason.response) { + reason.response.data = transformData( + reason.response.data, + reason.response.headers, + config.transformResponse + ); + } + } + + return Promise.reject(reason); + }); + }; + + +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + /** + * Transform the data for a request or a response + * + * @param {Object|String} data The data to be transformed + * @param {Array} headers The headers for the request or response + * @param {Array|Function} fns A single function or Array of functions + * @returns {*} The resulting transformed data + */ + module.exports = function transformData(data, headers, fns) { + /*eslint no-param-reassign:0*/ + utils.forEach(fns, function transform(fn) { + data = fn(data, headers); + }); + + return data; + }; + + +/***/ }), +/* 20 */ +/***/ (function(module, exports) { + + 'use strict'; + + module.exports = function isCancel(value) { + return !!(value && value.__CANCEL__); + }; + + +/***/ }), +/* 21 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Determines whether the specified URL is absolute + * + * @param {string} url The URL to test + * @returns {boolean} True if the specified URL is absolute, otherwise false + */ + module.exports = function isAbsoluteURL(url) { + // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). + // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed + // by any combination of letters, digits, plus, period, or hyphen. + return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url); + }; + + +/***/ }), +/* 22 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Creates a new URL by combining the specified URLs + * + * @param {string} baseURL The base URL + * @param {string} relativeURL The relative URL + * @returns {string} The combined URL + */ + module.exports = function combineURLs(baseURL, relativeURL) { + return relativeURL + ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') + : baseURL; + }; + + +/***/ }), +/* 23 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * A `Cancel` is an object that is thrown when an operation is canceled. + * + * @class + * @param {string=} message The message. + */ + function Cancel(message) { + this.message = message; + } + + Cancel.prototype.toString = function toString() { + return 'Cancel' + (this.message ? ': ' + this.message : ''); + }; + + Cancel.prototype.__CANCEL__ = true; + + module.exports = Cancel; + + +/***/ }), +/* 24 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var Cancel = __webpack_require__(23); + + /** + * A `CancelToken` is an object that can be used to request cancellation of an operation. + * + * @class + * @param {Function} executor The executor function. + */ + function CancelToken(executor) { + if (typeof executor !== 'function') { + throw new TypeError('executor must be a function.'); + } + + var resolvePromise; + this.promise = new Promise(function promiseExecutor(resolve) { + resolvePromise = resolve; + }); + + var token = this; + executor(function cancel(message) { + if (token.reason) { + // Cancellation has already been requested + return; + } + + token.reason = new Cancel(message); + resolvePromise(token.reason); + }); + } + + /** + * Throws a `Cancel` if cancellation has been requested. + */ + CancelToken.prototype.throwIfRequested = function throwIfRequested() { + if (this.reason) { + throw this.reason; + } + }; + + /** + * Returns an object that contains a new `CancelToken` and a function that, when called, + * cancels the `CancelToken`. + */ + CancelToken.source = function source() { + var cancel; + var token = new CancelToken(function executor(c) { + cancel = c; + }); + return { + token: token, + cancel: cancel + }; + }; + + module.exports = CancelToken; + + +/***/ }), +/* 25 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Syntactic sugar for invoking a function and expanding an array for arguments. + * + * Common use case would be to use `Function.prototype.apply`. + * + * ```js + * function f(x, y, z) {} + * var args = [1, 2, 3]; + * f.apply(null, args); + * ``` + * + * With `spread` this example can be re-written. + * + * ```js + * spread(function(x, y, z) {})([1, 2, 3]); + * ``` + * + * @param {Function} callback + * @returns {Function} + */ + module.exports = function spread(callback) { + return function wrap(arr) { + return callback.apply(null, arr); + }; + }; + + +/***/ }) +/******/ ]) +}); +; +//# sourceMappingURL=axios.map \ No newline at end of file diff --git a/node_modules/axios/dist/axios.map b/node_modules/axios/dist/axios.map new file mode 100644 index 00000000..6b76578d --- /dev/null +++ b/node_modules/axios/dist/axios.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///webpack/bootstrap 48f4719183d3ec9e4379","webpack:///./index.js","webpack:///./lib/axios.js","webpack:///./lib/utils.js","webpack:///./lib/helpers/bind.js","webpack:///./~/is-buffer/index.js","webpack:///./lib/core/Axios.js","webpack:///./lib/defaults.js","webpack:///./lib/helpers/normalizeHeaderName.js","webpack:///./lib/adapters/xhr.js","webpack:///./lib/core/settle.js","webpack:///./lib/core/createError.js","webpack:///./lib/core/enhanceError.js","webpack:///./lib/helpers/buildURL.js","webpack:///./lib/helpers/parseHeaders.js","webpack:///./lib/helpers/isURLSameOrigin.js","webpack:///./lib/helpers/btoa.js","webpack:///./lib/helpers/cookies.js","webpack:///./lib/core/InterceptorManager.js","webpack:///./lib/core/dispatchRequest.js","webpack:///./lib/core/transformData.js","webpack:///./lib/cancel/isCancel.js","webpack:///./lib/helpers/isAbsoluteURL.js","webpack:///./lib/helpers/combineURLs.js","webpack:///./lib/cancel/Cancel.js","webpack:///./lib/cancel/CancelToken.js","webpack:///./lib/helpers/spread.js"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD,O;ACVA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,uBAAe;AACf;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;;AAGA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;;;;;;ACtCA,yC;;;;;;ACAA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,aAAY,MAAM;AAClB;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;;;;;;ACnDA;;AAEA;AACA;;AAEA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,aAAa;AACxB,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,oCAAmC,OAAO;AAC1C;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,SAAS,GAAG,SAAS;AAC5C,4BAA2B;AAC3B;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA,wCAAuC,OAAO;AAC9C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,aAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;AC9SA;;AAEA;AACA;AACA;AACA,oBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;;;;;;;ACVA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;;;;;;ACpBA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA,mCAAkC,cAAc;AAChD;;AAEA;AACA;AACA;;AAEA;AACA;AACA,IAAG;;AAEH;AACA;AACA,IAAG;;AAEH;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,iDAAgD;AAChD;AACA;AACA,MAAK;AACL;AACA,EAAC;;AAED;AACA;AACA;AACA,iDAAgD;AAChD;AACA;AACA;AACA,MAAK;AACL;AACA,EAAC;;AAED;;;;;;;AC9EA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yEAAwE;AACxE;AACA;AACA;AACA,wDAAuD;AACvD;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA,QAAO,YAAY;AACnB;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,EAAC;;AAED;AACA;AACA,EAAC;;AAED;;;;;;;AC/FA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;;;;;;ACXA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA,6CAA4C;AAC5C;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;;AAEA;AACA;AACA;;AAEA;AACA;AACA,IAAG;AACH;;;;;;;ACnLA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,SAAS;AACpB,YAAW,SAAS;AACpB,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACzBA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;;;;;;;ACjBA;;AAEA;AACA;AACA;AACA,YAAW,MAAM;AACjB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACpBA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;AACH;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA,QAAO;AACP;AACA;;AAEA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;;;;;;ACjEA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA,kBAAiB,eAAe;;AAEhC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;ACpDA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc,OAAO;AACrB,iBAAgB;AAChB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA,eAAc,OAAO;AACrB,iBAAgB,QAAQ;AACxB;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;;;;;;ACnEA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;;;;;;ACnCA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA,yCAAwC;AACxC,QAAO;;AAEP;AACA,2DAA0D,wBAAwB;AAClF;AACA,QAAO;;AAEP;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA,iCAAgC;AAChC,8BAA6B,aAAa,EAAE;AAC5C;AACA;AACA,IAAG;AACH;;;;;;;ACpDA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,SAAS;AACpB,YAAW,SAAS;AACpB;AACA,aAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;AAEA;;;;;;;ACnDA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,gCAA+B;AAC/B,wCAAuC;AACvC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,IAAG;AACH;;;;;;;ACrFA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,cAAc;AACzB,YAAW,MAAM;AACjB,YAAW,eAAe;AAC1B,cAAa,EAAE;AACf;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;ACnBA;;AAEA;AACA;AACA;;;;;;;ACJA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACbA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;;;;;;ACbA;;AAEA;AACA;AACA;AACA;AACA,YAAW,QAAQ;AACnB;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;;AAEA;;;;;;;AClBA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;;;;;;;ACxDA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B;AAC/B;AACA;AACA,YAAW,SAAS;AACpB,cAAa;AACb;AACA;AACA;AACA;AACA;AACA","file":"axios.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap 48f4719183d3ec9e4379","module.exports = require('./lib/axios');\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./index.js\n// module id = 0\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Factory for creating new instances\naxios.create = function create(instanceConfig) {\n return createInstance(utils.merge(defaults, instanceConfig));\n};\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/axios.js\n// module id = 1\n// module chunks = 0","'use strict';\n\nvar bind = require('./helpers/bind');\nvar isBuffer = require('is-buffer');\n\n/*global toString:true*/\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return toString.call(val) === '[object Array]';\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return (typeof FormData !== 'undefined') && (val instanceof FormData);\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = merge(result[key], val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n extend: extend,\n trim: trim\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/utils.js\n// module id = 2\n// module chunks = 0","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/bind.js\n// module id = 3\n// module chunks = 0","/*!\n * Determine if an object is a Buffer\n *\n * @author Feross Aboukhadijeh \n * @license MIT\n */\n\n// The _isBuffer check is for Safari 5-7 support, because it's missing\n// Object.prototype.constructor. Remove this eventually\nmodule.exports = function (obj) {\n return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer)\n}\n\nfunction isBuffer (obj) {\n return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n}\n\n// For Node v0.10 support. Remove this eventually.\nfunction isSlowBuffer (obj) {\n return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0))\n}\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/is-buffer/index.js\n// module id = 4\n// module chunks = 0","'use strict';\n\nvar defaults = require('./../defaults');\nvar utils = require('./../utils');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof config === 'string') {\n config = utils.merge({\n url: arguments[0]\n }, arguments[1]);\n }\n\n config = utils.merge(defaults, {method: 'get'}, this.defaults, config);\n config.method = config.method.toLowerCase();\n\n // Hook up interceptors middleware\n var chain = [dispatchRequest, undefined];\n var promise = Promise.resolve(config);\n\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n chain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n chain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/Axios.js\n// module id = 5\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar normalizeHeaderName = require('./helpers/normalizeHeaderName');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('./adapters/xhr');\n } else if (typeof process !== 'undefined') {\n // For node use HTTP adapter\n adapter = require('./adapters/http');\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/defaults.js\n// module id = 6\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/normalizeHeaderName.js\n// module id = 7\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar buildURL = require('./../helpers/buildURL');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\nvar btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || require('./../helpers/btoa');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n var loadEvent = 'onreadystatechange';\n var xDomain = false;\n\n // For IE 8/9 CORS support\n // Only supports POST and GET calls and doesn't returns the response headers.\n // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest.\n if (process.env.NODE_ENV !== 'test' &&\n typeof window !== 'undefined' &&\n window.XDomainRequest && !('withCredentials' in request) &&\n !isURLSameOrigin(config.url)) {\n request = new window.XDomainRequest();\n loadEvent = 'onload';\n xDomain = true;\n request.onprogress = function handleProgress() {};\n request.ontimeout = function handleTimeout() {};\n }\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password || '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n // Listen for ready state\n request[loadEvent] = function handleLoad() {\n if (!request || (request.readyState !== 4 && !xDomain)) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n var response = {\n data: responseData,\n // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201)\n status: request.status === 1223 ? 204 : request.status,\n statusText: request.status === 1223 ? 'No Content' : request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(resolve, reject, response);\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n var cookies = require('./../helpers/cookies');\n\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (config.withCredentials) {\n request.withCredentials = true;\n }\n\n // Add responseType to request if needed\n if (config.responseType) {\n try {\n request.responseType = config.responseType;\n } catch (e) {\n // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n if (config.responseType !== 'json') {\n throw e;\n }\n }\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken) {\n // Handle cancellation\n config.cancelToken.promise.then(function onCanceled(cancel) {\n if (!request) {\n return;\n }\n\n request.abort();\n reject(cancel);\n // Clean up request\n request = null;\n });\n }\n\n if (requestData === undefined) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/adapters/xhr.js\n// module id = 8\n// module chunks = 0","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n // Note: status is not exposed by XDomainRequest\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/settle.js\n// module id = 9\n// module chunks = 0","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/createError.js\n// module id = 10\n// module chunks = 0","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n error.request = request;\n error.response = response;\n return error;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/enhanceError.js\n// module id = 11\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/buildURL.js\n// module id = 12\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/parseHeaders.js\n// module id = 13\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isURLSameOrigin.js\n// module id = 14\n// module chunks = 0","'use strict';\n\n// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js\n\nvar chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';\n\nfunction E() {\n this.message = 'String contains an invalid character';\n}\nE.prototype = new Error;\nE.prototype.code = 5;\nE.prototype.name = 'InvalidCharacterError';\n\nfunction btoa(input) {\n var str = String(input);\n var output = '';\n for (\n // initialize result and counter\n var block, charCode, idx = 0, map = chars;\n // if the next str index does not exist:\n // change the mapping table to \"=\"\n // check if d has no fractional digits\n str.charAt(idx | 0) || (map = '=', idx % 1);\n // \"8 - idx % 1 * 8\" generates the sequence 2, 4, 6, 8\n output += map.charAt(63 & block >> 8 - idx % 1 * 8)\n ) {\n charCode = str.charCodeAt(idx += 3 / 4);\n if (charCode > 0xFF) {\n throw new E();\n }\n block = block << 8 | charCode;\n }\n return output;\n}\n\nmodule.exports = btoa;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/btoa.js\n// module id = 15\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/cookies.js\n// module id = 16\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/InterceptorManager.js\n// module id = 17\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar isAbsoluteURL = require('./../helpers/isAbsoluteURL');\nvar combineURLs = require('./../helpers/combineURLs');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Support baseURL config\n if (config.baseURL && !isAbsoluteURL(config.url)) {\n config.url = combineURLs(config.baseURL, config.url);\n }\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData(\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers || {}\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData(\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData(\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/dispatchRequest.js\n// module id = 18\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn(data, headers);\n });\n\n return data;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/transformData.js\n// module id = 19\n// module chunks = 0","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/isCancel.js\n// module id = 20\n// module chunks = 0","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isAbsoluteURL.js\n// module id = 21\n// module chunks = 0","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/combineURLs.js\n// module id = 22\n// module chunks = 0","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/Cancel.js\n// module id = 23\n// module chunks = 0","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/CancelToken.js\n// module id = 24\n// module chunks = 0","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/spread.js\n// module id = 25\n// module chunks = 0"],"sourceRoot":""} \ No newline at end of file diff --git a/node_modules/axios/dist/axios.min.js b/node_modules/axios/dist/axios.min.js new file mode 100644 index 00000000..69cc188e --- /dev/null +++ b/node_modules/axios/dist/axios.min.js @@ -0,0 +1,9 @@ +/* axios v0.18.0 | (c) 2018 by Matt Zabriskie */ +!function(e,t){"object"==typeof exports&&"object"==typeof module?module.exports=t():"function"==typeof define&&define.amd?define([],t):"object"==typeof exports?exports.axios=t():e.axios=t()}(this,function(){return function(e){function t(r){if(n[r])return n[r].exports;var o=n[r]={exports:{},id:r,loaded:!1};return e[r].call(o.exports,o,o.exports,t),o.loaded=!0,o.exports}var n={};return t.m=e,t.c=n,t.p="",t(0)}([function(e,t,n){e.exports=n(1)},function(e,t,n){"use strict";function r(e){var t=new s(e),n=i(s.prototype.request,t);return o.extend(n,s.prototype,t),o.extend(n,t),n}var o=n(2),i=n(3),s=n(5),u=n(6),a=r(u);a.Axios=s,a.create=function(e){return r(o.merge(u,e))},a.Cancel=n(23),a.CancelToken=n(24),a.isCancel=n(20),a.all=function(e){return Promise.all(e)},a.spread=n(25),e.exports=a,e.exports.default=a},function(e,t,n){"use strict";function r(e){return"[object Array]"===R.call(e)}function o(e){return"[object ArrayBuffer]"===R.call(e)}function i(e){return"undefined"!=typeof FormData&&e instanceof FormData}function s(e){var t;return t="undefined"!=typeof ArrayBuffer&&ArrayBuffer.isView?ArrayBuffer.isView(e):e&&e.buffer&&e.buffer instanceof ArrayBuffer}function u(e){return"string"==typeof e}function a(e){return"number"==typeof e}function c(e){return"undefined"==typeof e}function f(e){return null!==e&&"object"==typeof e}function p(e){return"[object Date]"===R.call(e)}function d(e){return"[object File]"===R.call(e)}function l(e){return"[object Blob]"===R.call(e)}function h(e){return"[object Function]"===R.call(e)}function m(e){return f(e)&&h(e.pipe)}function y(e){return"undefined"!=typeof URLSearchParams&&e instanceof URLSearchParams}function w(e){return e.replace(/^\s*/,"").replace(/\s*$/,"")}function g(){return("undefined"==typeof navigator||"ReactNative"!==navigator.product)&&("undefined"!=typeof window&&"undefined"!=typeof document)}function v(e,t){if(null!==e&&"undefined"!=typeof e)if("object"!=typeof e&&(e=[e]),r(e))for(var n=0,o=e.length;n + * @license MIT + */ +e.exports=function(e){return null!=e&&(n(e)||r(e)||!!e._isBuffer)}},function(e,t,n){"use strict";function r(e){this.defaults=e,this.interceptors={request:new s,response:new s}}var o=n(6),i=n(2),s=n(17),u=n(18);r.prototype.request=function(e){"string"==typeof e&&(e=i.merge({url:arguments[0]},arguments[1])),e=i.merge(o,{method:"get"},this.defaults,e),e.method=e.method.toLowerCase();var t=[u,void 0],n=Promise.resolve(e);for(this.interceptors.request.forEach(function(e){t.unshift(e.fulfilled,e.rejected)}),this.interceptors.response.forEach(function(e){t.push(e.fulfilled,e.rejected)});t.length;)n=n.then(t.shift(),t.shift());return n},i.forEach(["delete","get","head","options"],function(e){r.prototype[e]=function(t,n){return this.request(i.merge(n||{},{method:e,url:t}))}}),i.forEach(["post","put","patch"],function(e){r.prototype[e]=function(t,n,r){return this.request(i.merge(r||{},{method:e,url:t,data:n}))}}),e.exports=r},function(e,t,n){"use strict";function r(e,t){!i.isUndefined(e)&&i.isUndefined(e["Content-Type"])&&(e["Content-Type"]=t)}function o(){var e;return"undefined"!=typeof XMLHttpRequest?e=n(8):"undefined"!=typeof process&&(e=n(8)),e}var i=n(2),s=n(7),u={"Content-Type":"application/x-www-form-urlencoded"},a={adapter:o(),transformRequest:[function(e,t){return s(t,"Content-Type"),i.isFormData(e)||i.isArrayBuffer(e)||i.isBuffer(e)||i.isStream(e)||i.isFile(e)||i.isBlob(e)?e:i.isArrayBufferView(e)?e.buffer:i.isURLSearchParams(e)?(r(t,"application/x-www-form-urlencoded;charset=utf-8"),e.toString()):i.isObject(e)?(r(t,"application/json;charset=utf-8"),JSON.stringify(e)):e}],transformResponse:[function(e){if("string"==typeof e)try{e=JSON.parse(e)}catch(e){}return e}],timeout:0,xsrfCookieName:"XSRF-TOKEN",xsrfHeaderName:"X-XSRF-TOKEN",maxContentLength:-1,validateStatus:function(e){return e>=200&&e<300}};a.headers={common:{Accept:"application/json, text/plain, */*"}},i.forEach(["delete","get","head"],function(e){a.headers[e]={}}),i.forEach(["post","put","patch"],function(e){a.headers[e]=i.merge(u)}),e.exports=a},function(e,t,n){"use strict";var r=n(2);e.exports=function(e,t){r.forEach(e,function(n,r){r!==t&&r.toUpperCase()===t.toUpperCase()&&(e[t]=n,delete e[r])})}},function(e,t,n){"use strict";var r=n(2),o=n(9),i=n(12),s=n(13),u=n(14),a=n(10),c="undefined"!=typeof window&&window.btoa&&window.btoa.bind(window)||n(15);e.exports=function(e){return new Promise(function(t,f){var p=e.data,d=e.headers;r.isFormData(p)&&delete d["Content-Type"];var l=new XMLHttpRequest,h="onreadystatechange",m=!1;if("undefined"==typeof window||!window.XDomainRequest||"withCredentials"in l||u(e.url)||(l=new window.XDomainRequest,h="onload",m=!0,l.onprogress=function(){},l.ontimeout=function(){}),e.auth){var y=e.auth.username||"",w=e.auth.password||"";d.Authorization="Basic "+c(y+":"+w)}if(l.open(e.method.toUpperCase(),i(e.url,e.params,e.paramsSerializer),!0),l.timeout=e.timeout,l[h]=function(){if(l&&(4===l.readyState||m)&&(0!==l.status||l.responseURL&&0===l.responseURL.indexOf("file:"))){var n="getAllResponseHeaders"in l?s(l.getAllResponseHeaders()):null,r=e.responseType&&"text"!==e.responseType?l.response:l.responseText,i={data:r,status:1223===l.status?204:l.status,statusText:1223===l.status?"No Content":l.statusText,headers:n,config:e,request:l};o(t,f,i),l=null}},l.onerror=function(){f(a("Network Error",e,null,l)),l=null},l.ontimeout=function(){f(a("timeout of "+e.timeout+"ms exceeded",e,"ECONNABORTED",l)),l=null},r.isStandardBrowserEnv()){var g=n(16),v=(e.withCredentials||u(e.url))&&e.xsrfCookieName?g.read(e.xsrfCookieName):void 0;v&&(d[e.xsrfHeaderName]=v)}if("setRequestHeader"in l&&r.forEach(d,function(e,t){"undefined"==typeof p&&"content-type"===t.toLowerCase()?delete d[t]:l.setRequestHeader(t,e)}),e.withCredentials&&(l.withCredentials=!0),e.responseType)try{l.responseType=e.responseType}catch(t){if("json"!==e.responseType)throw t}"function"==typeof e.onDownloadProgress&&l.addEventListener("progress",e.onDownloadProgress),"function"==typeof e.onUploadProgress&&l.upload&&l.upload.addEventListener("progress",e.onUploadProgress),e.cancelToken&&e.cancelToken.promise.then(function(e){l&&(l.abort(),f(e),l=null)}),void 0===p&&(p=null),l.send(p)})}},function(e,t,n){"use strict";var r=n(10);e.exports=function(e,t,n){var o=n.config.validateStatus;n.status&&o&&!o(n.status)?t(r("Request failed with status code "+n.status,n.config,null,n.request,n)):e(n)}},function(e,t,n){"use strict";var r=n(11);e.exports=function(e,t,n,o,i){var s=new Error(e);return r(s,t,n,o,i)}},function(e,t){"use strict";e.exports=function(e,t,n,r,o){return e.config=t,n&&(e.code=n),e.request=r,e.response=o,e}},function(e,t,n){"use strict";function r(e){return encodeURIComponent(e).replace(/%40/gi,"@").replace(/%3A/gi,":").replace(/%24/g,"$").replace(/%2C/gi,",").replace(/%20/g,"+").replace(/%5B/gi,"[").replace(/%5D/gi,"]")}var o=n(2);e.exports=function(e,t,n){if(!t)return e;var i;if(n)i=n(t);else if(o.isURLSearchParams(t))i=t.toString();else{var s=[];o.forEach(t,function(e,t){null!==e&&"undefined"!=typeof e&&(o.isArray(e)?t+="[]":e=[e],o.forEach(e,function(e){o.isDate(e)?e=e.toISOString():o.isObject(e)&&(e=JSON.stringify(e)),s.push(r(t)+"="+r(e))}))}),i=s.join("&")}return i&&(e+=(e.indexOf("?")===-1?"?":"&")+i),e}},function(e,t,n){"use strict";var r=n(2),o=["age","authorization","content-length","content-type","etag","expires","from","host","if-modified-since","if-unmodified-since","last-modified","location","max-forwards","proxy-authorization","referer","retry-after","user-agent"];e.exports=function(e){var t,n,i,s={};return e?(r.forEach(e.split("\n"),function(e){if(i=e.indexOf(":"),t=r.trim(e.substr(0,i)).toLowerCase(),n=r.trim(e.substr(i+1)),t){if(s[t]&&o.indexOf(t)>=0)return;"set-cookie"===t?s[t]=(s[t]?s[t]:[]).concat([n]):s[t]=s[t]?s[t]+", "+n:n}}),s):s}},function(e,t,n){"use strict";var r=n(2);e.exports=r.isStandardBrowserEnv()?function(){function e(e){var t=e;return n&&(o.setAttribute("href",t),t=o.href),o.setAttribute("href",t),{href:o.href,protocol:o.protocol?o.protocol.replace(/:$/,""):"",host:o.host,search:o.search?o.search.replace(/^\?/,""):"",hash:o.hash?o.hash.replace(/^#/,""):"",hostname:o.hostname,port:o.port,pathname:"/"===o.pathname.charAt(0)?o.pathname:"/"+o.pathname}}var t,n=/(msie|trident)/i.test(navigator.userAgent),o=document.createElement("a");return t=e(window.location.href),function(n){var o=r.isString(n)?e(n):n;return o.protocol===t.protocol&&o.host===t.host}}():function(){return function(){return!0}}()},function(e,t){"use strict";function n(){this.message="String contains an invalid character"}function r(e){for(var t,r,i=String(e),s="",u=0,a=o;i.charAt(0|u)||(a="=",u%1);s+=a.charAt(63&t>>8-u%1*8)){if(r=i.charCodeAt(u+=.75),r>255)throw new n;t=t<<8|r}return s}var o="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=";n.prototype=new Error,n.prototype.code=5,n.prototype.name="InvalidCharacterError",e.exports=r},function(e,t,n){"use strict";var r=n(2);e.exports=r.isStandardBrowserEnv()?function(){return{write:function(e,t,n,o,i,s){var u=[];u.push(e+"="+encodeURIComponent(t)),r.isNumber(n)&&u.push("expires="+new Date(n).toGMTString()),r.isString(o)&&u.push("path="+o),r.isString(i)&&u.push("domain="+i),s===!0&&u.push("secure"),document.cookie=u.join("; ")},read:function(e){var t=document.cookie.match(new RegExp("(^|;\\s*)("+e+")=([^;]*)"));return t?decodeURIComponent(t[3]):null},remove:function(e){this.write(e,"",Date.now()-864e5)}}}():function(){return{write:function(){},read:function(){return null},remove:function(){}}}()},function(e,t,n){"use strict";function r(){this.handlers=[]}var o=n(2);r.prototype.use=function(e,t){return this.handlers.push({fulfilled:e,rejected:t}),this.handlers.length-1},r.prototype.eject=function(e){this.handlers[e]&&(this.handlers[e]=null)},r.prototype.forEach=function(e){o.forEach(this.handlers,function(t){null!==t&&e(t)})},e.exports=r},function(e,t,n){"use strict";function r(e){e.cancelToken&&e.cancelToken.throwIfRequested()}var o=n(2),i=n(19),s=n(20),u=n(6),a=n(21),c=n(22);e.exports=function(e){r(e),e.baseURL&&!a(e.url)&&(e.url=c(e.baseURL,e.url)),e.headers=e.headers||{},e.data=i(e.data,e.headers,e.transformRequest),e.headers=o.merge(e.headers.common||{},e.headers[e.method]||{},e.headers||{}),o.forEach(["delete","get","head","post","put","patch","common"],function(t){delete e.headers[t]});var t=e.adapter||u.adapter;return t(e).then(function(t){return r(e),t.data=i(t.data,t.headers,e.transformResponse),t},function(t){return s(t)||(r(e),t&&t.response&&(t.response.data=i(t.response.data,t.response.headers,e.transformResponse))),Promise.reject(t)})}},function(e,t,n){"use strict";var r=n(2);e.exports=function(e,t,n){return r.forEach(n,function(n){e=n(e,t)}),e}},function(e,t){"use strict";e.exports=function(e){return!(!e||!e.__CANCEL__)}},function(e,t){"use strict";e.exports=function(e){return/^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(e)}},function(e,t){"use strict";e.exports=function(e,t){return t?e.replace(/\/+$/,"")+"/"+t.replace(/^\/+/,""):e}},function(e,t){"use strict";function n(e){this.message=e}n.prototype.toString=function(){return"Cancel"+(this.message?": "+this.message:"")},n.prototype.__CANCEL__=!0,e.exports=n},function(e,t,n){"use strict";function r(e){if("function"!=typeof e)throw new TypeError("executor must be a function.");var t;this.promise=new Promise(function(e){t=e});var n=this;e(function(e){n.reason||(n.reason=new o(e),t(n.reason))})}var o=n(23);r.prototype.throwIfRequested=function(){if(this.reason)throw this.reason},r.source=function(){var e,t=new r(function(t){e=t});return{token:t,cancel:e}},e.exports=r},function(e,t){"use strict";e.exports=function(e){return function(t){return e.apply(null,t)}}}])}); +//# sourceMappingURL=axios.min.map \ No newline at end of file diff --git a/node_modules/axios/dist/axios.min.map b/node_modules/axios/dist/axios.min.map new file mode 100644 index 00000000..f7fdd449 --- /dev/null +++ b/node_modules/axios/dist/axios.min.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///axios.min.js","webpack:///webpack/bootstrap dad8263224c86c166a30","webpack:///./index.js","webpack:///./lib/axios.js","webpack:///./lib/utils.js","webpack:///./lib/helpers/bind.js","webpack:///./~/is-buffer/index.js","webpack:///./lib/core/Axios.js","webpack:///./lib/defaults.js","webpack:///./lib/helpers/normalizeHeaderName.js","webpack:///./lib/adapters/xhr.js","webpack:///./lib/core/settle.js","webpack:///./lib/core/createError.js","webpack:///./lib/core/enhanceError.js","webpack:///./lib/helpers/buildURL.js","webpack:///./lib/helpers/parseHeaders.js","webpack:///./lib/helpers/isURLSameOrigin.js","webpack:///./lib/helpers/btoa.js","webpack:///./lib/helpers/cookies.js","webpack:///./lib/core/InterceptorManager.js","webpack:///./lib/core/dispatchRequest.js","webpack:///./lib/core/transformData.js","webpack:///./lib/cancel/isCancel.js","webpack:///./lib/helpers/isAbsoluteURL.js","webpack:///./lib/helpers/combineURLs.js","webpack:///./lib/cancel/Cancel.js","webpack:///./lib/cancel/CancelToken.js","webpack:///./lib/helpers/spread.js"],"names":["root","factory","exports","module","define","amd","this","modules","__webpack_require__","moduleId","installedModules","id","loaded","call","m","c","p","createInstance","defaultConfig","context","Axios","instance","bind","prototype","request","utils","extend","defaults","axios","create","instanceConfig","merge","Cancel","CancelToken","isCancel","all","promises","Promise","spread","default","isArray","val","toString","isArrayBuffer","isFormData","FormData","isArrayBufferView","result","ArrayBuffer","isView","buffer","isString","isNumber","isUndefined","isObject","isDate","isFile","isBlob","isFunction","isStream","pipe","isURLSearchParams","URLSearchParams","trim","str","replace","isStandardBrowserEnv","navigator","product","window","document","forEach","obj","fn","i","l","length","key","Object","hasOwnProperty","assignValue","arguments","a","b","thisArg","isBuffer","args","Array","apply","constructor","isSlowBuffer","readFloatLE","slice","_isBuffer","interceptors","InterceptorManager","response","dispatchRequest","config","url","method","toLowerCase","chain","undefined","promise","resolve","interceptor","unshift","fulfilled","rejected","push","then","shift","data","setContentTypeIfUnset","headers","value","getDefaultAdapter","adapter","XMLHttpRequest","process","normalizeHeaderName","DEFAULT_CONTENT_TYPE","Content-Type","transformRequest","JSON","stringify","transformResponse","parse","e","timeout","xsrfCookieName","xsrfHeaderName","maxContentLength","validateStatus","status","common","Accept","normalizedName","name","toUpperCase","settle","buildURL","parseHeaders","isURLSameOrigin","createError","btoa","reject","requestData","requestHeaders","loadEvent","xDomain","XDomainRequest","onprogress","ontimeout","auth","username","password","Authorization","open","params","paramsSerializer","readyState","responseURL","indexOf","responseHeaders","getAllResponseHeaders","responseData","responseType","responseText","statusText","onerror","cookies","xsrfValue","withCredentials","read","setRequestHeader","onDownloadProgress","addEventListener","onUploadProgress","upload","cancelToken","cancel","abort","send","enhanceError","message","code","error","Error","encode","encodeURIComponent","serializedParams","parts","v","toISOString","join","ignoreDuplicateOf","parsed","split","line","substr","concat","resolveURL","href","msie","urlParsingNode","setAttribute","protocol","host","search","hash","hostname","port","pathname","charAt","originURL","test","userAgent","createElement","location","requestURL","E","input","block","charCode","String","output","idx","map","chars","charCodeAt","write","expires","path","domain","secure","cookie","Date","toGMTString","match","RegExp","decodeURIComponent","remove","now","handlers","use","eject","h","throwIfCancellationRequested","throwIfRequested","transformData","isAbsoluteURL","combineURLs","baseURL","reason","fns","__CANCEL__","relativeURL","executor","TypeError","resolvePromise","token","source","callback","arr"],"mappings":"CAAA,SAAAA,EAAAC,GACA,gBAAAC,UAAA,gBAAAC,QACAA,OAAAD,QAAAD,IACA,kBAAAG,gBAAAC,IACAD,UAAAH,GACA,gBAAAC,SACAA,QAAA,MAAAD,IAEAD,EAAA,MAAAC,KACCK,KAAA,WACD,MCAgB,UAAUC,GCN1B,QAAAC,GAAAC,GAGA,GAAAC,EAAAD,GACA,MAAAC,GAAAD,GAAAP,OAGA,IAAAC,GAAAO,EAAAD,IACAP,WACAS,GAAAF,EACAG,QAAA,EAUA,OANAL,GAAAE,GAAAI,KAAAV,EAAAD,QAAAC,IAAAD,QAAAM,GAGAL,EAAAS,QAAA,EAGAT,EAAAD,QAvBA,GAAAQ,KAqCA,OATAF,GAAAM,EAAAP,EAGAC,EAAAO,EAAAL,EAGAF,EAAAQ,EAAA,GAGAR,EAAA,KDgBM,SAAUL,EAAQD,EAASM,GEtDjCL,EAAAD,QAAAM,EAAA,IF4DM,SAAUL,EAAQD,EAASM,GG5DjC,YAaA,SAAAS,GAAAC,GACA,GAAAC,GAAA,GAAAC,GAAAF,GACAG,EAAAC,EAAAF,EAAAG,UAAAC,QAAAL,EAQA,OALAM,GAAAC,OAAAL,EAAAD,EAAAG,UAAAJ,GAGAM,EAAAC,OAAAL,EAAAF,GAEAE,EArBA,GAAAI,GAAAjB,EAAA,GACAc,EAAAd,EAAA,GACAY,EAAAZ,EAAA,GACAmB,EAAAnB,EAAA,GAsBAoB,EAAAX,EAAAU,EAGAC,GAAAR,QAGAQ,EAAAC,OAAA,SAAAC,GACA,MAAAb,GAAAQ,EAAAM,MAAAJ,EAAAG,KAIAF,EAAAI,OAAAxB,EAAA,IACAoB,EAAAK,YAAAzB,EAAA,IACAoB,EAAAM,SAAA1B,EAAA,IAGAoB,EAAAO,IAAA,SAAAC,GACA,MAAAC,SAAAF,IAAAC,IAEAR,EAAAU,OAAA9B,EAAA,IAEAL,EAAAD,QAAA0B,EAGAzB,EAAAD,QAAAqC,QAAAX,GHmEM,SAAUzB,EAAQD,EAASM,GItHjC,YAiBA,SAAAgC,GAAAC,GACA,yBAAAC,EAAA7B,KAAA4B,GASA,QAAAE,GAAAF,GACA,+BAAAC,EAAA7B,KAAA4B,GASA,QAAAG,GAAAH,GACA,yBAAAI,WAAAJ,YAAAI,UASA,QAAAC,GAAAL,GACA,GAAAM,EAMA,OAJAA,GADA,mBAAAC,0BAAA,OACAA,YAAAC,OAAAR,GAEA,GAAAA,EAAA,QAAAA,EAAAS,iBAAAF,aAWA,QAAAG,GAAAV,GACA,sBAAAA,GASA,QAAAW,GAAAX,GACA,sBAAAA,GASA,QAAAY,GAAAZ,GACA,yBAAAA,GASA,QAAAa,GAAAb,GACA,cAAAA,GAAA,gBAAAA,GASA,QAAAc,GAAAd,GACA,wBAAAC,EAAA7B,KAAA4B,GASA,QAAAe,GAAAf,GACA,wBAAAC,EAAA7B,KAAA4B,GASA,QAAAgB,GAAAhB,GACA,wBAAAC,EAAA7B,KAAA4B,GASA,QAAAiB,GAAAjB,GACA,4BAAAC,EAAA7B,KAAA4B,GASA,QAAAkB,GAAAlB,GACA,MAAAa,GAAAb,IAAAiB,EAAAjB,EAAAmB,MASA,QAAAC,GAAApB,GACA,yBAAAqB,kBAAArB,YAAAqB,iBASA,QAAAC,GAAAC,GACA,MAAAA,GAAAC,QAAA,WAAAA,QAAA,WAgBA,QAAAC,KACA,0BAAAC,YAAA,gBAAAA,UAAAC,WAIA,mBAAAC,SACA,mBAAAC,WAgBA,QAAAC,GAAAC,EAAAC,GAEA,UAAAD,GAAA,mBAAAA,GAUA,GALA,gBAAAA,KAEAA,OAGAhC,EAAAgC,GAEA,OAAAE,GAAA,EAAAC,EAAAH,EAAAI,OAAmCF,EAAAC,EAAOD,IAC1CD,EAAA5D,KAAA,KAAA2D,EAAAE,KAAAF,OAIA,QAAAK,KAAAL,GACAM,OAAAvD,UAAAwD,eAAAlE,KAAA2D,EAAAK,IACAJ,EAAA5D,KAAA,KAAA2D,EAAAK,KAAAL,GAuBA,QAAAzC,KAEA,QAAAiD,GAAAvC,EAAAoC,GACA,gBAAA9B,GAAA8B,IAAA,gBAAApC,GACAM,EAAA8B,GAAA9C,EAAAgB,EAAA8B,GAAApC,GAEAM,EAAA8B,GAAApC,EAIA,OATAM,MASA2B,EAAA,EAAAC,EAAAM,UAAAL,OAAuCF,EAAAC,EAAOD,IAC9CH,EAAAU,UAAAP,GAAAM,EAEA,OAAAjC,GAWA,QAAArB,GAAAwD,EAAAC,EAAAC,GAQA,MAPAb,GAAAY,EAAA,SAAA1C,EAAAoC,GACAO,GAAA,kBAAA3C,GACAyC,EAAAL,GAAAvD,EAAAmB,EAAA2C,GAEAF,EAAAL,GAAApC,IAGAyC,EApRA,GAAA5D,GAAAd,EAAA,GACA6E,EAAA7E,EAAA,GAMAkC,EAAAoC,OAAAvD,UAAAmB,QAgRAvC,GAAAD,SACAsC,UACAG,gBACA0C,WACAzC,aACAE,oBACAK,WACAC,WACAE,WACAD,cACAE,SACAC,SACAC,SACAC,aACAC,WACAE,oBACAK,uBACAK,UACAxC,QACAL,SACAqC,SJ8HM,SAAU5D,EAAQD,GK3axB,YAEAC,GAAAD,QAAA,SAAAuE,EAAAW,GACA,kBAEA,OADAE,GAAA,GAAAC,OAAAN,UAAAL,QACAF,EAAA,EAAmBA,EAAAY,EAAAV,OAAiBF,IACpCY,EAAAZ,GAAAO,UAAAP,EAEA,OAAAD,GAAAe,MAAAJ,EAAAE,MLobM,SAAUnF,EAAQD,GM/axB,QAAAmF,GAAAb,GACA,QAAAA,EAAAiB,aAAA,kBAAAjB,GAAAiB,YAAAJ,UAAAb,EAAAiB,YAAAJ,SAAAb,GAIA,QAAAkB,GAAAlB,GACA,wBAAAA,GAAAmB,aAAA,kBAAAnB,GAAAoB,OAAAP,EAAAb,EAAAoB,MAAA;;;;;;AAVAzF,EAAAD,QAAA,SAAAsE,GACA,aAAAA,IAAAa,EAAAb,IAAAkB,EAAAlB,QAAAqB,aN6cM,SAAU1F,EAAQD,EAASM,GOvdjC,YAYA,SAAAY,GAAAU,GACAxB,KAAAqB,SAAAG,EACAxB,KAAAwF,cACAtE,QAAA,GAAAuE,GACAC,SAAA,GAAAD,IAdA,GAAApE,GAAAnB,EAAA,GACAiB,EAAAjB,EAAA,GACAuF,EAAAvF,EAAA,IACAyF,EAAAzF,EAAA,GAoBAY,GAAAG,UAAAC,QAAA,SAAA0E,GAGA,gBAAAA,KACAA,EAAAzE,EAAAM,OACAoE,IAAAlB,UAAA,IACKA,UAAA,KAGLiB,EAAAzE,EAAAM,MAAAJ,GAAkCyE,OAAA,OAAc9F,KAAAqB,SAAAuE,GAChDA,EAAAE,OAAAF,EAAAE,OAAAC,aAGA,IAAAC,IAAAL,EAAAM,QACAC,EAAAnE,QAAAoE,QAAAP,EAUA,KARA5F,KAAAwF,aAAAtE,QAAA+C,QAAA,SAAAmC,GACAJ,EAAAK,QAAAD,EAAAE,UAAAF,EAAAG,YAGAvG,KAAAwF,aAAAE,SAAAzB,QAAA,SAAAmC,GACAJ,EAAAQ,KAAAJ,EAAAE,UAAAF,EAAAG,YAGAP,EAAA1B,QACA4B,IAAAO,KAAAT,EAAAU,QAAAV,EAAAU,QAGA,OAAAR,IAIA/E,EAAA8C,SAAA,0CAAA6B,GAEAhF,EAAAG,UAAA6E,GAAA,SAAAD,EAAAD,GACA,MAAA5F,MAAAkB,QAAAC,EAAAM,MAAAmE,OACAE,SACAD,YAKA1E,EAAA8C,SAAA,+BAAA6B,GAEAhF,EAAAG,UAAA6E,GAAA,SAAAD,EAAAc,EAAAf,GACA,MAAA5F,MAAAkB,QAAAC,EAAAM,MAAAmE,OACAE,SACAD,MACAc,aAKA9G,EAAAD,QAAAkB,GP8dM,SAAUjB,EAAQD,EAASM,GQ5iBjC,YASA,SAAA0G,GAAAC,EAAAC,IACA3F,EAAA4B,YAAA8D,IAAA1F,EAAA4B,YAAA8D,EAAA,mBACAA,EAAA,gBAAAC,GAIA,QAAAC,KACA,GAAAC,EAQA,OAPA,mBAAAC,gBAEAD,EAAA9G,EAAA,GACG,mBAAAgH,WAEHF,EAAA9G,EAAA,IAEA8G,EAtBA,GAAA7F,GAAAjB,EAAA,GACAiH,EAAAjH,EAAA,GAEAkH,GACAC,eAAA,qCAqBAhG,GACA2F,QAAAD,IAEAO,kBAAA,SAAAX,EAAAE,GAEA,MADAM,GAAAN,EAAA,gBACA1F,EAAAmB,WAAAqE,IACAxF,EAAAkB,cAAAsE,IACAxF,EAAA4D,SAAA4B,IACAxF,EAAAkC,SAAAsD,IACAxF,EAAA+B,OAAAyD,IACAxF,EAAAgC,OAAAwD,GAEAA,EAEAxF,EAAAqB,kBAAAmE,GACAA,EAAA/D,OAEAzB,EAAAoC,kBAAAoD,IACAC,EAAAC,EAAA,mDACAF,EAAAvE,YAEAjB,EAAA6B,SAAA2D,IACAC,EAAAC,EAAA,kCACAU,KAAAC,UAAAb,IAEAA,IAGAc,mBAAA,SAAAd,GAEA,mBAAAA,GACA,IACAA,EAAAY,KAAAG,MAAAf,GACO,MAAAgB,IAEP,MAAAhB,KAOAiB,QAAA,EAEAC,eAAA,aACAC,eAAA,eAEAC,kBAAA,EAEAC,eAAA,SAAAC,GACA,MAAAA,IAAA,KAAAA,EAAA,KAIA5G,GAAAwF,SACAqB,QACAC,OAAA,sCAIAhH,EAAA8C,SAAA,gCAAA6B,GACAzE,EAAAwF,QAAAf,QAGA3E,EAAA8C,SAAA,+BAAA6B,GACAzE,EAAAwF,QAAAf,GAAA3E,EAAAM,MAAA2F,KAGAvH,EAAAD,QAAAyB,GRmjBM,SAAUxB,EAAQD,EAASM,GSlpBjC,YAEA,IAAAiB,GAAAjB,EAAA,EAEAL,GAAAD,QAAA,SAAAiH,EAAAuB,GACAjH,EAAA8C,QAAA4C,EAAA,SAAAC,EAAAuB,GACAA,IAAAD,GAAAC,EAAAC,gBAAAF,EAAAE,gBACAzB,EAAAuB,GAAAtB,QACAD,GAAAwB,QT4pBM,SAAUxI,EAAQD,EAASM,GUpqBjC,YAEA,IAAAiB,GAAAjB,EAAA,GACAqI,EAAArI,EAAA,GACAsI,EAAAtI,EAAA,IACAuI,EAAAvI,EAAA,IACAwI,EAAAxI,EAAA,IACAyI,EAAAzI,EAAA,IACA0I,EAAA,mBAAA7E,gBAAA6E,MAAA7E,OAAA6E,KAAA5H,KAAA+C,SAAA7D,EAAA,GAEAL,GAAAD,QAAA,SAAAgG,GACA,UAAA7D,SAAA,SAAAoE,EAAA0C,GACA,GAAAC,GAAAlD,EAAAe,KACAoC,EAAAnD,EAAAiB,OAEA1F,GAAAmB,WAAAwG,UACAC,GAAA,eAGA,IAAA7H,GAAA,GAAA+F,gBACA+B,EAAA,qBACAC,GAAA,CAiBA,IAXA,mBAAAlF,UACAA,OAAAmF,gBAAA,mBAAAhI,IACAwH,EAAA9C,EAAAC,OACA3E,EAAA,GAAA6C,QAAAmF,eACAF,EAAA,SACAC,GAAA,EACA/H,EAAAiI,WAAA,aACAjI,EAAAkI,UAAA,cAIAxD,EAAAyD,KAAA,CACA,GAAAC,GAAA1D,EAAAyD,KAAAC,UAAA,GACAC,EAAA3D,EAAAyD,KAAAE,UAAA,EACAR,GAAAS,cAAA,SAAAZ,EAAAU,EAAA,IAAAC,GA+DA,GA5DArI,EAAAuI,KAAA7D,EAAAE,OAAAwC,cAAAE,EAAA5C,EAAAC,IAAAD,EAAA8D,OAAA9D,EAAA+D,mBAAA,GAGAzI,EAAA0G,QAAAhC,EAAAgC,QAGA1G,EAAA8H,GAAA,WACA,GAAA9H,IAAA,IAAAA,EAAA0I,YAAAX,KAQA,IAAA/H,EAAA+G,QAAA/G,EAAA2I,aAAA,IAAA3I,EAAA2I,YAAAC,QAAA,WAKA,GAAAC,GAAA,yBAAA7I,GAAAuH,EAAAvH,EAAA8I,yBAAA,KACAC,EAAArE,EAAAsE,cAAA,SAAAtE,EAAAsE,aAAAhJ,EAAAwE,SAAAxE,EAAAiJ,aACAzE,GACAiB,KAAAsD,EAEAhC,OAAA,OAAA/G,EAAA+G,OAAA,IAAA/G,EAAA+G,OACAmC,WAAA,OAAAlJ,EAAA+G,OAAA,aAAA/G,EAAAkJ,WACAvD,QAAAkD,EACAnE,SACA1E,UAGAqH,GAAApC,EAAA0C,EAAAnD,GAGAxE,EAAA,OAIAA,EAAAmJ,QAAA,WAGAxB,EAAAF,EAAA,gBAAA/C,EAAA,KAAA1E,IAGAA,EAAA,MAIAA,EAAAkI,UAAA,WACAP,EAAAF,EAAA,cAAA/C,EAAAgC,QAAA,cAAAhC,EAAA,eACA1E,IAGAA,EAAA,MAMAC,EAAAyC,uBAAA,CACA,GAAA0G,GAAApK,EAAA,IAGAqK,GAAA3E,EAAA4E,iBAAA9B,EAAA9C,EAAAC,OAAAD,EAAAiC,eACAyC,EAAAG,KAAA7E,EAAAiC,gBACA5B,MAEAsE,KACAxB,EAAAnD,EAAAkC,gBAAAyC,GAuBA,GAlBA,oBAAArJ,IACAC,EAAA8C,QAAA8E,EAAA,SAAA5G,EAAAoC,GACA,mBAAAuE,IAAA,iBAAAvE,EAAAwB,oBAEAgD,GAAAxE,GAGArD,EAAAwJ,iBAAAnG,EAAApC,KAMAyD,EAAA4E,kBACAtJ,EAAAsJ,iBAAA,GAIA5E,EAAAsE,aACA,IACAhJ,EAAAgJ,aAAAtE,EAAAsE,aACO,MAAAvC,GAGP,YAAA/B,EAAAsE,aACA,KAAAvC,GAMA,kBAAA/B,GAAA+E,oBACAzJ,EAAA0J,iBAAA,WAAAhF,EAAA+E,oBAIA,kBAAA/E,GAAAiF,kBAAA3J,EAAA4J,QACA5J,EAAA4J,OAAAF,iBAAA,WAAAhF,EAAAiF,kBAGAjF,EAAAmF,aAEAnF,EAAAmF,YAAA7E,QAAAO,KAAA,SAAAuE,GACA9J,IAIAA,EAAA+J,QACApC,EAAAmC,GAEA9J,EAAA,QAIA+E,SAAA6C,IACAA,EAAA,MAIA5H,EAAAgK,KAAApC,OV6qBM,SAAUjJ,EAAQD,EAASM,GW91BjC,YAEA,IAAAyI,GAAAzI,EAAA,GASAL,GAAAD,QAAA,SAAAuG,EAAA0C,EAAAnD,GACA,GAAAsC,GAAAtC,EAAAE,OAAAoC,cAEAtC,GAAAuC,QAAAD,MAAAtC,EAAAuC,QAGAY,EAAAF,EACA,mCAAAjD,EAAAuC,OACAvC,EAAAE,OACA,KACAF,EAAAxE,QACAwE,IAPAS,EAAAT,KX+2BM,SAAU7F,EAAQD,EAASM,GY93BjC,YAEA,IAAAiL,GAAAjL,EAAA,GAYAL,GAAAD,QAAA,SAAAwL,EAAAxF,EAAAyF,EAAAnK,EAAAwE,GACA,GAAA4F,GAAA,GAAAC,OAAAH,EACA,OAAAD,GAAAG,EAAA1F,EAAAyF,EAAAnK,EAAAwE,KZs4BM,SAAU7F,EAAQD,Gat5BxB,YAYAC,GAAAD,QAAA,SAAA0L,EAAA1F,EAAAyF,EAAAnK,EAAAwE,GAOA,MANA4F,GAAA1F,SACAyF,IACAC,EAAAD,QAEAC,EAAApK,UACAoK,EAAA5F,WACA4F,Ib85BM,SAAUzL,EAAQD,EAASM,Gcj7BjC,YAIA,SAAAsL,GAAArJ,GACA,MAAAsJ,oBAAAtJ,GACAwB,QAAA,aACAA,QAAA,aACAA,QAAA,YACAA,QAAA,aACAA,QAAA,YACAA,QAAA,aACAA,QAAA,aAVA,GAAAxC,GAAAjB,EAAA,EAoBAL,GAAAD,QAAA,SAAAiG,EAAA6D,EAAAC,GAEA,IAAAD,EACA,MAAA7D,EAGA,IAAA6F,EACA,IAAA/B,EACA+B,EAAA/B,EAAAD,OACG,IAAAvI,EAAAoC,kBAAAmG,GACHgC,EAAAhC,EAAAtH,eACG,CACH,GAAAuJ,KAEAxK,GAAA8C,QAAAyF,EAAA,SAAAvH,EAAAoC,GACA,OAAApC,GAAA,mBAAAA,KAIAhB,EAAAe,QAAAC,GACAoC,GAAA,KAEApC,MAGAhB,EAAA8C,QAAA9B,EAAA,SAAAyJ,GACAzK,EAAA8B,OAAA2I,GACAA,IAAAC,cACS1K,EAAA6B,SAAA4I,KACTA,EAAArE,KAAAC,UAAAoE,IAEAD,EAAAnF,KAAAgF,EAAAjH,GAAA,IAAAiH,EAAAI,SAIAF,EAAAC,EAAAG,KAAA,KAOA,MAJAJ,KACA7F,MAAAiE,QAAA,mBAAA4B,GAGA7F,Idy7BM,SAAUhG,EAAQD,EAASM,Gez/BjC,YAEA,IAAAiB,GAAAjB,EAAA,GAIA6L,GACA,6DACA,kEACA,gEACA,qCAgBAlM,GAAAD,QAAA,SAAAiH,GACA,GACAtC,GACApC,EACAiC,EAHA4H,IAKA,OAAAnF,IAEA1F,EAAA8C,QAAA4C,EAAAoF,MAAA,eAAAC,GAKA,GAJA9H,EAAA8H,EAAApC,QAAA,KACAvF,EAAApD,EAAAsC,KAAAyI,EAAAC,OAAA,EAAA/H,IAAA2B,cACA5D,EAAAhB,EAAAsC,KAAAyI,EAAAC,OAAA/H,EAAA,IAEAG,EAAA,CACA,GAAAyH,EAAAzH,IAAAwH,EAAAjC,QAAAvF,IAAA,EACA,MAEA,gBAAAA,EACAyH,EAAAzH,IAAAyH,EAAAzH,GAAAyH,EAAAzH,OAAA6H,QAAAjK,IAEA6J,EAAAzH,GAAAyH,EAAAzH,GAAAyH,EAAAzH,GAAA,KAAApC,OAKA6J,GAnBiBA,IfohCX,SAAUnM,EAAQD,EAASM,GgBpjCjC,YAEA,IAAAiB,GAAAjB,EAAA,EAEAL,GAAAD,QACAuB,EAAAyC,uBAIA,WAWA,QAAAyI,GAAAxG,GACA,GAAAyG,GAAAzG,CAWA,OATA0G,KAEAC,EAAAC,aAAA,OAAAH,GACAA,EAAAE,EAAAF,MAGAE,EAAAC,aAAA,OAAAH,IAIAA,KAAAE,EAAAF,KACAI,SAAAF,EAAAE,SAAAF,EAAAE,SAAA/I,QAAA,YACAgJ,KAAAH,EAAAG,KACAC,OAAAJ,EAAAI,OAAAJ,EAAAI,OAAAjJ,QAAA,aACAkJ,KAAAL,EAAAK,KAAAL,EAAAK,KAAAlJ,QAAA,YACAmJ,SAAAN,EAAAM,SACAC,KAAAP,EAAAO,KACAC,SAAA,MAAAR,EAAAQ,SAAAC,OAAA,GACAT,EAAAQ,SACA,IAAAR,EAAAQ,UAhCA,GAEAE,GAFAX,EAAA,kBAAAY,KAAAtJ,UAAAuJ,WACAZ,EAAAxI,SAAAqJ,cAAA,IA2CA,OARAH,GAAAb,EAAAtI,OAAAuJ,SAAAhB,MAQA,SAAAiB,GACA,GAAAvB,GAAA7K,EAAA0B,SAAA0K,GAAAlB,EAAAkB,IACA,OAAAvB,GAAAU,WAAAQ,EAAAR,UACAV,EAAAW,OAAAO,EAAAP,SAKA,WACA,kBACA,chB8jCM,SAAU9M,EAAQD,GiB9nCxB,YAMA,SAAA4N,KACAxN,KAAAoL,QAAA,uCAMA,QAAAxC,GAAA6E,GAGA,IAEA,GAAAC,GAAAC,EAJAjK,EAAAkK,OAAAH,GACAI,EAAA,GAGAC,EAAA,EAAAC,EAAAC,EAIAtK,EAAAuJ,OAAA,EAAAa,KAAAC,EAAA,IAAAD,EAAA,GAEAD,GAAAE,EAAAd,OAAA,GAAAS,GAAA,EAAAI,EAAA,KACA,CAEA,GADAH,EAAAjK,EAAAuK,WAAAH,GAAA,KACAH,EAAA,IACA,SAAAH,EAEAE,MAAA,EAAAC,EAEA,MAAAE,GA5BA,GAAAG,GAAA,mEAKAR,GAAAvM,UAAA,GAAAsK,OACAiC,EAAAvM,UAAAoK,KAAA,EACAmC,EAAAvM,UAAAoH,KAAA,wBAwBAxI,EAAAD,QAAAgJ,GjBqoCM,SAAU/I,EAAQD,EAASM,GkBxqCjC,YAEA,IAAAiB,GAAAjB,EAAA,EAEAL,GAAAD,QACAuB,EAAAyC,uBAGA,WACA,OACAsK,MAAA,SAAA7F,EAAAvB,EAAAqH,EAAAC,EAAAC,EAAAC,GACA,GAAAC,KACAA,GAAA/H,KAAA6B,EAAA,IAAAoD,mBAAA3E,IAEA3F,EAAA2B,SAAAqL,IACAI,EAAA/H,KAAA,cAAAgI,MAAAL,GAAAM,eAGAtN,EAAA0B,SAAAuL,IACAG,EAAA/H,KAAA,QAAA4H,GAGAjN,EAAA0B,SAAAwL,IACAE,EAAA/H,KAAA,UAAA6H,GAGAC,KAAA,GACAC,EAAA/H,KAAA,UAGAxC,SAAAuK,SAAAzC,KAAA,OAGArB,KAAA,SAAApC,GACA,GAAAqG,GAAA1K,SAAAuK,OAAAG,MAAA,GAAAC,QAAA,aAA0DtG,EAAA,aAC1D,OAAAqG,GAAAE,mBAAAF,EAAA,UAGAG,OAAA,SAAAxG,GACArI,KAAAkO,MAAA7F,EAAA,GAAAmG,KAAAM,MAAA,YAMA,WACA,OACAZ,MAAA,aACAzD,KAAA,WAA6B,aAC7BoE,OAAA,kBlBkrCM,SAAUhP,EAAQD,EAASM,GmBnuCjC,YAIA,SAAAuF,KACAzF,KAAA+O,YAHA,GAAA5N,GAAAjB,EAAA,EAcAuF,GAAAxE,UAAA+N,IAAA,SAAA1I,EAAAC,GAKA,MAJAvG,MAAA+O,SAAAvI,MACAF,YACAC,aAEAvG,KAAA+O,SAAAzK,OAAA,GAQAmB,EAAAxE,UAAAgO,MAAA,SAAA5O,GACAL,KAAA+O,SAAA1O,KACAL,KAAA+O,SAAA1O,GAAA,OAYAoF,EAAAxE,UAAAgD,QAAA,SAAAE,GACAhD,EAAA8C,QAAAjE,KAAA+O,SAAA,SAAAG,GACA,OAAAA,GACA/K,EAAA+K,MAKArP,EAAAD,QAAA6F,GnB0uCM,SAAU5F,EAAQD,EAASM,GoB7xCjC,YAYA,SAAAiP,GAAAvJ,GACAA,EAAAmF,aACAnF,EAAAmF,YAAAqE,mBAZA,GAAAjO,GAAAjB,EAAA,GACAmP,EAAAnP,EAAA,IACA0B,EAAA1B,EAAA,IACAmB,EAAAnB,EAAA,GACAoP,EAAApP,EAAA,IACAqP,EAAArP,EAAA,GAiBAL,GAAAD,QAAA,SAAAgG,GACAuJ,EAAAvJ,GAGAA,EAAA4J,UAAAF,EAAA1J,EAAAC,OACAD,EAAAC,IAAA0J,EAAA3J,EAAA4J,QAAA5J,EAAAC,MAIAD,EAAAiB,QAAAjB,EAAAiB,YAGAjB,EAAAe,KAAA0I,EACAzJ,EAAAe,KACAf,EAAAiB,QACAjB,EAAA0B,kBAIA1B,EAAAiB,QAAA1F,EAAAM,MACAmE,EAAAiB,QAAAqB,WACAtC,EAAAiB,QAAAjB,EAAAE,YACAF,EAAAiB,aAGA1F,EAAA8C,SACA,qDACA,SAAA6B,SACAF,GAAAiB,QAAAf,IAIA,IAAAkB,GAAApB,EAAAoB,SAAA3F,EAAA2F,OAEA,OAAAA,GAAApB,GAAAa,KAAA,SAAAf,GAUA,MATAyJ,GAAAvJ,GAGAF,EAAAiB,KAAA0I,EACA3J,EAAAiB,KACAjB,EAAAmB,QACAjB,EAAA6B,mBAGA/B,GACG,SAAA+J,GAcH,MAbA7N,GAAA6N,KACAN,EAAAvJ,GAGA6J,KAAA/J,WACA+J,EAAA/J,SAAAiB,KAAA0I,EACAI,EAAA/J,SAAAiB,KACA8I,EAAA/J,SAAAmB,QACAjB,EAAA6B,qBAKA1F,QAAA8G,OAAA4G,OpBsyCM,SAAU5P,EAAQD,EAASM,GqBz3CjC,YAEA,IAAAiB,GAAAjB,EAAA,EAUAL,GAAAD,QAAA,SAAA+G,EAAAE,EAAA6I,GAMA,MAJAvO,GAAA8C,QAAAyL,EAAA,SAAAvL,GACAwC,EAAAxC,EAAAwC,EAAAE,KAGAF,IrBi4CM,SAAU9G,EAAQD,GsBn5CxB,YAEAC,GAAAD,QAAA,SAAAkH,GACA,SAAAA,MAAA6I,ctB25CM,SAAU9P,EAAQD,GuB95CxB,YAQAC,GAAAD,QAAA,SAAAiG,GAIA,sCAAAsH,KAAAtH,KvBs6CM,SAAUhG,EAAQD,GwBl7CxB,YASAC,GAAAD,QAAA,SAAA4P,EAAAI,GACA,MAAAA,GACAJ,EAAA7L,QAAA,eAAAiM,EAAAjM,QAAA,WACA6L,IxB07CM,SAAU3P,EAAQD,GyBt8CxB,YAQA,SAAA8B,GAAA0J,GACApL,KAAAoL,UAGA1J,EAAAT,UAAAmB,SAAA,WACA,gBAAApC,KAAAoL,QAAA,KAAApL,KAAAoL,QAAA,KAGA1J,EAAAT,UAAA0O,YAAA,EAEA9P,EAAAD,QAAA8B,GzB68CM,SAAU7B,EAAQD,EAASM,G0B/9CjC,YAUA,SAAAyB,GAAAkO,GACA,qBAAAA,GACA,SAAAC,WAAA,+BAGA,IAAAC,EACA/P,MAAAkG,QAAA,GAAAnE,SAAA,SAAAoE,GACA4J,EAAA5J,GAGA,IAAA6J,GAAAhQ,IACA6P,GAAA,SAAAzE,GACA4E,EAAAP,SAKAO,EAAAP,OAAA,GAAA/N,GAAA0J,GACA2E,EAAAC,EAAAP,WA1BA,GAAA/N,GAAAxB,EAAA,GAiCAyB,GAAAV,UAAAmO,iBAAA,WACA,GAAApP,KAAAyP,OACA,KAAAzP,MAAAyP,QAQA9N,EAAAsO,OAAA,WACA,GAAAjF,GACAgF,EAAA,GAAArO,GAAA,SAAAlB,GACAuK,EAAAvK,GAEA,QACAuP,QACAhF,WAIAnL,EAAAD,QAAA+B,G1Bs+CM,SAAU9B,EAAQD,G2B9hDxB,YAsBAC,GAAAD,QAAA,SAAAsQ,GACA,gBAAAC,GACA,MAAAD,GAAAhL,MAAA,KAAAiL","file":"axios.min.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition","(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn /******/ (function(modules) { // webpackBootstrap\n/******/ \t// The module cache\n/******/ \tvar installedModules = {};\n/******/\n/******/ \t// The require function\n/******/ \tfunction __webpack_require__(moduleId) {\n/******/\n/******/ \t\t// Check if module is in cache\n/******/ \t\tif(installedModules[moduleId])\n/******/ \t\t\treturn installedModules[moduleId].exports;\n/******/\n/******/ \t\t// Create a new module (and put it into the cache)\n/******/ \t\tvar module = installedModules[moduleId] = {\n/******/ \t\t\texports: {},\n/******/ \t\t\tid: moduleId,\n/******/ \t\t\tloaded: false\n/******/ \t\t};\n/******/\n/******/ \t\t// Execute the module function\n/******/ \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n/******/\n/******/ \t\t// Flag the module as loaded\n/******/ \t\tmodule.loaded = true;\n/******/\n/******/ \t\t// Return the exports of the module\n/******/ \t\treturn module.exports;\n/******/ \t}\n/******/\n/******/\n/******/ \t// expose the modules object (__webpack_modules__)\n/******/ \t__webpack_require__.m = modules;\n/******/\n/******/ \t// expose the module cache\n/******/ \t__webpack_require__.c = installedModules;\n/******/\n/******/ \t// __webpack_public_path__\n/******/ \t__webpack_require__.p = \"\";\n/******/\n/******/ \t// Load entry module and return exports\n/******/ \treturn __webpack_require__(0);\n/******/ })\n/************************************************************************/\n/******/ ([\n/* 0 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\tmodule.exports = __webpack_require__(1);\n\n/***/ }),\n/* 1 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar bind = __webpack_require__(3);\n\tvar Axios = __webpack_require__(5);\n\tvar defaults = __webpack_require__(6);\n\t\n\t/**\n\t * Create an instance of Axios\n\t *\n\t * @param {Object} defaultConfig The default config for the instance\n\t * @return {Axios} A new instance of Axios\n\t */\n\tfunction createInstance(defaultConfig) {\n\t var context = new Axios(defaultConfig);\n\t var instance = bind(Axios.prototype.request, context);\n\t\n\t // Copy axios.prototype to instance\n\t utils.extend(instance, Axios.prototype, context);\n\t\n\t // Copy context to instance\n\t utils.extend(instance, context);\n\t\n\t return instance;\n\t}\n\t\n\t// Create the default instance to be exported\n\tvar axios = createInstance(defaults);\n\t\n\t// Expose Axios class to allow class inheritance\n\taxios.Axios = Axios;\n\t\n\t// Factory for creating new instances\n\taxios.create = function create(instanceConfig) {\n\t return createInstance(utils.merge(defaults, instanceConfig));\n\t};\n\t\n\t// Expose Cancel & CancelToken\n\taxios.Cancel = __webpack_require__(23);\n\taxios.CancelToken = __webpack_require__(24);\n\taxios.isCancel = __webpack_require__(20);\n\t\n\t// Expose all/spread\n\taxios.all = function all(promises) {\n\t return Promise.all(promises);\n\t};\n\taxios.spread = __webpack_require__(25);\n\t\n\tmodule.exports = axios;\n\t\n\t// Allow use of default import syntax in TypeScript\n\tmodule.exports.default = axios;\n\n\n/***/ }),\n/* 2 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar bind = __webpack_require__(3);\n\tvar isBuffer = __webpack_require__(4);\n\t\n\t/*global toString:true*/\n\t\n\t// utils is a library of generic helper functions non-specific to axios\n\t\n\tvar toString = Object.prototype.toString;\n\t\n\t/**\n\t * Determine if a value is an Array\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an Array, otherwise false\n\t */\n\tfunction isArray(val) {\n\t return toString.call(val) === '[object Array]';\n\t}\n\t\n\t/**\n\t * Determine if a value is an ArrayBuffer\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n\t */\n\tfunction isArrayBuffer(val) {\n\t return toString.call(val) === '[object ArrayBuffer]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a FormData\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an FormData, otherwise false\n\t */\n\tfunction isFormData(val) {\n\t return (typeof FormData !== 'undefined') && (val instanceof FormData);\n\t}\n\t\n\t/**\n\t * Determine if a value is a view on an ArrayBuffer\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n\t */\n\tfunction isArrayBufferView(val) {\n\t var result;\n\t if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n\t result = ArrayBuffer.isView(val);\n\t } else {\n\t result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n\t }\n\t return result;\n\t}\n\t\n\t/**\n\t * Determine if a value is a String\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a String, otherwise false\n\t */\n\tfunction isString(val) {\n\t return typeof val === 'string';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Number\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Number, otherwise false\n\t */\n\tfunction isNumber(val) {\n\t return typeof val === 'number';\n\t}\n\t\n\t/**\n\t * Determine if a value is undefined\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if the value is undefined, otherwise false\n\t */\n\tfunction isUndefined(val) {\n\t return typeof val === 'undefined';\n\t}\n\t\n\t/**\n\t * Determine if a value is an Object\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an Object, otherwise false\n\t */\n\tfunction isObject(val) {\n\t return val !== null && typeof val === 'object';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Date\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Date, otherwise false\n\t */\n\tfunction isDate(val) {\n\t return toString.call(val) === '[object Date]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a File\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a File, otherwise false\n\t */\n\tfunction isFile(val) {\n\t return toString.call(val) === '[object File]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Blob\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Blob, otherwise false\n\t */\n\tfunction isBlob(val) {\n\t return toString.call(val) === '[object Blob]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Function\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Function, otherwise false\n\t */\n\tfunction isFunction(val) {\n\t return toString.call(val) === '[object Function]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Stream\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Stream, otherwise false\n\t */\n\tfunction isStream(val) {\n\t return isObject(val) && isFunction(val.pipe);\n\t}\n\t\n\t/**\n\t * Determine if a value is a URLSearchParams object\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n\t */\n\tfunction isURLSearchParams(val) {\n\t return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n\t}\n\t\n\t/**\n\t * Trim excess whitespace off the beginning and end of a string\n\t *\n\t * @param {String} str The String to trim\n\t * @returns {String} The String freed of excess whitespace\n\t */\n\tfunction trim(str) {\n\t return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n\t}\n\t\n\t/**\n\t * Determine if we're running in a standard browser environment\n\t *\n\t * This allows axios to run in a web worker, and react-native.\n\t * Both environments support XMLHttpRequest, but not fully standard globals.\n\t *\n\t * web workers:\n\t * typeof window -> undefined\n\t * typeof document -> undefined\n\t *\n\t * react-native:\n\t * navigator.product -> 'ReactNative'\n\t */\n\tfunction isStandardBrowserEnv() {\n\t if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {\n\t return false;\n\t }\n\t return (\n\t typeof window !== 'undefined' &&\n\t typeof document !== 'undefined'\n\t );\n\t}\n\t\n\t/**\n\t * Iterate over an Array or an Object invoking a function for each item.\n\t *\n\t * If `obj` is an Array callback will be called passing\n\t * the value, index, and complete array for each item.\n\t *\n\t * If 'obj' is an Object callback will be called passing\n\t * the value, key, and complete object for each property.\n\t *\n\t * @param {Object|Array} obj The object to iterate\n\t * @param {Function} fn The callback to invoke for each item\n\t */\n\tfunction forEach(obj, fn) {\n\t // Don't bother if no value provided\n\t if (obj === null || typeof obj === 'undefined') {\n\t return;\n\t }\n\t\n\t // Force an array if not already something iterable\n\t if (typeof obj !== 'object') {\n\t /*eslint no-param-reassign:0*/\n\t obj = [obj];\n\t }\n\t\n\t if (isArray(obj)) {\n\t // Iterate over array values\n\t for (var i = 0, l = obj.length; i < l; i++) {\n\t fn.call(null, obj[i], i, obj);\n\t }\n\t } else {\n\t // Iterate over object keys\n\t for (var key in obj) {\n\t if (Object.prototype.hasOwnProperty.call(obj, key)) {\n\t fn.call(null, obj[key], key, obj);\n\t }\n\t }\n\t }\n\t}\n\t\n\t/**\n\t * Accepts varargs expecting each argument to be an object, then\n\t * immutably merges the properties of each object and returns result.\n\t *\n\t * When multiple objects contain the same key the later object in\n\t * the arguments list will take precedence.\n\t *\n\t * Example:\n\t *\n\t * ```js\n\t * var result = merge({foo: 123}, {foo: 456});\n\t * console.log(result.foo); // outputs 456\n\t * ```\n\t *\n\t * @param {Object} obj1 Object to merge\n\t * @returns {Object} Result of all merge properties\n\t */\n\tfunction merge(/* obj1, obj2, obj3, ... */) {\n\t var result = {};\n\t function assignValue(val, key) {\n\t if (typeof result[key] === 'object' && typeof val === 'object') {\n\t result[key] = merge(result[key], val);\n\t } else {\n\t result[key] = val;\n\t }\n\t }\n\t\n\t for (var i = 0, l = arguments.length; i < l; i++) {\n\t forEach(arguments[i], assignValue);\n\t }\n\t return result;\n\t}\n\t\n\t/**\n\t * Extends object a by mutably adding to it the properties of object b.\n\t *\n\t * @param {Object} a The object to be extended\n\t * @param {Object} b The object to copy properties from\n\t * @param {Object} thisArg The object to bind function to\n\t * @return {Object} The resulting value of object a\n\t */\n\tfunction extend(a, b, thisArg) {\n\t forEach(b, function assignValue(val, key) {\n\t if (thisArg && typeof val === 'function') {\n\t a[key] = bind(val, thisArg);\n\t } else {\n\t a[key] = val;\n\t }\n\t });\n\t return a;\n\t}\n\t\n\tmodule.exports = {\n\t isArray: isArray,\n\t isArrayBuffer: isArrayBuffer,\n\t isBuffer: isBuffer,\n\t isFormData: isFormData,\n\t isArrayBufferView: isArrayBufferView,\n\t isString: isString,\n\t isNumber: isNumber,\n\t isObject: isObject,\n\t isUndefined: isUndefined,\n\t isDate: isDate,\n\t isFile: isFile,\n\t isBlob: isBlob,\n\t isFunction: isFunction,\n\t isStream: isStream,\n\t isURLSearchParams: isURLSearchParams,\n\t isStandardBrowserEnv: isStandardBrowserEnv,\n\t forEach: forEach,\n\t merge: merge,\n\t extend: extend,\n\t trim: trim\n\t};\n\n\n/***/ }),\n/* 3 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\tmodule.exports = function bind(fn, thisArg) {\n\t return function wrap() {\n\t var args = new Array(arguments.length);\n\t for (var i = 0; i < args.length; i++) {\n\t args[i] = arguments[i];\n\t }\n\t return fn.apply(thisArg, args);\n\t };\n\t};\n\n\n/***/ }),\n/* 4 */\n/***/ (function(module, exports) {\n\n\t/*!\n\t * Determine if an object is a Buffer\n\t *\n\t * @author Feross Aboukhadijeh \n\t * @license MIT\n\t */\n\t\n\t// The _isBuffer check is for Safari 5-7 support, because it's missing\n\t// Object.prototype.constructor. Remove this eventually\n\tmodule.exports = function (obj) {\n\t return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer)\n\t}\n\t\n\tfunction isBuffer (obj) {\n\t return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n\t}\n\t\n\t// For Node v0.10 support. Remove this eventually.\n\tfunction isSlowBuffer (obj) {\n\t return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0))\n\t}\n\n\n/***/ }),\n/* 5 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar defaults = __webpack_require__(6);\n\tvar utils = __webpack_require__(2);\n\tvar InterceptorManager = __webpack_require__(17);\n\tvar dispatchRequest = __webpack_require__(18);\n\t\n\t/**\n\t * Create a new instance of Axios\n\t *\n\t * @param {Object} instanceConfig The default config for the instance\n\t */\n\tfunction Axios(instanceConfig) {\n\t this.defaults = instanceConfig;\n\t this.interceptors = {\n\t request: new InterceptorManager(),\n\t response: new InterceptorManager()\n\t };\n\t}\n\t\n\t/**\n\t * Dispatch a request\n\t *\n\t * @param {Object} config The config specific for this request (merged with this.defaults)\n\t */\n\tAxios.prototype.request = function request(config) {\n\t /*eslint no-param-reassign:0*/\n\t // Allow for axios('example/url'[, config]) a la fetch API\n\t if (typeof config === 'string') {\n\t config = utils.merge({\n\t url: arguments[0]\n\t }, arguments[1]);\n\t }\n\t\n\t config = utils.merge(defaults, {method: 'get'}, this.defaults, config);\n\t config.method = config.method.toLowerCase();\n\t\n\t // Hook up interceptors middleware\n\t var chain = [dispatchRequest, undefined];\n\t var promise = Promise.resolve(config);\n\t\n\t this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n\t chain.unshift(interceptor.fulfilled, interceptor.rejected);\n\t });\n\t\n\t this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n\t chain.push(interceptor.fulfilled, interceptor.rejected);\n\t });\n\t\n\t while (chain.length) {\n\t promise = promise.then(chain.shift(), chain.shift());\n\t }\n\t\n\t return promise;\n\t};\n\t\n\t// Provide aliases for supported request methods\n\tutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n\t /*eslint func-names:0*/\n\t Axios.prototype[method] = function(url, config) {\n\t return this.request(utils.merge(config || {}, {\n\t method: method,\n\t url: url\n\t }));\n\t };\n\t});\n\t\n\tutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n\t /*eslint func-names:0*/\n\t Axios.prototype[method] = function(url, data, config) {\n\t return this.request(utils.merge(config || {}, {\n\t method: method,\n\t url: url,\n\t data: data\n\t }));\n\t };\n\t});\n\t\n\tmodule.exports = Axios;\n\n\n/***/ }),\n/* 6 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar normalizeHeaderName = __webpack_require__(7);\n\t\n\tvar DEFAULT_CONTENT_TYPE = {\n\t 'Content-Type': 'application/x-www-form-urlencoded'\n\t};\n\t\n\tfunction setContentTypeIfUnset(headers, value) {\n\t if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n\t headers['Content-Type'] = value;\n\t }\n\t}\n\t\n\tfunction getDefaultAdapter() {\n\t var adapter;\n\t if (typeof XMLHttpRequest !== 'undefined') {\n\t // For browsers use XHR adapter\n\t adapter = __webpack_require__(8);\n\t } else if (typeof process !== 'undefined') {\n\t // For node use HTTP adapter\n\t adapter = __webpack_require__(8);\n\t }\n\t return adapter;\n\t}\n\t\n\tvar defaults = {\n\t adapter: getDefaultAdapter(),\n\t\n\t transformRequest: [function transformRequest(data, headers) {\n\t normalizeHeaderName(headers, 'Content-Type');\n\t if (utils.isFormData(data) ||\n\t utils.isArrayBuffer(data) ||\n\t utils.isBuffer(data) ||\n\t utils.isStream(data) ||\n\t utils.isFile(data) ||\n\t utils.isBlob(data)\n\t ) {\n\t return data;\n\t }\n\t if (utils.isArrayBufferView(data)) {\n\t return data.buffer;\n\t }\n\t if (utils.isURLSearchParams(data)) {\n\t setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n\t return data.toString();\n\t }\n\t if (utils.isObject(data)) {\n\t setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n\t return JSON.stringify(data);\n\t }\n\t return data;\n\t }],\n\t\n\t transformResponse: [function transformResponse(data) {\n\t /*eslint no-param-reassign:0*/\n\t if (typeof data === 'string') {\n\t try {\n\t data = JSON.parse(data);\n\t } catch (e) { /* Ignore */ }\n\t }\n\t return data;\n\t }],\n\t\n\t /**\n\t * A timeout in milliseconds to abort a request. If set to 0 (default) a\n\t * timeout is not created.\n\t */\n\t timeout: 0,\n\t\n\t xsrfCookieName: 'XSRF-TOKEN',\n\t xsrfHeaderName: 'X-XSRF-TOKEN',\n\t\n\t maxContentLength: -1,\n\t\n\t validateStatus: function validateStatus(status) {\n\t return status >= 200 && status < 300;\n\t }\n\t};\n\t\n\tdefaults.headers = {\n\t common: {\n\t 'Accept': 'application/json, text/plain, */*'\n\t }\n\t};\n\t\n\tutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n\t defaults.headers[method] = {};\n\t});\n\t\n\tutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n\t defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n\t});\n\t\n\tmodule.exports = defaults;\n\n\n/***/ }),\n/* 7 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n\t utils.forEach(headers, function processHeader(value, name) {\n\t if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n\t headers[normalizedName] = value;\n\t delete headers[name];\n\t }\n\t });\n\t};\n\n\n/***/ }),\n/* 8 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar settle = __webpack_require__(9);\n\tvar buildURL = __webpack_require__(12);\n\tvar parseHeaders = __webpack_require__(13);\n\tvar isURLSameOrigin = __webpack_require__(14);\n\tvar createError = __webpack_require__(10);\n\tvar btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || __webpack_require__(15);\n\t\n\tmodule.exports = function xhrAdapter(config) {\n\t return new Promise(function dispatchXhrRequest(resolve, reject) {\n\t var requestData = config.data;\n\t var requestHeaders = config.headers;\n\t\n\t if (utils.isFormData(requestData)) {\n\t delete requestHeaders['Content-Type']; // Let the browser set it\n\t }\n\t\n\t var request = new XMLHttpRequest();\n\t var loadEvent = 'onreadystatechange';\n\t var xDomain = false;\n\t\n\t // For IE 8/9 CORS support\n\t // Only supports POST and GET calls and doesn't returns the response headers.\n\t // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest.\n\t if ((\"production\") !== 'test' &&\n\t typeof window !== 'undefined' &&\n\t window.XDomainRequest && !('withCredentials' in request) &&\n\t !isURLSameOrigin(config.url)) {\n\t request = new window.XDomainRequest();\n\t loadEvent = 'onload';\n\t xDomain = true;\n\t request.onprogress = function handleProgress() {};\n\t request.ontimeout = function handleTimeout() {};\n\t }\n\t\n\t // HTTP basic authentication\n\t if (config.auth) {\n\t var username = config.auth.username || '';\n\t var password = config.auth.password || '';\n\t requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n\t }\n\t\n\t request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\t\n\t // Set the request timeout in MS\n\t request.timeout = config.timeout;\n\t\n\t // Listen for ready state\n\t request[loadEvent] = function handleLoad() {\n\t if (!request || (request.readyState !== 4 && !xDomain)) {\n\t return;\n\t }\n\t\n\t // The request errored out and we didn't get a response, this will be\n\t // handled by onerror instead\n\t // With one exception: request that using file: protocol, most browsers\n\t // will return status as 0 even though it's a successful request\n\t if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n\t return;\n\t }\n\t\n\t // Prepare the response\n\t var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n\t var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n\t var response = {\n\t data: responseData,\n\t // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201)\n\t status: request.status === 1223 ? 204 : request.status,\n\t statusText: request.status === 1223 ? 'No Content' : request.statusText,\n\t headers: responseHeaders,\n\t config: config,\n\t request: request\n\t };\n\t\n\t settle(resolve, reject, response);\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle low level network errors\n\t request.onerror = function handleError() {\n\t // Real errors are hidden from us by the browser\n\t // onerror should only fire if it's a network error\n\t reject(createError('Network Error', config, null, request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle timeout\n\t request.ontimeout = function handleTimeout() {\n\t reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n\t request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Add xsrf header\n\t // This is only done if running in a standard browser environment.\n\t // Specifically not if we're in a web worker, or react-native.\n\t if (utils.isStandardBrowserEnv()) {\n\t var cookies = __webpack_require__(16);\n\t\n\t // Add xsrf header\n\t var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n\t cookies.read(config.xsrfCookieName) :\n\t undefined;\n\t\n\t if (xsrfValue) {\n\t requestHeaders[config.xsrfHeaderName] = xsrfValue;\n\t }\n\t }\n\t\n\t // Add headers to the request\n\t if ('setRequestHeader' in request) {\n\t utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n\t if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n\t // Remove Content-Type if data is undefined\n\t delete requestHeaders[key];\n\t } else {\n\t // Otherwise add header to the request\n\t request.setRequestHeader(key, val);\n\t }\n\t });\n\t }\n\t\n\t // Add withCredentials to request if needed\n\t if (config.withCredentials) {\n\t request.withCredentials = true;\n\t }\n\t\n\t // Add responseType to request if needed\n\t if (config.responseType) {\n\t try {\n\t request.responseType = config.responseType;\n\t } catch (e) {\n\t // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n\t // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n\t if (config.responseType !== 'json') {\n\t throw e;\n\t }\n\t }\n\t }\n\t\n\t // Handle progress if needed\n\t if (typeof config.onDownloadProgress === 'function') {\n\t request.addEventListener('progress', config.onDownloadProgress);\n\t }\n\t\n\t // Not all browsers support upload events\n\t if (typeof config.onUploadProgress === 'function' && request.upload) {\n\t request.upload.addEventListener('progress', config.onUploadProgress);\n\t }\n\t\n\t if (config.cancelToken) {\n\t // Handle cancellation\n\t config.cancelToken.promise.then(function onCanceled(cancel) {\n\t if (!request) {\n\t return;\n\t }\n\t\n\t request.abort();\n\t reject(cancel);\n\t // Clean up request\n\t request = null;\n\t });\n\t }\n\t\n\t if (requestData === undefined) {\n\t requestData = null;\n\t }\n\t\n\t // Send the request\n\t request.send(requestData);\n\t });\n\t};\n\n\n/***/ }),\n/* 9 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar createError = __webpack_require__(10);\n\t\n\t/**\n\t * Resolve or reject a Promise based on response status.\n\t *\n\t * @param {Function} resolve A function that resolves the promise.\n\t * @param {Function} reject A function that rejects the promise.\n\t * @param {object} response The response.\n\t */\n\tmodule.exports = function settle(resolve, reject, response) {\n\t var validateStatus = response.config.validateStatus;\n\t // Note: status is not exposed by XDomainRequest\n\t if (!response.status || !validateStatus || validateStatus(response.status)) {\n\t resolve(response);\n\t } else {\n\t reject(createError(\n\t 'Request failed with status code ' + response.status,\n\t response.config,\n\t null,\n\t response.request,\n\t response\n\t ));\n\t }\n\t};\n\n\n/***/ }),\n/* 10 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar enhanceError = __webpack_require__(11);\n\t\n\t/**\n\t * Create an Error with the specified message, config, error code, request and response.\n\t *\n\t * @param {string} message The error message.\n\t * @param {Object} config The config.\n\t * @param {string} [code] The error code (for example, 'ECONNABORTED').\n\t * @param {Object} [request] The request.\n\t * @param {Object} [response] The response.\n\t * @returns {Error} The created error.\n\t */\n\tmodule.exports = function createError(message, config, code, request, response) {\n\t var error = new Error(message);\n\t return enhanceError(error, config, code, request, response);\n\t};\n\n\n/***/ }),\n/* 11 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Update an Error with the specified config, error code, and response.\n\t *\n\t * @param {Error} error The error to update.\n\t * @param {Object} config The config.\n\t * @param {string} [code] The error code (for example, 'ECONNABORTED').\n\t * @param {Object} [request] The request.\n\t * @param {Object} [response] The response.\n\t * @returns {Error} The error.\n\t */\n\tmodule.exports = function enhanceError(error, config, code, request, response) {\n\t error.config = config;\n\t if (code) {\n\t error.code = code;\n\t }\n\t error.request = request;\n\t error.response = response;\n\t return error;\n\t};\n\n\n/***/ }),\n/* 12 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tfunction encode(val) {\n\t return encodeURIComponent(val).\n\t replace(/%40/gi, '@').\n\t replace(/%3A/gi, ':').\n\t replace(/%24/g, '$').\n\t replace(/%2C/gi, ',').\n\t replace(/%20/g, '+').\n\t replace(/%5B/gi, '[').\n\t replace(/%5D/gi, ']');\n\t}\n\t\n\t/**\n\t * Build a URL by appending params to the end\n\t *\n\t * @param {string} url The base of the url (e.g., http://www.google.com)\n\t * @param {object} [params] The params to be appended\n\t * @returns {string} The formatted url\n\t */\n\tmodule.exports = function buildURL(url, params, paramsSerializer) {\n\t /*eslint no-param-reassign:0*/\n\t if (!params) {\n\t return url;\n\t }\n\t\n\t var serializedParams;\n\t if (paramsSerializer) {\n\t serializedParams = paramsSerializer(params);\n\t } else if (utils.isURLSearchParams(params)) {\n\t serializedParams = params.toString();\n\t } else {\n\t var parts = [];\n\t\n\t utils.forEach(params, function serialize(val, key) {\n\t if (val === null || typeof val === 'undefined') {\n\t return;\n\t }\n\t\n\t if (utils.isArray(val)) {\n\t key = key + '[]';\n\t } else {\n\t val = [val];\n\t }\n\t\n\t utils.forEach(val, function parseValue(v) {\n\t if (utils.isDate(v)) {\n\t v = v.toISOString();\n\t } else if (utils.isObject(v)) {\n\t v = JSON.stringify(v);\n\t }\n\t parts.push(encode(key) + '=' + encode(v));\n\t });\n\t });\n\t\n\t serializedParams = parts.join('&');\n\t }\n\t\n\t if (serializedParams) {\n\t url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n\t }\n\t\n\t return url;\n\t};\n\n\n/***/ }),\n/* 13 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t// Headers whose duplicates are ignored by node\n\t// c.f. https://nodejs.org/api/http.html#http_message_headers\n\tvar ignoreDuplicateOf = [\n\t 'age', 'authorization', 'content-length', 'content-type', 'etag',\n\t 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n\t 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n\t 'referer', 'retry-after', 'user-agent'\n\t];\n\t\n\t/**\n\t * Parse headers into an object\n\t *\n\t * ```\n\t * Date: Wed, 27 Aug 2014 08:58:49 GMT\n\t * Content-Type: application/json\n\t * Connection: keep-alive\n\t * Transfer-Encoding: chunked\n\t * ```\n\t *\n\t * @param {String} headers Headers needing to be parsed\n\t * @returns {Object} Headers parsed into an object\n\t */\n\tmodule.exports = function parseHeaders(headers) {\n\t var parsed = {};\n\t var key;\n\t var val;\n\t var i;\n\t\n\t if (!headers) { return parsed; }\n\t\n\t utils.forEach(headers.split('\\n'), function parser(line) {\n\t i = line.indexOf(':');\n\t key = utils.trim(line.substr(0, i)).toLowerCase();\n\t val = utils.trim(line.substr(i + 1));\n\t\n\t if (key) {\n\t if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n\t return;\n\t }\n\t if (key === 'set-cookie') {\n\t parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n\t } else {\n\t parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n\t }\n\t }\n\t });\n\t\n\t return parsed;\n\t};\n\n\n/***/ }),\n/* 14 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = (\n\t utils.isStandardBrowserEnv() ?\n\t\n\t // Standard browser envs have full support of the APIs needed to test\n\t // whether the request URL is of the same origin as current location.\n\t (function standardBrowserEnv() {\n\t var msie = /(msie|trident)/i.test(navigator.userAgent);\n\t var urlParsingNode = document.createElement('a');\n\t var originURL;\n\t\n\t /**\n\t * Parse a URL to discover it's components\n\t *\n\t * @param {String} url The URL to be parsed\n\t * @returns {Object}\n\t */\n\t function resolveURL(url) {\n\t var href = url;\n\t\n\t if (msie) {\n\t // IE needs attribute set twice to normalize properties\n\t urlParsingNode.setAttribute('href', href);\n\t href = urlParsingNode.href;\n\t }\n\t\n\t urlParsingNode.setAttribute('href', href);\n\t\n\t // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n\t return {\n\t href: urlParsingNode.href,\n\t protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n\t host: urlParsingNode.host,\n\t search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n\t hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n\t hostname: urlParsingNode.hostname,\n\t port: urlParsingNode.port,\n\t pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n\t urlParsingNode.pathname :\n\t '/' + urlParsingNode.pathname\n\t };\n\t }\n\t\n\t originURL = resolveURL(window.location.href);\n\t\n\t /**\n\t * Determine if a URL shares the same origin as the current location\n\t *\n\t * @param {String} requestURL The URL to test\n\t * @returns {boolean} True if URL shares the same origin, otherwise false\n\t */\n\t return function isURLSameOrigin(requestURL) {\n\t var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n\t return (parsed.protocol === originURL.protocol &&\n\t parsed.host === originURL.host);\n\t };\n\t })() :\n\t\n\t // Non standard browser envs (web workers, react-native) lack needed support.\n\t (function nonStandardBrowserEnv() {\n\t return function isURLSameOrigin() {\n\t return true;\n\t };\n\t })()\n\t);\n\n\n/***/ }),\n/* 15 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js\n\t\n\tvar chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';\n\t\n\tfunction E() {\n\t this.message = 'String contains an invalid character';\n\t}\n\tE.prototype = new Error;\n\tE.prototype.code = 5;\n\tE.prototype.name = 'InvalidCharacterError';\n\t\n\tfunction btoa(input) {\n\t var str = String(input);\n\t var output = '';\n\t for (\n\t // initialize result and counter\n\t var block, charCode, idx = 0, map = chars;\n\t // if the next str index does not exist:\n\t // change the mapping table to \"=\"\n\t // check if d has no fractional digits\n\t str.charAt(idx | 0) || (map = '=', idx % 1);\n\t // \"8 - idx % 1 * 8\" generates the sequence 2, 4, 6, 8\n\t output += map.charAt(63 & block >> 8 - idx % 1 * 8)\n\t ) {\n\t charCode = str.charCodeAt(idx += 3 / 4);\n\t if (charCode > 0xFF) {\n\t throw new E();\n\t }\n\t block = block << 8 | charCode;\n\t }\n\t return output;\n\t}\n\t\n\tmodule.exports = btoa;\n\n\n/***/ }),\n/* 16 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = (\n\t utils.isStandardBrowserEnv() ?\n\t\n\t // Standard browser envs support document.cookie\n\t (function standardBrowserEnv() {\n\t return {\n\t write: function write(name, value, expires, path, domain, secure) {\n\t var cookie = [];\n\t cookie.push(name + '=' + encodeURIComponent(value));\n\t\n\t if (utils.isNumber(expires)) {\n\t cookie.push('expires=' + new Date(expires).toGMTString());\n\t }\n\t\n\t if (utils.isString(path)) {\n\t cookie.push('path=' + path);\n\t }\n\t\n\t if (utils.isString(domain)) {\n\t cookie.push('domain=' + domain);\n\t }\n\t\n\t if (secure === true) {\n\t cookie.push('secure');\n\t }\n\t\n\t document.cookie = cookie.join('; ');\n\t },\n\t\n\t read: function read(name) {\n\t var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n\t return (match ? decodeURIComponent(match[3]) : null);\n\t },\n\t\n\t remove: function remove(name) {\n\t this.write(name, '', Date.now() - 86400000);\n\t }\n\t };\n\t })() :\n\t\n\t // Non standard browser env (web workers, react-native) lack needed support.\n\t (function nonStandardBrowserEnv() {\n\t return {\n\t write: function write() {},\n\t read: function read() { return null; },\n\t remove: function remove() {}\n\t };\n\t })()\n\t);\n\n\n/***/ }),\n/* 17 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tfunction InterceptorManager() {\n\t this.handlers = [];\n\t}\n\t\n\t/**\n\t * Add a new interceptor to the stack\n\t *\n\t * @param {Function} fulfilled The function to handle `then` for a `Promise`\n\t * @param {Function} rejected The function to handle `reject` for a `Promise`\n\t *\n\t * @return {Number} An ID used to remove interceptor later\n\t */\n\tInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n\t this.handlers.push({\n\t fulfilled: fulfilled,\n\t rejected: rejected\n\t });\n\t return this.handlers.length - 1;\n\t};\n\t\n\t/**\n\t * Remove an interceptor from the stack\n\t *\n\t * @param {Number} id The ID that was returned by `use`\n\t */\n\tInterceptorManager.prototype.eject = function eject(id) {\n\t if (this.handlers[id]) {\n\t this.handlers[id] = null;\n\t }\n\t};\n\t\n\t/**\n\t * Iterate over all the registered interceptors\n\t *\n\t * This method is particularly useful for skipping over any\n\t * interceptors that may have become `null` calling `eject`.\n\t *\n\t * @param {Function} fn The function to call for each interceptor\n\t */\n\tInterceptorManager.prototype.forEach = function forEach(fn) {\n\t utils.forEach(this.handlers, function forEachHandler(h) {\n\t if (h !== null) {\n\t fn(h);\n\t }\n\t });\n\t};\n\t\n\tmodule.exports = InterceptorManager;\n\n\n/***/ }),\n/* 18 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar transformData = __webpack_require__(19);\n\tvar isCancel = __webpack_require__(20);\n\tvar defaults = __webpack_require__(6);\n\tvar isAbsoluteURL = __webpack_require__(21);\n\tvar combineURLs = __webpack_require__(22);\n\t\n\t/**\n\t * Throws a `Cancel` if cancellation has been requested.\n\t */\n\tfunction throwIfCancellationRequested(config) {\n\t if (config.cancelToken) {\n\t config.cancelToken.throwIfRequested();\n\t }\n\t}\n\t\n\t/**\n\t * Dispatch a request to the server using the configured adapter.\n\t *\n\t * @param {object} config The config that is to be used for the request\n\t * @returns {Promise} The Promise to be fulfilled\n\t */\n\tmodule.exports = function dispatchRequest(config) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Support baseURL config\n\t if (config.baseURL && !isAbsoluteURL(config.url)) {\n\t config.url = combineURLs(config.baseURL, config.url);\n\t }\n\t\n\t // Ensure headers exist\n\t config.headers = config.headers || {};\n\t\n\t // Transform request data\n\t config.data = transformData(\n\t config.data,\n\t config.headers,\n\t config.transformRequest\n\t );\n\t\n\t // Flatten headers\n\t config.headers = utils.merge(\n\t config.headers.common || {},\n\t config.headers[config.method] || {},\n\t config.headers || {}\n\t );\n\t\n\t utils.forEach(\n\t ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n\t function cleanHeaderConfig(method) {\n\t delete config.headers[method];\n\t }\n\t );\n\t\n\t var adapter = config.adapter || defaults.adapter;\n\t\n\t return adapter(config).then(function onAdapterResolution(response) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Transform response data\n\t response.data = transformData(\n\t response.data,\n\t response.headers,\n\t config.transformResponse\n\t );\n\t\n\t return response;\n\t }, function onAdapterRejection(reason) {\n\t if (!isCancel(reason)) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Transform response data\n\t if (reason && reason.response) {\n\t reason.response.data = transformData(\n\t reason.response.data,\n\t reason.response.headers,\n\t config.transformResponse\n\t );\n\t }\n\t }\n\t\n\t return Promise.reject(reason);\n\t });\n\t};\n\n\n/***/ }),\n/* 19 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t/**\n\t * Transform the data for a request or a response\n\t *\n\t * @param {Object|String} data The data to be transformed\n\t * @param {Array} headers The headers for the request or response\n\t * @param {Array|Function} fns A single function or Array of functions\n\t * @returns {*} The resulting transformed data\n\t */\n\tmodule.exports = function transformData(data, headers, fns) {\n\t /*eslint no-param-reassign:0*/\n\t utils.forEach(fns, function transform(fn) {\n\t data = fn(data, headers);\n\t });\n\t\n\t return data;\n\t};\n\n\n/***/ }),\n/* 20 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\tmodule.exports = function isCancel(value) {\n\t return !!(value && value.__CANCEL__);\n\t};\n\n\n/***/ }),\n/* 21 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Determines whether the specified URL is absolute\n\t *\n\t * @param {string} url The URL to test\n\t * @returns {boolean} True if the specified URL is absolute, otherwise false\n\t */\n\tmodule.exports = function isAbsoluteURL(url) {\n\t // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n\t // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n\t // by any combination of letters, digits, plus, period, or hyphen.\n\t return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n\t};\n\n\n/***/ }),\n/* 22 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Creates a new URL by combining the specified URLs\n\t *\n\t * @param {string} baseURL The base URL\n\t * @param {string} relativeURL The relative URL\n\t * @returns {string} The combined URL\n\t */\n\tmodule.exports = function combineURLs(baseURL, relativeURL) {\n\t return relativeURL\n\t ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n\t : baseURL;\n\t};\n\n\n/***/ }),\n/* 23 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * A `Cancel` is an object that is thrown when an operation is canceled.\n\t *\n\t * @class\n\t * @param {string=} message The message.\n\t */\n\tfunction Cancel(message) {\n\t this.message = message;\n\t}\n\t\n\tCancel.prototype.toString = function toString() {\n\t return 'Cancel' + (this.message ? ': ' + this.message : '');\n\t};\n\t\n\tCancel.prototype.__CANCEL__ = true;\n\t\n\tmodule.exports = Cancel;\n\n\n/***/ }),\n/* 24 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar Cancel = __webpack_require__(23);\n\t\n\t/**\n\t * A `CancelToken` is an object that can be used to request cancellation of an operation.\n\t *\n\t * @class\n\t * @param {Function} executor The executor function.\n\t */\n\tfunction CancelToken(executor) {\n\t if (typeof executor !== 'function') {\n\t throw new TypeError('executor must be a function.');\n\t }\n\t\n\t var resolvePromise;\n\t this.promise = new Promise(function promiseExecutor(resolve) {\n\t resolvePromise = resolve;\n\t });\n\t\n\t var token = this;\n\t executor(function cancel(message) {\n\t if (token.reason) {\n\t // Cancellation has already been requested\n\t return;\n\t }\n\t\n\t token.reason = new Cancel(message);\n\t resolvePromise(token.reason);\n\t });\n\t}\n\t\n\t/**\n\t * Throws a `Cancel` if cancellation has been requested.\n\t */\n\tCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n\t if (this.reason) {\n\t throw this.reason;\n\t }\n\t};\n\t\n\t/**\n\t * Returns an object that contains a new `CancelToken` and a function that, when called,\n\t * cancels the `CancelToken`.\n\t */\n\tCancelToken.source = function source() {\n\t var cancel;\n\t var token = new CancelToken(function executor(c) {\n\t cancel = c;\n\t });\n\t return {\n\t token: token,\n\t cancel: cancel\n\t };\n\t};\n\t\n\tmodule.exports = CancelToken;\n\n\n/***/ }),\n/* 25 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Syntactic sugar for invoking a function and expanding an array for arguments.\n\t *\n\t * Common use case would be to use `Function.prototype.apply`.\n\t *\n\t * ```js\n\t * function f(x, y, z) {}\n\t * var args = [1, 2, 3];\n\t * f.apply(null, args);\n\t * ```\n\t *\n\t * With `spread` this example can be re-written.\n\t *\n\t * ```js\n\t * spread(function(x, y, z) {})([1, 2, 3]);\n\t * ```\n\t *\n\t * @param {Function} callback\n\t * @returns {Function}\n\t */\n\tmodule.exports = function spread(callback) {\n\t return function wrap(arr) {\n\t return callback.apply(null, arr);\n\t };\n\t};\n\n\n/***/ })\n/******/ ])\n});\n;\n\n\n// WEBPACK FOOTER //\n// axios.min.js"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap dad8263224c86c166a30","module.exports = require('./lib/axios');\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./index.js\n// module id = 0\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Factory for creating new instances\naxios.create = function create(instanceConfig) {\n return createInstance(utils.merge(defaults, instanceConfig));\n};\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/axios.js\n// module id = 1\n// module chunks = 0","'use strict';\n\nvar bind = require('./helpers/bind');\nvar isBuffer = require('is-buffer');\n\n/*global toString:true*/\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return toString.call(val) === '[object Array]';\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return (typeof FormData !== 'undefined') && (val instanceof FormData);\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = merge(result[key], val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n extend: extend,\n trim: trim\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/utils.js\n// module id = 2\n// module chunks = 0","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/bind.js\n// module id = 3\n// module chunks = 0","/*!\n * Determine if an object is a Buffer\n *\n * @author Feross Aboukhadijeh \n * @license MIT\n */\n\n// The _isBuffer check is for Safari 5-7 support, because it's missing\n// Object.prototype.constructor. Remove this eventually\nmodule.exports = function (obj) {\n return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer)\n}\n\nfunction isBuffer (obj) {\n return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n}\n\n// For Node v0.10 support. Remove this eventually.\nfunction isSlowBuffer (obj) {\n return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0))\n}\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/is-buffer/index.js\n// module id = 4\n// module chunks = 0","'use strict';\n\nvar defaults = require('./../defaults');\nvar utils = require('./../utils');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof config === 'string') {\n config = utils.merge({\n url: arguments[0]\n }, arguments[1]);\n }\n\n config = utils.merge(defaults, {method: 'get'}, this.defaults, config);\n config.method = config.method.toLowerCase();\n\n // Hook up interceptors middleware\n var chain = [dispatchRequest, undefined];\n var promise = Promise.resolve(config);\n\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n chain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n chain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/Axios.js\n// module id = 5\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar normalizeHeaderName = require('./helpers/normalizeHeaderName');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('./adapters/xhr');\n } else if (typeof process !== 'undefined') {\n // For node use HTTP adapter\n adapter = require('./adapters/http');\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/defaults.js\n// module id = 6\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/normalizeHeaderName.js\n// module id = 7\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar buildURL = require('./../helpers/buildURL');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\nvar btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || require('./../helpers/btoa');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n var loadEvent = 'onreadystatechange';\n var xDomain = false;\n\n // For IE 8/9 CORS support\n // Only supports POST and GET calls and doesn't returns the response headers.\n // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest.\n if (process.env.NODE_ENV !== 'test' &&\n typeof window !== 'undefined' &&\n window.XDomainRequest && !('withCredentials' in request) &&\n !isURLSameOrigin(config.url)) {\n request = new window.XDomainRequest();\n loadEvent = 'onload';\n xDomain = true;\n request.onprogress = function handleProgress() {};\n request.ontimeout = function handleTimeout() {};\n }\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password || '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n // Listen for ready state\n request[loadEvent] = function handleLoad() {\n if (!request || (request.readyState !== 4 && !xDomain)) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n var response = {\n data: responseData,\n // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201)\n status: request.status === 1223 ? 204 : request.status,\n statusText: request.status === 1223 ? 'No Content' : request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(resolve, reject, response);\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n var cookies = require('./../helpers/cookies');\n\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (config.withCredentials) {\n request.withCredentials = true;\n }\n\n // Add responseType to request if needed\n if (config.responseType) {\n try {\n request.responseType = config.responseType;\n } catch (e) {\n // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n if (config.responseType !== 'json') {\n throw e;\n }\n }\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken) {\n // Handle cancellation\n config.cancelToken.promise.then(function onCanceled(cancel) {\n if (!request) {\n return;\n }\n\n request.abort();\n reject(cancel);\n // Clean up request\n request = null;\n });\n }\n\n if (requestData === undefined) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/adapters/xhr.js\n// module id = 8\n// module chunks = 0","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n // Note: status is not exposed by XDomainRequest\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/settle.js\n// module id = 9\n// module chunks = 0","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/createError.js\n// module id = 10\n// module chunks = 0","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n error.request = request;\n error.response = response;\n return error;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/enhanceError.js\n// module id = 11\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/buildURL.js\n// module id = 12\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/parseHeaders.js\n// module id = 13\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isURLSameOrigin.js\n// module id = 14\n// module chunks = 0","'use strict';\n\n// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js\n\nvar chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';\n\nfunction E() {\n this.message = 'String contains an invalid character';\n}\nE.prototype = new Error;\nE.prototype.code = 5;\nE.prototype.name = 'InvalidCharacterError';\n\nfunction btoa(input) {\n var str = String(input);\n var output = '';\n for (\n // initialize result and counter\n var block, charCode, idx = 0, map = chars;\n // if the next str index does not exist:\n // change the mapping table to \"=\"\n // check if d has no fractional digits\n str.charAt(idx | 0) || (map = '=', idx % 1);\n // \"8 - idx % 1 * 8\" generates the sequence 2, 4, 6, 8\n output += map.charAt(63 & block >> 8 - idx % 1 * 8)\n ) {\n charCode = str.charCodeAt(idx += 3 / 4);\n if (charCode > 0xFF) {\n throw new E();\n }\n block = block << 8 | charCode;\n }\n return output;\n}\n\nmodule.exports = btoa;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/btoa.js\n// module id = 15\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/cookies.js\n// module id = 16\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/InterceptorManager.js\n// module id = 17\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar isAbsoluteURL = require('./../helpers/isAbsoluteURL');\nvar combineURLs = require('./../helpers/combineURLs');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Support baseURL config\n if (config.baseURL && !isAbsoluteURL(config.url)) {\n config.url = combineURLs(config.baseURL, config.url);\n }\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData(\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers || {}\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData(\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData(\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/dispatchRequest.js\n// module id = 18\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn(data, headers);\n });\n\n return data;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/transformData.js\n// module id = 19\n// module chunks = 0","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/isCancel.js\n// module id = 20\n// module chunks = 0","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isAbsoluteURL.js\n// module id = 21\n// module chunks = 0","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/combineURLs.js\n// module id = 22\n// module chunks = 0","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/Cancel.js\n// module id = 23\n// module chunks = 0","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/CancelToken.js\n// module id = 24\n// module chunks = 0","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/spread.js\n// module id = 25\n// module chunks = 0"],"sourceRoot":""} \ No newline at end of file diff --git a/node_modules/axios/index.d.ts b/node_modules/axios/index.d.ts new file mode 100644 index 00000000..403fd1af --- /dev/null +++ b/node_modules/axios/index.d.ts @@ -0,0 +1,131 @@ +export interface AxiosTransformer { + (data: any, headers?: any): any; +} + +export interface AxiosAdapter { + (config: AxiosRequestConfig): AxiosPromise; +} + +export interface AxiosBasicCredentials { + username: string; + password: string; +} + +export interface AxiosProxyConfig { + host: string; + port: number; + auth?: { + username: string; + password:string; + } +} + +export interface AxiosRequestConfig { + url?: string; + method?: string; + baseURL?: string; + transformRequest?: AxiosTransformer | AxiosTransformer[]; + transformResponse?: AxiosTransformer | AxiosTransformer[]; + headers?: any; + params?: any; + paramsSerializer?: (params: any) => string; + data?: any; + timeout?: number; + withCredentials?: boolean; + adapter?: AxiosAdapter; + auth?: AxiosBasicCredentials; + responseType?: string; + xsrfCookieName?: string; + xsrfHeaderName?: string; + onUploadProgress?: (progressEvent: any) => void; + onDownloadProgress?: (progressEvent: any) => void; + maxContentLength?: number; + validateStatus?: (status: number) => boolean; + maxRedirects?: number; + httpAgent?: any; + httpsAgent?: any; + proxy?: AxiosProxyConfig | false; + cancelToken?: CancelToken; +} + +export interface AxiosResponse { + data: T; + status: number; + statusText: string; + headers: any; + config: AxiosRequestConfig; + request?: any; +} + +export interface AxiosError extends Error { + config: AxiosRequestConfig; + code?: string; + request?: any; + response?: AxiosResponse; +} + +export interface AxiosPromise extends Promise> { +} + +export interface CancelStatic { + new (message?: string): Cancel; +} + +export interface Cancel { + message: string; +} + +export interface Canceler { + (message?: string): void; +} + +export interface CancelTokenStatic { + new (executor: (cancel: Canceler) => void): CancelToken; + source(): CancelTokenSource; +} + +export interface CancelToken { + promise: Promise; + reason?: Cancel; + throwIfRequested(): void; +} + +export interface CancelTokenSource { + token: CancelToken; + cancel: Canceler; +} + +export interface AxiosInterceptorManager { + use(onFulfilled?: (value: V) => V | Promise, onRejected?: (error: any) => any): number; + eject(id: number): void; +} + +export interface AxiosInstance { + (config: AxiosRequestConfig): AxiosPromise; + (url: string, config?: AxiosRequestConfig): AxiosPromise; + defaults: AxiosRequestConfig; + interceptors: { + request: AxiosInterceptorManager; + response: AxiosInterceptorManager; + }; + request(config: AxiosRequestConfig): AxiosPromise; + get(url: string, config?: AxiosRequestConfig): AxiosPromise; + delete(url: string, config?: AxiosRequestConfig): AxiosPromise; + head(url: string, config?: AxiosRequestConfig): AxiosPromise; + post(url: string, data?: any, config?: AxiosRequestConfig): AxiosPromise; + put(url: string, data?: any, config?: AxiosRequestConfig): AxiosPromise; + patch(url: string, data?: any, config?: AxiosRequestConfig): AxiosPromise; +} + +export interface AxiosStatic extends AxiosInstance { + create(config?: AxiosRequestConfig): AxiosInstance; + Cancel: CancelStatic; + CancelToken: CancelTokenStatic; + isCancel(value: any): boolean; + all(values: (T | Promise)[]): Promise; + spread(callback: (...args: T[]) => R): (array: T[]) => R; +} + +declare const Axios: AxiosStatic; + +export default Axios; diff --git a/node_modules/axios/index.js b/node_modules/axios/index.js new file mode 100644 index 00000000..79dfd09d --- /dev/null +++ b/node_modules/axios/index.js @@ -0,0 +1 @@ +module.exports = require('./lib/axios'); \ No newline at end of file diff --git a/node_modules/axios/lib/adapters/README.md b/node_modules/axios/lib/adapters/README.md new file mode 100644 index 00000000..68f11189 --- /dev/null +++ b/node_modules/axios/lib/adapters/README.md @@ -0,0 +1,37 @@ +# axios // adapters + +The modules under `adapters/` are modules that handle dispatching a request and settling a returned `Promise` once a response is received. + +## Example + +```js +var settle = require('./../core/settle'); + +module.exports = function myAdapter(config) { + // At this point: + // - config has been merged with defaults + // - request transformers have already run + // - request interceptors have already run + + // Make the request using config provided + // Upon response settle the Promise + + return new Promise(function(resolve, reject) { + + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // From here: + // - response transformers will run + // - response interceptors will run + }); +} +``` diff --git a/node_modules/axios/lib/adapters/http.js b/node_modules/axios/lib/adapters/http.js new file mode 100755 index 00000000..b986487c --- /dev/null +++ b/node_modules/axios/lib/adapters/http.js @@ -0,0 +1,237 @@ +'use strict'; + +var utils = require('./../utils'); +var settle = require('./../core/settle'); +var buildURL = require('./../helpers/buildURL'); +var http = require('http'); +var https = require('https'); +var httpFollow = require('follow-redirects').http; +var httpsFollow = require('follow-redirects').https; +var url = require('url'); +var zlib = require('zlib'); +var pkg = require('./../../package.json'); +var createError = require('../core/createError'); +var enhanceError = require('../core/enhanceError'); + +/*eslint consistent-return:0*/ +module.exports = function httpAdapter(config) { + return new Promise(function dispatchHttpRequest(resolve, reject) { + var data = config.data; + var headers = config.headers; + var timer; + + // Set User-Agent (required by some servers) + // Only set header if it hasn't been set in config + // See https://github.com/axios/axios/issues/69 + if (!headers['User-Agent'] && !headers['user-agent']) { + headers['User-Agent'] = 'axios/' + pkg.version; + } + + if (data && !utils.isStream(data)) { + if (Buffer.isBuffer(data)) { + // Nothing to do... + } else if (utils.isArrayBuffer(data)) { + data = new Buffer(new Uint8Array(data)); + } else if (utils.isString(data)) { + data = new Buffer(data, 'utf-8'); + } else { + return reject(createError( + 'Data after transformation must be a string, an ArrayBuffer, a Buffer, or a Stream', + config + )); + } + + // Add Content-Length header if data exists + headers['Content-Length'] = data.length; + } + + // HTTP basic authentication + var auth = undefined; + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + auth = username + ':' + password; + } + + // Parse url + var parsed = url.parse(config.url); + var protocol = parsed.protocol || 'http:'; + + if (!auth && parsed.auth) { + var urlAuth = parsed.auth.split(':'); + var urlUsername = urlAuth[0] || ''; + var urlPassword = urlAuth[1] || ''; + auth = urlUsername + ':' + urlPassword; + } + + if (auth) { + delete headers.Authorization; + } + + var isHttps = protocol === 'https:'; + var agent = isHttps ? config.httpsAgent : config.httpAgent; + + var options = { + path: buildURL(parsed.path, config.params, config.paramsSerializer).replace(/^\?/, ''), + method: config.method, + headers: headers, + agent: agent, + auth: auth + }; + + if (config.socketPath) { + options.socketPath = config.socketPath; + } else { + options.hostname = parsed.hostname; + options.port = parsed.port; + } + + var proxy = config.proxy; + if (!proxy && proxy !== false) { + var proxyEnv = protocol.slice(0, -1) + '_proxy'; + var proxyUrl = process.env[proxyEnv] || process.env[proxyEnv.toUpperCase()]; + if (proxyUrl) { + var parsedProxyUrl = url.parse(proxyUrl); + proxy = { + host: parsedProxyUrl.hostname, + port: parsedProxyUrl.port + }; + + if (parsedProxyUrl.auth) { + var proxyUrlAuth = parsedProxyUrl.auth.split(':'); + proxy.auth = { + username: proxyUrlAuth[0], + password: proxyUrlAuth[1] + }; + } + } + } + + if (proxy) { + options.hostname = proxy.host; + options.host = proxy.host; + options.headers.host = parsed.hostname + (parsed.port ? ':' + parsed.port : ''); + options.port = proxy.port; + options.path = protocol + '//' + parsed.hostname + (parsed.port ? ':' + parsed.port : '') + options.path; + + // Basic proxy authorization + if (proxy.auth) { + var base64 = new Buffer(proxy.auth.username + ':' + proxy.auth.password, 'utf8').toString('base64'); + options.headers['Proxy-Authorization'] = 'Basic ' + base64; + } + } + + var transport; + if (config.transport) { + transport = config.transport; + } else if (config.maxRedirects === 0) { + transport = isHttps ? https : http; + } else { + if (config.maxRedirects) { + options.maxRedirects = config.maxRedirects; + } + transport = isHttps ? httpsFollow : httpFollow; + } + + if (config.maxContentLength && config.maxContentLength > -1) { + options.maxBodyLength = config.maxContentLength; + } + + // Create the request + var req = transport.request(options, function handleResponse(res) { + if (req.aborted) return; + + // Response has been received so kill timer that handles request timeout + clearTimeout(timer); + timer = null; + + // uncompress the response body transparently if required + var stream = res; + switch (res.headers['content-encoding']) { + /*eslint default-case:0*/ + case 'gzip': + case 'compress': + case 'deflate': + // add the unzipper to the body stream processing pipeline + stream = stream.pipe(zlib.createUnzip()); + + // remove the content-encoding in order to not confuse downstream operations + delete res.headers['content-encoding']; + break; + } + + // return the last request in case of redirects + var lastRequest = res.req || req; + + var response = { + status: res.statusCode, + statusText: res.statusMessage, + headers: res.headers, + config: config, + request: lastRequest + }; + + if (config.responseType === 'stream') { + response.data = stream; + settle(resolve, reject, response); + } else { + var responseBuffer = []; + stream.on('data', function handleStreamData(chunk) { + responseBuffer.push(chunk); + + // make sure the content length is not over the maxContentLength if specified + if (config.maxContentLength > -1 && Buffer.concat(responseBuffer).length > config.maxContentLength) { + reject(createError('maxContentLength size of ' + config.maxContentLength + ' exceeded', + config, null, lastRequest)); + } + }); + + stream.on('error', function handleStreamError(err) { + if (req.aborted) return; + reject(enhanceError(err, config, null, lastRequest)); + }); + + stream.on('end', function handleStreamEnd() { + var responseData = Buffer.concat(responseBuffer); + if (config.responseType !== 'arraybuffer') { + responseData = responseData.toString('utf8'); + } + + response.data = responseData; + settle(resolve, reject, response); + }); + } + }); + + // Handle errors + req.on('error', function handleRequestError(err) { + if (req.aborted) return; + reject(enhanceError(err, config, null, req)); + }); + + // Handle request timeout + if (config.timeout && !timer) { + timer = setTimeout(function handleRequestTimeout() { + req.abort(); + reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', req)); + }, config.timeout); + } + + if (config.cancelToken) { + // Handle cancellation + config.cancelToken.promise.then(function onCanceled(cancel) { + if (req.aborted) return; + + req.abort(); + reject(cancel); + }); + } + + // Send the request + if (utils.isStream(data)) { + data.pipe(req); + } else { + req.end(data); + } + }); +}; diff --git a/node_modules/axios/lib/adapters/xhr.js b/node_modules/axios/lib/adapters/xhr.js new file mode 100644 index 00000000..81364bd5 --- /dev/null +++ b/node_modules/axios/lib/adapters/xhr.js @@ -0,0 +1,180 @@ +'use strict'; + +var utils = require('./../utils'); +var settle = require('./../core/settle'); +var buildURL = require('./../helpers/buildURL'); +var parseHeaders = require('./../helpers/parseHeaders'); +var isURLSameOrigin = require('./../helpers/isURLSameOrigin'); +var createError = require('../core/createError'); +var btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || require('./../helpers/btoa'); + +module.exports = function xhrAdapter(config) { + return new Promise(function dispatchXhrRequest(resolve, reject) { + var requestData = config.data; + var requestHeaders = config.headers; + + if (utils.isFormData(requestData)) { + delete requestHeaders['Content-Type']; // Let the browser set it + } + + var request = new XMLHttpRequest(); + var loadEvent = 'onreadystatechange'; + var xDomain = false; + + // For IE 8/9 CORS support + // Only supports POST and GET calls and doesn't returns the response headers. + // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest. + if (process.env.NODE_ENV !== 'test' && + typeof window !== 'undefined' && + window.XDomainRequest && !('withCredentials' in request) && + !isURLSameOrigin(config.url)) { + request = new window.XDomainRequest(); + loadEvent = 'onload'; + xDomain = true; + request.onprogress = function handleProgress() {}; + request.ontimeout = function handleTimeout() {}; + } + + // HTTP basic authentication + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); + } + + request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true); + + // Set the request timeout in MS + request.timeout = config.timeout; + + // Listen for ready state + request[loadEvent] = function handleLoad() { + if (!request || (request.readyState !== 4 && !xDomain)) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + + // Prepare the response + var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; + var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response; + var response = { + data: responseData, + // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201) + status: request.status === 1223 ? 204 : request.status, + statusText: request.status === 1223 ? 'No Content' : request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // Clean up request + request = null; + }; + + // Handle low level network errors + request.onerror = function handleError() { + // Real errors are hidden from us by the browser + // onerror should only fire if it's a network error + reject(createError('Network Error', config, null, request)); + + // Clean up request + request = null; + }; + + // Handle timeout + request.ontimeout = function handleTimeout() { + reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', + request)); + + // Clean up request + request = null; + }; + + // Add xsrf header + // This is only done if running in a standard browser environment. + // Specifically not if we're in a web worker, or react-native. + if (utils.isStandardBrowserEnv()) { + var cookies = require('./../helpers/cookies'); + + // Add xsrf header + var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ? + cookies.read(config.xsrfCookieName) : + undefined; + + if (xsrfValue) { + requestHeaders[config.xsrfHeaderName] = xsrfValue; + } + } + + // Add headers to the request + if ('setRequestHeader' in request) { + utils.forEach(requestHeaders, function setRequestHeader(val, key) { + if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { + // Remove Content-Type if data is undefined + delete requestHeaders[key]; + } else { + // Otherwise add header to the request + request.setRequestHeader(key, val); + } + }); + } + + // Add withCredentials to request if needed + if (config.withCredentials) { + request.withCredentials = true; + } + + // Add responseType to request if needed + if (config.responseType) { + try { + request.responseType = config.responseType; + } catch (e) { + // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2. + // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function. + if (config.responseType !== 'json') { + throw e; + } + } + } + + // Handle progress if needed + if (typeof config.onDownloadProgress === 'function') { + request.addEventListener('progress', config.onDownloadProgress); + } + + // Not all browsers support upload events + if (typeof config.onUploadProgress === 'function' && request.upload) { + request.upload.addEventListener('progress', config.onUploadProgress); + } + + if (config.cancelToken) { + // Handle cancellation + config.cancelToken.promise.then(function onCanceled(cancel) { + if (!request) { + return; + } + + request.abort(); + reject(cancel); + // Clean up request + request = null; + }); + } + + if (requestData === undefined) { + requestData = null; + } + + // Send the request + request.send(requestData); + }); +}; diff --git a/node_modules/axios/lib/axios.js b/node_modules/axios/lib/axios.js new file mode 100644 index 00000000..ed1f5194 --- /dev/null +++ b/node_modules/axios/lib/axios.js @@ -0,0 +1,52 @@ +'use strict'; + +var utils = require('./utils'); +var bind = require('./helpers/bind'); +var Axios = require('./core/Axios'); +var defaults = require('./defaults'); + +/** + * Create an instance of Axios + * + * @param {Object} defaultConfig The default config for the instance + * @return {Axios} A new instance of Axios + */ +function createInstance(defaultConfig) { + var context = new Axios(defaultConfig); + var instance = bind(Axios.prototype.request, context); + + // Copy axios.prototype to instance + utils.extend(instance, Axios.prototype, context); + + // Copy context to instance + utils.extend(instance, context); + + return instance; +} + +// Create the default instance to be exported +var axios = createInstance(defaults); + +// Expose Axios class to allow class inheritance +axios.Axios = Axios; + +// Factory for creating new instances +axios.create = function create(instanceConfig) { + return createInstance(utils.merge(defaults, instanceConfig)); +}; + +// Expose Cancel & CancelToken +axios.Cancel = require('./cancel/Cancel'); +axios.CancelToken = require('./cancel/CancelToken'); +axios.isCancel = require('./cancel/isCancel'); + +// Expose all/spread +axios.all = function all(promises) { + return Promise.all(promises); +}; +axios.spread = require('./helpers/spread'); + +module.exports = axios; + +// Allow use of default import syntax in TypeScript +module.exports.default = axios; diff --git a/node_modules/axios/lib/cancel/Cancel.js b/node_modules/axios/lib/cancel/Cancel.js new file mode 100644 index 00000000..e0de4003 --- /dev/null +++ b/node_modules/axios/lib/cancel/Cancel.js @@ -0,0 +1,19 @@ +'use strict'; + +/** + * A `Cancel` is an object that is thrown when an operation is canceled. + * + * @class + * @param {string=} message The message. + */ +function Cancel(message) { + this.message = message; +} + +Cancel.prototype.toString = function toString() { + return 'Cancel' + (this.message ? ': ' + this.message : ''); +}; + +Cancel.prototype.__CANCEL__ = true; + +module.exports = Cancel; diff --git a/node_modules/axios/lib/cancel/CancelToken.js b/node_modules/axios/lib/cancel/CancelToken.js new file mode 100644 index 00000000..6b46e666 --- /dev/null +++ b/node_modules/axios/lib/cancel/CancelToken.js @@ -0,0 +1,57 @@ +'use strict'; + +var Cancel = require('./Cancel'); + +/** + * A `CancelToken` is an object that can be used to request cancellation of an operation. + * + * @class + * @param {Function} executor The executor function. + */ +function CancelToken(executor) { + if (typeof executor !== 'function') { + throw new TypeError('executor must be a function.'); + } + + var resolvePromise; + this.promise = new Promise(function promiseExecutor(resolve) { + resolvePromise = resolve; + }); + + var token = this; + executor(function cancel(message) { + if (token.reason) { + // Cancellation has already been requested + return; + } + + token.reason = new Cancel(message); + resolvePromise(token.reason); + }); +} + +/** + * Throws a `Cancel` if cancellation has been requested. + */ +CancelToken.prototype.throwIfRequested = function throwIfRequested() { + if (this.reason) { + throw this.reason; + } +}; + +/** + * Returns an object that contains a new `CancelToken` and a function that, when called, + * cancels the `CancelToken`. + */ +CancelToken.source = function source() { + var cancel; + var token = new CancelToken(function executor(c) { + cancel = c; + }); + return { + token: token, + cancel: cancel + }; +}; + +module.exports = CancelToken; diff --git a/node_modules/axios/lib/cancel/isCancel.js b/node_modules/axios/lib/cancel/isCancel.js new file mode 100644 index 00000000..051f3ae4 --- /dev/null +++ b/node_modules/axios/lib/cancel/isCancel.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function isCancel(value) { + return !!(value && value.__CANCEL__); +}; diff --git a/node_modules/axios/lib/core/Axios.js b/node_modules/axios/lib/core/Axios.js new file mode 100644 index 00000000..d21edbc0 --- /dev/null +++ b/node_modules/axios/lib/core/Axios.js @@ -0,0 +1,79 @@ +'use strict'; + +var defaults = require('./../defaults'); +var utils = require('./../utils'); +var InterceptorManager = require('./InterceptorManager'); +var dispatchRequest = require('./dispatchRequest'); + +/** + * Create a new instance of Axios + * + * @param {Object} instanceConfig The default config for the instance + */ +function Axios(instanceConfig) { + this.defaults = instanceConfig; + this.interceptors = { + request: new InterceptorManager(), + response: new InterceptorManager() + }; +} + +/** + * Dispatch a request + * + * @param {Object} config The config specific for this request (merged with this.defaults) + */ +Axios.prototype.request = function request(config) { + /*eslint no-param-reassign:0*/ + // Allow for axios('example/url'[, config]) a la fetch API + if (typeof config === 'string') { + config = utils.merge({ + url: arguments[0] + }, arguments[1]); + } + + config = utils.merge(defaults, {method: 'get'}, this.defaults, config); + config.method = config.method.toLowerCase(); + + // Hook up interceptors middleware + var chain = [dispatchRequest, undefined]; + var promise = Promise.resolve(config); + + this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { + chain.unshift(interceptor.fulfilled, interceptor.rejected); + }); + + this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { + chain.push(interceptor.fulfilled, interceptor.rejected); + }); + + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; +}; + +// Provide aliases for supported request methods +utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url + })); + }; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, data, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url, + data: data + })); + }; +}); + +module.exports = Axios; diff --git a/node_modules/axios/lib/core/InterceptorManager.js b/node_modules/axios/lib/core/InterceptorManager.js new file mode 100644 index 00000000..50d667bb --- /dev/null +++ b/node_modules/axios/lib/core/InterceptorManager.js @@ -0,0 +1,52 @@ +'use strict'; + +var utils = require('./../utils'); + +function InterceptorManager() { + this.handlers = []; +} + +/** + * Add a new interceptor to the stack + * + * @param {Function} fulfilled The function to handle `then` for a `Promise` + * @param {Function} rejected The function to handle `reject` for a `Promise` + * + * @return {Number} An ID used to remove interceptor later + */ +InterceptorManager.prototype.use = function use(fulfilled, rejected) { + this.handlers.push({ + fulfilled: fulfilled, + rejected: rejected + }); + return this.handlers.length - 1; +}; + +/** + * Remove an interceptor from the stack + * + * @param {Number} id The ID that was returned by `use` + */ +InterceptorManager.prototype.eject = function eject(id) { + if (this.handlers[id]) { + this.handlers[id] = null; + } +}; + +/** + * Iterate over all the registered interceptors + * + * This method is particularly useful for skipping over any + * interceptors that may have become `null` calling `eject`. + * + * @param {Function} fn The function to call for each interceptor + */ +InterceptorManager.prototype.forEach = function forEach(fn) { + utils.forEach(this.handlers, function forEachHandler(h) { + if (h !== null) { + fn(h); + } + }); +}; + +module.exports = InterceptorManager; diff --git a/node_modules/axios/lib/core/README.md b/node_modules/axios/lib/core/README.md new file mode 100644 index 00000000..253bc486 --- /dev/null +++ b/node_modules/axios/lib/core/README.md @@ -0,0 +1,7 @@ +# axios // core + +The modules found in `core/` should be modules that are specific to the domain logic of axios. These modules would most likely not make sense to be consumed outside of the axios module, as their logic is too specific. Some examples of core modules are: + +- Dispatching requests +- Managing interceptors +- Handling config diff --git a/node_modules/axios/lib/core/createError.js b/node_modules/axios/lib/core/createError.js new file mode 100644 index 00000000..933680f6 --- /dev/null +++ b/node_modules/axios/lib/core/createError.js @@ -0,0 +1,18 @@ +'use strict'; + +var enhanceError = require('./enhanceError'); + +/** + * Create an Error with the specified message, config, error code, request and response. + * + * @param {string} message The error message. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The created error. + */ +module.exports = function createError(message, config, code, request, response) { + var error = new Error(message); + return enhanceError(error, config, code, request, response); +}; diff --git a/node_modules/axios/lib/core/dispatchRequest.js b/node_modules/axios/lib/core/dispatchRequest.js new file mode 100644 index 00000000..9ea70f22 --- /dev/null +++ b/node_modules/axios/lib/core/dispatchRequest.js @@ -0,0 +1,86 @@ +'use strict'; + +var utils = require('./../utils'); +var transformData = require('./transformData'); +var isCancel = require('../cancel/isCancel'); +var defaults = require('../defaults'); +var isAbsoluteURL = require('./../helpers/isAbsoluteURL'); +var combineURLs = require('./../helpers/combineURLs'); + +/** + * Throws a `Cancel` if cancellation has been requested. + */ +function throwIfCancellationRequested(config) { + if (config.cancelToken) { + config.cancelToken.throwIfRequested(); + } +} + +/** + * Dispatch a request to the server using the configured adapter. + * + * @param {object} config The config that is to be used for the request + * @returns {Promise} The Promise to be fulfilled + */ +module.exports = function dispatchRequest(config) { + throwIfCancellationRequested(config); + + // Support baseURL config + if (config.baseURL && !isAbsoluteURL(config.url)) { + config.url = combineURLs(config.baseURL, config.url); + } + + // Ensure headers exist + config.headers = config.headers || {}; + + // Transform request data + config.data = transformData( + config.data, + config.headers, + config.transformRequest + ); + + // Flatten headers + config.headers = utils.merge( + config.headers.common || {}, + config.headers[config.method] || {}, + config.headers || {} + ); + + utils.forEach( + ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], + function cleanHeaderConfig(method) { + delete config.headers[method]; + } + ); + + var adapter = config.adapter || defaults.adapter; + + return adapter(config).then(function onAdapterResolution(response) { + throwIfCancellationRequested(config); + + // Transform response data + response.data = transformData( + response.data, + response.headers, + config.transformResponse + ); + + return response; + }, function onAdapterRejection(reason) { + if (!isCancel(reason)) { + throwIfCancellationRequested(config); + + // Transform response data + if (reason && reason.response) { + reason.response.data = transformData( + reason.response.data, + reason.response.headers, + config.transformResponse + ); + } + } + + return Promise.reject(reason); + }); +}; diff --git a/node_modules/axios/lib/core/enhanceError.js b/node_modules/axios/lib/core/enhanceError.js new file mode 100644 index 00000000..8dfd5b45 --- /dev/null +++ b/node_modules/axios/lib/core/enhanceError.js @@ -0,0 +1,21 @@ +'use strict'; + +/** + * Update an Error with the specified config, error code, and response. + * + * @param {Error} error The error to update. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The error. + */ +module.exports = function enhanceError(error, config, code, request, response) { + error.config = config; + if (code) { + error.code = code; + } + error.request = request; + error.response = response; + return error; +}; diff --git a/node_modules/axios/lib/core/settle.js b/node_modules/axios/lib/core/settle.js new file mode 100644 index 00000000..8db5e23c --- /dev/null +++ b/node_modules/axios/lib/core/settle.js @@ -0,0 +1,26 @@ +'use strict'; + +var createError = require('./createError'); + +/** + * Resolve or reject a Promise based on response status. + * + * @param {Function} resolve A function that resolves the promise. + * @param {Function} reject A function that rejects the promise. + * @param {object} response The response. + */ +module.exports = function settle(resolve, reject, response) { + var validateStatus = response.config.validateStatus; + // Note: status is not exposed by XDomainRequest + if (!response.status || !validateStatus || validateStatus(response.status)) { + resolve(response); + } else { + reject(createError( + 'Request failed with status code ' + response.status, + response.config, + null, + response.request, + response + )); + } +}; diff --git a/node_modules/axios/lib/core/transformData.js b/node_modules/axios/lib/core/transformData.js new file mode 100644 index 00000000..e0653620 --- /dev/null +++ b/node_modules/axios/lib/core/transformData.js @@ -0,0 +1,20 @@ +'use strict'; + +var utils = require('./../utils'); + +/** + * Transform the data for a request or a response + * + * @param {Object|String} data The data to be transformed + * @param {Array} headers The headers for the request or response + * @param {Array|Function} fns A single function or Array of functions + * @returns {*} The resulting transformed data + */ +module.exports = function transformData(data, headers, fns) { + /*eslint no-param-reassign:0*/ + utils.forEach(fns, function transform(fn) { + data = fn(data, headers); + }); + + return data; +}; diff --git a/node_modules/axios/lib/defaults.js b/node_modules/axios/lib/defaults.js new file mode 100644 index 00000000..65a25d51 --- /dev/null +++ b/node_modules/axios/lib/defaults.js @@ -0,0 +1,96 @@ +'use strict'; + +var utils = require('./utils'); +var normalizeHeaderName = require('./helpers/normalizeHeaderName'); + +var DEFAULT_CONTENT_TYPE = { + 'Content-Type': 'application/x-www-form-urlencoded' +}; + +function setContentTypeIfUnset(headers, value) { + if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { + headers['Content-Type'] = value; + } +} + +function getDefaultAdapter() { + var adapter; + if (typeof XMLHttpRequest !== 'undefined') { + // For browsers use XHR adapter + adapter = require('./adapters/xhr'); + } else if (typeof process !== 'undefined') { + // For node use HTTP adapter + adapter = require('./adapters/http'); + } + return adapter; +} + +var defaults = { + adapter: getDefaultAdapter(), + + transformRequest: [function transformRequest(data, headers) { + normalizeHeaderName(headers, 'Content-Type'); + if (utils.isFormData(data) || + utils.isArrayBuffer(data) || + utils.isBuffer(data) || + utils.isStream(data) || + utils.isFile(data) || + utils.isBlob(data) + ) { + return data; + } + if (utils.isArrayBufferView(data)) { + return data.buffer; + } + if (utils.isURLSearchParams(data)) { + setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); + return data.toString(); + } + if (utils.isObject(data)) { + setContentTypeIfUnset(headers, 'application/json;charset=utf-8'); + return JSON.stringify(data); + } + return data; + }], + + transformResponse: [function transformResponse(data) { + /*eslint no-param-reassign:0*/ + if (typeof data === 'string') { + try { + data = JSON.parse(data); + } catch (e) { /* Ignore */ } + } + return data; + }], + + /** + * A timeout in milliseconds to abort a request. If set to 0 (default) a + * timeout is not created. + */ + timeout: 0, + + xsrfCookieName: 'XSRF-TOKEN', + xsrfHeaderName: 'X-XSRF-TOKEN', + + maxContentLength: -1, + + validateStatus: function validateStatus(status) { + return status >= 200 && status < 300; + } +}; + +defaults.headers = { + common: { + 'Accept': 'application/json, text/plain, */*' + } +}; + +utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { + defaults.headers[method] = {}; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); +}); + +module.exports = defaults; diff --git a/node_modules/axios/lib/helpers/README.md b/node_modules/axios/lib/helpers/README.md new file mode 100644 index 00000000..4ae34193 --- /dev/null +++ b/node_modules/axios/lib/helpers/README.md @@ -0,0 +1,7 @@ +# axios // helpers + +The modules found in `helpers/` should be generic modules that are _not_ specific to the domain logic of axios. These modules could theoretically be published to npm on their own and consumed by other modules or apps. Some examples of generic modules are things like: + +- Browser polyfills +- Managing cookies +- Parsing HTTP headers diff --git a/node_modules/axios/lib/helpers/bind.js b/node_modules/axios/lib/helpers/bind.js new file mode 100644 index 00000000..6147c608 --- /dev/null +++ b/node_modules/axios/lib/helpers/bind.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function bind(fn, thisArg) { + return function wrap() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + return fn.apply(thisArg, args); + }; +}; diff --git a/node_modules/axios/lib/helpers/btoa.js b/node_modules/axios/lib/helpers/btoa.js new file mode 100644 index 00000000..2fe50142 --- /dev/null +++ b/node_modules/axios/lib/helpers/btoa.js @@ -0,0 +1,36 @@ +'use strict'; + +// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js + +var chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/='; + +function E() { + this.message = 'String contains an invalid character'; +} +E.prototype = new Error; +E.prototype.code = 5; +E.prototype.name = 'InvalidCharacterError'; + +function btoa(input) { + var str = String(input); + var output = ''; + for ( + // initialize result and counter + var block, charCode, idx = 0, map = chars; + // if the next str index does not exist: + // change the mapping table to "=" + // check if d has no fractional digits + str.charAt(idx | 0) || (map = '=', idx % 1); + // "8 - idx % 1 * 8" generates the sequence 2, 4, 6, 8 + output += map.charAt(63 & block >> 8 - idx % 1 * 8) + ) { + charCode = str.charCodeAt(idx += 3 / 4); + if (charCode > 0xFF) { + throw new E(); + } + block = block << 8 | charCode; + } + return output; +} + +module.exports = btoa; diff --git a/node_modules/axios/lib/helpers/buildURL.js b/node_modules/axios/lib/helpers/buildURL.js new file mode 100644 index 00000000..be83cd00 --- /dev/null +++ b/node_modules/axios/lib/helpers/buildURL.js @@ -0,0 +1,66 @@ +'use strict'; + +var utils = require('./../utils'); + +function encode(val) { + return encodeURIComponent(val). + replace(/%40/gi, '@'). + replace(/%3A/gi, ':'). + replace(/%24/g, '$'). + replace(/%2C/gi, ','). + replace(/%20/g, '+'). + replace(/%5B/gi, '['). + replace(/%5D/gi, ']'); +} + +/** + * Build a URL by appending params to the end + * + * @param {string} url The base of the url (e.g., http://www.google.com) + * @param {object} [params] The params to be appended + * @returns {string} The formatted url + */ +module.exports = function buildURL(url, params, paramsSerializer) { + /*eslint no-param-reassign:0*/ + if (!params) { + return url; + } + + var serializedParams; + if (paramsSerializer) { + serializedParams = paramsSerializer(params); + } else if (utils.isURLSearchParams(params)) { + serializedParams = params.toString(); + } else { + var parts = []; + + utils.forEach(params, function serialize(val, key) { + if (val === null || typeof val === 'undefined') { + return; + } + + if (utils.isArray(val)) { + key = key + '[]'; + } else { + val = [val]; + } + + utils.forEach(val, function parseValue(v) { + if (utils.isDate(v)) { + v = v.toISOString(); + } else if (utils.isObject(v)) { + v = JSON.stringify(v); + } + parts.push(encode(key) + '=' + encode(v)); + }); + }); + + serializedParams = parts.join('&'); + } + + if (serializedParams) { + url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; + } + + return url; +}; diff --git a/node_modules/axios/lib/helpers/combineURLs.js b/node_modules/axios/lib/helpers/combineURLs.js new file mode 100644 index 00000000..f1b58a58 --- /dev/null +++ b/node_modules/axios/lib/helpers/combineURLs.js @@ -0,0 +1,14 @@ +'use strict'; + +/** + * Creates a new URL by combining the specified URLs + * + * @param {string} baseURL The base URL + * @param {string} relativeURL The relative URL + * @returns {string} The combined URL + */ +module.exports = function combineURLs(baseURL, relativeURL) { + return relativeURL + ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') + : baseURL; +}; diff --git a/node_modules/axios/lib/helpers/cookies.js b/node_modules/axios/lib/helpers/cookies.js new file mode 100644 index 00000000..e45a4f91 --- /dev/null +++ b/node_modules/axios/lib/helpers/cookies.js @@ -0,0 +1,53 @@ +'use strict'; + +var utils = require('./../utils'); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs support document.cookie + (function standardBrowserEnv() { + return { + write: function write(name, value, expires, path, domain, secure) { + var cookie = []; + cookie.push(name + '=' + encodeURIComponent(value)); + + if (utils.isNumber(expires)) { + cookie.push('expires=' + new Date(expires).toGMTString()); + } + + if (utils.isString(path)) { + cookie.push('path=' + path); + } + + if (utils.isString(domain)) { + cookie.push('domain=' + domain); + } + + if (secure === true) { + cookie.push('secure'); + } + + document.cookie = cookie.join('; '); + }, + + read: function read(name) { + var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); + return (match ? decodeURIComponent(match[3]) : null); + }, + + remove: function remove(name) { + this.write(name, '', Date.now() - 86400000); + } + }; + })() : + + // Non standard browser env (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return { + write: function write() {}, + read: function read() { return null; }, + remove: function remove() {} + }; + })() +); diff --git a/node_modules/axios/lib/helpers/deprecatedMethod.js b/node_modules/axios/lib/helpers/deprecatedMethod.js new file mode 100644 index 00000000..ed40965b --- /dev/null +++ b/node_modules/axios/lib/helpers/deprecatedMethod.js @@ -0,0 +1,24 @@ +'use strict'; + +/*eslint no-console:0*/ + +/** + * Supply a warning to the developer that a method they are using + * has been deprecated. + * + * @param {string} method The name of the deprecated method + * @param {string} [instead] The alternate method to use if applicable + * @param {string} [docs] The documentation URL to get further details + */ +module.exports = function deprecatedMethod(method, instead, docs) { + try { + console.warn( + 'DEPRECATED method `' + method + '`.' + + (instead ? ' Use `' + instead + '` instead.' : '') + + ' This method will be removed in a future release.'); + + if (docs) { + console.warn('For more information about usage see ' + docs); + } + } catch (e) { /* Ignore */ } +}; diff --git a/node_modules/axios/lib/helpers/isAbsoluteURL.js b/node_modules/axios/lib/helpers/isAbsoluteURL.js new file mode 100644 index 00000000..d33e9927 --- /dev/null +++ b/node_modules/axios/lib/helpers/isAbsoluteURL.js @@ -0,0 +1,14 @@ +'use strict'; + +/** + * Determines whether the specified URL is absolute + * + * @param {string} url The URL to test + * @returns {boolean} True if the specified URL is absolute, otherwise false + */ +module.exports = function isAbsoluteURL(url) { + // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). + // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed + // by any combination of letters, digits, plus, period, or hyphen. + return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url); +}; diff --git a/node_modules/axios/lib/helpers/isURLSameOrigin.js b/node_modules/axios/lib/helpers/isURLSameOrigin.js new file mode 100644 index 00000000..e292745f --- /dev/null +++ b/node_modules/axios/lib/helpers/isURLSameOrigin.js @@ -0,0 +1,68 @@ +'use strict'; + +var utils = require('./../utils'); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs have full support of the APIs needed to test + // whether the request URL is of the same origin as current location. + (function standardBrowserEnv() { + var msie = /(msie|trident)/i.test(navigator.userAgent); + var urlParsingNode = document.createElement('a'); + var originURL; + + /** + * Parse a URL to discover it's components + * + * @param {String} url The URL to be parsed + * @returns {Object} + */ + function resolveURL(url) { + var href = url; + + if (msie) { + // IE needs attribute set twice to normalize properties + urlParsingNode.setAttribute('href', href); + href = urlParsingNode.href; + } + + urlParsingNode.setAttribute('href', href); + + // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils + return { + href: urlParsingNode.href, + protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', + host: urlParsingNode.host, + search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', + hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', + hostname: urlParsingNode.hostname, + port: urlParsingNode.port, + pathname: (urlParsingNode.pathname.charAt(0) === '/') ? + urlParsingNode.pathname : + '/' + urlParsingNode.pathname + }; + } + + originURL = resolveURL(window.location.href); + + /** + * Determine if a URL shares the same origin as the current location + * + * @param {String} requestURL The URL to test + * @returns {boolean} True if URL shares the same origin, otherwise false + */ + return function isURLSameOrigin(requestURL) { + var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; + return (parsed.protocol === originURL.protocol && + parsed.host === originURL.host); + }; + })() : + + // Non standard browser envs (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return function isURLSameOrigin() { + return true; + }; + })() +); diff --git a/node_modules/axios/lib/helpers/normalizeHeaderName.js b/node_modules/axios/lib/helpers/normalizeHeaderName.js new file mode 100644 index 00000000..738c9fe4 --- /dev/null +++ b/node_modules/axios/lib/helpers/normalizeHeaderName.js @@ -0,0 +1,12 @@ +'use strict'; + +var utils = require('../utils'); + +module.exports = function normalizeHeaderName(headers, normalizedName) { + utils.forEach(headers, function processHeader(value, name) { + if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { + headers[normalizedName] = value; + delete headers[name]; + } + }); +}; diff --git a/node_modules/axios/lib/helpers/parseHeaders.js b/node_modules/axios/lib/helpers/parseHeaders.js new file mode 100644 index 00000000..8af2cc7f --- /dev/null +++ b/node_modules/axios/lib/helpers/parseHeaders.js @@ -0,0 +1,53 @@ +'use strict'; + +var utils = require('./../utils'); + +// Headers whose duplicates are ignored by node +// c.f. https://nodejs.org/api/http.html#http_message_headers +var ignoreDuplicateOf = [ + 'age', 'authorization', 'content-length', 'content-type', 'etag', + 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', + 'last-modified', 'location', 'max-forwards', 'proxy-authorization', + 'referer', 'retry-after', 'user-agent' +]; + +/** + * Parse headers into an object + * + * ``` + * Date: Wed, 27 Aug 2014 08:58:49 GMT + * Content-Type: application/json + * Connection: keep-alive + * Transfer-Encoding: chunked + * ``` + * + * @param {String} headers Headers needing to be parsed + * @returns {Object} Headers parsed into an object + */ +module.exports = function parseHeaders(headers) { + var parsed = {}; + var key; + var val; + var i; + + if (!headers) { return parsed; } + + utils.forEach(headers.split('\n'), function parser(line) { + i = line.indexOf(':'); + key = utils.trim(line.substr(0, i)).toLowerCase(); + val = utils.trim(line.substr(i + 1)); + + if (key) { + if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { + return; + } + if (key === 'set-cookie') { + parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); + } else { + parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; + } + } + }); + + return parsed; +}; diff --git a/node_modules/axios/lib/helpers/spread.js b/node_modules/axios/lib/helpers/spread.js new file mode 100644 index 00000000..25e3cdd3 --- /dev/null +++ b/node_modules/axios/lib/helpers/spread.js @@ -0,0 +1,27 @@ +'use strict'; + +/** + * Syntactic sugar for invoking a function and expanding an array for arguments. + * + * Common use case would be to use `Function.prototype.apply`. + * + * ```js + * function f(x, y, z) {} + * var args = [1, 2, 3]; + * f.apply(null, args); + * ``` + * + * With `spread` this example can be re-written. + * + * ```js + * spread(function(x, y, z) {})([1, 2, 3]); + * ``` + * + * @param {Function} callback + * @returns {Function} + */ +module.exports = function spread(callback) { + return function wrap(arr) { + return callback.apply(null, arr); + }; +}; diff --git a/node_modules/axios/lib/utils.js b/node_modules/axios/lib/utils.js new file mode 100644 index 00000000..b3fd865b --- /dev/null +++ b/node_modules/axios/lib/utils.js @@ -0,0 +1,303 @@ +'use strict'; + +var bind = require('./helpers/bind'); +var isBuffer = require('is-buffer'); + +/*global toString:true*/ + +// utils is a library of generic helper functions non-specific to axios + +var toString = Object.prototype.toString; + +/** + * Determine if a value is an Array + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Array, otherwise false + */ +function isArray(val) { + return toString.call(val) === '[object Array]'; +} + +/** + * Determine if a value is an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an ArrayBuffer, otherwise false + */ +function isArrayBuffer(val) { + return toString.call(val) === '[object ArrayBuffer]'; +} + +/** + * Determine if a value is a FormData + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an FormData, otherwise false + */ +function isFormData(val) { + return (typeof FormData !== 'undefined') && (val instanceof FormData); +} + +/** + * Determine if a value is a view on an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false + */ +function isArrayBufferView(val) { + var result; + if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { + result = ArrayBuffer.isView(val); + } else { + result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer); + } + return result; +} + +/** + * Determine if a value is a String + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a String, otherwise false + */ +function isString(val) { + return typeof val === 'string'; +} + +/** + * Determine if a value is a Number + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Number, otherwise false + */ +function isNumber(val) { + return typeof val === 'number'; +} + +/** + * Determine if a value is undefined + * + * @param {Object} val The value to test + * @returns {boolean} True if the value is undefined, otherwise false + */ +function isUndefined(val) { + return typeof val === 'undefined'; +} + +/** + * Determine if a value is an Object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Object, otherwise false + */ +function isObject(val) { + return val !== null && typeof val === 'object'; +} + +/** + * Determine if a value is a Date + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Date, otherwise false + */ +function isDate(val) { + return toString.call(val) === '[object Date]'; +} + +/** + * Determine if a value is a File + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ +function isFile(val) { + return toString.call(val) === '[object File]'; +} + +/** + * Determine if a value is a Blob + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Blob, otherwise false + */ +function isBlob(val) { + return toString.call(val) === '[object Blob]'; +} + +/** + * Determine if a value is a Function + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Function, otherwise false + */ +function isFunction(val) { + return toString.call(val) === '[object Function]'; +} + +/** + * Determine if a value is a Stream + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Stream, otherwise false + */ +function isStream(val) { + return isObject(val) && isFunction(val.pipe); +} + +/** + * Determine if a value is a URLSearchParams object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a URLSearchParams object, otherwise false + */ +function isURLSearchParams(val) { + return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams; +} + +/** + * Trim excess whitespace off the beginning and end of a string + * + * @param {String} str The String to trim + * @returns {String} The String freed of excess whitespace + */ +function trim(str) { + return str.replace(/^\s*/, '').replace(/\s*$/, ''); +} + +/** + * Determine if we're running in a standard browser environment + * + * This allows axios to run in a web worker, and react-native. + * Both environments support XMLHttpRequest, but not fully standard globals. + * + * web workers: + * typeof window -> undefined + * typeof document -> undefined + * + * react-native: + * navigator.product -> 'ReactNative' + */ +function isStandardBrowserEnv() { + if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') { + return false; + } + return ( + typeof window !== 'undefined' && + typeof document !== 'undefined' + ); +} + +/** + * Iterate over an Array or an Object invoking a function for each item. + * + * If `obj` is an Array callback will be called passing + * the value, index, and complete array for each item. + * + * If 'obj' is an Object callback will be called passing + * the value, key, and complete object for each property. + * + * @param {Object|Array} obj The object to iterate + * @param {Function} fn The callback to invoke for each item + */ +function forEach(obj, fn) { + // Don't bother if no value provided + if (obj === null || typeof obj === 'undefined') { + return; + } + + // Force an array if not already something iterable + if (typeof obj !== 'object') { + /*eslint no-param-reassign:0*/ + obj = [obj]; + } + + if (isArray(obj)) { + // Iterate over array values + for (var i = 0, l = obj.length; i < l; i++) { + fn.call(null, obj[i], i, obj); + } + } else { + // Iterate over object keys + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) { + fn.call(null, obj[key], key, obj); + } + } + } +} + +/** + * Accepts varargs expecting each argument to be an object, then + * immutably merges the properties of each object and returns result. + * + * When multiple objects contain the same key the later object in + * the arguments list will take precedence. + * + * Example: + * + * ```js + * var result = merge({foo: 123}, {foo: 456}); + * console.log(result.foo); // outputs 456 + * ``` + * + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ +function merge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (typeof result[key] === 'object' && typeof val === 'object') { + result[key] = merge(result[key], val); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; +} + +/** + * Extends object a by mutably adding to it the properties of object b. + * + * @param {Object} a The object to be extended + * @param {Object} b The object to copy properties from + * @param {Object} thisArg The object to bind function to + * @return {Object} The resulting value of object a + */ +function extend(a, b, thisArg) { + forEach(b, function assignValue(val, key) { + if (thisArg && typeof val === 'function') { + a[key] = bind(val, thisArg); + } else { + a[key] = val; + } + }); + return a; +} + +module.exports = { + isArray: isArray, + isArrayBuffer: isArrayBuffer, + isBuffer: isBuffer, + isFormData: isFormData, + isArrayBufferView: isArrayBufferView, + isString: isString, + isNumber: isNumber, + isObject: isObject, + isUndefined: isUndefined, + isDate: isDate, + isFile: isFile, + isBlob: isBlob, + isFunction: isFunction, + isStream: isStream, + isURLSearchParams: isURLSearchParams, + isStandardBrowserEnv: isStandardBrowserEnv, + forEach: forEach, + merge: merge, + extend: extend, + trim: trim +}; diff --git a/node_modules/axios/package.json b/node_modules/axios/package.json new file mode 100644 index 00000000..40254632 --- /dev/null +++ b/node_modules/axios/package.json @@ -0,0 +1,111 @@ +{ + "_from": "axios", + "_id": "axios@0.18.0", + "_inBundle": false, + "_integrity": "sha1-MtU+SFHv3AoRmTts0AB4nXDAUQI=", + "_location": "/axios", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "axios", + "name": "axios", + "escapedName": "axios", + "rawSpec": "", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "http://registry.npmjs.org/axios/-/axios-0.18.0.tgz", + "_shasum": "32d53e4851efdc0a11993b6cd000789d70c05102", + "_spec": "axios", + "_where": "/Users/hopper/ada/unit-5-js/projects/trek", + "author": { + "name": "Matt Zabriskie" + }, + "browser": { + "./lib/adapters/http.js": "./lib/adapters/xhr.js" + }, + "bugs": { + "url": "https://github.com/axios/axios/issues" + }, + "bundleDependencies": false, + "bundlesize": [ + { + "path": "./dist/axios.min.js", + "threshold": "5kB" + } + ], + "dependencies": { + "follow-redirects": "^1.3.0", + "is-buffer": "^1.1.5" + }, + "deprecated": false, + "description": "Promise based HTTP client for the browser and node.js", + "devDependencies": { + "bundlesize": "^0.5.7", + "coveralls": "^2.11.9", + "es6-promise": "^4.0.5", + "grunt": "^1.0.1", + "grunt-banner": "^0.6.0", + "grunt-cli": "^1.2.0", + "grunt-contrib-clean": "^1.0.0", + "grunt-contrib-nodeunit": "^1.0.0", + "grunt-contrib-watch": "^1.0.0", + "grunt-eslint": "^19.0.0", + "grunt-karma": "^2.0.0", + "grunt-ts": "^6.0.0-beta.3", + "grunt-webpack": "^1.0.18", + "istanbul-instrumenter-loader": "^1.0.0", + "jasmine-core": "^2.4.1", + "karma": "^1.3.0", + "karma-chrome-launcher": "^2.0.0", + "karma-coverage": "^1.0.0", + "karma-firefox-launcher": "^1.0.0", + "karma-jasmine": "^1.0.2", + "karma-jasmine-ajax": "^0.1.13", + "karma-opera-launcher": "^1.0.0", + "karma-safari-launcher": "^1.0.0", + "karma-sauce-launcher": "^1.1.0", + "karma-sinon": "^1.0.5", + "karma-sourcemap-loader": "^0.3.7", + "karma-webpack": "^1.7.0", + "load-grunt-tasks": "^3.5.2", + "minimist": "^1.2.0", + "sinon": "^1.17.4", + "typescript": "^2.0.3", + "url-search-params": "^0.6.1", + "webpack": "^1.13.1", + "webpack-dev-server": "^1.14.1" + }, + "homepage": "https://github.com/axios/axios", + "keywords": [ + "xhr", + "http", + "ajax", + "promise", + "node" + ], + "license": "MIT", + "main": "index.js", + "name": "axios", + "repository": { + "type": "git", + "url": "git+https://github.com/axios/axios.git" + }, + "scripts": { + "build": "NODE_ENV=production grunt build", + "coveralls": "cat coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js", + "examples": "node ./examples/server.js", + "postversion": "git push && git push --tags", + "preversion": "npm test", + "start": "node ./sandbox/server.js", + "test": "grunt test && bundlesize", + "version": "npm run build && grunt version && git add -A dist && git add CHANGELOG.md bower.json package.json" + }, + "typings": "./index.d.ts", + "version": "0.18.0" +} diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml new file mode 100644 index 00000000..20a70685 --- /dev/null +++ b/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc new file mode 100644 index 00000000..146371ed --- /dev/null +++ b/node_modules/debug/.eslintrc @@ -0,0 +1,14 @@ +{ + "env": { + "browser": true, + "node": true + }, + "globals": { + "chrome": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore new file mode 100644 index 00000000..5f60eecc --- /dev/null +++ b/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml new file mode 100644 index 00000000..a7643003 --- /dev/null +++ b/node_modules/debug/.travis.yml @@ -0,0 +1,20 @@ +sudo: false + +language: node_js + +node_js: + - "4" + - "6" + - "8" + +install: + - make install + +script: + - make lint + - make test + +matrix: + include: + - node_js: '8' + env: BROWSER=1 diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md new file mode 100644 index 00000000..820d21e3 --- /dev/null +++ b/node_modules/debug/CHANGELOG.md @@ -0,0 +1,395 @@ + +3.1.0 / 2017-09-26 +================== + + * Add `DEBUG_HIDE_DATE` env var (#486) + * Remove ReDoS regexp in %o formatter (#504) + * Remove "component" from package.json + * Remove `component.json` + * Ignore package-lock.json + * Examples: fix colors printout + * Fix: browser detection + * Fix: spelling mistake (#496, @EdwardBetts) + +3.0.1 / 2017-08-24 +================== + + * Fix: Disable colors in Edge and Internet Explorer (#489) + +3.0.0 / 2017-08-08 +================== + + * Breaking: Remove DEBUG_FD (#406) + * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418) + * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408) + * Addition: document `enabled` flag (#465) + * Addition: add 256 colors mode (#481) + * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440) + * Update: component: update "ms" to v2.0.0 + * Update: separate the Node and Browser tests in Travis-CI + * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots + * Update: separate Node.js and web browser examples for organization + * Update: update "browserify" to v14.4.0 + * Fix: fix Readme typo (#473) + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE new file mode 100644 index 00000000..658c933d --- /dev/null +++ b/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile new file mode 100644 index 00000000..3ddd1360 --- /dev/null +++ b/node_modules/debug/Makefile @@ -0,0 +1,58 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +install: node_modules + +browser: dist/debug.js + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +dist/debug.js: src/*.js node_modules + @mkdir -p dist + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + +lint: + @eslint *.js src/*.js + +test-node: + @istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + @cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +test-browser: + @$(MAKE) browser + @karma start --single-run + +test-all: + @concurrently \ + "make test-node" \ + "make test-browser" + +test: + @if [ "x$(BROWSER)" = "x" ]; then \ + $(MAKE) test-node; \ + else \ + $(MAKE) test-browser; \ + fi + +clean: + rimraf dist coverage + +.PHONY: browser install clean lint test test-all test-node test-browser diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md new file mode 100644 index 00000000..8e754d17 --- /dev/null +++ b/node_modules/debug/README.md @@ -0,0 +1,368 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows note + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Note that PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Then, run the program to be debugged as usual. + + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js new file mode 100644 index 00000000..103a82d1 --- /dev/null +++ b/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js new file mode 100644 index 00000000..7fc36fe6 --- /dev/null +++ b/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json new file mode 100644 index 00000000..def54db4 --- /dev/null +++ b/node_modules/debug/package.json @@ -0,0 +1,82 @@ +{ + "_from": "debug@=3.1.0", + "_id": "debug@3.1.0", + "_inBundle": false, + "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "_location": "/debug", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "debug@=3.1.0", + "name": "debug", + "escapedName": "debug", + "rawSpec": "=3.1.0", + "saveSpec": null, + "fetchSpec": "=3.1.0" + }, + "_requiredBy": [ + "/follow-redirects" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "_shasum": "5bb5a0672628b64149566ba16819e61518c67261", + "_spec": "debug@=3.1.0", + "_where": "/Users/hopper/ada/unit-5-js/projects/trek/node_modules/follow-redirects", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "2.0.0" + }, + "deprecated": false, + "description": "small debugging utility", + "devDependencies": { + "browserify": "14.4.0", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "version": "3.1.0" +} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js new file mode 100644 index 00000000..f5149ff5 --- /dev/null +++ b/node_modules/debug/src/browser.js @@ -0,0 +1,195 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', + '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', + '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', + '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', + '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', + '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', + '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', + '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', + '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', + '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', + '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js new file mode 100644 index 00000000..77e6384a --- /dev/null +++ b/node_modules/debug/src/debug.js @@ -0,0 +1,225 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * Active `debug` instances. + */ +exports.instances = []; + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + var prevTime; + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + exports.instances.push(debug); + + return debug; +} + +function destroy () { + var index = exports.instances.indexOf(this); + if (index !== -1) { + exports.instances.splice(index, 1); + return true; + } else { + return false; + } +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var i; + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < exports.instances.length; i++) { + var instance = exports.instances[i]; + instance.enabled = exports.enabled(instance.namespace); + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js new file mode 100644 index 00000000..cabcbcda --- /dev/null +++ b/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js new file mode 100644 index 00000000..d666fb9c --- /dev/null +++ b/node_modules/debug/src/node.js @@ -0,0 +1,186 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [ 6, 2, 3, 4, 5, 1 ]; + +try { + var supportsColor = require('supports-color'); + if (supportsColor && supportsColor.level >= 2) { + exports.colors = [ + 20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, + 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, + 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, + 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, + 205, 206, 207, 208, 209, 214, 215, 220, 221 + ]; + } +} catch (err) { + // swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(process.stderr.fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var colorCode = '\u001b[3' + (c < 8 ? c : '8;5;' + c); + var prefix = ' ' + colorCode + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } else { + return new Date().toISOString() + ' '; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log() { + return process.stderr.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/follow-redirects/LICENSE b/node_modules/follow-redirects/LICENSE new file mode 100644 index 00000000..742cbada --- /dev/null +++ b/node_modules/follow-redirects/LICENSE @@ -0,0 +1,18 @@ +Copyright 2014–present Olivier Lalonde , James Talmage , Ruben Verborgh + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/follow-redirects/README.md b/node_modules/follow-redirects/README.md new file mode 100644 index 00000000..6d413379 --- /dev/null +++ b/node_modules/follow-redirects/README.md @@ -0,0 +1,155 @@ +## Follow Redirects + +Drop-in replacement for Nodes `http` and `https` that automatically follows redirects. + +[![npm version](https://img.shields.io/npm/v/follow-redirects.svg)](https://www.npmjs.com/package/follow-redirects) +[![Build Status](https://travis-ci.org/follow-redirects/follow-redirects.svg?branch=master)](https://travis-ci.org/follow-redirects/follow-redirects) +[![Coverage Status](https://coveralls.io/repos/follow-redirects/follow-redirects/badge.svg?branch=master)](https://coveralls.io/r/follow-redirects/follow-redirects?branch=master) +[![Dependency Status](https://david-dm.org/follow-redirects/follow-redirects.svg)](https://david-dm.org/follow-redirects/follow-redirects) +[![npm downloads](https://img.shields.io/npm/dm/follow-redirects.svg)](https://www.npmjs.com/package/follow-redirects) + +`follow-redirects` provides [request](https://nodejs.org/api/http.html#http_http_request_options_callback) and [get](https://nodejs.org/api/http.html#http_http_get_options_callback) + methods that behave identically to those found on the native [http](https://nodejs.org/api/http.html#http_http_request_options_callback) and [https](https://nodejs.org/api/https.html#https_https_request_options_callback) + modules, with the exception that they will seamlessly follow redirects. + +```javascript +var http = require('follow-redirects').http; +var https = require('follow-redirects').https; + +http.get('http://bit.ly/900913', function (response) { + response.on('data', function (chunk) { + console.log(chunk); + }); +}).on('error', function (err) { + console.error(err); +}); +``` + +You can inspect the final redirected URL through the `responseUrl` property on the `response`. +If no redirection happened, `responseUrl` is the original request URL. + +```javascript +https.request({ + host: 'bitly.com', + path: '/UHfDGO', +}, function (response) { + console.log(response.responseUrl); + // 'http://duckduckgo.com/robots.txt' +}); +``` + +## Options +### Global options +Global options are set directly on the `follow-redirects` module: + +```javascript +var followRedirects = require('follow-redirects'); +followRedirects.maxRedirects = 10; +followRedirects.maxBodyLength = 20 * 1024 * 1024; // 20 MB +``` + +The following global options are supported: + +- `maxRedirects` (default: `21`) – sets the maximum number of allowed redirects; if exceeded, an error will be emitted. + +- `maxBodyLength` (default: 10MB) – sets the maximum size of the request body; if exceeded, an error will be emitted. + + +### Per-request options +Per-request options are set by passing an `options` object: + +```javascript +var url = require('url'); +var followRedirects = require('follow-redirects'); + +var options = url.parse('http://bit.ly/900913'); +options.maxRedirects = 10; +http.request(options); +``` + +In addition to the [standard HTTP](https://nodejs.org/api/http.html#http_http_request_options_callback) and [HTTPS options](https://nodejs.org/api/https.html#https_https_request_options_callback), +the following per-request options are supported: +- `followRedirects` (default: `true`) – whether redirects should be followed. + +- `maxRedirects` (default: `21`) – sets the maximum number of allowed redirects; if exceeded, an error will be emitted. + +- `maxBodyLength` (default: 10MB) – sets the maximum size of the request body; if exceeded, an error will be emitted. + +- `agents` (default: `undefined`) – sets the `agent` option per protocol, since HTTP and HTTPS use different agents. Example value: `{ http: new http.Agent(), https: new https.Agent() }` + +- `trackRedirects` (default: `false`) – whether to store the redirected response details into the `redirects` array on the response object. + + +### Advanced usage +By default, `follow-redirects` will use the Node.js default implementations +of [`http`](https://nodejs.org/api/http.html) +and [`https`](https://nodejs.org/api/https.html). +To enable features such as caching and/or intermediate request tracking, +you might instead want to wrap `follow-redirects` around custom protocol implementations: + +```javascript +var followRedirects = require('follow-redirects').wrap({ + http: require('your-custom-http'), + https: require('your-custom-https'), +}); +``` + +Such custom protocols only need an implementation of the `request` method. + +## Browserify Usage + +Due to the way `XMLHttpRequest` works, the `browserify` versions of `http` and `https` already follow redirects. + If you are *only* targeting the browser, then this library has little value for you. If you want to write cross + platform code for node and the browser, `follow-redirects` provides a great solution for making the native node + modules behave the same as they do in browserified builds in the browser. To avoid bundling unnecessary code + you should tell browserify to swap out `follow-redirects` with the standard modules when bundling. + To make this easier, you need to change how you require the modules: + +```javascript +var http = require('follow-redirects/http'); +var https = require('follow-redirects/https'); +``` + +You can then replace `follow-redirects` in your browserify configuration like so: + +```javascript +"browser": { + "follow-redirects/http" : "http", + "follow-redirects/https" : "https" +} +``` + +The `browserify-http` module has not kept pace with node development, and no long behaves identically to the native + module when running in the browser. If you are experiencing problems, you may want to check out + [browserify-http-2](https://www.npmjs.com/package/http-browserify-2). It is more actively maintained and + attempts to address a few of the shortcomings of `browserify-http`. In that case, your browserify config should + look something like this: + +```javascript +"browser": { + "follow-redirects/http" : "browserify-http-2/http", + "follow-redirects/https" : "browserify-http-2/https" +} +``` + +## Contributing + +Pull Requests are always welcome. Please [file an issue](https://github.com/follow-redirects/follow-redirects/issues) + detailing your proposal before you invest your valuable time. Additional features and bug fixes should be accompanied + by tests. You can run the test suite locally with a simple `npm test` command. + +## Debug Logging + +`follow-redirects` uses the excellent [debug](https://www.npmjs.com/package/debug) for logging. To turn on logging + set the environment variable `DEBUG=follow-redirects` for debug output from just this module. When running the test + suite it is sometimes advantageous to set `DEBUG=*` to see output from the express server as well. + +## Authors + +- Olivier Lalonde (olalonde@gmail.com) +- James Talmage (james@talmage.io) +- [Ruben Verborgh](https://ruben.verborgh.org/) + +## License + +[https://github.com/follow-redirects/follow-redirects/blob/master/LICENSE](MIT License) diff --git a/node_modules/follow-redirects/http.js b/node_modules/follow-redirects/http.js new file mode 100644 index 00000000..695e3561 --- /dev/null +++ b/node_modules/follow-redirects/http.js @@ -0,0 +1 @@ +module.exports = require("./").http; diff --git a/node_modules/follow-redirects/https.js b/node_modules/follow-redirects/https.js new file mode 100644 index 00000000..d21c921d --- /dev/null +++ b/node_modules/follow-redirects/https.js @@ -0,0 +1 @@ +module.exports = require("./").https; diff --git a/node_modules/follow-redirects/index.js b/node_modules/follow-redirects/index.js new file mode 100644 index 00000000..4d7297a3 --- /dev/null +++ b/node_modules/follow-redirects/index.js @@ -0,0 +1,322 @@ +var url = require("url"); +var http = require("http"); +var https = require("https"); +var assert = require("assert"); +var Writable = require("stream").Writable; +var debug = require("debug")("follow-redirects"); + +// RFC7231§4.2.1: Of the request methods defined by this specification, +// the GET, HEAD, OPTIONS, and TRACE methods are defined to be safe. +var SAFE_METHODS = { GET: true, HEAD: true, OPTIONS: true, TRACE: true }; + +// Create handlers that pass events from native requests +var eventHandlers = Object.create(null); +["abort", "aborted", "error", "socket", "timeout"].forEach(function (event) { + eventHandlers[event] = function (arg) { + this._redirectable.emit(event, arg); + }; +}); + +// An HTTP(S) request that can be redirected +function RedirectableRequest(options, responseCallback) { + // Initialize the request + Writable.call(this); + options.headers = options.headers || {}; + this._options = options; + this._redirectCount = 0; + this._redirects = []; + this._requestBodyLength = 0; + this._requestBodyBuffers = []; + + // Since http.request treats host as an alias of hostname, + // but the url module interprets host as hostname plus port, + // eliminate the host property to avoid confusion. + if (options.host) { + // Use hostname if set, because it has precedence + if (!options.hostname) { + options.hostname = options.host; + } + delete options.host; + } + + // Attach a callback if passed + if (responseCallback) { + this.on("response", responseCallback); + } + + // React to responses of native requests + var self = this; + this._onNativeResponse = function (response) { + self._processResponse(response); + }; + + // Complete the URL object when necessary + if (!options.pathname && options.path) { + var searchPos = options.path.indexOf("?"); + if (searchPos < 0) { + options.pathname = options.path; + } + else { + options.pathname = options.path.substring(0, searchPos); + options.search = options.path.substring(searchPos); + } + } + + // Perform the first request + this._performRequest(); +} +RedirectableRequest.prototype = Object.create(Writable.prototype); + +// Writes buffered data to the current native request +RedirectableRequest.prototype.write = function (data, encoding, callback) { + // Validate input and shift parameters if necessary + if (!(typeof data === "string" || typeof data === "object" && ("length" in data))) { + throw new Error("data should be a string, Buffer or Uint8Array"); + } + if (typeof encoding === "function") { + callback = encoding; + encoding = null; + } + + // Ignore empty buffers, since writing them doesn't invoke the callback + // https://github.com/nodejs/node/issues/22066 + if (data.length === 0) { + if (callback) { + callback(); + } + return; + } + // Only write when we don't exceed the maximum body length + if (this._requestBodyLength + data.length <= this._options.maxBodyLength) { + this._requestBodyLength += data.length; + this._requestBodyBuffers.push({ data: data, encoding: encoding }); + this._currentRequest.write(data, encoding, callback); + } + // Error when we exceed the maximum body length + else { + this.emit("error", new Error("Request body larger than maxBodyLength limit")); + this.abort(); + } +}; + +// Ends the current native request +RedirectableRequest.prototype.end = function (data, encoding, callback) { + // Shift parameters if necessary + if (typeof data === "function") { + callback = data; + data = encoding = null; + } + else if (typeof encoding === "function") { + callback = encoding; + encoding = null; + } + + // Write data and end + var currentRequest = this._currentRequest; + this.write(data || "", encoding, function () { + currentRequest.end(null, null, callback); + }); +}; + +// Sets a header value on the current native request +RedirectableRequest.prototype.setHeader = function (name, value) { + this._options.headers[name] = value; + this._currentRequest.setHeader(name, value); +}; + +// Clears a header value on the current native request +RedirectableRequest.prototype.removeHeader = function (name) { + delete this._options.headers[name]; + this._currentRequest.removeHeader(name); +}; + +// Proxy all other public ClientRequest methods +[ + "abort", "flushHeaders", "getHeader", + "setNoDelay", "setSocketKeepAlive", "setTimeout", +].forEach(function (method) { + RedirectableRequest.prototype[method] = function (a, b) { + return this._currentRequest[method](a, b); + }; +}); + +// Proxy all public ClientRequest properties +["aborted", "connection", "socket"].forEach(function (property) { + Object.defineProperty(RedirectableRequest.prototype, property, { + get: function () { return this._currentRequest[property]; }, + }); +}); + +// Executes the next native request (initial or redirect) +RedirectableRequest.prototype._performRequest = function () { + // Load the native protocol + var protocol = this._options.protocol; + var nativeProtocol = this._options.nativeProtocols[protocol]; + if (!nativeProtocol) { + this.emit("error", new Error("Unsupported protocol " + protocol)); + return; + } + + // If specified, use the agent corresponding to the protocol + // (HTTP and HTTPS use different types of agents) + if (this._options.agents) { + var scheme = protocol.substr(0, protocol.length - 1); + this._options.agent = this._options.agents[scheme]; + } + + // Create the native request + var request = this._currentRequest = + nativeProtocol.request(this._options, this._onNativeResponse); + this._currentUrl = url.format(this._options); + + // Set up event handlers + request._redirectable = this; + for (var event in eventHandlers) { + /* istanbul ignore else */ + if (event) { + request.on(event, eventHandlers[event]); + } + } + + // End a redirected request + // (The first request must be ended explicitly with RedirectableRequest#end) + if (this._isRedirect) { + // Write the request entity and end. + var i = 0; + var buffers = this._requestBodyBuffers; + (function writeNext() { + if (i < buffers.length) { + var buffer = buffers[i++]; + request.write(buffer.data, buffer.encoding, writeNext); + } + else { + request.end(); + } + }()); + } +}; + +// Processes a response from the current native request +RedirectableRequest.prototype._processResponse = function (response) { + // Store the redirected response + if (this._options.trackRedirects) { + this._redirects.push({ + url: this._currentUrl, + headers: response.headers, + statusCode: response.statusCode, + }); + } + + // RFC7231§6.4: The 3xx (Redirection) class of status code indicates + // that further action needs to be taken by the user agent in order to + // fulfill the request. If a Location header field is provided, + // the user agent MAY automatically redirect its request to the URI + // referenced by the Location field value, + // even if the specific status code is not understood. + var location = response.headers.location; + if (location && this._options.followRedirects !== false && + response.statusCode >= 300 && response.statusCode < 400) { + // RFC7231§6.4: A client SHOULD detect and intervene + // in cyclical redirections (i.e., "infinite" redirection loops). + if (++this._redirectCount > this._options.maxRedirects) { + this.emit("error", new Error("Max redirects exceeded.")); + return; + } + + // RFC7231§6.4: Automatic redirection needs to done with + // care for methods not known to be safe […], + // since the user might not wish to redirect an unsafe request. + // RFC7231§6.4.7: The 307 (Temporary Redirect) status code indicates + // that the target resource resides temporarily under a different URI + // and the user agent MUST NOT change the request method + // if it performs an automatic redirection to that URI. + var header; + var headers = this._options.headers; + if (response.statusCode !== 307 && !(this._options.method in SAFE_METHODS)) { + this._options.method = "GET"; + // Drop a possible entity and headers related to it + this._requestBodyBuffers = []; + for (header in headers) { + if (/^content-/i.test(header)) { + delete headers[header]; + } + } + } + + // Drop the Host header, as the redirect might lead to a different host + if (!this._isRedirect) { + for (header in headers) { + if (/^host$/i.test(header)) { + delete headers[header]; + } + } + } + + // Perform the redirected request + var redirectUrl = url.resolve(this._currentUrl, location); + debug("redirecting to", redirectUrl); + Object.assign(this._options, url.parse(redirectUrl)); + this._isRedirect = true; + this._performRequest(); + + // Discard the remainder of the response to avoid waiting for data + response.destroy(); + } + else { + // The response is not a redirect; return it as-is + response.responseUrl = this._currentUrl; + response.redirects = this._redirects; + this.emit("response", response); + + // Clean up + this._requestBodyBuffers = []; + } +}; + +// Wraps the key/value object of protocols with redirect functionality +function wrap(protocols) { + // Default settings + var exports = { + maxRedirects: 21, + maxBodyLength: 10 * 1024 * 1024, + }; + + // Wrap each protocol + var nativeProtocols = {}; + Object.keys(protocols).forEach(function (scheme) { + var protocol = scheme + ":"; + var nativeProtocol = nativeProtocols[protocol] = protocols[scheme]; + var wrappedProtocol = exports[scheme] = Object.create(nativeProtocol); + + // Executes a request, following redirects + wrappedProtocol.request = function (options, callback) { + if (typeof options === "string") { + options = url.parse(options); + options.maxRedirects = exports.maxRedirects; + } + else { + options = Object.assign({ + protocol: protocol, + maxRedirects: exports.maxRedirects, + maxBodyLength: exports.maxBodyLength, + }, options); + } + options.nativeProtocols = nativeProtocols; + assert.equal(options.protocol, protocol, "protocol mismatch"); + debug("options", options); + return new RedirectableRequest(options, callback); + }; + + // Executes a GET request, following redirects + wrappedProtocol.get = function (options, callback) { + var request = wrappedProtocol.request(options, callback); + request.end(); + return request; + }; + }); + return exports; +} + +// Exports +module.exports = wrap({ http: http, https: https }); +module.exports.wrap = wrap; diff --git a/node_modules/follow-redirects/package.json b/node_modules/follow-redirects/package.json new file mode 100644 index 00000000..b13982ab --- /dev/null +++ b/node_modules/follow-redirects/package.json @@ -0,0 +1,96 @@ +{ + "_from": "follow-redirects@^1.3.0", + "_id": "follow-redirects@1.5.10", + "_inBundle": false, + "_integrity": "sha512-0V5l4Cizzvqt5D44aTXbFZz+FtyXV1vrDN6qrelxtfYQKW0KO0W2T/hkE8xvGa/540LkZlkaUjO4ailYTFtHVQ==", + "_location": "/follow-redirects", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "follow-redirects@^1.3.0", + "name": "follow-redirects", + "escapedName": "follow-redirects", + "rawSpec": "^1.3.0", + "saveSpec": null, + "fetchSpec": "^1.3.0" + }, + "_requiredBy": [ + "/axios" + ], + "_resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.5.10.tgz", + "_shasum": "7b7a9f9aea2fdff36786a94ff643ed07f4ff5e2a", + "_spec": "follow-redirects@^1.3.0", + "_where": "/Users/hopper/ada/unit-5-js/projects/trek/node_modules/axios", + "author": { + "name": "Ruben Verborgh", + "email": "ruben@verborgh.org", + "url": "https://ruben.verborgh.org/" + }, + "bugs": { + "url": "https://github.com/follow-redirects/follow-redirects/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Olivier Lalonde", + "email": "olalonde@gmail.com", + "url": "http://www.syskall.com" + }, + { + "name": "James Talmage", + "email": "james@talmage.io" + } + ], + "dependencies": { + "debug": "=3.1.0" + }, + "deprecated": false, + "description": "HTTP and HTTPS modules that follow redirects.", + "devDependencies": { + "concat-stream": "^1.6.0", + "coveralls": "^3.0.2", + "eslint": "^4.19.1", + "express": "^4.16.2", + "mocha": "^5.0.0", + "nyc": "^11.8.0" + }, + "engines": { + "node": ">=4.0" + }, + "files": [ + "index.js", + "create.js", + "http.js", + "https.js" + ], + "homepage": "https://github.com/follow-redirects/follow-redirects", + "keywords": [ + "http", + "https", + "url", + "redirect", + "client", + "location", + "utility" + ], + "license": "MIT", + "main": "index.js", + "name": "follow-redirects", + "nyc": { + "reporter": [ + "lcov", + "text" + ] + }, + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/follow-redirects/follow-redirects.git" + }, + "scripts": { + "lint": "eslint *.js test", + "mocha": "nyc mocha", + "test": "npm run lint && npm run mocha" + }, + "version": "1.5.10" +} diff --git a/node_modules/is-buffer/LICENSE b/node_modules/is-buffer/LICENSE new file mode 100644 index 00000000..0c068cee --- /dev/null +++ b/node_modules/is-buffer/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Feross Aboukhadijeh + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/is-buffer/README.md b/node_modules/is-buffer/README.md new file mode 100644 index 00000000..cce0a8cf --- /dev/null +++ b/node_modules/is-buffer/README.md @@ -0,0 +1,53 @@ +# is-buffer [![travis][travis-image]][travis-url] [![npm][npm-image]][npm-url] [![downloads][downloads-image]][downloads-url] [![javascript style guide][standard-image]][standard-url] + +[travis-image]: https://img.shields.io/travis/feross/is-buffer/master.svg +[travis-url]: https://travis-ci.org/feross/is-buffer +[npm-image]: https://img.shields.io/npm/v/is-buffer.svg +[npm-url]: https://npmjs.org/package/is-buffer +[downloads-image]: https://img.shields.io/npm/dm/is-buffer.svg +[downloads-url]: https://npmjs.org/package/is-buffer +[standard-image]: https://img.shields.io/badge/code_style-standard-brightgreen.svg +[standard-url]: https://standardjs.com + +#### Determine if an object is a [`Buffer`](http://nodejs.org/api/buffer.html) (including the [browserify Buffer](https://github.com/feross/buffer)) + +[![saucelabs][saucelabs-image]][saucelabs-url] + +[saucelabs-image]: https://saucelabs.com/browser-matrix/is-buffer.svg +[saucelabs-url]: https://saucelabs.com/u/is-buffer + +## Why not use `Buffer.isBuffer`? + +This module lets you check if an object is a `Buffer` without using `Buffer.isBuffer` (which includes the whole [buffer](https://github.com/feross/buffer) module in [browserify](http://browserify.org/)). + +It's future-proof and works in node too! + +## install + +```bash +npm install is-buffer +``` + +## usage + +```js +var isBuffer = require('is-buffer') + +isBuffer(new Buffer(4)) // true + +isBuffer(undefined) // false +isBuffer(null) // false +isBuffer('') // false +isBuffer(true) // false +isBuffer(false) // false +isBuffer(0) // false +isBuffer(1) // false +isBuffer(1.0) // false +isBuffer('string') // false +isBuffer({}) // false +isBuffer(function foo () {}) // false +``` + +## license + +MIT. Copyright (C) [Feross Aboukhadijeh](http://feross.org). diff --git a/node_modules/is-buffer/index.js b/node_modules/is-buffer/index.js new file mode 100644 index 00000000..9cce3965 --- /dev/null +++ b/node_modules/is-buffer/index.js @@ -0,0 +1,21 @@ +/*! + * Determine if an object is a Buffer + * + * @author Feross Aboukhadijeh + * @license MIT + */ + +// The _isBuffer check is for Safari 5-7 support, because it's missing +// Object.prototype.constructor. Remove this eventually +module.exports = function (obj) { + return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer) +} + +function isBuffer (obj) { + return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj) +} + +// For Node v0.10 support. Remove this eventually. +function isSlowBuffer (obj) { + return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0)) +} diff --git a/node_modules/is-buffer/package.json b/node_modules/is-buffer/package.json new file mode 100644 index 00000000..f9de8b9b --- /dev/null +++ b/node_modules/is-buffer/package.json @@ -0,0 +1,77 @@ +{ + "_from": "is-buffer@^1.1.5", + "_id": "is-buffer@1.1.6", + "_inBundle": false, + "_integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==", + "_location": "/is-buffer", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "is-buffer@^1.1.5", + "name": "is-buffer", + "escapedName": "is-buffer", + "rawSpec": "^1.1.5", + "saveSpec": null, + "fetchSpec": "^1.1.5" + }, + "_requiredBy": [ + "/axios" + ], + "_resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "_shasum": "efaa2ea9daa0d7ab2ea13a97b2b8ad51fefbe8be", + "_spec": "is-buffer@^1.1.5", + "_where": "/Users/hopper/ada/unit-5-js/projects/trek/node_modules/axios", + "author": { + "name": "Feross Aboukhadijeh", + "email": "feross@feross.org", + "url": "http://feross.org/" + }, + "bugs": { + "url": "https://github.com/feross/is-buffer/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Determine if an object is a Buffer", + "devDependencies": { + "standard": "*", + "tape": "^4.0.0", + "zuul": "^3.0.0" + }, + "homepage": "https://github.com/feross/is-buffer#readme", + "keywords": [ + "buffer", + "buffers", + "type", + "core buffer", + "browser buffer", + "browserify", + "typed array", + "uint32array", + "int16array", + "int32array", + "float32array", + "float64array", + "browser", + "arraybuffer", + "dataview" + ], + "license": "MIT", + "main": "index.js", + "name": "is-buffer", + "repository": { + "type": "git", + "url": "git://github.com/feross/is-buffer.git" + }, + "scripts": { + "test": "standard && npm run test-node && npm run test-browser", + "test-browser": "zuul -- test/*.js", + "test-browser-local": "zuul --local -- test/*.js", + "test-node": "tape test/*.js" + }, + "testling": { + "files": "test/*.js" + }, + "version": "1.1.6" +} diff --git a/node_modules/is-buffer/test/basic.js b/node_modules/is-buffer/test/basic.js new file mode 100644 index 00000000..be4f8e43 --- /dev/null +++ b/node_modules/is-buffer/test/basic.js @@ -0,0 +1,24 @@ +var isBuffer = require('../') +var test = require('tape') + +test('is-buffer', function (t) { + t.equal(isBuffer(Buffer.alloc(4)), true, 'new Buffer(4)') + t.equal(isBuffer(Buffer.allocUnsafeSlow(100)), true, 'SlowBuffer(100)') + + t.equal(isBuffer(undefined), false, 'undefined') + t.equal(isBuffer(null), false, 'null') + t.equal(isBuffer(''), false, 'empty string') + t.equal(isBuffer(true), false, 'true') + t.equal(isBuffer(false), false, 'false') + t.equal(isBuffer(0), false, '0') + t.equal(isBuffer(1), false, '1') + t.equal(isBuffer(1.0), false, '1.0') + t.equal(isBuffer('string'), false, 'string') + t.equal(isBuffer({}), false, '{}') + t.equal(isBuffer([]), false, '[]') + t.equal(isBuffer(function foo () {}), false, 'function foo () {}') + t.equal(isBuffer({ isBuffer: null }), false, '{ isBuffer: null }') + t.equal(isBuffer({ isBuffer: function () { throw new Error() } }), false, '{ isBuffer: function () { throw new Error() } }') + + t.end() +}) diff --git a/node_modules/jquery/AUTHORS.txt b/node_modules/jquery/AUTHORS.txt new file mode 100644 index 00000000..4bb5da15 --- /dev/null +++ b/node_modules/jquery/AUTHORS.txt @@ -0,0 +1,313 @@ +Authors ordered by first contribution. + +John Resig +Gilles van den Hoven +Michael Geary +Stefan Petre +Yehuda Katz +Corey Jewett +Klaus Hartl +Franck Marcia +Jörn Zaefferer +Paul Bakaus +Brandon Aaron +Mike Alsup +Dave Methvin +Ed Engelhardt +Sean Catchpole +Paul Mclanahan +David Serduke +Richard D. Worth +Scott González +Ariel Flesler +Jon Evans +TJ Holowaychuk +Michael Bensoussan +Robert Katić +Louis-Rémi Babé +Earle Castledine +Damian Janowski +Rich Dougherty +Kim Dalsgaard +Andrea Giammarchi +Mark Gibson +Karl Swedberg +Justin Meyer +Ben Alman +James Padolsey +David Petersen +Batiste Bieler +Alexander Farkas +Rick Waldron +Filipe Fortes +Neeraj Singh +Paul Irish +Iraê Carvalho +Matt Curry +Michael Monteleone +Noah Sloan +Tom Viner +Douglas Neiner +Adam J. Sontag +Dave Reed +Ralph Whitbeck +Carl Fürstenberg +Jacob Wright +J. Ryan Stinnett +unknown +temp01 +Heungsub Lee +Colin Snover +Ryan W Tenney +Pinhook +Ron Otten +Jephte Clain +Anton Matzneller +Alex Sexton +Dan Heberden +Henri Wiechers +Russell Holbrook +Julian Aubourg +Gianni Alessandro Chiappetta +Scott Jehl +James Burke +Jonas Pfenniger +Xavi Ramirez +Jared Grippe +Sylvester Keil +Brandon Sterne +Mathias Bynens +Timmy Willison <4timmywil@gmail.com> +Corey Frang +Digitalxero +Anton Kovalyov +David Murdoch +Josh Varner +Charles McNulty +Jordan Boesch +Jess Thrysoee +Michael Murray +Lee Carpenter +Alexis Abril +Rob Morgan +John Firebaugh +Sam Bisbee +Gilmore Davidson +Brian Brennan +Xavier Montillet +Daniel Pihlstrom +Sahab Yazdani +avaly +Scott Hughes +Mike Sherov +Greg Hazel +Schalk Neethling +Denis Knauf +Timo Tijhof +Steen Nielsen +Anton Ryzhov +Shi Chuan +Berker Peksag +Toby Brain +Matt Mueller +Justin +Daniel Herman +Oleg Gaidarenko +Richard Gibson +Rafaël Blais Masson +cmc3cn <59194618@qq.com> +Joe Presbrey +Sindre Sorhus +Arne de Bree +Vladislav Zarakovsky +Andrew E Monat +Oskari +Joao Henrique de Andrade Bruni +tsinha +Matt Farmer +Trey Hunner +Jason Moon +Jeffery To +Kris Borchers +Vladimir Zhuravlev +Jacob Thornton +Chad Killingsworth +Nowres Rafid +David Benjamin +Uri Gilad +Chris Faulkner +Elijah Manor +Daniel Chatfield +Nikita Govorov +Wesley Walser +Mike Pennisi +Markus Staab +Dave Riddle +Callum Macrae +Benjamin Truyman +James Huston +Erick Ruiz de Chávez +David Bonner +Akintayo Akinwunmi +MORGAN +Ismail Khair +Carl Danley +Mike Petrovich +Greg Lavallee +Daniel Gálvez +Sai Lung Wong +Tom H Fuertes +Roland Eckl +Jay Merrifield +Allen J Schmidt Jr +Jonathan Sampson +Marcel Greter +Matthias Jäggli +David Fox +Yiming He +Devin Cooper +Paul Ramos +Rod Vagg +Bennett Sorbo +Sebastian Burkhard +Zachary Adam Kaplan +nanto_vi +nanto +Danil Somsikov +Ryunosuke SATO +Jean Boussier +Adam Coulombe +Andrew Plummer +Mark Raddatz +Isaac Z. Schlueter +Karl Sieburg +Pascal Borreli +Nguyen Phuc Lam +Dmitry Gusev +Michał Gołębiowski-Owczarek +Li Xudong +Steven Benner +Tom H Fuertes +Renato Oliveira dos Santos +ros3cin +Jason Bedard +Kyle Robinson Young +Chris Talkington +Eddie Monge +Terry Jones +Jason Merino +Jeremy Dunck +Chris Price +Guy Bedford +Amey Sakhadeo +Mike Sidorov +Anthony Ryan +Dominik D. Geyer +George Kats +Lihan Li +Ronny Springer +Chris Antaki +Marian Sollmann +njhamann +Ilya Kantor +David Hong +John Paul +Jakob Stoeck +Christopher Jones +Forbes Lindesay +S. Andrew Sheppard +Leonardo Balter +Roman Reiß +Benjy Cui +Rodrigo Rosenfeld Rosas +John Hoven +Philip Jägenstedt +Christian Kosmowski +Liang Peng +TJ VanToll +Senya Pugach +Aurelio De Rosa +Nazar Mokrynskyi +Amit Merchant +Jason Bedard +Arthur Verschaeve +Dan Hart +Bin Xin +David Corbacho +Veaceslav Grimalschi +Daniel Husar +Frederic Hemberger +Ben Toews +Aditya Raghavan +Victor Homyakov +Shivaji Varma +Nicolas HENRY +Anne-Gaelle Colom +George Mauer +Leonardo Braga +Stephen Edgar +Thomas Tortorini +Winston Howes +Jon Hester +Alexander O'Mara +Bastian Buchholz +Arthur Stolyar +Calvin Metcalf +Mu Haibao +Richard McDaniel +Chris Rebert +Gabriel Schulhof +Gilad Peleg +Martin Naumann +Marek Lewandowski +Bruno Pérel +Reed Loden +Daniel Nill +Yongwoo Jeon +Sean Henderson +Richard Kraaijenhagen +Connor Atherton +Gary Ye +Christian Grete +Liza Ramo +Julian Alexander Murillo +Joelle Fleurantin +Jae Sung Park +Jun Sun +Josh Soref +Henry Wong +Jon Dufresne +Martijn W. van der Lee +Devin Wilson +Steve Mao +Zack Hall +Bernhard M. Wiedemann +Todor Prikumov +Jha Naman +William Robinet +Alexander Lisianoi +Vitaliy Terziev +Joe Trumbull +Alexander K +Damian Senn +Ralin Chimev +Felipe Sateler +Christophe Tafani-Dereeper +Manoj Kumar +David Broder-Rodgers +Alex Louden +Alex Padilla +南漂一卒 +karan-96 +Boom Lee +Andreas Solleder +CDAGaming +Pierre Spring +Shashanka Nataraj +Erik Lax +Matan Kotler-Berkowitz <205matan@gmail.com> +Jordan Beland +Henry Zhu +Saptak Sengupta +Nilton Cesar +basil.belokon diff --git a/node_modules/jquery/LICENSE.txt b/node_modules/jquery/LICENSE.txt new file mode 100644 index 00000000..e4e5e00e --- /dev/null +++ b/node_modules/jquery/LICENSE.txt @@ -0,0 +1,36 @@ +Copyright JS Foundation and other contributors, https://js.foundation/ + +This software consists of voluntary contributions made by many +individuals. For exact contribution history, see the revision history +available at https://github.com/jquery/jquery + +The following license applies to all parts of this software except as +documented below: + +==== + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +==== + +All files located in the node_modules and external directories are +externally maintained libraries used by this software which have their +own licenses; we recommend you read them, as their terms may differ from +the terms above. diff --git a/node_modules/jquery/README.md b/node_modules/jquery/README.md new file mode 100644 index 00000000..83e7b937 --- /dev/null +++ b/node_modules/jquery/README.md @@ -0,0 +1,67 @@ +# jQuery + +> jQuery is a fast, small, and feature-rich JavaScript library. + +For information on how to get started and how to use jQuery, please see [jQuery's documentation](http://api.jquery.com/). +For source files and issues, please visit the [jQuery repo](https://github.com/jquery/jquery). + +If upgrading, please see the [blog post for 3.3.1](https://blog.jquery.com/2017/03/20/jquery-3.3.1-now-available/). This includes notable differences from the previous version and a more readable changelog. + +## Including jQuery + +Below are some of the most common ways to include jQuery. + +### Browser + +#### Script tag + +```html + +``` + +#### Babel + +[Babel](http://babeljs.io/) is a next generation JavaScript compiler. One of the features is the ability to use ES6/ES2015 modules now, even though browsers do not yet support this feature natively. + +```js +import $ from "jquery"; +``` + +#### Browserify/Webpack + +There are several ways to use [Browserify](http://browserify.org/) and [Webpack](https://webpack.github.io/). For more information on using these tools, please refer to the corresponding project's documention. In the script, including jQuery will usually look like this... + +```js +var $ = require("jquery"); +``` + +#### AMD (Asynchronous Module Definition) + +AMD is a module format built for the browser. For more information, we recommend [require.js' documentation](http://requirejs.org/docs/whyamd.html). + +```js +define(["jquery"], function($) { + +}); +``` + +### Node + +To include jQuery in [Node](nodejs.org), first install with npm. + +```sh +npm install jquery +``` + +For jQuery to work in Node, a window with a document is required. Since no such window exists natively in Node, one can be mocked by tools such as [jsdom](https://github.com/tmpvar/jsdom). This can be useful for testing purposes. + +```js +require("jsdom").env("", function(err, window) { + if (err) { + console.error(err); + return; + } + + var $ = require("jquery")(window); +}); +``` diff --git a/node_modules/jquery/bower.json b/node_modules/jquery/bower.json new file mode 100644 index 00000000..95798d5a --- /dev/null +++ b/node_modules/jquery/bower.json @@ -0,0 +1,14 @@ +{ + "name": "jquery", + "main": "dist/jquery.js", + "license": "MIT", + "ignore": [ + "package.json" + ], + "keywords": [ + "jquery", + "javascript", + "browser", + "library" + ] +} \ No newline at end of file diff --git a/node_modules/jquery/dist/core.js b/node_modules/jquery/dist/core.js new file mode 100644 index 00000000..3a1c0cc7 --- /dev/null +++ b/node_modules/jquery/dist/core.js @@ -0,0 +1,399 @@ +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + +define( [ + "./var/arr", + "./var/document", + "./var/getProto", + "./var/slice", + "./var/concat", + "./var/push", + "./var/indexOf", + "./var/class2type", + "./var/toString", + "./var/hasOwn", + "./var/fnToString", + "./var/ObjectFunctionString", + "./var/support", + "./var/isFunction", + "./var/isWindow", + "./core/DOMEval", + "./core/toType" +], function( arr, document, getProto, slice, concat, push, indexOf, + class2type, toString, hasOwn, fnToString, ObjectFunctionString, + support, isFunction, isWindow, DOMEval, toType ) { + +"use strict"; + +var + version = "3.3.1", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }, + + // Support: Android <=4.0 only + // Make sure we trim BOM and NBSP + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + + if ( copyIsArray ) { + copyIsArray = false; + clone = src && Array.isArray( src ) ? src : []; + + } else { + clone = src && jQuery.isPlainObject( src ) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + + /* eslint-disable no-unused-vars */ + // See https://github.com/eslint/eslint/issues/6125 + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a global context + globalEval: function( code ) { + DOMEval( code ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // Support: Android <=4.0 only + trim: function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), +function( i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +} ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} + +return jQuery; +} ); diff --git a/node_modules/jquery/dist/jquery.js b/node_modules/jquery/dist/jquery.js new file mode 100644 index 00000000..9b5206bc --- /dev/null +++ b/node_modules/jquery/dist/jquery.js @@ -0,0 +1,10364 @@ +/*! + * jQuery JavaScript Library v3.3.1 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2018-01-20T17:24Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var document = window.document; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var concat = arr.concat; + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + return typeof obj === "function" && typeof obj.nodeType !== "number"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + + + + var preservedScriptAttributes = { + type: true, + src: true, + noModule: true + }; + + function DOMEval( code, doc, node ) { + doc = doc || document; + + var i, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + if ( node[ i ] ) { + script[ i ] = node[ i ]; + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var + version = "3.3.1", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }, + + // Support: Android <=4.0 only + // Make sure we trim BOM and NBSP + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + + if ( copyIsArray ) { + copyIsArray = false; + clone = src && Array.isArray( src ) ? src : []; + + } else { + clone = src && jQuery.isPlainObject( src ) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + + /* eslint-disable no-unused-vars */ + // See https://github.com/eslint/eslint/issues/6125 + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a global context + globalEval: function( code ) { + DOMEval( code ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // Support: Android <=4.0 only + trim: function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), +function( i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +} ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.3.3 + * https://sizzlejs.com/ + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: 2016-08-08 + */ +(function( window ) { + +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ({}).hasOwnProperty, + arr = [], + pop = arr.pop, + push_native = arr.push, + push = arr.push, + slice = arr.slice, + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[i] === elem ) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = "(?:\\\\.|[\\w-]|[^\0-\\xa0])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace + + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ), + + rattributeQuotes = new RegExp( "=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ), + funescape = function( _, escaped, escapedWhitespace ) { + var high = "0x" + escaped - 0x10000; + // NaN means non-codepoint + // Support: Firefox<24 + // Workaround erroneous numeric interpretation of +"0x" + return high !== high || escapedWhitespace ? + escaped : + high < 0 ? + // BMP codepoint + String.fromCharCode( high + 0x10000 ) : + // Supplemental Plane codepoint (surrogate pair) + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }, + + disabledAncestor = addCombinator( + function( elem ) { + return elem.disabled === true && ("form" in elem || "label" in elem); + }, + { dir: "parentNode", next: "legend" } + ); + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + (arr = slice.call( preferredDoc.childNodes )), + preferredDoc.childNodes + ); + // Support: Android<4.0 + // Detect silently failing push.apply + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + push_native.apply( target, slice.call(els) ); + } : + + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + // Can't trust NodeList.length + while ( (target[j++] = els[i++]) ) {} + target.length = j - 1; + } + }; +} + +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + + if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) { + setDocument( context ); + } + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) { + + // ID selector + if ( (m = match[1]) ) { + + // Document context + if ( nodeType === 9 ) { + if ( (elem = context.getElementById( m )) ) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && (elem = newContext.getElementById( m )) && + contains( context, elem ) && + elem.id === m ) { + + results.push( elem ); + return results; + } + } + + // Type selector + } else if ( match[2] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( (m = match[3]) && support.getElementsByClassName && + context.getElementsByClassName ) { + + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( support.qsa && + !compilerCache[ selector + " " ] && + (!rbuggyQSA || !rbuggyQSA.test( selector )) ) { + + if ( nodeType !== 1 ) { + newContext = context; + newSelector = selector; + + // qSA looks outside Element context, which is not what we want + // Thanks to Andrew Dupont for this workaround technique + // Support: IE <=8 + // Exclude object elements + } else if ( context.nodeName.toLowerCase() !== "object" ) { + + // Capture the context ID, setting it first if necessary + if ( (nid = context.getAttribute( "id" )) ) { + nid = nid.replace( rcssescape, fcssescape ); + } else { + context.setAttribute( "id", (nid = expando) ); + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[i] = "#" + nid + " " + toSelector( groups[i] ); + } + newSelector = groups.join( "," ); + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + } + + if ( newSelector ) { + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return (cache[ key + " " ] = value); + } + return cache; +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement("fieldset"); + + try { + return !!fn( el ); + } catch (e) { + return false; + } finally { + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + // release memory in IE + el = null; + } +} + +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split("|"), + i = arr.length; + + while ( i-- ) { + Expr.attrHandle[ arr[i] ] = handler; + } +} + +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( (cur = cur.nextSibling) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + disabledAncestor( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +// Expose support vars for convenience +support = Sizzle.support = {}; + +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); + + // Support: IE 9-11, Edge + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + if ( preferredDoc !== document && + (subWindow = document.defaultView) && subWindow.top !== subWindow ) { + + // Support: IE 11, Edge + if ( subWindow.addEventListener ) { + subWindow.addEventListener( "unload", unloadHandler, false ); + + // Support: IE 9 - 10 only + } else if ( subWindow.attachEvent ) { + subWindow.attachEvent( "onunload", unloadHandler ); + } + } + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert(function( el ) { + el.className = "i"; + return !el.getAttribute("className"); + }); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert(function( el ) { + el.appendChild( document.createComment("") ); + return !el.getElementsByTagName("*").length; + }); + + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert(function( el ) { + docElem.appendChild( el ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + }); + + // ID filter and find + if ( support.getById ) { + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute("id") === attrId; + }; + }; + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode("id"); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode("id"); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( (elem = elems[i++]) ) { + node = elem.getAttributeNode("id"); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find["TAG"] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : + + function( tag, context ) { + var elem, + tmp = [], + i = 0, + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( (elem = results[i++]) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ( (support.qsa = rnative.test( document.querySelectorAll )) ) { + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( el ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild( el ).innerHTML = "" + + ""; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( el.querySelectorAll("[msallowcapture^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !el.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push("~="); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !el.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push(".#.+[+~]"); + } + }); + + assert(function( el ) { + el.innerHTML = "" + + ""; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement("input"); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( el.querySelectorAll("[name=d]").length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( el.querySelectorAll(":enabled").length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild( el ).disabled = true; + if ( el.querySelectorAll(":disabled").length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll("*,:x"); + rbuggyQSA.push(",.*:"); + }); + } + + if ( (support.matchesSelector = rnative.test( (matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector) )) ) { + + assert(function( el ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( el, "*" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( el, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + }); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + )); + } : + function( a, b ) { + if ( b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + (!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) { + + // Choose the first element that is related to our preferred document + if ( a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) { + return -1; + } + if ( b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + return a === document ? -1 : + b === document ? 1 : + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( (cur = cur.parentNode) ) { + ap.unshift( cur ); + } + cur = b; + while ( (cur = cur.parentNode) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[i] === bp[i] ) { + i++; + } + + return i ? + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[i], bp[i] ) : + + // Otherwise nodes in our document sort first + ap[i] === preferredDoc ? -1 : + bp[i] === preferredDoc ? 1 : + 0; + }; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + if ( support.matchesSelector && documentIsHTML && + !compilerCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch (e) {} + } + + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + // Set document vars if needed + if ( ( context.ownerDocument || context ) !== document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + (val = elem.getAttributeNode(name)) && val.specified ? + val.value : + null; +}; + +Sizzle.escape = function( sel ) { + return (sel + "").replace( rcssescape, fcssescape ); +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); + + if ( hasDuplicate ) { + while ( (elem = results[i++]) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + // If no nodeType, this is expected to be an array + while ( (node = elem[i++]) ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[3] || match[4] || match[5] || "" ).replace( runescape, funescape ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1].slice( 0, 3 ) === "nth" ) { + // nth-* requires argument + if ( !match[3] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) ); + match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" ); + + // other types prohibit arguments + } else if ( match[3] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[6] && match[2]; + + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[3] ) { + match[2] = match[4] || match[5] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + match[0] = match[0].slice( 0, excess ); + match[2] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { return true; } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "" ); + }); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, what, argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( (node = node[ dir ]) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( (node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + (diff = nodeIndex = 0) || start.pop()) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + // Use previously-cached element index if available + if ( useCache ) { + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + // Use the same loop as above to seek `elem` from the start + while ( (node = ++nodeIndex && node && node[ dir ] || + (diff = nodeIndex = 0) || start.pop()) ) { + + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + uniqueCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + // Potentially complex pseudos + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + // Don't keep the element (issue #299) + input[0] = null; + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + // lang value must be a valid identifier + if ( !ridentifier.test(lang || "") ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( (elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( (elem = elem.parentNode) && elem.nodeType === 1 ); + return false; + }; + }), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, + + // Boolean properties + "enabled": createDisabledPseudo( false ), + "disabled": createDisabledPseudo( true ), + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; + } + groups.push( (tokens = []) ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + matched = match.shift(); + tokens.push({ + value: matched, + // Cast descendant combinators to space + type: match[0].replace( rtrim, " " ) + }); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + matched = match.shift(); + tokens.push({ + value: matched, + type: type, + matches: match + }); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[i].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || (elem[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || (outerCache[ elem.uniqueID ] = {}); + + if ( skip && skip === elem.nodeName.toLowerCase() ) { + elem = elem[ dir ] || elem; + } else if ( (oldCache = uniqueCache[ key ]) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return (newCache[ 2 ] = oldCache[ 2 ]); + } else { + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator(elementMatcher( matchers ), matcher) ]; + } else { + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" }) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find["TAG"]( "*", outermost ), + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1), + len = elems.length; + + if ( outermost ) { + outermostContext = context === document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: ) matching elements by id + for ( ; i !== len && (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + if ( !context && elem.ownerDocument !== document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( (matcher = elementMatchers[j++]) ) { + if ( matcher( elem, context || document, xml) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( (matcher = setMatchers[j++]) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; + +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( (selector = compiled.selector || selector) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[1].type ] ) { + + context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( runescape, funescape ), + rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; + +// One-time assignments + +// Sort stability +support.sortStable = expando.split("").sort( sortOrder ).join("") === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert(function( el ) { + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement("fieldset") ) & 1; +}); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert(function( el ) { + el.innerHTML = ""; + return el.firstChild.getAttribute("href") === "#" ; +}) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + }); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert(function( el ) { + el.innerHTML = ""; + el.firstChild.setAttribute( "value", "" ); + return el.firstChild.getAttribute( "value" ) === ""; +}) ) { + addHandle( "value", function( elem, name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + }); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert(function( el ) { + return el.getAttribute("disabled") == null; +}) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + (val = elem.getAttributeNode( name )) && val.specified ? + val.value : + null; + } + }); +} + +return Sizzle; + +})( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +jQuery.escapeSelector = Sizzle.escape; + + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +}; +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( nodeName( elem, "iframe" ) ) { + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.stackTrace ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getStackHook ) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the master Deferred + master = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + master.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( master.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return master.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), master.reject ); + } + + return master.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +jQuery.Deferred.exceptionHook = function( error, stack ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + jQuery.contains( elem.ownerDocument, elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + +var swap = function( elem, options, callback, args ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.apply( elem, args || [] ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]+)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + + // Support: IE <=9 only + option: [ 1, "" ], + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [ 1, "", "
" ], + col: [ 2, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + + _default: [ 0, "", "" ] +}; + +// Support: IE <=9 only +wrapMap.optgroup = wrapMap.option; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, contains, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + contains = jQuery.contains( elem.ownerDocument, elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( contains ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; +} )(); +var documentElement = document.documentElement; + + + +var + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +// Support: IE <=9 only +// See #13393 for more info +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Don't attach events to noData or text/comment nodes (but allow plain objects) + if ( !elemData ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = {}; + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + // Make a writable jQuery.Event from the native event object + var event = jQuery.event.fix( nativeEvent ); + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + handlers = ( dataPriv.get( this, "events" ) || {} )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // Triggered event must either 1) have no namespace, or 2) have namespace(s) + // a subset or equal to those in the bound event (both can have no namespace). + if ( !event.rnamespace || event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + focus: { + + // Fire native event if possible so blur/focus sequence is correct + trigger: function() { + if ( this !== safeActiveElement() && this.focus ) { + this.focus(); + return false; + } + }, + delegateType: "focusin" + }, + blur: { + trigger: function() { + if ( this === safeActiveElement() && this.blur ) { + this.blur(); + return false; + } + }, + delegateType: "focusout" + }, + click: { + + // For checkbox, fire native event so checked state will be right + trigger: function() { + if ( this.type === "checkbox" && this.click && nodeName( this, "input" ) ) { + this.click(); + return false; + } + }, + + // For cross-browser consistency, don't fire native .click() on links + _default: function( event ) { + return nodeName( event.target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + + which: function( event ) { + var button = event.button; + + // Add which for key events + if ( event.which == null && rkeyEvent.test( event.type ) ) { + return event.charCode != null ? event.charCode : event.keyCode; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + if ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) { + if ( button & 1 ) { + return 1; + } + + if ( button & 2 ) { + return 3; + } + + if ( button & 4 ) { + return 2; + } + + return 0; + } + + return event.which; + } +}, jQuery.event.addProp ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + /* eslint-disable max-len */ + + // See https://github.com/eslint/eslint/issues/3229 + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi, + + /* eslint-enable */ + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.access( src ); + pdataCur = dataPriv.set( dest, pdataOld ); + events = pdataOld.events; + + if ( events ) { + delete pdataCur.handle; + pdataCur.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = concat.apply( [], args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl ) { + jQuery._evalUrl( node.src ); + } + } else { + DOMEval( node.textContent.replace( rcleanScript, "" ), doc, node ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && jQuery.contains( node.ownerDocument, node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html.replace( rxhtmlTag, "<$1>" ); + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = jQuery.contains( elem.ownerDocument, elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + div.style.position = "absolute"; + scrollboxSizeVal = div.offsetWidth === 36 || "absolute"; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if ( computed ) { + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }, + + cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style; + +// Return a css property mapped to a potentially vendor prefixed property +function vendorPropName( name ) { + + // Shortcut for names that are not vendor prefixed + if ( name in emptyStyle ) { + return name; + } + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a property mapped along what jQuery.cssProps suggests or to +// a vendor prefixed property. +function finalPropName( name ) { + var ret = jQuery.cssProps[ name ]; + if ( !ret ) { + ret = jQuery.cssProps[ name ] = vendorPropName( name ) || name; + } + return ret; +} + +function setPositiveNumber( elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + if ( box === "margin" ) { + delta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + ) ); + } + + return delta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + val = curCSS( elem, dimension, styles ), + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox; + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + // Check for style in case a browser which returns unreliable values + // for getComputedStyle silently falls back to the reliable elem.style + valueIsBorderBox = valueIsBorderBox && + ( support.boxSizingReliable() || val === elem.style[ dimension ] ); + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + if ( val === "auto" || + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) { + + val = elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ]; + + // offsetWidth/offsetHeight provide border-box values + valueIsBorderBox = true; + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + if ( type === "number" ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra && boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ); + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && support.scrollboxSize() === styles.position ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && + ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || + jQuery.cssHooks[ tween.prop ] ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + return this.each( function() { + var className, i, self, classNames; + + if ( isValidValue ) { + + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = classesToArray( value ); + + while ( ( className = classNames[ i++ ] ) ) { + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion + + +support.focusin = "onfocusin" in window; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || {} )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + var doc = this.ownerDocument || this, + attaches = dataPriv.access( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); + } + dataPriv.access( doc, fix, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this, + attaches = dataPriv.access( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + dataPriv.remove( doc, fix ); + + } else { + dataPriv.access( doc, fix, attaches ); + } + } + }; + } ); +} +var location = window.location; + +var nonce = Date.now(); + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) { + xml = undefined; + } + + if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; +}; + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ) + .filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ) + .map( function( i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match == null ? null : match; + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce++ ) + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + + +jQuery._evalUrl = function( url ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + "throws": true + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( "