+
@@ -74,6 +75,9 @@ const App = () => {
+
+
+
);
diff --git a/src/ui/store.jsx b/src/ui/store.jsx
index 6f458015..e8ac1023 100644
--- a/src/ui/store.jsx
+++ b/src/ui/store.jsx
@@ -34,10 +34,10 @@ const settings = {
settings: null,
setSettings: action((state, settings) => {
setCurrency(settings.currency);
- setNetwork(settings.network);
+ setNetwork(settings?.network);
state.settings = {
...settings,
- adaSymbol: settings.network.id === NETWORK_ID.mainnet ? '₳' : 't₳',
+ adaSymbol: settings?.network?.id === NETWORK_ID.mainnet ? '₳' : 't₳',
};
}),
};
@@ -153,7 +153,7 @@ const StoreInit = ({ children }) => {
{children}
{info && info.length ?
: ''}
{/* Settings Overlay */}
- {settings.network.id !== NETWORK_ID.mainnet && (
+ {settings?.network?.id !== NETWORK_ID.mainnet && (
{
{(() => {
- switch (settings.network.id) {
+ switch (settings?.network?.id) {
case NETWORK_ID.testnet:
return 'Testnet';
case NETWORK_ID.preview:
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/cap b/temporary_modules/trezor-connect/node_modules/.bin/cap
new file mode 100644
index 00000000..e1daead7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/cap
@@ -0,0 +1,12 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../@capacitor/cli/bin/capacitor" "$@"
+else
+ exec node "$basedir/../@capacitor/cli/bin/capacitor" "$@"
+fi
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/cap.cmd b/temporary_modules/trezor-connect/node_modules/.bin/cap.cmd
new file mode 100644
index 00000000..5a1d74ba
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/cap.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\@capacitor\cli\bin\capacitor" %*
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/cap.ps1 b/temporary_modules/trezor-connect/node_modules/.bin/cap.ps1
new file mode 100644
index 00000000..3472e8f9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/cap.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../@capacitor/cli/bin/capacitor" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../@capacitor/cli/bin/capacitor" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../@capacitor/cli/bin/capacitor" $args
+ } else {
+ & "node$exe" "$basedir/../@capacitor/cli/bin/capacitor" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/capacitor b/temporary_modules/trezor-connect/node_modules/.bin/capacitor
new file mode 100644
index 00000000..e1daead7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/capacitor
@@ -0,0 +1,12 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../@capacitor/cli/bin/capacitor" "$@"
+else
+ exec node "$basedir/../@capacitor/cli/bin/capacitor" "$@"
+fi
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/capacitor.cmd b/temporary_modules/trezor-connect/node_modules/.bin/capacitor.cmd
new file mode 100644
index 00000000..5a1d74ba
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/capacitor.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\@capacitor\cli\bin\capacitor" %*
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/capacitor.ps1 b/temporary_modules/trezor-connect/node_modules/.bin/capacitor.ps1
new file mode 100644
index 00000000..3472e8f9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/capacitor.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../@capacitor/cli/bin/capacitor" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../@capacitor/cli/bin/capacitor" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../@capacitor/cli/bin/capacitor" $args
+ } else {
+ & "node$exe" "$basedir/../@capacitor/cli/bin/capacitor" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/is-docker b/temporary_modules/trezor-connect/node_modules/.bin/is-docker
new file mode 100644
index 00000000..9e457930
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/is-docker
@@ -0,0 +1,12 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../is-docker/cli.js" "$@"
+else
+ exec node "$basedir/../is-docker/cli.js" "$@"
+fi
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/is-docker.cmd b/temporary_modules/trezor-connect/node_modules/.bin/is-docker.cmd
new file mode 100644
index 00000000..79e76ca1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/is-docker.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\is-docker\cli.js" %*
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/is-docker.ps1 b/temporary_modules/trezor-connect/node_modules/.bin/is-docker.ps1
new file mode 100644
index 00000000..74276253
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/is-docker.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../is-docker/cli.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../is-docker/cli.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../is-docker/cli.js" $args
+ } else {
+ & "node$exe" "$basedir/../is-docker/cli.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/mkdirp b/temporary_modules/trezor-connect/node_modules/.bin/mkdirp
new file mode 100644
index 00000000..6ba5765a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/mkdirp
@@ -0,0 +1,12 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../mkdirp/bin/cmd.js" "$@"
+else
+ exec node "$basedir/../mkdirp/bin/cmd.js" "$@"
+fi
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/mkdirp.cmd b/temporary_modules/trezor-connect/node_modules/.bin/mkdirp.cmd
new file mode 100644
index 00000000..a865dd9f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/mkdirp.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\mkdirp\bin\cmd.js" %*
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/mkdirp.ps1 b/temporary_modules/trezor-connect/node_modules/.bin/mkdirp.ps1
new file mode 100644
index 00000000..911e8546
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/mkdirp.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../mkdirp/bin/cmd.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../mkdirp/bin/cmd.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../mkdirp/bin/cmd.js" $args
+ } else {
+ & "node$exe" "$basedir/../mkdirp/bin/cmd.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/native-run b/temporary_modules/trezor-connect/node_modules/.bin/native-run
new file mode 100644
index 00000000..df55b2ef
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/native-run
@@ -0,0 +1,12 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../native-run/bin/native-run" "$@"
+else
+ exec node "$basedir/../native-run/bin/native-run" "$@"
+fi
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/native-run.cmd b/temporary_modules/trezor-connect/node_modules/.bin/native-run.cmd
new file mode 100644
index 00000000..dcbd47d9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/native-run.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\native-run\bin\native-run" %*
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/native-run.ps1 b/temporary_modules/trezor-connect/node_modules/.bin/native-run.ps1
new file mode 100644
index 00000000..410110bc
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/native-run.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../native-run/bin/native-run" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../native-run/bin/native-run" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../native-run/bin/native-run" $args
+ } else {
+ & "node$exe" "$basedir/../native-run/bin/native-run" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/node-which b/temporary_modules/trezor-connect/node_modules/.bin/node-which
new file mode 100644
index 00000000..aece7353
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/node-which
@@ -0,0 +1,12 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../which/bin/node-which" "$@"
+else
+ exec node "$basedir/../which/bin/node-which" "$@"
+fi
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/node-which.cmd b/temporary_modules/trezor-connect/node_modules/.bin/node-which.cmd
new file mode 100644
index 00000000..8738aed8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/node-which.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\which\bin\node-which" %*
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/node-which.ps1 b/temporary_modules/trezor-connect/node_modules/.bin/node-which.ps1
new file mode 100644
index 00000000..cfb09e84
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/node-which.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../which/bin/node-which" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../which/bin/node-which" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../which/bin/node-which" $args
+ } else {
+ & "node$exe" "$basedir/../which/bin/node-which" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/semver b/temporary_modules/trezor-connect/node_modules/.bin/semver
new file mode 100644
index 00000000..77443e78
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/semver
@@ -0,0 +1,12 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../semver/bin/semver.js" "$@"
+else
+ exec node "$basedir/../semver/bin/semver.js" "$@"
+fi
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/semver.cmd b/temporary_modules/trezor-connect/node_modules/.bin/semver.cmd
new file mode 100644
index 00000000..9913fa9d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/semver.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\semver\bin\semver.js" %*
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/semver.ps1 b/temporary_modules/trezor-connect/node_modules/.bin/semver.ps1
new file mode 100644
index 00000000..314717ad
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/semver.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../semver/bin/semver.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../semver/bin/semver.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../semver/bin/semver.js" $args
+ } else {
+ & "node$exe" "$basedir/../semver/bin/semver.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/tree-kill b/temporary_modules/trezor-connect/node_modules/.bin/tree-kill
new file mode 100644
index 00000000..5cbbf1bf
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/tree-kill
@@ -0,0 +1,12 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../tree-kill/cli.js" "$@"
+else
+ exec node "$basedir/../tree-kill/cli.js" "$@"
+fi
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/tree-kill.cmd b/temporary_modules/trezor-connect/node_modules/.bin/tree-kill.cmd
new file mode 100644
index 00000000..dcb9aa69
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/tree-kill.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\tree-kill\cli.js" %*
diff --git a/temporary_modules/trezor-connect/node_modules/.bin/tree-kill.ps1 b/temporary_modules/trezor-connect/node_modules/.bin/tree-kill.ps1
new file mode 100644
index 00000000..61d62ddb
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.bin/tree-kill.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../tree-kill/cli.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../tree-kill/cli.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../tree-kill/cli.js" $args
+ } else {
+ & "node$exe" "$basedir/../tree-kill/cli.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/temporary_modules/trezor-connect/node_modules/.package-lock.json b/temporary_modules/trezor-connect/node_modules/.package-lock.json
new file mode 100644
index 00000000..854c1af1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/.package-lock.json
@@ -0,0 +1,863 @@
+{
+ "name": "trezor-connect",
+ "version": "8.2.3",
+ "lockfileVersion": 2,
+ "requires": true,
+ "packages": {
+ "node_modules/@babel/runtime": {
+ "version": "7.17.9",
+ "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.17.9.tgz",
+ "integrity": "sha512-lSiBBvodq29uShpWGNbgFdKYNiFDo5/HIYsaCEY9ff4sb10x9jizo2+pRrSyF4jKZCXqgzuqBOQKbUm90gQwJg==",
+ "dependencies": {
+ "regenerator-runtime": "^0.13.4"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@capacitor/cli": {
+ "version": "3.5.0",
+ "resolved": "https://registry.npmjs.org/@capacitor/cli/-/cli-3.5.0.tgz",
+ "integrity": "sha512-URRAfCbrXufaxRCsDR68m0H3PPndyd4UyfhF4Y+DM5GI1i+0a1SlDYx2s/Ik0ttUFuKc+StwtlmR9Bt5sYNPtQ==",
+ "dependencies": {
+ "@ionic/cli-framework-output": "^2.2.1",
+ "@ionic/utils-fs": "^3.1.5",
+ "@ionic/utils-subprocess": "^2.1.6",
+ "@ionic/utils-terminal": "^2.3.0",
+ "commander": "^6.0.0",
+ "debug": "^4.2.0",
+ "env-paths": "^2.2.0",
+ "kleur": "^4.1.1",
+ "native-run": "^1.5.0",
+ "open": "^7.4.2",
+ "plist": "^3.0.2",
+ "prompts": "^2.3.2",
+ "semver": "^7.3.2",
+ "tar": "^6.1.11",
+ "tslib": "^2.1.0",
+ "xml2js": "^0.4.23"
+ },
+ "bin": {
+ "cap": "bin/capacitor",
+ "capacitor": "bin/capacitor"
+ },
+ "engines": {
+ "node": ">=12.4.0"
+ }
+ },
+ "node_modules/@capacitor/core": {
+ "version": "3.5.0",
+ "resolved": "https://registry.npmjs.org/@capacitor/core/-/core-3.5.0.tgz",
+ "integrity": "sha512-+CFSG+CztpFIir9gGqNEtAYuf6OWryQ8dojXoeozAkoz3mKvyFfcEfvLVPo/pw/B4zHIlNnJLHne6vbjAFbDKQ==",
+ "dependencies": {
+ "tslib": "^2.1.0"
+ }
+ },
+ "node_modules/@ionic/cli-framework-output": {
+ "version": "2.2.3",
+ "resolved": "https://registry.npmjs.org/@ionic/cli-framework-output/-/cli-framework-output-2.2.3.tgz",
+ "integrity": "sha512-Ok0DuQseeyEQnpq1eIE9Wt2oy80qmsprmQYu4bMeiaggbXTmzdf0wa+2CIRrAy1Mzh7Lnz95AI4KyYl3h+97GQ==",
+ "dependencies": {
+ "@ionic/utils-terminal": "2.3.1",
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "engines": {
+ "node": ">=10.3.0"
+ }
+ },
+ "node_modules/@ionic/utils-array": {
+ "version": "2.1.5",
+ "resolved": "https://registry.npmjs.org/@ionic/utils-array/-/utils-array-2.1.5.tgz",
+ "integrity": "sha512-HD72a71IQVBmQckDwmA8RxNVMTbxnaLbgFOl+dO5tbvW9CkkSFCv41h6fUuNsSEVgngfkn0i98HDuZC8mk+lTA==",
+ "dependencies": {
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "engines": {
+ "node": ">=10.3.0"
+ }
+ },
+ "node_modules/@ionic/utils-fs": {
+ "version": "3.1.5",
+ "resolved": "https://registry.npmjs.org/@ionic/utils-fs/-/utils-fs-3.1.5.tgz",
+ "integrity": "sha512-a41bY2dHqWSEQQ/80CpbXSs8McyiCFf2DnIWWLukrhYWf46h4qi6M/8dxcMKrofRiqI/3F+cL3S2mOm9Zz/o2Q==",
+ "dependencies": {
+ "debug": "^4.0.0",
+ "fs-extra": "^9.0.0",
+ "tslib": "^2.0.1"
+ },
+ "engines": {
+ "node": ">=10.3.0"
+ }
+ },
+ "node_modules/@ionic/utils-object": {
+ "version": "2.1.5",
+ "resolved": "https://registry.npmjs.org/@ionic/utils-object/-/utils-object-2.1.5.tgz",
+ "integrity": "sha512-XnYNSwfewUqxq+yjER1hxTKggftpNjFLJH0s37jcrNDwbzmbpFTQTVAp4ikNK4rd9DOebX/jbeZb8jfD86IYxw==",
+ "dependencies": {
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "engines": {
+ "node": ">=10.3.0"
+ }
+ },
+ "node_modules/@ionic/utils-process": {
+ "version": "2.1.8",
+ "resolved": "https://registry.npmjs.org/@ionic/utils-process/-/utils-process-2.1.8.tgz",
+ "integrity": "sha512-VBBoyTzi+m6tgKAItl+jiTQneGwTOsctcrTG4CsEgmVOVOEhUYkPhddXqzD+oC54hPDU9ROsd3I014P5CWEuhQ==",
+ "dependencies": {
+ "@ionic/utils-object": "2.1.5",
+ "@ionic/utils-terminal": "2.3.1",
+ "debug": "^4.0.0",
+ "signal-exit": "^3.0.3",
+ "tree-kill": "^1.2.2",
+ "tslib": "^2.0.1"
+ },
+ "engines": {
+ "node": ">=10.3.0"
+ }
+ },
+ "node_modules/@ionic/utils-stream": {
+ "version": "3.1.5",
+ "resolved": "https://registry.npmjs.org/@ionic/utils-stream/-/utils-stream-3.1.5.tgz",
+ "integrity": "sha512-hkm46uHvEC05X/8PHgdJi4l4zv9VQDELZTM+Kz69odtO9zZYfnt8DkfXHJqJ+PxmtiE5mk/ehJWLnn/XAczTUw==",
+ "dependencies": {
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "engines": {
+ "node": ">=10.3.0"
+ }
+ },
+ "node_modules/@ionic/utils-subprocess": {
+ "version": "2.1.9",
+ "resolved": "https://registry.npmjs.org/@ionic/utils-subprocess/-/utils-subprocess-2.1.9.tgz",
+ "integrity": "sha512-OZ4QKyFOoC3+NCcBW8tvDUdLzWqOMKZPpzOQR009xVsfGbT3LwV8h60os7VRAbRV2KrA7t6YMMDrMQYV5DS+DQ==",
+ "dependencies": {
+ "@ionic/utils-array": "2.1.5",
+ "@ionic/utils-fs": "3.1.5",
+ "@ionic/utils-process": "2.1.8",
+ "@ionic/utils-stream": "3.1.5",
+ "@ionic/utils-terminal": "2.3.1",
+ "cross-spawn": "^7.0.3",
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "engines": {
+ "node": ">=10.3.0"
+ }
+ },
+ "node_modules/@ionic/utils-terminal": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/@ionic/utils-terminal/-/utils-terminal-2.3.1.tgz",
+ "integrity": "sha512-cglsSd2AckI3Ldtdfczeq64vIIDjtPspV5QJtky8f8uIdxkeOIGeRV7bCj1+BEf1hyo+ZuggQxLviHnbMZhiRw==",
+ "dependencies": {
+ "debug": "^4.0.0",
+ "signal-exit": "^3.0.3",
+ "slice-ansi": "^4.0.0",
+ "string-width": "^4.1.0",
+ "strip-ansi": "^6.0.0",
+ "tslib": "^2.0.1",
+ "untildify": "^4.0.0",
+ "wrap-ansi": "^7.0.0"
+ },
+ "engines": {
+ "node": ">=10.3.0"
+ }
+ },
+ "node_modules/ansi-regex": {
+ "version": "5.0.1",
+ "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz",
+ "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==",
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/ansi-styles": {
+ "version": "4.3.0",
+ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz",
+ "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==",
+ "dependencies": {
+ "color-convert": "^2.0.1"
+ },
+ "engines": {
+ "node": ">=8"
+ },
+ "funding": {
+ "url": "https://github.com/chalk/ansi-styles?sponsor=1"
+ }
+ },
+ "node_modules/astral-regex": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/astral-regex/-/astral-regex-2.0.0.tgz",
+ "integrity": "sha512-Z7tMw1ytTXt5jqMcOP+OQteU1VuNK9Y02uuJtKQ1Sv69jXQKKg5cibLwGJow8yzZP+eAc18EmLGPal0bp36rvQ==",
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/at-least-node": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/at-least-node/-/at-least-node-1.0.0.tgz",
+ "integrity": "sha512-+q/t7Ekv1EDY2l6Gda6LLiX14rU9TV20Wa3ofeQmwPFZbOMo9DXrLbOjFaaclkXKWidIaopwAObQDqwWtGUjqg==",
+ "engines": {
+ "node": ">= 4.0.0"
+ }
+ },
+ "node_modules/base64-js": {
+ "version": "1.5.1",
+ "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.5.1.tgz",
+ "integrity": "sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==",
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/feross"
+ },
+ {
+ "type": "patreon",
+ "url": "https://www.patreon.com/feross"
+ },
+ {
+ "type": "consulting",
+ "url": "https://feross.org/support"
+ }
+ ]
+ },
+ "node_modules/big-integer": {
+ "version": "1.6.51",
+ "resolved": "https://registry.npmjs.org/big-integer/-/big-integer-1.6.51.tgz",
+ "integrity": "sha512-GPEid2Y9QU1Exl1rpO9B2IPJGHPSupF5GnVIP0blYvNOMer2bTvSWs1jGOUg04hTmu67nmLsQ9TBo1puaotBHg==",
+ "engines": {
+ "node": ">=0.6"
+ }
+ },
+ "node_modules/bplist-parser": {
+ "version": "0.3.1",
+ "resolved": "https://registry.npmjs.org/bplist-parser/-/bplist-parser-0.3.1.tgz",
+ "integrity": "sha512-PyJxiNtA5T2PlLIeBot4lbp7rj4OadzjnMZD/G5zuBNt8ei/yCU7+wW0h2bag9vr8c+/WuRWmSxbqAl9hL1rBA==",
+ "dependencies": {
+ "big-integer": "1.6.x"
+ },
+ "engines": {
+ "node": ">= 5.10.0"
+ }
+ },
+ "node_modules/buffer-crc32": {
+ "version": "0.2.13",
+ "resolved": "https://registry.npmjs.org/buffer-crc32/-/buffer-crc32-0.2.13.tgz",
+ "integrity": "sha1-DTM+PwDqxQqhRUq9MO+MKl2ackI=",
+ "engines": {
+ "node": "*"
+ }
+ },
+ "node_modules/chownr": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/chownr/-/chownr-2.0.0.tgz",
+ "integrity": "sha512-bIomtDF5KGpdogkLd9VspvFzk9KfpyyGlS8YFVZl7TGPBHL5snIOnxeshwVgPteQ9b4Eydl+pVbIyE1DcvCWgQ==",
+ "engines": {
+ "node": ">=10"
+ }
+ },
+ "node_modules/color-convert": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz",
+ "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==",
+ "dependencies": {
+ "color-name": "~1.1.4"
+ },
+ "engines": {
+ "node": ">=7.0.0"
+ }
+ },
+ "node_modules/color-name": {
+ "version": "1.1.4",
+ "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz",
+ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA=="
+ },
+ "node_modules/commander": {
+ "version": "6.2.1",
+ "resolved": "https://registry.npmjs.org/commander/-/commander-6.2.1.tgz",
+ "integrity": "sha512-U7VdrJFnJgo4xjrHpTzu0yrHPGImdsmD95ZlgYSEajAn2JKzDhDTPG9kBTefmObL2w/ngeZnilk+OV9CG3d7UA==",
+ "engines": {
+ "node": ">= 6"
+ }
+ },
+ "node_modules/cross-spawn": {
+ "version": "7.0.3",
+ "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.3.tgz",
+ "integrity": "sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w==",
+ "dependencies": {
+ "path-key": "^3.1.0",
+ "shebang-command": "^2.0.0",
+ "which": "^2.0.1"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/debug": {
+ "version": "4.3.4",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz",
+ "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==",
+ "dependencies": {
+ "ms": "2.1.2"
+ },
+ "engines": {
+ "node": ">=6.0"
+ },
+ "peerDependenciesMeta": {
+ "supports-color": {
+ "optional": true
+ }
+ }
+ },
+ "node_modules/elementtree": {
+ "version": "0.1.7",
+ "resolved": "https://registry.npmjs.org/elementtree/-/elementtree-0.1.7.tgz",
+ "integrity": "sha1-mskb5uUvtuYkTE5UpKw+2K6OKcA=",
+ "dependencies": {
+ "sax": "1.1.4"
+ },
+ "engines": {
+ "node": ">= 0.4.0"
+ }
+ },
+ "node_modules/emoji-regex": {
+ "version": "8.0.0",
+ "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz",
+ "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A=="
+ },
+ "node_modules/env-paths": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/env-paths/-/env-paths-2.2.1.tgz",
+ "integrity": "sha512-+h1lkLKhZMTYjog1VEpJNG7NZJWcuc2DDk/qsqSTRRCOXiLjeQ1d1/udrUGhqMxUgAlwKNZ0cf2uqan5GLuS2A==",
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/events": {
+ "version": "3.3.0",
+ "resolved": "https://registry.npmjs.org/events/-/events-3.3.0.tgz",
+ "integrity": "sha512-mQw+2fkQbALzQ7V0MY0IqdnXNOeTtP4r0lN9z7AAawCXgqea7bDii20AYrIBrFd/Hx0M2Ocz6S111CaFkUcb0Q==",
+ "engines": {
+ "node": ">=0.8.x"
+ }
+ },
+ "node_modules/fd-slicer": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/fd-slicer/-/fd-slicer-1.1.0.tgz",
+ "integrity": "sha1-JcfInLH5B3+IkbvmHY85Dq4lbx4=",
+ "dependencies": {
+ "pend": "~1.2.0"
+ }
+ },
+ "node_modules/fs-extra": {
+ "version": "9.1.0",
+ "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-9.1.0.tgz",
+ "integrity": "sha512-hcg3ZmepS30/7BSFqRvoo3DOMQu7IjqxO5nCDt+zM9XWjb33Wg7ziNT+Qvqbuc3+gWpzO02JubVyk2G4Zvo1OQ==",
+ "dependencies": {
+ "at-least-node": "^1.0.0",
+ "graceful-fs": "^4.2.0",
+ "jsonfile": "^6.0.1",
+ "universalify": "^2.0.0"
+ },
+ "engines": {
+ "node": ">=10"
+ }
+ },
+ "node_modules/fs-minipass": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-2.1.0.tgz",
+ "integrity": "sha512-V/JgOLFCS+R6Vcq0slCuaeWEdNC3ouDlJMNIsacH2VtALiu9mV4LPrHc5cDl8k5aw6J8jwgWWpiTo5RYhmIzvg==",
+ "dependencies": {
+ "minipass": "^3.0.0"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/graceful-fs": {
+ "version": "4.2.10",
+ "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.10.tgz",
+ "integrity": "sha512-9ByhssR2fPVsNZj478qUUbKfmL0+t5BDVyjShtyZZLiK7ZDAArFFfopyOTj0M05wE2tJPisA4iTnnXl2YoPvOA=="
+ },
+ "node_modules/inherits": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
+ "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ=="
+ },
+ "node_modules/ini": {
+ "version": "1.3.8",
+ "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.8.tgz",
+ "integrity": "sha512-JV/yugV2uzW5iMRSiZAyDtQd+nxtUnjeLt0acNdw98kKLrvuRVyB80tsREOE7yvGVgalhZ6RNXCmEHkUKBKxew=="
+ },
+ "node_modules/is-docker": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/is-docker/-/is-docker-2.2.1.tgz",
+ "integrity": "sha512-F+i2BKsFrH66iaUFc0woD8sLy8getkwTwtOBjvs56Cx4CgJDeKQeqfz8wAYiSb8JOprWhHH5p77PbmYCvvUuXQ==",
+ "bin": {
+ "is-docker": "cli.js"
+ },
+ "engines": {
+ "node": ">=8"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/is-fullwidth-code-point": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz",
+ "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==",
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/is-wsl": {
+ "version": "2.2.0",
+ "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-2.2.0.tgz",
+ "integrity": "sha512-fKzAra0rGJUUBwGBgNkHZuToZcn+TtXHpeCgmkMJMMYx1sQDYaCSyjJBSCa2nH1DGm7s3n1oBnohoVTBaN7Lww==",
+ "dependencies": {
+ "is-docker": "^2.0.0"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/isexe": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz",
+ "integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA="
+ },
+ "node_modules/jsonfile": {
+ "version": "6.1.0",
+ "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-6.1.0.tgz",
+ "integrity": "sha512-5dgndWOriYSm5cnYaJNhalLNDKOqFwyDB/rr1E9ZsGciGvKPs8R2xYGCacuf3z6K1YKDz182fd+fY3cn3pMqXQ==",
+ "dependencies": {
+ "universalify": "^2.0.0"
+ },
+ "optionalDependencies": {
+ "graceful-fs": "^4.1.6"
+ }
+ },
+ "node_modules/kleur": {
+ "version": "4.1.4",
+ "resolved": "https://registry.npmjs.org/kleur/-/kleur-4.1.4.tgz",
+ "integrity": "sha512-8QADVssbrFjivHWQU7KkMgptGTl6WAcSdlbBPY4uNF+mWr6DGcKrvY2w4FQJoXch7+fKMjj0dRrL75vk3k23OA==",
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/lru-cache": {
+ "version": "6.0.0",
+ "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-6.0.0.tgz",
+ "integrity": "sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA==",
+ "dependencies": {
+ "yallist": "^4.0.0"
+ },
+ "engines": {
+ "node": ">=10"
+ }
+ },
+ "node_modules/minipass": {
+ "version": "3.1.6",
+ "resolved": "https://registry.npmjs.org/minipass/-/minipass-3.1.6.tgz",
+ "integrity": "sha512-rty5kpw9/z8SX9dmxblFA6edItUmwJgMeYDZRrwlIVN27i8gysGbznJwUggw2V/FVqFSDdWy040ZPS811DYAqQ==",
+ "dependencies": {
+ "yallist": "^4.0.0"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/minizlib": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/minizlib/-/minizlib-2.1.2.tgz",
+ "integrity": "sha512-bAxsR8BVfj60DWXHE3u30oHzfl4G7khkSuPW+qvpd7jFRHm7dLxOjUk1EHACJ/hxLY8phGJ0YhYHZo7jil7Qdg==",
+ "dependencies": {
+ "minipass": "^3.0.0",
+ "yallist": "^4.0.0"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/mkdirp": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-1.0.4.tgz",
+ "integrity": "sha512-vVqVZQyf3WLx2Shd0qJ9xuvqgAyKPLAiqITEtqW0oIUjzo3PePDd6fW9iFz30ef7Ysp/oiWqbhszeGWW2T6Gzw==",
+ "bin": {
+ "mkdirp": "bin/cmd.js"
+ },
+ "engines": {
+ "node": ">=10"
+ }
+ },
+ "node_modules/ms": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
+ "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w=="
+ },
+ "node_modules/native-run": {
+ "version": "1.5.0",
+ "resolved": "https://registry.npmjs.org/native-run/-/native-run-1.5.0.tgz",
+ "integrity": "sha512-YYsYYAljk70N+FJLeY5KuafsBit7agOBR3ch1KTXOaKkREkM49yCwJIwVz2faoWpJ2MeyLdXltk5PskUuPQqZA==",
+ "dependencies": {
+ "@ionic/utils-fs": "^3.1.5",
+ "@ionic/utils-terminal": "^2.3.1",
+ "bplist-parser": "^0.3.0",
+ "debug": "^4.3.2",
+ "elementtree": "^0.1.7",
+ "ini": "^1.3.5",
+ "plist": "^3.0.4",
+ "split2": "^3.2.2",
+ "through2": "^4.0.2",
+ "tslib": "^2.3.1",
+ "yauzl": "^2.10.0"
+ },
+ "bin": {
+ "native-run": "bin/native-run"
+ },
+ "engines": {
+ "node": ">=10.3.0"
+ }
+ },
+ "node_modules/open": {
+ "version": "7.4.2",
+ "resolved": "https://registry.npmjs.org/open/-/open-7.4.2.tgz",
+ "integrity": "sha512-MVHddDVweXZF3awtlAS+6pgKLlm/JgxZ90+/NBurBoQctVOOB/zDdVjcyPzQ+0laDGbsWgrRkflI65sQeOgT9Q==",
+ "dependencies": {
+ "is-docker": "^2.0.0",
+ "is-wsl": "^2.1.1"
+ },
+ "engines": {
+ "node": ">=8"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/path-key": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz",
+ "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==",
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/pend": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/pend/-/pend-1.2.0.tgz",
+ "integrity": "sha1-elfrVQpng/kRUzH89GY9XI4AelA="
+ },
+ "node_modules/plist": {
+ "version": "3.0.5",
+ "resolved": "https://registry.npmjs.org/plist/-/plist-3.0.5.tgz",
+ "integrity": "sha512-83vX4eYdQp3vP9SxuYgEM/G/pJQqLUz/V/xzPrzruLs7fz7jxGQ1msZ/mg1nwZxUSuOp4sb+/bEIbRrbzZRxDA==",
+ "dependencies": {
+ "base64-js": "^1.5.1",
+ "xmlbuilder": "^9.0.7"
+ },
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/prompts": {
+ "version": "2.4.2",
+ "resolved": "https://registry.npmjs.org/prompts/-/prompts-2.4.2.tgz",
+ "integrity": "sha512-NxNv/kLguCA7p3jE8oL2aEBsrJWgAakBpgmgK6lpPWV+WuOmY6r2/zbAVnP+T8bQlA0nzHXSJSJW0Hq7ylaD2Q==",
+ "dependencies": {
+ "kleur": "^3.0.3",
+ "sisteransi": "^1.0.5"
+ },
+ "engines": {
+ "node": ">= 6"
+ }
+ },
+ "node_modules/prompts/node_modules/kleur": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/kleur/-/kleur-3.0.3.tgz",
+ "integrity": "sha512-eTIzlVOSUR+JxdDFepEYcBMtZ9Qqdef+rnzWdRZuMbOywu5tO2w2N7rqjoANZ5k9vywhL6Br1VRjUIgTQx4E8w==",
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/readable-stream": {
+ "version": "3.6.0",
+ "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz",
+ "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==",
+ "dependencies": {
+ "inherits": "^2.0.3",
+ "string_decoder": "^1.1.1",
+ "util-deprecate": "^1.0.1"
+ },
+ "engines": {
+ "node": ">= 6"
+ }
+ },
+ "node_modules/regenerator-runtime": {
+ "version": "0.13.9",
+ "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.9.tgz",
+ "integrity": "sha512-p3VT+cOEgxFsRRA9X4lkI1E+k2/CtnKtU4gcxyaCUreilL/vqI6CdZ3wxVUx3UOUg+gnUOQQcRI7BmSI656MYA=="
+ },
+ "node_modules/safe-buffer": {
+ "version": "5.2.1",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz",
+ "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==",
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/feross"
+ },
+ {
+ "type": "patreon",
+ "url": "https://www.patreon.com/feross"
+ },
+ {
+ "type": "consulting",
+ "url": "https://feross.org/support"
+ }
+ ]
+ },
+ "node_modules/sax": {
+ "version": "1.1.4",
+ "resolved": "https://registry.npmjs.org/sax/-/sax-1.1.4.tgz",
+ "integrity": "sha1-dLbTPJrh4AFRDxeakRaFiPGu2qk="
+ },
+ "node_modules/semver": {
+ "version": "7.3.7",
+ "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.7.tgz",
+ "integrity": "sha512-QlYTucUYOews+WeEujDoEGziz4K6c47V/Bd+LjSSYcA94p+DmINdf7ncaUinThfvZyu13lN9OY1XDxt8C0Tw0g==",
+ "dependencies": {
+ "lru-cache": "^6.0.0"
+ },
+ "bin": {
+ "semver": "bin/semver.js"
+ },
+ "engines": {
+ "node": ">=10"
+ }
+ },
+ "node_modules/shebang-command": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz",
+ "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==",
+ "dependencies": {
+ "shebang-regex": "^3.0.0"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/shebang-regex": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-3.0.0.tgz",
+ "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==",
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/signal-exit": {
+ "version": "3.0.7",
+ "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.7.tgz",
+ "integrity": "sha512-wnD2ZE+l+SPC/uoS0vXeE9L1+0wuaMqKlfz9AMUo38JsyLSBWSFcHR1Rri62LZc12vLr1gb3jl7iwQhgwpAbGQ=="
+ },
+ "node_modules/sisteransi": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/sisteransi/-/sisteransi-1.0.5.tgz",
+ "integrity": "sha512-bLGGlR1QxBcynn2d5YmDX4MGjlZvy2MRBDRNHLJ8VI6l6+9FUiyTFNJ0IveOSP0bcXgVDPRcfGqA0pjaqUpfVg=="
+ },
+ "node_modules/slice-ansi": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/slice-ansi/-/slice-ansi-4.0.0.tgz",
+ "integrity": "sha512-qMCMfhY040cVHT43K9BFygqYbUPFZKHOg7K73mtTWJRb8pyP3fzf4Ixd5SzdEJQ6MRUg/WBnOLxghZtKKurENQ==",
+ "dependencies": {
+ "ansi-styles": "^4.0.0",
+ "astral-regex": "^2.0.0",
+ "is-fullwidth-code-point": "^3.0.0"
+ },
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/chalk/slice-ansi?sponsor=1"
+ }
+ },
+ "node_modules/split2": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/split2/-/split2-3.2.2.tgz",
+ "integrity": "sha512-9NThjpgZnifTkJpzTZ7Eue85S49QwpNhZTq6GRJwObb6jnLFNGB7Qm73V5HewTROPyxD0C29xqmaI68bQtV+hg==",
+ "dependencies": {
+ "readable-stream": "^3.0.0"
+ }
+ },
+ "node_modules/string_decoder": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.3.0.tgz",
+ "integrity": "sha512-hkRX8U1WjJFd8LsDJ2yQ/wWWxaopEsABU1XfkM8A+j0+85JAGppt16cr1Whg6KIbb4okU6Mql6BOj+uup/wKeA==",
+ "dependencies": {
+ "safe-buffer": "~5.2.0"
+ }
+ },
+ "node_modules/string-width": {
+ "version": "4.2.3",
+ "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz",
+ "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==",
+ "dependencies": {
+ "emoji-regex": "^8.0.0",
+ "is-fullwidth-code-point": "^3.0.0",
+ "strip-ansi": "^6.0.1"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/strip-ansi": {
+ "version": "6.0.1",
+ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz",
+ "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==",
+ "dependencies": {
+ "ansi-regex": "^5.0.1"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/tar": {
+ "version": "6.1.11",
+ "resolved": "https://registry.npmjs.org/tar/-/tar-6.1.11.tgz",
+ "integrity": "sha512-an/KZQzQUkZCkuoAA64hM92X0Urb6VpRhAFllDzz44U2mcD5scmT3zBc4VgVpkugF580+DQn8eAFSyoQt0tznA==",
+ "dependencies": {
+ "chownr": "^2.0.0",
+ "fs-minipass": "^2.0.0",
+ "minipass": "^3.0.0",
+ "minizlib": "^2.1.1",
+ "mkdirp": "^1.0.3",
+ "yallist": "^4.0.0"
+ },
+ "engines": {
+ "node": ">= 10"
+ }
+ },
+ "node_modules/through2": {
+ "version": "4.0.2",
+ "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz",
+ "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==",
+ "dependencies": {
+ "readable-stream": "3"
+ }
+ },
+ "node_modules/tree-kill": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/tree-kill/-/tree-kill-1.2.2.tgz",
+ "integrity": "sha512-L0Orpi8qGpRG//Nd+H90vFB+3iHnue1zSSGmNOOCh1GLJ7rUKVwV2HvijphGQS2UmhUZewS9VgvxYIdgr+fG1A==",
+ "bin": {
+ "tree-kill": "cli.js"
+ }
+ },
+ "node_modules/tslib": {
+ "version": "2.4.0",
+ "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.4.0.tgz",
+ "integrity": "sha512-d6xOpEDfsi2CZVlPQzGeux8XMwLT9hssAsaPYExaQMuYskwb+x1x7J371tWlbBdWHroy99KnVB6qIkUbs5X3UQ=="
+ },
+ "node_modules/universalify": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/universalify/-/universalify-2.0.0.tgz",
+ "integrity": "sha512-hAZsKq7Yy11Zu1DE0OzWjw7nnLZmJZYTDZZyEFHZdUhV8FkH5MCfoU1XMaxXovpyW5nq5scPqq0ZDP9Zyl04oQ==",
+ "engines": {
+ "node": ">= 10.0.0"
+ }
+ },
+ "node_modules/untildify": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/untildify/-/untildify-4.0.0.tgz",
+ "integrity": "sha512-KK8xQ1mkzZeg9inewmFVDNkg3l5LUhoq9kN6iWYB/CC9YMG8HA+c1Q8HwDe6dEX7kErrEVNVBO3fWsVq5iDgtw==",
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/util-deprecate": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
+ "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8="
+ },
+ "node_modules/whatwg-fetch": {
+ "version": "3.6.2",
+ "resolved": "https://registry.npmjs.org/whatwg-fetch/-/whatwg-fetch-3.6.2.tgz",
+ "integrity": "sha512-bJlen0FcuU/0EMLrdbJ7zOnW6ITZLrZMIarMUVmdKtsGvZna8vxKYaexICWPfZ8qwf9fzNq+UEIZrnSaApt6RA=="
+ },
+ "node_modules/which": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz",
+ "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==",
+ "dependencies": {
+ "isexe": "^2.0.0"
+ },
+ "bin": {
+ "node-which": "bin/node-which"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/wrap-ansi": {
+ "version": "7.0.0",
+ "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-7.0.0.tgz",
+ "integrity": "sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==",
+ "dependencies": {
+ "ansi-styles": "^4.0.0",
+ "string-width": "^4.1.0",
+ "strip-ansi": "^6.0.0"
+ },
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/chalk/wrap-ansi?sponsor=1"
+ }
+ },
+ "node_modules/xml2js": {
+ "version": "0.4.23",
+ "resolved": "https://registry.npmjs.org/xml2js/-/xml2js-0.4.23.tgz",
+ "integrity": "sha512-ySPiMjM0+pLDftHgXY4By0uswI3SPKLDw/i3UXbnO8M/p28zqexCUoPmQFrYD+/1BzhGJSs2i1ERWKJAtiLrug==",
+ "dependencies": {
+ "sax": ">=0.6.0",
+ "xmlbuilder": "~11.0.0"
+ },
+ "engines": {
+ "node": ">=4.0.0"
+ }
+ },
+ "node_modules/xml2js/node_modules/xmlbuilder": {
+ "version": "11.0.1",
+ "resolved": "https://registry.npmjs.org/xmlbuilder/-/xmlbuilder-11.0.1.tgz",
+ "integrity": "sha512-fDlsI/kFEx7gLvbecc0/ohLG50fugQp8ryHzMTuW9vSa1GJ0XYWKnhsUx7oie3G98+r56aTQIUB4kht42R3JvA==",
+ "engines": {
+ "node": ">=4.0"
+ }
+ },
+ "node_modules/xmlbuilder": {
+ "version": "9.0.7",
+ "resolved": "https://registry.npmjs.org/xmlbuilder/-/xmlbuilder-9.0.7.tgz",
+ "integrity": "sha1-Ey7mPS7FVlxVfiD0wi35rKaGsQ0=",
+ "engines": {
+ "node": ">=4.0"
+ }
+ },
+ "node_modules/yallist": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/yallist/-/yallist-4.0.0.tgz",
+ "integrity": "sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A=="
+ },
+ "node_modules/yauzl": {
+ "version": "2.10.0",
+ "resolved": "https://registry.npmjs.org/yauzl/-/yauzl-2.10.0.tgz",
+ "integrity": "sha1-x+sXyT4RLLEIb6bY5R+wZnt5pfk=",
+ "dependencies": {
+ "buffer-crc32": "~0.2.3",
+ "fd-slicer": "~1.1.0"
+ }
+ }
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/LICENSE b/temporary_modules/trezor-connect/node_modules/@babel/runtime/LICENSE
new file mode 100644
index 00000000..f31575ec
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/LICENSE
@@ -0,0 +1,22 @@
+MIT License
+
+Copyright (c) 2014-present Sebastian McKenzie and other contributors
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/README.md b/temporary_modules/trezor-connect/node_modules/@babel/runtime/README.md
new file mode 100644
index 00000000..be27e834
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/README.md
@@ -0,0 +1,19 @@
+# @babel/runtime
+
+> babel's modular runtime helpers
+
+See our website [@babel/runtime](https://babeljs.io/docs/en/babel-runtime) for more information.
+
+## Install
+
+Using npm:
+
+```sh
+npm install --save @babel/runtime
+```
+
+or using yarn:
+
+```sh
+yarn add @babel/runtime
+```
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/AsyncGenerator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/AsyncGenerator.js
new file mode 100644
index 00000000..e6a15a7c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/AsyncGenerator.js
@@ -0,0 +1,98 @@
+var AwaitValue = require("./AwaitValue.js");
+
+function AsyncGenerator(gen) {
+ var front, back;
+
+ function send(key, arg) {
+ return new Promise(function (resolve, reject) {
+ var request = {
+ key: key,
+ arg: arg,
+ resolve: resolve,
+ reject: reject,
+ next: null
+ };
+
+ if (back) {
+ back = back.next = request;
+ } else {
+ front = back = request;
+ resume(key, arg);
+ }
+ });
+ }
+
+ function resume(key, arg) {
+ try {
+ var result = gen[key](arg);
+ var value = result.value;
+ var wrappedAwait = value instanceof AwaitValue;
+ Promise.resolve(wrappedAwait ? value.wrapped : value).then(function (arg) {
+ if (wrappedAwait) {
+ resume(key === "return" ? "return" : "next", arg);
+ return;
+ }
+
+ settle(result.done ? "return" : "normal", arg);
+ }, function (err) {
+ resume("throw", err);
+ });
+ } catch (err) {
+ settle("throw", err);
+ }
+ }
+
+ function settle(type, value) {
+ switch (type) {
+ case "return":
+ front.resolve({
+ value: value,
+ done: true
+ });
+ break;
+
+ case "throw":
+ front.reject(value);
+ break;
+
+ default:
+ front.resolve({
+ value: value,
+ done: false
+ });
+ break;
+ }
+
+ front = front.next;
+
+ if (front) {
+ resume(front.key, front.arg);
+ } else {
+ back = null;
+ }
+ }
+
+ this._invoke = send;
+
+ if (typeof gen["return"] !== "function") {
+ this["return"] = undefined;
+ }
+}
+
+AsyncGenerator.prototype[typeof Symbol === "function" && Symbol.asyncIterator || "@@asyncIterator"] = function () {
+ return this;
+};
+
+AsyncGenerator.prototype.next = function (arg) {
+ return this._invoke("next", arg);
+};
+
+AsyncGenerator.prototype["throw"] = function (arg) {
+ return this._invoke("throw", arg);
+};
+
+AsyncGenerator.prototype["return"] = function (arg) {
+ return this._invoke("return", arg);
+};
+
+module.exports = AsyncGenerator, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/AwaitValue.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/AwaitValue.js
new file mode 100644
index 00000000..5ddee2e1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/AwaitValue.js
@@ -0,0 +1,5 @@
+function _AwaitValue(value) {
+ this.wrapped = value;
+}
+
+module.exports = _AwaitValue, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/applyDecoratedDescriptor.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/applyDecoratedDescriptor.js
new file mode 100644
index 00000000..9080fd63
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/applyDecoratedDescriptor.js
@@ -0,0 +1,30 @@
+function _applyDecoratedDescriptor(target, property, decorators, descriptor, context) {
+ var desc = {};
+ Object.keys(descriptor).forEach(function (key) {
+ desc[key] = descriptor[key];
+ });
+ desc.enumerable = !!desc.enumerable;
+ desc.configurable = !!desc.configurable;
+
+ if ('value' in desc || desc.initializer) {
+ desc.writable = true;
+ }
+
+ desc = decorators.slice().reverse().reduce(function (desc, decorator) {
+ return decorator(target, property, desc) || desc;
+ }, desc);
+
+ if (context && desc.initializer !== void 0) {
+ desc.value = desc.initializer ? desc.initializer.call(context) : void 0;
+ desc.initializer = undefined;
+ }
+
+ if (desc.initializer === void 0) {
+ Object.defineProperty(target, property, desc);
+ desc = null;
+ }
+
+ return desc;
+}
+
+module.exports = _applyDecoratedDescriptor, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/applyDecs.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/applyDecs.js
new file mode 100644
index 00000000..b27baad2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/applyDecs.js
@@ -0,0 +1,284 @@
+var _typeof = require("./typeof.js")["default"];
+
+function createMetadataMethodsForProperty(metadataMap, kind, property, decoratorFinishedRef) {
+ return {
+ getMetadata: function getMetadata(key) {
+ assertNotFinished(decoratorFinishedRef, "getMetadata"), assertMetadataKey(key);
+ var metadataForKey = metadataMap[key];
+ if (void 0 !== metadataForKey) if (1 === kind) {
+ var pub = metadataForKey["public"];
+ if (void 0 !== pub) return pub[property];
+ } else if (2 === kind) {
+ var priv = metadataForKey["private"];
+ if (void 0 !== priv) return priv.get(property);
+ } else if (Object.hasOwnProperty.call(metadataForKey, "constructor")) return metadataForKey.constructor;
+ },
+ setMetadata: function setMetadata(key, value) {
+ assertNotFinished(decoratorFinishedRef, "setMetadata"), assertMetadataKey(key);
+ var metadataForKey = metadataMap[key];
+
+ if (void 0 === metadataForKey && (metadataForKey = metadataMap[key] = {}), 1 === kind) {
+ var pub = metadataForKey["public"];
+ void 0 === pub && (pub = metadataForKey["public"] = {}), pub[property] = value;
+ } else if (2 === kind) {
+ var priv = metadataForKey.priv;
+ void 0 === priv && (priv = metadataForKey["private"] = new Map()), priv.set(property, value);
+ } else metadataForKey.constructor = value;
+ }
+ };
+}
+
+function convertMetadataMapToFinal(obj, metadataMap) {
+ var parentMetadataMap = obj[Symbol.metadata || Symbol["for"]("Symbol.metadata")],
+ metadataKeys = Object.getOwnPropertySymbols(metadataMap);
+
+ if (0 !== metadataKeys.length) {
+ for (var i = 0; i < metadataKeys.length; i++) {
+ var key = metadataKeys[i],
+ metaForKey = metadataMap[key],
+ parentMetaForKey = parentMetadataMap ? parentMetadataMap[key] : null,
+ pub = metaForKey["public"],
+ parentPub = parentMetaForKey ? parentMetaForKey["public"] : null;
+ pub && parentPub && Object.setPrototypeOf(pub, parentPub);
+ var priv = metaForKey["private"];
+
+ if (priv) {
+ var privArr = Array.from(priv.values()),
+ parentPriv = parentMetaForKey ? parentMetaForKey["private"] : null;
+ parentPriv && (privArr = privArr.concat(parentPriv)), metaForKey["private"] = privArr;
+ }
+
+ parentMetaForKey && Object.setPrototypeOf(metaForKey, parentMetaForKey);
+ }
+
+ parentMetadataMap && Object.setPrototypeOf(metadataMap, parentMetadataMap), obj[Symbol.metadata || Symbol["for"]("Symbol.metadata")] = metadataMap;
+ }
+}
+
+function createAddInitializerMethod(initializers, decoratorFinishedRef) {
+ return function (initializer) {
+ assertNotFinished(decoratorFinishedRef, "addInitializer"), assertCallable(initializer, "An initializer"), initializers.push(initializer);
+ };
+}
+
+function memberDec(dec, name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value) {
+ var kindStr;
+
+ switch (kind) {
+ case 1:
+ kindStr = "accessor";
+ break;
+
+ case 2:
+ kindStr = "method";
+ break;
+
+ case 3:
+ kindStr = "getter";
+ break;
+
+ case 4:
+ kindStr = "setter";
+ break;
+
+ default:
+ kindStr = "field";
+ }
+
+ var metadataKind,
+ metadataName,
+ ctx = {
+ kind: kindStr,
+ name: isPrivate ? "#" + name : name,
+ isStatic: isStatic,
+ isPrivate: isPrivate
+ },
+ decoratorFinishedRef = {
+ v: !1
+ };
+
+ if (0 !== kind && (ctx.addInitializer = createAddInitializerMethod(initializers, decoratorFinishedRef)), isPrivate) {
+ metadataKind = 2, metadataName = Symbol(name);
+ var access = {};
+ 0 === kind ? (access.get = desc.get, access.set = desc.set) : 2 === kind ? access.get = function () {
+ return desc.value;
+ } : (1 !== kind && 3 !== kind || (access.get = function () {
+ return desc.get.call(this);
+ }), 1 !== kind && 4 !== kind || (access.set = function (v) {
+ desc.set.call(this, v);
+ })), ctx.access = access;
+ } else metadataKind = 1, metadataName = name;
+
+ try {
+ return dec(value, Object.assign(ctx, createMetadataMethodsForProperty(metadataMap, metadataKind, metadataName, decoratorFinishedRef)));
+ } finally {
+ decoratorFinishedRef.v = !0;
+ }
+}
+
+function assertNotFinished(decoratorFinishedRef, fnName) {
+ if (decoratorFinishedRef.v) throw new Error("attempted to call " + fnName + " after decoration was finished");
+}
+
+function assertMetadataKey(key) {
+ if ("symbol" != _typeof(key)) throw new TypeError("Metadata keys must be symbols, received: " + key);
+}
+
+function assertCallable(fn, hint) {
+ if ("function" != typeof fn) throw new TypeError(hint + " must be a function");
+}
+
+function assertValidReturnValue(kind, value) {
+ var type = _typeof(value);
+
+ if (1 === kind) {
+ if ("object" !== type || null === value) throw new TypeError("accessor decorators must return an object with get, set, or init properties or void 0");
+ void 0 !== value.get && assertCallable(value.get, "accessor.get"), void 0 !== value.set && assertCallable(value.set, "accessor.set"), void 0 !== value.init && assertCallable(value.init, "accessor.init"), void 0 !== value.initializer && assertCallable(value.initializer, "accessor.initializer");
+ } else if ("function" !== type) {
+ var hint;
+ throw hint = 0 === kind ? "field" : 10 === kind ? "class" : "method", new TypeError(hint + " decorators must return a function or void 0");
+ }
+}
+
+function getInit(desc) {
+ var initializer;
+ return null == (initializer = desc.init) && (initializer = desc.initializer) && "undefined" != typeof console && console.warn(".initializer has been renamed to .init as of March 2022"), initializer;
+}
+
+function applyMemberDec(ret, base, decInfo, name, kind, isStatic, isPrivate, metadataMap, initializers) {
+ var desc,
+ initializer,
+ value,
+ newValue,
+ get,
+ set,
+ decs = decInfo[0];
+ if (isPrivate ? desc = 0 === kind || 1 === kind ? {
+ get: decInfo[3],
+ set: decInfo[4]
+ } : 3 === kind ? {
+ get: decInfo[3]
+ } : 4 === kind ? {
+ set: decInfo[3]
+ } : {
+ value: decInfo[3]
+ } : 0 !== kind && (desc = Object.getOwnPropertyDescriptor(base, name)), 1 === kind ? value = {
+ get: desc.get,
+ set: desc.set
+ } : 2 === kind ? value = desc.value : 3 === kind ? value = desc.get : 4 === kind && (value = desc.set), "function" == typeof decs) void 0 !== (newValue = memberDec(decs, name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value)) && (assertValidReturnValue(kind, newValue), 0 === kind ? initializer = newValue : 1 === kind ? (initializer = getInit(newValue), get = newValue.get || value.get, set = newValue.set || value.set, value = {
+ get: get,
+ set: set
+ }) : value = newValue);else for (var i = decs.length - 1; i >= 0; i--) {
+ var newInit;
+ if (void 0 !== (newValue = memberDec(decs[i], name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value))) assertValidReturnValue(kind, newValue), 0 === kind ? newInit = newValue : 1 === kind ? (newInit = getInit(newValue), get = newValue.get || value.get, set = newValue.set || value.set, value = {
+ get: get,
+ set: set
+ }) : value = newValue, void 0 !== newInit && (void 0 === initializer ? initializer = newInit : "function" == typeof initializer ? initializer = [initializer, newInit] : initializer.push(newInit));
+ }
+
+ if (0 === kind || 1 === kind) {
+ if (void 0 === initializer) initializer = function initializer(instance, init) {
+ return init;
+ };else if ("function" != typeof initializer) {
+ var ownInitializers = initializer;
+
+ initializer = function initializer(instance, init) {
+ for (var value = init, i = 0; i < ownInitializers.length; i++) {
+ value = ownInitializers[i].call(instance, value);
+ }
+
+ return value;
+ };
+ } else {
+ var originalInitializer = initializer;
+
+ initializer = function initializer(instance, init) {
+ return originalInitializer.call(instance, init);
+ };
+ }
+ ret.push(initializer);
+ }
+
+ 0 !== kind && (1 === kind ? (desc.get = value.get, desc.set = value.set) : 2 === kind ? desc.value = value : 3 === kind ? desc.get = value : 4 === kind && (desc.set = value), isPrivate ? 1 === kind ? (ret.push(function (instance, args) {
+ return value.get.call(instance, args);
+ }), ret.push(function (instance, args) {
+ return value.set.call(instance, args);
+ })) : 2 === kind ? ret.push(value) : ret.push(function (instance, args) {
+ return value.call(instance, args);
+ }) : Object.defineProperty(base, name, desc));
+}
+
+function applyMemberDecs(ret, Class, protoMetadataMap, staticMetadataMap, decInfos) {
+ for (var protoInitializers, staticInitializers, existingProtoNonFields = new Map(), existingStaticNonFields = new Map(), i = 0; i < decInfos.length; i++) {
+ var decInfo = decInfos[i];
+
+ if (Array.isArray(decInfo)) {
+ var base,
+ metadataMap,
+ initializers,
+ kind = decInfo[1],
+ name = decInfo[2],
+ isPrivate = decInfo.length > 3,
+ isStatic = kind >= 5;
+
+ if (isStatic ? (base = Class, metadataMap = staticMetadataMap, 0 !== (kind -= 5) && (initializers = staticInitializers = staticInitializers || [])) : (base = Class.prototype, metadataMap = protoMetadataMap, 0 !== kind && (initializers = protoInitializers = protoInitializers || [])), 0 !== kind && !isPrivate) {
+ var existingNonFields = isStatic ? existingStaticNonFields : existingProtoNonFields,
+ existingKind = existingNonFields.get(name) || 0;
+ if (!0 === existingKind || 3 === existingKind && 4 !== kind || 4 === existingKind && 3 !== kind) throw new Error("Attempted to decorate a public method/accessor that has the same name as a previously decorated public method/accessor. This is not currently supported by the decorators plugin. Property name was: " + name);
+ !existingKind && kind > 2 ? existingNonFields.set(name, kind) : existingNonFields.set(name, !0);
+ }
+
+ applyMemberDec(ret, base, decInfo, name, kind, isStatic, isPrivate, metadataMap, initializers);
+ }
+ }
+
+ pushInitializers(ret, protoInitializers), pushInitializers(ret, staticInitializers);
+}
+
+function pushInitializers(ret, initializers) {
+ initializers && ret.push(function (instance) {
+ for (var i = 0; i < initializers.length; i++) {
+ initializers[i].call(instance);
+ }
+
+ return instance;
+ });
+}
+
+function applyClassDecs(ret, targetClass, metadataMap, classDecs) {
+ if (classDecs.length > 0) {
+ for (var initializers = [], newClass = targetClass, name = targetClass.name, i = classDecs.length - 1; i >= 0; i--) {
+ var decoratorFinishedRef = {
+ v: !1
+ };
+
+ try {
+ var ctx = Object.assign({
+ kind: "class",
+ name: name,
+ addInitializer: createAddInitializerMethod(initializers, decoratorFinishedRef)
+ }, createMetadataMethodsForProperty(metadataMap, 0, name, decoratorFinishedRef)),
+ nextNewClass = classDecs[i](newClass, ctx);
+ } finally {
+ decoratorFinishedRef.v = !0;
+ }
+
+ void 0 !== nextNewClass && (assertValidReturnValue(10, nextNewClass), newClass = nextNewClass);
+ }
+
+ ret.push(newClass, function () {
+ for (var i = 0; i < initializers.length; i++) {
+ initializers[i].call(newClass);
+ }
+ });
+ }
+}
+
+function applyDecs(targetClass, memberDecs, classDecs) {
+ var ret = [],
+ staticMetadataMap = {},
+ protoMetadataMap = {};
+ return applyMemberDecs(ret, targetClass, protoMetadataMap, staticMetadataMap, memberDecs), convertMetadataMapToFinal(targetClass.prototype, protoMetadataMap), applyClassDecs(ret, targetClass, staticMetadataMap, classDecs), convertMetadataMapToFinal(targetClass, staticMetadataMap), ret;
+}
+
+module.exports = applyDecs, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/arrayLikeToArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/arrayLikeToArray.js
new file mode 100644
index 00000000..465974f1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/arrayLikeToArray.js
@@ -0,0 +1,11 @@
+function _arrayLikeToArray(arr, len) {
+ if (len == null || len > arr.length) len = arr.length;
+
+ for (var i = 0, arr2 = new Array(len); i < len; i++) {
+ arr2[i] = arr[i];
+ }
+
+ return arr2;
+}
+
+module.exports = _arrayLikeToArray, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/arrayWithHoles.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/arrayWithHoles.js
new file mode 100644
index 00000000..b5680a0e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/arrayWithHoles.js
@@ -0,0 +1,5 @@
+function _arrayWithHoles(arr) {
+ if (Array.isArray(arr)) return arr;
+}
+
+module.exports = _arrayWithHoles, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/arrayWithoutHoles.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/arrayWithoutHoles.js
new file mode 100644
index 00000000..30bf377f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/arrayWithoutHoles.js
@@ -0,0 +1,7 @@
+var arrayLikeToArray = require("./arrayLikeToArray.js");
+
+function _arrayWithoutHoles(arr) {
+ if (Array.isArray(arr)) return arrayLikeToArray(arr);
+}
+
+module.exports = _arrayWithoutHoles, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/assertThisInitialized.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/assertThisInitialized.js
new file mode 100644
index 00000000..70ea8557
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/assertThisInitialized.js
@@ -0,0 +1,9 @@
+function _assertThisInitialized(self) {
+ if (self === void 0) {
+ throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
+ }
+
+ return self;
+}
+
+module.exports = _assertThisInitialized, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/asyncGeneratorDelegate.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/asyncGeneratorDelegate.js
new file mode 100644
index 00000000..cf7d4801
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/asyncGeneratorDelegate.js
@@ -0,0 +1,56 @@
+function _asyncGeneratorDelegate(inner, awaitWrap) {
+ var iter = {},
+ waiting = false;
+
+ function pump(key, value) {
+ waiting = true;
+ value = new Promise(function (resolve) {
+ resolve(inner[key](value));
+ });
+ return {
+ done: false,
+ value: awaitWrap(value)
+ };
+ }
+
+ ;
+
+ iter[typeof Symbol !== "undefined" && Symbol.iterator || "@@iterator"] = function () {
+ return this;
+ };
+
+ iter.next = function (value) {
+ if (waiting) {
+ waiting = false;
+ return value;
+ }
+
+ return pump("next", value);
+ };
+
+ if (typeof inner["throw"] === "function") {
+ iter["throw"] = function (value) {
+ if (waiting) {
+ waiting = false;
+ throw value;
+ }
+
+ return pump("throw", value);
+ };
+ }
+
+ if (typeof inner["return"] === "function") {
+ iter["return"] = function (value) {
+ if (waiting) {
+ waiting = false;
+ return value;
+ }
+
+ return pump("return", value);
+ };
+ }
+
+ return iter;
+}
+
+module.exports = _asyncGeneratorDelegate, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/asyncIterator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/asyncIterator.js
new file mode 100644
index 00000000..d8e11f01
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/asyncIterator.js
@@ -0,0 +1,50 @@
+function _asyncIterator(iterable) {
+ var method,
+ async,
+ sync,
+ retry = 2;
+
+ for ("undefined" != typeof Symbol && (async = Symbol.asyncIterator, sync = Symbol.iterator); retry--;) {
+ if (async && null != (method = iterable[async])) return method.call(iterable);
+ if (sync && null != (method = iterable[sync])) return new AsyncFromSyncIterator(method.call(iterable));
+ async = "@@asyncIterator", sync = "@@iterator";
+ }
+
+ throw new TypeError("Object is not async iterable");
+}
+
+function AsyncFromSyncIterator(s) {
+ function AsyncFromSyncIteratorContinuation(r) {
+ if (Object(r) !== r) return Promise.reject(new TypeError(r + " is not an object."));
+ var done = r.done;
+ return Promise.resolve(r.value).then(function (value) {
+ return {
+ value: value,
+ done: done
+ };
+ });
+ }
+
+ return AsyncFromSyncIterator = function AsyncFromSyncIterator(s) {
+ this.s = s, this.n = s.next;
+ }, AsyncFromSyncIterator.prototype = {
+ s: null,
+ n: null,
+ next: function next() {
+ return AsyncFromSyncIteratorContinuation(this.n.apply(this.s, arguments));
+ },
+ "return": function _return(value) {
+ var ret = this.s["return"];
+ return void 0 === ret ? Promise.resolve({
+ value: value,
+ done: !0
+ }) : AsyncFromSyncIteratorContinuation(ret.apply(this.s, arguments));
+ },
+ "throw": function _throw(value) {
+ var thr = this.s["return"];
+ return void 0 === thr ? Promise.reject(value) : AsyncFromSyncIteratorContinuation(thr.apply(this.s, arguments));
+ }
+ }, new AsyncFromSyncIterator(s);
+}
+
+module.exports = _asyncIterator, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/asyncToGenerator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/asyncToGenerator.js
new file mode 100644
index 00000000..becd1630
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/asyncToGenerator.js
@@ -0,0 +1,37 @@
+function asyncGeneratorStep(gen, resolve, reject, _next, _throw, key, arg) {
+ try {
+ var info = gen[key](arg);
+ var value = info.value;
+ } catch (error) {
+ reject(error);
+ return;
+ }
+
+ if (info.done) {
+ resolve(value);
+ } else {
+ Promise.resolve(value).then(_next, _throw);
+ }
+}
+
+function _asyncToGenerator(fn) {
+ return function () {
+ var self = this,
+ args = arguments;
+ return new Promise(function (resolve, reject) {
+ var gen = fn.apply(self, args);
+
+ function _next(value) {
+ asyncGeneratorStep(gen, resolve, reject, _next, _throw, "next", value);
+ }
+
+ function _throw(err) {
+ asyncGeneratorStep(gen, resolve, reject, _next, _throw, "throw", err);
+ }
+
+ _next(undefined);
+ });
+ };
+}
+
+module.exports = _asyncToGenerator, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/awaitAsyncGenerator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/awaitAsyncGenerator.js
new file mode 100644
index 00000000..f0f30ed7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/awaitAsyncGenerator.js
@@ -0,0 +1,7 @@
+var AwaitValue = require("./AwaitValue.js");
+
+function _awaitAsyncGenerator(value) {
+ return new AwaitValue(value);
+}
+
+module.exports = _awaitAsyncGenerator, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/checkPrivateRedeclaration.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/checkPrivateRedeclaration.js
new file mode 100644
index 00000000..6cd0fcbb
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/checkPrivateRedeclaration.js
@@ -0,0 +1,7 @@
+function _checkPrivateRedeclaration(obj, privateCollection) {
+ if (privateCollection.has(obj)) {
+ throw new TypeError("Cannot initialize the same private elements twice on an object");
+ }
+}
+
+module.exports = _checkPrivateRedeclaration, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classApplyDescriptorDestructureSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classApplyDescriptorDestructureSet.js
new file mode 100644
index 00000000..ea1c860d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classApplyDescriptorDestructureSet.js
@@ -0,0 +1,22 @@
+function _classApplyDescriptorDestructureSet(receiver, descriptor) {
+ if (descriptor.set) {
+ if (!("__destrObj" in descriptor)) {
+ descriptor.__destrObj = {
+ set value(v) {
+ descriptor.set.call(receiver, v);
+ }
+
+ };
+ }
+
+ return descriptor.__destrObj;
+ } else {
+ if (!descriptor.writable) {
+ throw new TypeError("attempted to set read only private field");
+ }
+
+ return descriptor;
+ }
+}
+
+module.exports = _classApplyDescriptorDestructureSet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classApplyDescriptorGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classApplyDescriptorGet.js
new file mode 100644
index 00000000..b9d0e949
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classApplyDescriptorGet.js
@@ -0,0 +1,9 @@
+function _classApplyDescriptorGet(receiver, descriptor) {
+ if (descriptor.get) {
+ return descriptor.get.call(receiver);
+ }
+
+ return descriptor.value;
+}
+
+module.exports = _classApplyDescriptorGet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classApplyDescriptorSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classApplyDescriptorSet.js
new file mode 100644
index 00000000..9824b5c5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classApplyDescriptorSet.js
@@ -0,0 +1,13 @@
+function _classApplyDescriptorSet(receiver, descriptor, value) {
+ if (descriptor.set) {
+ descriptor.set.call(receiver, value);
+ } else {
+ if (!descriptor.writable) {
+ throw new TypeError("attempted to set read only private field");
+ }
+
+ descriptor.value = value;
+ }
+}
+
+module.exports = _classApplyDescriptorSet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classCallCheck.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classCallCheck.js
new file mode 100644
index 00000000..14188453
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classCallCheck.js
@@ -0,0 +1,7 @@
+function _classCallCheck(instance, Constructor) {
+ if (!(instance instanceof Constructor)) {
+ throw new TypeError("Cannot call a class as a function");
+ }
+}
+
+module.exports = _classCallCheck, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classCheckPrivateStaticAccess.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classCheckPrivateStaticAccess.js
new file mode 100644
index 00000000..7f5213bc
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classCheckPrivateStaticAccess.js
@@ -0,0 +1,7 @@
+function _classCheckPrivateStaticAccess(receiver, classConstructor) {
+ if (receiver !== classConstructor) {
+ throw new TypeError("Private static access of wrong provenance");
+ }
+}
+
+module.exports = _classCheckPrivateStaticAccess, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classCheckPrivateStaticFieldDescriptor.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classCheckPrivateStaticFieldDescriptor.js
new file mode 100644
index 00000000..87ec4ea8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classCheckPrivateStaticFieldDescriptor.js
@@ -0,0 +1,7 @@
+function _classCheckPrivateStaticFieldDescriptor(descriptor, action) {
+ if (descriptor === undefined) {
+ throw new TypeError("attempted to " + action + " private static field before its declaration");
+ }
+}
+
+module.exports = _classCheckPrivateStaticFieldDescriptor, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classExtractFieldDescriptor.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classExtractFieldDescriptor.js
new file mode 100644
index 00000000..5c422bfc
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classExtractFieldDescriptor.js
@@ -0,0 +1,9 @@
+function _classExtractFieldDescriptor(receiver, privateMap, action) {
+ if (!privateMap.has(receiver)) {
+ throw new TypeError("attempted to " + action + " private field on non-instance");
+ }
+
+ return privateMap.get(receiver);
+}
+
+module.exports = _classExtractFieldDescriptor, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classNameTDZError.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classNameTDZError.js
new file mode 100644
index 00000000..9a48c703
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classNameTDZError.js
@@ -0,0 +1,5 @@
+function _classNameTDZError(name) {
+ throw new Error("Class \"" + name + "\" cannot be referenced in computed property keys.");
+}
+
+module.exports = _classNameTDZError, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldDestructureSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldDestructureSet.js
new file mode 100644
index 00000000..07abfe5f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldDestructureSet.js
@@ -0,0 +1,10 @@
+var classApplyDescriptorDestructureSet = require("./classApplyDescriptorDestructureSet.js");
+
+var classExtractFieldDescriptor = require("./classExtractFieldDescriptor.js");
+
+function _classPrivateFieldDestructureSet(receiver, privateMap) {
+ var descriptor = classExtractFieldDescriptor(receiver, privateMap, "set");
+ return classApplyDescriptorDestructureSet(receiver, descriptor);
+}
+
+module.exports = _classPrivateFieldDestructureSet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldGet.js
new file mode 100644
index 00000000..470ded71
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldGet.js
@@ -0,0 +1,10 @@
+var classApplyDescriptorGet = require("./classApplyDescriptorGet.js");
+
+var classExtractFieldDescriptor = require("./classExtractFieldDescriptor.js");
+
+function _classPrivateFieldGet(receiver, privateMap) {
+ var descriptor = classExtractFieldDescriptor(receiver, privateMap, "get");
+ return classApplyDescriptorGet(receiver, descriptor);
+}
+
+module.exports = _classPrivateFieldGet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldInitSpec.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldInitSpec.js
new file mode 100644
index 00000000..a6243c27
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldInitSpec.js
@@ -0,0 +1,8 @@
+var checkPrivateRedeclaration = require("./checkPrivateRedeclaration.js");
+
+function _classPrivateFieldInitSpec(obj, privateMap, value) {
+ checkPrivateRedeclaration(obj, privateMap);
+ privateMap.set(obj, value);
+}
+
+module.exports = _classPrivateFieldInitSpec, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldLooseBase.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldLooseBase.js
new file mode 100644
index 00000000..571109ff
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldLooseBase.js
@@ -0,0 +1,9 @@
+function _classPrivateFieldBase(receiver, privateKey) {
+ if (!Object.prototype.hasOwnProperty.call(receiver, privateKey)) {
+ throw new TypeError("attempted to use private field on non-instance");
+ }
+
+ return receiver;
+}
+
+module.exports = _classPrivateFieldBase, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldLooseKey.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldLooseKey.js
new file mode 100644
index 00000000..b05e1940
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldLooseKey.js
@@ -0,0 +1,7 @@
+var id = 0;
+
+function _classPrivateFieldKey(name) {
+ return "__private_" + id++ + "_" + name;
+}
+
+module.exports = _classPrivateFieldKey, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldSet.js
new file mode 100644
index 00000000..f8ab8420
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateFieldSet.js
@@ -0,0 +1,11 @@
+var classApplyDescriptorSet = require("./classApplyDescriptorSet.js");
+
+var classExtractFieldDescriptor = require("./classExtractFieldDescriptor.js");
+
+function _classPrivateFieldSet(receiver, privateMap, value) {
+ var descriptor = classExtractFieldDescriptor(receiver, privateMap, "set");
+ classApplyDescriptorSet(receiver, descriptor, value);
+ return value;
+}
+
+module.exports = _classPrivateFieldSet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateMethodGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateMethodGet.js
new file mode 100644
index 00000000..540a1f3e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateMethodGet.js
@@ -0,0 +1,9 @@
+function _classPrivateMethodGet(receiver, privateSet, fn) {
+ if (!privateSet.has(receiver)) {
+ throw new TypeError("attempted to get private field on non-instance");
+ }
+
+ return fn;
+}
+
+module.exports = _classPrivateMethodGet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateMethodInitSpec.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateMethodInitSpec.js
new file mode 100644
index 00000000..6c4df76e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateMethodInitSpec.js
@@ -0,0 +1,8 @@
+var checkPrivateRedeclaration = require("./checkPrivateRedeclaration.js");
+
+function _classPrivateMethodInitSpec(obj, privateSet) {
+ checkPrivateRedeclaration(obj, privateSet);
+ privateSet.add(obj);
+}
+
+module.exports = _classPrivateMethodInitSpec, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateMethodSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateMethodSet.js
new file mode 100644
index 00000000..226789d5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classPrivateMethodSet.js
@@ -0,0 +1,5 @@
+function _classPrivateMethodSet() {
+ throw new TypeError("attempted to reassign private method");
+}
+
+module.exports = _classPrivateMethodSet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateFieldDestructureSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateFieldDestructureSet.js
new file mode 100644
index 00000000..120c74d8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateFieldDestructureSet.js
@@ -0,0 +1,13 @@
+var classApplyDescriptorDestructureSet = require("./classApplyDescriptorDestructureSet.js");
+
+var classCheckPrivateStaticAccess = require("./classCheckPrivateStaticAccess.js");
+
+var classCheckPrivateStaticFieldDescriptor = require("./classCheckPrivateStaticFieldDescriptor.js");
+
+function _classStaticPrivateFieldDestructureSet(receiver, classConstructor, descriptor) {
+ classCheckPrivateStaticAccess(receiver, classConstructor);
+ classCheckPrivateStaticFieldDescriptor(descriptor, "set");
+ return classApplyDescriptorDestructureSet(receiver, descriptor);
+}
+
+module.exports = _classStaticPrivateFieldDestructureSet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecGet.js
new file mode 100644
index 00000000..d7201c33
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecGet.js
@@ -0,0 +1,13 @@
+var classApplyDescriptorGet = require("./classApplyDescriptorGet.js");
+
+var classCheckPrivateStaticAccess = require("./classCheckPrivateStaticAccess.js");
+
+var classCheckPrivateStaticFieldDescriptor = require("./classCheckPrivateStaticFieldDescriptor.js");
+
+function _classStaticPrivateFieldSpecGet(receiver, classConstructor, descriptor) {
+ classCheckPrivateStaticAccess(receiver, classConstructor);
+ classCheckPrivateStaticFieldDescriptor(descriptor, "get");
+ return classApplyDescriptorGet(receiver, descriptor);
+}
+
+module.exports = _classStaticPrivateFieldSpecGet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecSet.js
new file mode 100644
index 00000000..2aa13ef9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecSet.js
@@ -0,0 +1,14 @@
+var classApplyDescriptorSet = require("./classApplyDescriptorSet.js");
+
+var classCheckPrivateStaticAccess = require("./classCheckPrivateStaticAccess.js");
+
+var classCheckPrivateStaticFieldDescriptor = require("./classCheckPrivateStaticFieldDescriptor.js");
+
+function _classStaticPrivateFieldSpecSet(receiver, classConstructor, descriptor, value) {
+ classCheckPrivateStaticAccess(receiver, classConstructor);
+ classCheckPrivateStaticFieldDescriptor(descriptor, "set");
+ classApplyDescriptorSet(receiver, descriptor, value);
+ return value;
+}
+
+module.exports = _classStaticPrivateFieldSpecSet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateMethodGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateMethodGet.js
new file mode 100644
index 00000000..d77c8422
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateMethodGet.js
@@ -0,0 +1,8 @@
+var classCheckPrivateStaticAccess = require("./classCheckPrivateStaticAccess.js");
+
+function _classStaticPrivateMethodGet(receiver, classConstructor, method) {
+ classCheckPrivateStaticAccess(receiver, classConstructor);
+ return method;
+}
+
+module.exports = _classStaticPrivateMethodGet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateMethodSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateMethodSet.js
new file mode 100644
index 00000000..2e1c83fd
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/classStaticPrivateMethodSet.js
@@ -0,0 +1,5 @@
+function _classStaticPrivateMethodSet() {
+ throw new TypeError("attempted to set read only static private field");
+}
+
+module.exports = _classStaticPrivateMethodSet, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/construct.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/construct.js
new file mode 100644
index 00000000..c2518afc
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/construct.js
@@ -0,0 +1,22 @@
+var setPrototypeOf = require("./setPrototypeOf.js");
+
+var isNativeReflectConstruct = require("./isNativeReflectConstruct.js");
+
+function _construct(Parent, args, Class) {
+ if (isNativeReflectConstruct()) {
+ module.exports = _construct = Reflect.construct, module.exports.__esModule = true, module.exports["default"] = module.exports;
+ } else {
+ module.exports = _construct = function _construct(Parent, args, Class) {
+ var a = [null];
+ a.push.apply(a, args);
+ var Constructor = Function.bind.apply(Parent, a);
+ var instance = new Constructor();
+ if (Class) setPrototypeOf(instance, Class.prototype);
+ return instance;
+ }, module.exports.__esModule = true, module.exports["default"] = module.exports;
+ }
+
+ return _construct.apply(null, arguments);
+}
+
+module.exports = _construct, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createClass.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createClass.js
new file mode 100644
index 00000000..4273e7a1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createClass.js
@@ -0,0 +1,20 @@
+function _defineProperties(target, props) {
+ for (var i = 0; i < props.length; i++) {
+ var descriptor = props[i];
+ descriptor.enumerable = descriptor.enumerable || false;
+ descriptor.configurable = true;
+ if ("value" in descriptor) descriptor.writable = true;
+ Object.defineProperty(target, descriptor.key, descriptor);
+ }
+}
+
+function _createClass(Constructor, protoProps, staticProps) {
+ if (protoProps) _defineProperties(Constructor.prototype, protoProps);
+ if (staticProps) _defineProperties(Constructor, staticProps);
+ Object.defineProperty(Constructor, "prototype", {
+ writable: false
+ });
+ return Constructor;
+}
+
+module.exports = _createClass, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createForOfIteratorHelper.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createForOfIteratorHelper.js
new file mode 100644
index 00000000..0835893b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createForOfIteratorHelper.js
@@ -0,0 +1,60 @@
+var unsupportedIterableToArray = require("./unsupportedIterableToArray.js");
+
+function _createForOfIteratorHelper(o, allowArrayLike) {
+ var it = typeof Symbol !== "undefined" && o[Symbol.iterator] || o["@@iterator"];
+
+ if (!it) {
+ if (Array.isArray(o) || (it = unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") {
+ if (it) o = it;
+ var i = 0;
+
+ var F = function F() {};
+
+ return {
+ s: F,
+ n: function n() {
+ if (i >= o.length) return {
+ done: true
+ };
+ return {
+ done: false,
+ value: o[i++]
+ };
+ },
+ e: function e(_e) {
+ throw _e;
+ },
+ f: F
+ };
+ }
+
+ throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+ }
+
+ var normalCompletion = true,
+ didErr = false,
+ err;
+ return {
+ s: function s() {
+ it = it.call(o);
+ },
+ n: function n() {
+ var step = it.next();
+ normalCompletion = step.done;
+ return step;
+ },
+ e: function e(_e2) {
+ didErr = true;
+ err = _e2;
+ },
+ f: function f() {
+ try {
+ if (!normalCompletion && it["return"] != null) it["return"]();
+ } finally {
+ if (didErr) throw err;
+ }
+ }
+ };
+}
+
+module.exports = _createForOfIteratorHelper, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createForOfIteratorHelperLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createForOfIteratorHelperLoose.js
new file mode 100644
index 00000000..65d3bc9e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createForOfIteratorHelperLoose.js
@@ -0,0 +1,24 @@
+var unsupportedIterableToArray = require("./unsupportedIterableToArray.js");
+
+function _createForOfIteratorHelperLoose(o, allowArrayLike) {
+ var it = typeof Symbol !== "undefined" && o[Symbol.iterator] || o["@@iterator"];
+ if (it) return (it = it.call(o)).next.bind(it);
+
+ if (Array.isArray(o) || (it = unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") {
+ if (it) o = it;
+ var i = 0;
+ return function () {
+ if (i >= o.length) return {
+ done: true
+ };
+ return {
+ done: false,
+ value: o[i++]
+ };
+ };
+ }
+
+ throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+}
+
+module.exports = _createForOfIteratorHelperLoose, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createSuper.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createSuper.js
new file mode 100644
index 00000000..624728bb
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/createSuper.js
@@ -0,0 +1,24 @@
+var getPrototypeOf = require("./getPrototypeOf.js");
+
+var isNativeReflectConstruct = require("./isNativeReflectConstruct.js");
+
+var possibleConstructorReturn = require("./possibleConstructorReturn.js");
+
+function _createSuper(Derived) {
+ var hasNativeReflectConstruct = isNativeReflectConstruct();
+ return function _createSuperInternal() {
+ var Super = getPrototypeOf(Derived),
+ result;
+
+ if (hasNativeReflectConstruct) {
+ var NewTarget = getPrototypeOf(this).constructor;
+ result = Reflect.construct(Super, arguments, NewTarget);
+ } else {
+ result = Super.apply(this, arguments);
+ }
+
+ return possibleConstructorReturn(this, result);
+ };
+}
+
+module.exports = _createSuper, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/decorate.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/decorate.js
new file mode 100644
index 00000000..3bd35e7d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/decorate.js
@@ -0,0 +1,400 @@
+var toArray = require("./toArray.js");
+
+var toPropertyKey = require("./toPropertyKey.js");
+
+function _decorate(decorators, factory, superClass, mixins) {
+ var api = _getDecoratorsApi();
+
+ if (mixins) {
+ for (var i = 0; i < mixins.length; i++) {
+ api = mixins[i](api);
+ }
+ }
+
+ var r = factory(function initialize(O) {
+ api.initializeInstanceElements(O, decorated.elements);
+ }, superClass);
+ var decorated = api.decorateClass(_coalesceClassElements(r.d.map(_createElementDescriptor)), decorators);
+ api.initializeClassElements(r.F, decorated.elements);
+ return api.runClassFinishers(r.F, decorated.finishers);
+}
+
+function _getDecoratorsApi() {
+ _getDecoratorsApi = function _getDecoratorsApi() {
+ return api;
+ };
+
+ var api = {
+ elementsDefinitionOrder: [["method"], ["field"]],
+ initializeInstanceElements: function initializeInstanceElements(O, elements) {
+ ["method", "field"].forEach(function (kind) {
+ elements.forEach(function (element) {
+ if (element.kind === kind && element.placement === "own") {
+ this.defineClassElement(O, element);
+ }
+ }, this);
+ }, this);
+ },
+ initializeClassElements: function initializeClassElements(F, elements) {
+ var proto = F.prototype;
+ ["method", "field"].forEach(function (kind) {
+ elements.forEach(function (element) {
+ var placement = element.placement;
+
+ if (element.kind === kind && (placement === "static" || placement === "prototype")) {
+ var receiver = placement === "static" ? F : proto;
+ this.defineClassElement(receiver, element);
+ }
+ }, this);
+ }, this);
+ },
+ defineClassElement: function defineClassElement(receiver, element) {
+ var descriptor = element.descriptor;
+
+ if (element.kind === "field") {
+ var initializer = element.initializer;
+ descriptor = {
+ enumerable: descriptor.enumerable,
+ writable: descriptor.writable,
+ configurable: descriptor.configurable,
+ value: initializer === void 0 ? void 0 : initializer.call(receiver)
+ };
+ }
+
+ Object.defineProperty(receiver, element.key, descriptor);
+ },
+ decorateClass: function decorateClass(elements, decorators) {
+ var newElements = [];
+ var finishers = [];
+ var placements = {
+ "static": [],
+ prototype: [],
+ own: []
+ };
+ elements.forEach(function (element) {
+ this.addElementPlacement(element, placements);
+ }, this);
+ elements.forEach(function (element) {
+ if (!_hasDecorators(element)) return newElements.push(element);
+ var elementFinishersExtras = this.decorateElement(element, placements);
+ newElements.push(elementFinishersExtras.element);
+ newElements.push.apply(newElements, elementFinishersExtras.extras);
+ finishers.push.apply(finishers, elementFinishersExtras.finishers);
+ }, this);
+
+ if (!decorators) {
+ return {
+ elements: newElements,
+ finishers: finishers
+ };
+ }
+
+ var result = this.decorateConstructor(newElements, decorators);
+ finishers.push.apply(finishers, result.finishers);
+ result.finishers = finishers;
+ return result;
+ },
+ addElementPlacement: function addElementPlacement(element, placements, silent) {
+ var keys = placements[element.placement];
+
+ if (!silent && keys.indexOf(element.key) !== -1) {
+ throw new TypeError("Duplicated element (" + element.key + ")");
+ }
+
+ keys.push(element.key);
+ },
+ decorateElement: function decorateElement(element, placements) {
+ var extras = [];
+ var finishers = [];
+
+ for (var decorators = element.decorators, i = decorators.length - 1; i >= 0; i--) {
+ var keys = placements[element.placement];
+ keys.splice(keys.indexOf(element.key), 1);
+ var elementObject = this.fromElementDescriptor(element);
+ var elementFinisherExtras = this.toElementFinisherExtras((0, decorators[i])(elementObject) || elementObject);
+ element = elementFinisherExtras.element;
+ this.addElementPlacement(element, placements);
+
+ if (elementFinisherExtras.finisher) {
+ finishers.push(elementFinisherExtras.finisher);
+ }
+
+ var newExtras = elementFinisherExtras.extras;
+
+ if (newExtras) {
+ for (var j = 0; j < newExtras.length; j++) {
+ this.addElementPlacement(newExtras[j], placements);
+ }
+
+ extras.push.apply(extras, newExtras);
+ }
+ }
+
+ return {
+ element: element,
+ finishers: finishers,
+ extras: extras
+ };
+ },
+ decorateConstructor: function decorateConstructor(elements, decorators) {
+ var finishers = [];
+
+ for (var i = decorators.length - 1; i >= 0; i--) {
+ var obj = this.fromClassDescriptor(elements);
+ var elementsAndFinisher = this.toClassDescriptor((0, decorators[i])(obj) || obj);
+
+ if (elementsAndFinisher.finisher !== undefined) {
+ finishers.push(elementsAndFinisher.finisher);
+ }
+
+ if (elementsAndFinisher.elements !== undefined) {
+ elements = elementsAndFinisher.elements;
+
+ for (var j = 0; j < elements.length - 1; j++) {
+ for (var k = j + 1; k < elements.length; k++) {
+ if (elements[j].key === elements[k].key && elements[j].placement === elements[k].placement) {
+ throw new TypeError("Duplicated element (" + elements[j].key + ")");
+ }
+ }
+ }
+ }
+ }
+
+ return {
+ elements: elements,
+ finishers: finishers
+ };
+ },
+ fromElementDescriptor: function fromElementDescriptor(element) {
+ var obj = {
+ kind: element.kind,
+ key: element.key,
+ placement: element.placement,
+ descriptor: element.descriptor
+ };
+ var desc = {
+ value: "Descriptor",
+ configurable: true
+ };
+ Object.defineProperty(obj, Symbol.toStringTag, desc);
+ if (element.kind === "field") obj.initializer = element.initializer;
+ return obj;
+ },
+ toElementDescriptors: function toElementDescriptors(elementObjects) {
+ if (elementObjects === undefined) return;
+ return toArray(elementObjects).map(function (elementObject) {
+ var element = this.toElementDescriptor(elementObject);
+ this.disallowProperty(elementObject, "finisher", "An element descriptor");
+ this.disallowProperty(elementObject, "extras", "An element descriptor");
+ return element;
+ }, this);
+ },
+ toElementDescriptor: function toElementDescriptor(elementObject) {
+ var kind = String(elementObject.kind);
+
+ if (kind !== "method" && kind !== "field") {
+ throw new TypeError('An element descriptor\'s .kind property must be either "method" or' + ' "field", but a decorator created an element descriptor with' + ' .kind "' + kind + '"');
+ }
+
+ var key = toPropertyKey(elementObject.key);
+ var placement = String(elementObject.placement);
+
+ if (placement !== "static" && placement !== "prototype" && placement !== "own") {
+ throw new TypeError('An element descriptor\'s .placement property must be one of "static",' + ' "prototype" or "own", but a decorator created an element descriptor' + ' with .placement "' + placement + '"');
+ }
+
+ var descriptor = elementObject.descriptor;
+ this.disallowProperty(elementObject, "elements", "An element descriptor");
+ var element = {
+ kind: kind,
+ key: key,
+ placement: placement,
+ descriptor: Object.assign({}, descriptor)
+ };
+
+ if (kind !== "field") {
+ this.disallowProperty(elementObject, "initializer", "A method descriptor");
+ } else {
+ this.disallowProperty(descriptor, "get", "The property descriptor of a field descriptor");
+ this.disallowProperty(descriptor, "set", "The property descriptor of a field descriptor");
+ this.disallowProperty(descriptor, "value", "The property descriptor of a field descriptor");
+ element.initializer = elementObject.initializer;
+ }
+
+ return element;
+ },
+ toElementFinisherExtras: function toElementFinisherExtras(elementObject) {
+ var element = this.toElementDescriptor(elementObject);
+
+ var finisher = _optionalCallableProperty(elementObject, "finisher");
+
+ var extras = this.toElementDescriptors(elementObject.extras);
+ return {
+ element: element,
+ finisher: finisher,
+ extras: extras
+ };
+ },
+ fromClassDescriptor: function fromClassDescriptor(elements) {
+ var obj = {
+ kind: "class",
+ elements: elements.map(this.fromElementDescriptor, this)
+ };
+ var desc = {
+ value: "Descriptor",
+ configurable: true
+ };
+ Object.defineProperty(obj, Symbol.toStringTag, desc);
+ return obj;
+ },
+ toClassDescriptor: function toClassDescriptor(obj) {
+ var kind = String(obj.kind);
+
+ if (kind !== "class") {
+ throw new TypeError('A class descriptor\'s .kind property must be "class", but a decorator' + ' created a class descriptor with .kind "' + kind + '"');
+ }
+
+ this.disallowProperty(obj, "key", "A class descriptor");
+ this.disallowProperty(obj, "placement", "A class descriptor");
+ this.disallowProperty(obj, "descriptor", "A class descriptor");
+ this.disallowProperty(obj, "initializer", "A class descriptor");
+ this.disallowProperty(obj, "extras", "A class descriptor");
+
+ var finisher = _optionalCallableProperty(obj, "finisher");
+
+ var elements = this.toElementDescriptors(obj.elements);
+ return {
+ elements: elements,
+ finisher: finisher
+ };
+ },
+ runClassFinishers: function runClassFinishers(constructor, finishers) {
+ for (var i = 0; i < finishers.length; i++) {
+ var newConstructor = (0, finishers[i])(constructor);
+
+ if (newConstructor !== undefined) {
+ if (typeof newConstructor !== "function") {
+ throw new TypeError("Finishers must return a constructor.");
+ }
+
+ constructor = newConstructor;
+ }
+ }
+
+ return constructor;
+ },
+ disallowProperty: function disallowProperty(obj, name, objectType) {
+ if (obj[name] !== undefined) {
+ throw new TypeError(objectType + " can't have a ." + name + " property.");
+ }
+ }
+ };
+ return api;
+}
+
+function _createElementDescriptor(def) {
+ var key = toPropertyKey(def.key);
+ var descriptor;
+
+ if (def.kind === "method") {
+ descriptor = {
+ value: def.value,
+ writable: true,
+ configurable: true,
+ enumerable: false
+ };
+ } else if (def.kind === "get") {
+ descriptor = {
+ get: def.value,
+ configurable: true,
+ enumerable: false
+ };
+ } else if (def.kind === "set") {
+ descriptor = {
+ set: def.value,
+ configurable: true,
+ enumerable: false
+ };
+ } else if (def.kind === "field") {
+ descriptor = {
+ configurable: true,
+ writable: true,
+ enumerable: true
+ };
+ }
+
+ var element = {
+ kind: def.kind === "field" ? "field" : "method",
+ key: key,
+ placement: def["static"] ? "static" : def.kind === "field" ? "own" : "prototype",
+ descriptor: descriptor
+ };
+ if (def.decorators) element.decorators = def.decorators;
+ if (def.kind === "field") element.initializer = def.value;
+ return element;
+}
+
+function _coalesceGetterSetter(element, other) {
+ if (element.descriptor.get !== undefined) {
+ other.descriptor.get = element.descriptor.get;
+ } else {
+ other.descriptor.set = element.descriptor.set;
+ }
+}
+
+function _coalesceClassElements(elements) {
+ var newElements = [];
+
+ var isSameElement = function isSameElement(other) {
+ return other.kind === "method" && other.key === element.key && other.placement === element.placement;
+ };
+
+ for (var i = 0; i < elements.length; i++) {
+ var element = elements[i];
+ var other;
+
+ if (element.kind === "method" && (other = newElements.find(isSameElement))) {
+ if (_isDataDescriptor(element.descriptor) || _isDataDescriptor(other.descriptor)) {
+ if (_hasDecorators(element) || _hasDecorators(other)) {
+ throw new ReferenceError("Duplicated methods (" + element.key + ") can't be decorated.");
+ }
+
+ other.descriptor = element.descriptor;
+ } else {
+ if (_hasDecorators(element)) {
+ if (_hasDecorators(other)) {
+ throw new ReferenceError("Decorators can't be placed on different accessors with for " + "the same property (" + element.key + ").");
+ }
+
+ other.decorators = element.decorators;
+ }
+
+ _coalesceGetterSetter(element, other);
+ }
+ } else {
+ newElements.push(element);
+ }
+ }
+
+ return newElements;
+}
+
+function _hasDecorators(element) {
+ return element.decorators && element.decorators.length;
+}
+
+function _isDataDescriptor(desc) {
+ return desc !== undefined && !(desc.value === undefined && desc.writable === undefined);
+}
+
+function _optionalCallableProperty(obj, name) {
+ var value = obj[name];
+
+ if (value !== undefined && typeof value !== "function") {
+ throw new TypeError("Expected '" + name + "' to be a function");
+ }
+
+ return value;
+}
+
+module.exports = _decorate, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/defaults.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/defaults.js
new file mode 100644
index 00000000..6c1c196d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/defaults.js
@@ -0,0 +1,16 @@
+function _defaults(obj, defaults) {
+ var keys = Object.getOwnPropertyNames(defaults);
+
+ for (var i = 0; i < keys.length; i++) {
+ var key = keys[i];
+ var value = Object.getOwnPropertyDescriptor(defaults, key);
+
+ if (value && value.configurable && obj[key] === undefined) {
+ Object.defineProperty(obj, key, value);
+ }
+ }
+
+ return obj;
+}
+
+module.exports = _defaults, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/defineEnumerableProperties.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/defineEnumerableProperties.js
new file mode 100644
index 00000000..cd491282
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/defineEnumerableProperties.js
@@ -0,0 +1,24 @@
+function _defineEnumerableProperties(obj, descs) {
+ for (var key in descs) {
+ var desc = descs[key];
+ desc.configurable = desc.enumerable = true;
+ if ("value" in desc) desc.writable = true;
+ Object.defineProperty(obj, key, desc);
+ }
+
+ if (Object.getOwnPropertySymbols) {
+ var objectSymbols = Object.getOwnPropertySymbols(descs);
+
+ for (var i = 0; i < objectSymbols.length; i++) {
+ var sym = objectSymbols[i];
+ var desc = descs[sym];
+ desc.configurable = desc.enumerable = true;
+ if ("value" in desc) desc.writable = true;
+ Object.defineProperty(obj, sym, desc);
+ }
+ }
+
+ return obj;
+}
+
+module.exports = _defineEnumerableProperties, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/defineProperty.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/defineProperty.js
new file mode 100644
index 00000000..fe7d6bb9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/defineProperty.js
@@ -0,0 +1,16 @@
+function _defineProperty(obj, key, value) {
+ if (key in obj) {
+ Object.defineProperty(obj, key, {
+ value: value,
+ enumerable: true,
+ configurable: true,
+ writable: true
+ });
+ } else {
+ obj[key] = value;
+ }
+
+ return obj;
+}
+
+module.exports = _defineProperty, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/AsyncGenerator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/AsyncGenerator.js
new file mode 100644
index 00000000..919aab87
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/AsyncGenerator.js
@@ -0,0 +1,95 @@
+import AwaitValue from "./AwaitValue.js";
+export default function AsyncGenerator(gen) {
+ var front, back;
+
+ function send(key, arg) {
+ return new Promise(function (resolve, reject) {
+ var request = {
+ key: key,
+ arg: arg,
+ resolve: resolve,
+ reject: reject,
+ next: null
+ };
+
+ if (back) {
+ back = back.next = request;
+ } else {
+ front = back = request;
+ resume(key, arg);
+ }
+ });
+ }
+
+ function resume(key, arg) {
+ try {
+ var result = gen[key](arg);
+ var value = result.value;
+ var wrappedAwait = value instanceof AwaitValue;
+ Promise.resolve(wrappedAwait ? value.wrapped : value).then(function (arg) {
+ if (wrappedAwait) {
+ resume(key === "return" ? "return" : "next", arg);
+ return;
+ }
+
+ settle(result.done ? "return" : "normal", arg);
+ }, function (err) {
+ resume("throw", err);
+ });
+ } catch (err) {
+ settle("throw", err);
+ }
+ }
+
+ function settle(type, value) {
+ switch (type) {
+ case "return":
+ front.resolve({
+ value: value,
+ done: true
+ });
+ break;
+
+ case "throw":
+ front.reject(value);
+ break;
+
+ default:
+ front.resolve({
+ value: value,
+ done: false
+ });
+ break;
+ }
+
+ front = front.next;
+
+ if (front) {
+ resume(front.key, front.arg);
+ } else {
+ back = null;
+ }
+ }
+
+ this._invoke = send;
+
+ if (typeof gen["return"] !== "function") {
+ this["return"] = undefined;
+ }
+}
+
+AsyncGenerator.prototype[typeof Symbol === "function" && Symbol.asyncIterator || "@@asyncIterator"] = function () {
+ return this;
+};
+
+AsyncGenerator.prototype.next = function (arg) {
+ return this._invoke("next", arg);
+};
+
+AsyncGenerator.prototype["throw"] = function (arg) {
+ return this._invoke("throw", arg);
+};
+
+AsyncGenerator.prototype["return"] = function (arg) {
+ return this._invoke("return", arg);
+};
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/AwaitValue.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/AwaitValue.js
new file mode 100644
index 00000000..5237e18f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/AwaitValue.js
@@ -0,0 +1,3 @@
+export default function _AwaitValue(value) {
+ this.wrapped = value;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/applyDecoratedDescriptor.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/applyDecoratedDescriptor.js
new file mode 100644
index 00000000..84b59617
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/applyDecoratedDescriptor.js
@@ -0,0 +1,28 @@
+export default function _applyDecoratedDescriptor(target, property, decorators, descriptor, context) {
+ var desc = {};
+ Object.keys(descriptor).forEach(function (key) {
+ desc[key] = descriptor[key];
+ });
+ desc.enumerable = !!desc.enumerable;
+ desc.configurable = !!desc.configurable;
+
+ if ('value' in desc || desc.initializer) {
+ desc.writable = true;
+ }
+
+ desc = decorators.slice().reverse().reduce(function (desc, decorator) {
+ return decorator(target, property, desc) || desc;
+ }, desc);
+
+ if (context && desc.initializer !== void 0) {
+ desc.value = desc.initializer ? desc.initializer.call(context) : void 0;
+ desc.initializer = undefined;
+ }
+
+ if (desc.initializer === void 0) {
+ Object.defineProperty(target, property, desc);
+ desc = null;
+ }
+
+ return desc;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/applyDecs.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/applyDecs.js
new file mode 100644
index 00000000..a6187c02
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/applyDecs.js
@@ -0,0 +1,282 @@
+import _typeof from "./typeof.js";
+
+function createMetadataMethodsForProperty(metadataMap, kind, property, decoratorFinishedRef) {
+ return {
+ getMetadata: function getMetadata(key) {
+ assertNotFinished(decoratorFinishedRef, "getMetadata"), assertMetadataKey(key);
+ var metadataForKey = metadataMap[key];
+ if (void 0 !== metadataForKey) if (1 === kind) {
+ var pub = metadataForKey["public"];
+ if (void 0 !== pub) return pub[property];
+ } else if (2 === kind) {
+ var priv = metadataForKey["private"];
+ if (void 0 !== priv) return priv.get(property);
+ } else if (Object.hasOwnProperty.call(metadataForKey, "constructor")) return metadataForKey.constructor;
+ },
+ setMetadata: function setMetadata(key, value) {
+ assertNotFinished(decoratorFinishedRef, "setMetadata"), assertMetadataKey(key);
+ var metadataForKey = metadataMap[key];
+
+ if (void 0 === metadataForKey && (metadataForKey = metadataMap[key] = {}), 1 === kind) {
+ var pub = metadataForKey["public"];
+ void 0 === pub && (pub = metadataForKey["public"] = {}), pub[property] = value;
+ } else if (2 === kind) {
+ var priv = metadataForKey.priv;
+ void 0 === priv && (priv = metadataForKey["private"] = new Map()), priv.set(property, value);
+ } else metadataForKey.constructor = value;
+ }
+ };
+}
+
+function convertMetadataMapToFinal(obj, metadataMap) {
+ var parentMetadataMap = obj[Symbol.metadata || Symbol["for"]("Symbol.metadata")],
+ metadataKeys = Object.getOwnPropertySymbols(metadataMap);
+
+ if (0 !== metadataKeys.length) {
+ for (var i = 0; i < metadataKeys.length; i++) {
+ var key = metadataKeys[i],
+ metaForKey = metadataMap[key],
+ parentMetaForKey = parentMetadataMap ? parentMetadataMap[key] : null,
+ pub = metaForKey["public"],
+ parentPub = parentMetaForKey ? parentMetaForKey["public"] : null;
+ pub && parentPub && Object.setPrototypeOf(pub, parentPub);
+ var priv = metaForKey["private"];
+
+ if (priv) {
+ var privArr = Array.from(priv.values()),
+ parentPriv = parentMetaForKey ? parentMetaForKey["private"] : null;
+ parentPriv && (privArr = privArr.concat(parentPriv)), metaForKey["private"] = privArr;
+ }
+
+ parentMetaForKey && Object.setPrototypeOf(metaForKey, parentMetaForKey);
+ }
+
+ parentMetadataMap && Object.setPrototypeOf(metadataMap, parentMetadataMap), obj[Symbol.metadata || Symbol["for"]("Symbol.metadata")] = metadataMap;
+ }
+}
+
+function createAddInitializerMethod(initializers, decoratorFinishedRef) {
+ return function (initializer) {
+ assertNotFinished(decoratorFinishedRef, "addInitializer"), assertCallable(initializer, "An initializer"), initializers.push(initializer);
+ };
+}
+
+function memberDec(dec, name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value) {
+ var kindStr;
+
+ switch (kind) {
+ case 1:
+ kindStr = "accessor";
+ break;
+
+ case 2:
+ kindStr = "method";
+ break;
+
+ case 3:
+ kindStr = "getter";
+ break;
+
+ case 4:
+ kindStr = "setter";
+ break;
+
+ default:
+ kindStr = "field";
+ }
+
+ var metadataKind,
+ metadataName,
+ ctx = {
+ kind: kindStr,
+ name: isPrivate ? "#" + name : name,
+ isStatic: isStatic,
+ isPrivate: isPrivate
+ },
+ decoratorFinishedRef = {
+ v: !1
+ };
+
+ if (0 !== kind && (ctx.addInitializer = createAddInitializerMethod(initializers, decoratorFinishedRef)), isPrivate) {
+ metadataKind = 2, metadataName = Symbol(name);
+ var access = {};
+ 0 === kind ? (access.get = desc.get, access.set = desc.set) : 2 === kind ? access.get = function () {
+ return desc.value;
+ } : (1 !== kind && 3 !== kind || (access.get = function () {
+ return desc.get.call(this);
+ }), 1 !== kind && 4 !== kind || (access.set = function (v) {
+ desc.set.call(this, v);
+ })), ctx.access = access;
+ } else metadataKind = 1, metadataName = name;
+
+ try {
+ return dec(value, Object.assign(ctx, createMetadataMethodsForProperty(metadataMap, metadataKind, metadataName, decoratorFinishedRef)));
+ } finally {
+ decoratorFinishedRef.v = !0;
+ }
+}
+
+function assertNotFinished(decoratorFinishedRef, fnName) {
+ if (decoratorFinishedRef.v) throw new Error("attempted to call " + fnName + " after decoration was finished");
+}
+
+function assertMetadataKey(key) {
+ if ("symbol" != _typeof(key)) throw new TypeError("Metadata keys must be symbols, received: " + key);
+}
+
+function assertCallable(fn, hint) {
+ if ("function" != typeof fn) throw new TypeError(hint + " must be a function");
+}
+
+function assertValidReturnValue(kind, value) {
+ var type = _typeof(value);
+
+ if (1 === kind) {
+ if ("object" !== type || null === value) throw new TypeError("accessor decorators must return an object with get, set, or init properties or void 0");
+ void 0 !== value.get && assertCallable(value.get, "accessor.get"), void 0 !== value.set && assertCallable(value.set, "accessor.set"), void 0 !== value.init && assertCallable(value.init, "accessor.init"), void 0 !== value.initializer && assertCallable(value.initializer, "accessor.initializer");
+ } else if ("function" !== type) {
+ var hint;
+ throw hint = 0 === kind ? "field" : 10 === kind ? "class" : "method", new TypeError(hint + " decorators must return a function or void 0");
+ }
+}
+
+function getInit(desc) {
+ var initializer;
+ return null == (initializer = desc.init) && (initializer = desc.initializer) && "undefined" != typeof console && console.warn(".initializer has been renamed to .init as of March 2022"), initializer;
+}
+
+function applyMemberDec(ret, base, decInfo, name, kind, isStatic, isPrivate, metadataMap, initializers) {
+ var desc,
+ initializer,
+ value,
+ newValue,
+ get,
+ set,
+ decs = decInfo[0];
+ if (isPrivate ? desc = 0 === kind || 1 === kind ? {
+ get: decInfo[3],
+ set: decInfo[4]
+ } : 3 === kind ? {
+ get: decInfo[3]
+ } : 4 === kind ? {
+ set: decInfo[3]
+ } : {
+ value: decInfo[3]
+ } : 0 !== kind && (desc = Object.getOwnPropertyDescriptor(base, name)), 1 === kind ? value = {
+ get: desc.get,
+ set: desc.set
+ } : 2 === kind ? value = desc.value : 3 === kind ? value = desc.get : 4 === kind && (value = desc.set), "function" == typeof decs) void 0 !== (newValue = memberDec(decs, name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value)) && (assertValidReturnValue(kind, newValue), 0 === kind ? initializer = newValue : 1 === kind ? (initializer = getInit(newValue), get = newValue.get || value.get, set = newValue.set || value.set, value = {
+ get: get,
+ set: set
+ }) : value = newValue);else for (var i = decs.length - 1; i >= 0; i--) {
+ var newInit;
+ if (void 0 !== (newValue = memberDec(decs[i], name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value))) assertValidReturnValue(kind, newValue), 0 === kind ? newInit = newValue : 1 === kind ? (newInit = getInit(newValue), get = newValue.get || value.get, set = newValue.set || value.set, value = {
+ get: get,
+ set: set
+ }) : value = newValue, void 0 !== newInit && (void 0 === initializer ? initializer = newInit : "function" == typeof initializer ? initializer = [initializer, newInit] : initializer.push(newInit));
+ }
+
+ if (0 === kind || 1 === kind) {
+ if (void 0 === initializer) initializer = function initializer(instance, init) {
+ return init;
+ };else if ("function" != typeof initializer) {
+ var ownInitializers = initializer;
+
+ initializer = function initializer(instance, init) {
+ for (var value = init, i = 0; i < ownInitializers.length; i++) {
+ value = ownInitializers[i].call(instance, value);
+ }
+
+ return value;
+ };
+ } else {
+ var originalInitializer = initializer;
+
+ initializer = function initializer(instance, init) {
+ return originalInitializer.call(instance, init);
+ };
+ }
+ ret.push(initializer);
+ }
+
+ 0 !== kind && (1 === kind ? (desc.get = value.get, desc.set = value.set) : 2 === kind ? desc.value = value : 3 === kind ? desc.get = value : 4 === kind && (desc.set = value), isPrivate ? 1 === kind ? (ret.push(function (instance, args) {
+ return value.get.call(instance, args);
+ }), ret.push(function (instance, args) {
+ return value.set.call(instance, args);
+ })) : 2 === kind ? ret.push(value) : ret.push(function (instance, args) {
+ return value.call(instance, args);
+ }) : Object.defineProperty(base, name, desc));
+}
+
+function applyMemberDecs(ret, Class, protoMetadataMap, staticMetadataMap, decInfos) {
+ for (var protoInitializers, staticInitializers, existingProtoNonFields = new Map(), existingStaticNonFields = new Map(), i = 0; i < decInfos.length; i++) {
+ var decInfo = decInfos[i];
+
+ if (Array.isArray(decInfo)) {
+ var base,
+ metadataMap,
+ initializers,
+ kind = decInfo[1],
+ name = decInfo[2],
+ isPrivate = decInfo.length > 3,
+ isStatic = kind >= 5;
+
+ if (isStatic ? (base = Class, metadataMap = staticMetadataMap, 0 !== (kind -= 5) && (initializers = staticInitializers = staticInitializers || [])) : (base = Class.prototype, metadataMap = protoMetadataMap, 0 !== kind && (initializers = protoInitializers = protoInitializers || [])), 0 !== kind && !isPrivate) {
+ var existingNonFields = isStatic ? existingStaticNonFields : existingProtoNonFields,
+ existingKind = existingNonFields.get(name) || 0;
+ if (!0 === existingKind || 3 === existingKind && 4 !== kind || 4 === existingKind && 3 !== kind) throw new Error("Attempted to decorate a public method/accessor that has the same name as a previously decorated public method/accessor. This is not currently supported by the decorators plugin. Property name was: " + name);
+ !existingKind && kind > 2 ? existingNonFields.set(name, kind) : existingNonFields.set(name, !0);
+ }
+
+ applyMemberDec(ret, base, decInfo, name, kind, isStatic, isPrivate, metadataMap, initializers);
+ }
+ }
+
+ pushInitializers(ret, protoInitializers), pushInitializers(ret, staticInitializers);
+}
+
+function pushInitializers(ret, initializers) {
+ initializers && ret.push(function (instance) {
+ for (var i = 0; i < initializers.length; i++) {
+ initializers[i].call(instance);
+ }
+
+ return instance;
+ });
+}
+
+function applyClassDecs(ret, targetClass, metadataMap, classDecs) {
+ if (classDecs.length > 0) {
+ for (var initializers = [], newClass = targetClass, name = targetClass.name, i = classDecs.length - 1; i >= 0; i--) {
+ var decoratorFinishedRef = {
+ v: !1
+ };
+
+ try {
+ var ctx = Object.assign({
+ kind: "class",
+ name: name,
+ addInitializer: createAddInitializerMethod(initializers, decoratorFinishedRef)
+ }, createMetadataMethodsForProperty(metadataMap, 0, name, decoratorFinishedRef)),
+ nextNewClass = classDecs[i](newClass, ctx);
+ } finally {
+ decoratorFinishedRef.v = !0;
+ }
+
+ void 0 !== nextNewClass && (assertValidReturnValue(10, nextNewClass), newClass = nextNewClass);
+ }
+
+ ret.push(newClass, function () {
+ for (var i = 0; i < initializers.length; i++) {
+ initializers[i].call(newClass);
+ }
+ });
+ }
+}
+
+export default function applyDecs(targetClass, memberDecs, classDecs) {
+ var ret = [],
+ staticMetadataMap = {},
+ protoMetadataMap = {};
+ return applyMemberDecs(ret, targetClass, protoMetadataMap, staticMetadataMap, memberDecs), convertMetadataMapToFinal(targetClass.prototype, protoMetadataMap), applyClassDecs(ret, targetClass, staticMetadataMap, classDecs), convertMetadataMapToFinal(targetClass, staticMetadataMap), ret;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/arrayLikeToArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/arrayLikeToArray.js
new file mode 100644
index 00000000..edbeb8ee
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/arrayLikeToArray.js
@@ -0,0 +1,9 @@
+export default function _arrayLikeToArray(arr, len) {
+ if (len == null || len > arr.length) len = arr.length;
+
+ for (var i = 0, arr2 = new Array(len); i < len; i++) {
+ arr2[i] = arr[i];
+ }
+
+ return arr2;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/arrayWithHoles.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/arrayWithHoles.js
new file mode 100644
index 00000000..be734fc3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/arrayWithHoles.js
@@ -0,0 +1,3 @@
+export default function _arrayWithHoles(arr) {
+ if (Array.isArray(arr)) return arr;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/arrayWithoutHoles.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/arrayWithoutHoles.js
new file mode 100644
index 00000000..f7d8dc78
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/arrayWithoutHoles.js
@@ -0,0 +1,4 @@
+import arrayLikeToArray from "./arrayLikeToArray.js";
+export default function _arrayWithoutHoles(arr) {
+ if (Array.isArray(arr)) return arrayLikeToArray(arr);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js
new file mode 100644
index 00000000..bbf849ca
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js
@@ -0,0 +1,7 @@
+export default function _assertThisInitialized(self) {
+ if (self === void 0) {
+ throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
+ }
+
+ return self;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/asyncGeneratorDelegate.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/asyncGeneratorDelegate.js
new file mode 100644
index 00000000..a7ccd675
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/asyncGeneratorDelegate.js
@@ -0,0 +1,54 @@
+export default function _asyncGeneratorDelegate(inner, awaitWrap) {
+ var iter = {},
+ waiting = false;
+
+ function pump(key, value) {
+ waiting = true;
+ value = new Promise(function (resolve) {
+ resolve(inner[key](value));
+ });
+ return {
+ done: false,
+ value: awaitWrap(value)
+ };
+ }
+
+ ;
+
+ iter[typeof Symbol !== "undefined" && Symbol.iterator || "@@iterator"] = function () {
+ return this;
+ };
+
+ iter.next = function (value) {
+ if (waiting) {
+ waiting = false;
+ return value;
+ }
+
+ return pump("next", value);
+ };
+
+ if (typeof inner["throw"] === "function") {
+ iter["throw"] = function (value) {
+ if (waiting) {
+ waiting = false;
+ throw value;
+ }
+
+ return pump("throw", value);
+ };
+ }
+
+ if (typeof inner["return"] === "function") {
+ iter["return"] = function (value) {
+ if (waiting) {
+ waiting = false;
+ return value;
+ }
+
+ return pump("return", value);
+ };
+ }
+
+ return iter;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/asyncIterator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/asyncIterator.js
new file mode 100644
index 00000000..030c44e0
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/asyncIterator.js
@@ -0,0 +1,48 @@
+export default function _asyncIterator(iterable) {
+ var method,
+ async,
+ sync,
+ retry = 2;
+
+ for ("undefined" != typeof Symbol && (async = Symbol.asyncIterator, sync = Symbol.iterator); retry--;) {
+ if (async && null != (method = iterable[async])) return method.call(iterable);
+ if (sync && null != (method = iterable[sync])) return new AsyncFromSyncIterator(method.call(iterable));
+ async = "@@asyncIterator", sync = "@@iterator";
+ }
+
+ throw new TypeError("Object is not async iterable");
+}
+
+function AsyncFromSyncIterator(s) {
+ function AsyncFromSyncIteratorContinuation(r) {
+ if (Object(r) !== r) return Promise.reject(new TypeError(r + " is not an object."));
+ var done = r.done;
+ return Promise.resolve(r.value).then(function (value) {
+ return {
+ value: value,
+ done: done
+ };
+ });
+ }
+
+ return AsyncFromSyncIterator = function AsyncFromSyncIterator(s) {
+ this.s = s, this.n = s.next;
+ }, AsyncFromSyncIterator.prototype = {
+ s: null,
+ n: null,
+ next: function next() {
+ return AsyncFromSyncIteratorContinuation(this.n.apply(this.s, arguments));
+ },
+ "return": function _return(value) {
+ var ret = this.s["return"];
+ return void 0 === ret ? Promise.resolve({
+ value: value,
+ done: !0
+ }) : AsyncFromSyncIteratorContinuation(ret.apply(this.s, arguments));
+ },
+ "throw": function _throw(value) {
+ var thr = this.s["return"];
+ return void 0 === thr ? Promise.reject(value) : AsyncFromSyncIteratorContinuation(thr.apply(this.s, arguments));
+ }
+ }, new AsyncFromSyncIterator(s);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/asyncToGenerator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/asyncToGenerator.js
new file mode 100644
index 00000000..2a25f543
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/asyncToGenerator.js
@@ -0,0 +1,35 @@
+function asyncGeneratorStep(gen, resolve, reject, _next, _throw, key, arg) {
+ try {
+ var info = gen[key](arg);
+ var value = info.value;
+ } catch (error) {
+ reject(error);
+ return;
+ }
+
+ if (info.done) {
+ resolve(value);
+ } else {
+ Promise.resolve(value).then(_next, _throw);
+ }
+}
+
+export default function _asyncToGenerator(fn) {
+ return function () {
+ var self = this,
+ args = arguments;
+ return new Promise(function (resolve, reject) {
+ var gen = fn.apply(self, args);
+
+ function _next(value) {
+ asyncGeneratorStep(gen, resolve, reject, _next, _throw, "next", value);
+ }
+
+ function _throw(err) {
+ asyncGeneratorStep(gen, resolve, reject, _next, _throw, "throw", err);
+ }
+
+ _next(undefined);
+ });
+ };
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/awaitAsyncGenerator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/awaitAsyncGenerator.js
new file mode 100644
index 00000000..ccca65e5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/awaitAsyncGenerator.js
@@ -0,0 +1,4 @@
+import AwaitValue from "./AwaitValue.js";
+export default function _awaitAsyncGenerator(value) {
+ return new AwaitValue(value);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/checkPrivateRedeclaration.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/checkPrivateRedeclaration.js
new file mode 100644
index 00000000..99014036
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/checkPrivateRedeclaration.js
@@ -0,0 +1,5 @@
+export default function _checkPrivateRedeclaration(obj, privateCollection) {
+ if (privateCollection.has(obj)) {
+ throw new TypeError("Cannot initialize the same private elements twice on an object");
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorDestructureSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorDestructureSet.js
new file mode 100644
index 00000000..4472adc6
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorDestructureSet.js
@@ -0,0 +1,20 @@
+export default function _classApplyDescriptorDestructureSet(receiver, descriptor) {
+ if (descriptor.set) {
+ if (!("__destrObj" in descriptor)) {
+ descriptor.__destrObj = {
+ set value(v) {
+ descriptor.set.call(receiver, v);
+ }
+
+ };
+ }
+
+ return descriptor.__destrObj;
+ } else {
+ if (!descriptor.writable) {
+ throw new TypeError("attempted to set read only private field");
+ }
+
+ return descriptor;
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorGet.js
new file mode 100644
index 00000000..0fad169d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorGet.js
@@ -0,0 +1,7 @@
+export default function _classApplyDescriptorGet(receiver, descriptor) {
+ if (descriptor.get) {
+ return descriptor.get.call(receiver);
+ }
+
+ return descriptor.value;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorSet.js
new file mode 100644
index 00000000..f295f3e3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorSet.js
@@ -0,0 +1,11 @@
+export default function _classApplyDescriptorSet(receiver, descriptor, value) {
+ if (descriptor.set) {
+ descriptor.set.call(receiver, value);
+ } else {
+ if (!descriptor.writable) {
+ throw new TypeError("attempted to set read only private field");
+ }
+
+ descriptor.value = value;
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classCallCheck.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classCallCheck.js
new file mode 100644
index 00000000..2f1738a3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classCallCheck.js
@@ -0,0 +1,5 @@
+export default function _classCallCheck(instance, Constructor) {
+ if (!(instance instanceof Constructor)) {
+ throw new TypeError("Cannot call a class as a function");
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticAccess.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticAccess.js
new file mode 100644
index 00000000..098ed309
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticAccess.js
@@ -0,0 +1,5 @@
+export default function _classCheckPrivateStaticAccess(receiver, classConstructor) {
+ if (receiver !== classConstructor) {
+ throw new TypeError("Private static access of wrong provenance");
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticFieldDescriptor.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticFieldDescriptor.js
new file mode 100644
index 00000000..0ef34b8d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticFieldDescriptor.js
@@ -0,0 +1,5 @@
+export default function _classCheckPrivateStaticFieldDescriptor(descriptor, action) {
+ if (descriptor === undefined) {
+ throw new TypeError("attempted to " + action + " private static field before its declaration");
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classExtractFieldDescriptor.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classExtractFieldDescriptor.js
new file mode 100644
index 00000000..8dabe9a3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classExtractFieldDescriptor.js
@@ -0,0 +1,7 @@
+export default function _classExtractFieldDescriptor(receiver, privateMap, action) {
+ if (!privateMap.has(receiver)) {
+ throw new TypeError("attempted to " + action + " private field on non-instance");
+ }
+
+ return privateMap.get(receiver);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classNameTDZError.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classNameTDZError.js
new file mode 100644
index 00000000..f7b6dd57
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classNameTDZError.js
@@ -0,0 +1,3 @@
+export default function _classNameTDZError(name) {
+ throw new Error("Class \"" + name + "\" cannot be referenced in computed property keys.");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldDestructureSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldDestructureSet.js
new file mode 100644
index 00000000..fb588336
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldDestructureSet.js
@@ -0,0 +1,6 @@
+import classApplyDescriptorDestructureSet from "./classApplyDescriptorDestructureSet.js";
+import classExtractFieldDescriptor from "./classExtractFieldDescriptor.js";
+export default function _classPrivateFieldDestructureSet(receiver, privateMap) {
+ var descriptor = classExtractFieldDescriptor(receiver, privateMap, "set");
+ return classApplyDescriptorDestructureSet(receiver, descriptor);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldGet.js
new file mode 100644
index 00000000..53cd1379
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldGet.js
@@ -0,0 +1,6 @@
+import classApplyDescriptorGet from "./classApplyDescriptorGet.js";
+import classExtractFieldDescriptor from "./classExtractFieldDescriptor.js";
+export default function _classPrivateFieldGet(receiver, privateMap) {
+ var descriptor = classExtractFieldDescriptor(receiver, privateMap, "get");
+ return classApplyDescriptorGet(receiver, descriptor);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldInitSpec.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldInitSpec.js
new file mode 100644
index 00000000..2253dd84
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldInitSpec.js
@@ -0,0 +1,5 @@
+import checkPrivateRedeclaration from "./checkPrivateRedeclaration.js";
+export default function _classPrivateFieldInitSpec(obj, privateMap, value) {
+ checkPrivateRedeclaration(obj, privateMap);
+ privateMap.set(obj, value);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseBase.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseBase.js
new file mode 100644
index 00000000..5b10916f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseBase.js
@@ -0,0 +1,7 @@
+export default function _classPrivateFieldBase(receiver, privateKey) {
+ if (!Object.prototype.hasOwnProperty.call(receiver, privateKey)) {
+ throw new TypeError("attempted to use private field on non-instance");
+ }
+
+ return receiver;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseKey.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseKey.js
new file mode 100644
index 00000000..5b7e5ac0
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseKey.js
@@ -0,0 +1,4 @@
+var id = 0;
+export default function _classPrivateFieldKey(name) {
+ return "__private_" + id++ + "_" + name;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldSet.js
new file mode 100644
index 00000000..ad91be44
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateFieldSet.js
@@ -0,0 +1,7 @@
+import classApplyDescriptorSet from "./classApplyDescriptorSet.js";
+import classExtractFieldDescriptor from "./classExtractFieldDescriptor.js";
+export default function _classPrivateFieldSet(receiver, privateMap, value) {
+ var descriptor = classExtractFieldDescriptor(receiver, privateMap, "set");
+ classApplyDescriptorSet(receiver, descriptor, value);
+ return value;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateMethodGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateMethodGet.js
new file mode 100644
index 00000000..38b9d584
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateMethodGet.js
@@ -0,0 +1,7 @@
+export default function _classPrivateMethodGet(receiver, privateSet, fn) {
+ if (!privateSet.has(receiver)) {
+ throw new TypeError("attempted to get private field on non-instance");
+ }
+
+ return fn;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateMethodInitSpec.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateMethodInitSpec.js
new file mode 100644
index 00000000..18d12915
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateMethodInitSpec.js
@@ -0,0 +1,5 @@
+import checkPrivateRedeclaration from "./checkPrivateRedeclaration.js";
+export default function _classPrivateMethodInitSpec(obj, privateSet) {
+ checkPrivateRedeclaration(obj, privateSet);
+ privateSet.add(obj);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateMethodSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateMethodSet.js
new file mode 100644
index 00000000..2bbaf3a7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classPrivateMethodSet.js
@@ -0,0 +1,3 @@
+export default function _classPrivateMethodSet() {
+ throw new TypeError("attempted to reassign private method");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldDestructureSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldDestructureSet.js
new file mode 100644
index 00000000..77afcfb1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldDestructureSet.js
@@ -0,0 +1,8 @@
+import classApplyDescriptorDestructureSet from "./classApplyDescriptorDestructureSet.js";
+import classCheckPrivateStaticAccess from "./classCheckPrivateStaticAccess.js";
+import classCheckPrivateStaticFieldDescriptor from "./classCheckPrivateStaticFieldDescriptor.js";
+export default function _classStaticPrivateFieldDestructureSet(receiver, classConstructor, descriptor) {
+ classCheckPrivateStaticAccess(receiver, classConstructor);
+ classCheckPrivateStaticFieldDescriptor(descriptor, "set");
+ return classApplyDescriptorDestructureSet(receiver, descriptor);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecGet.js
new file mode 100644
index 00000000..d253d311
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecGet.js
@@ -0,0 +1,8 @@
+import classApplyDescriptorGet from "./classApplyDescriptorGet.js";
+import classCheckPrivateStaticAccess from "./classCheckPrivateStaticAccess.js";
+import classCheckPrivateStaticFieldDescriptor from "./classCheckPrivateStaticFieldDescriptor.js";
+export default function _classStaticPrivateFieldSpecGet(receiver, classConstructor, descriptor) {
+ classCheckPrivateStaticAccess(receiver, classConstructor);
+ classCheckPrivateStaticFieldDescriptor(descriptor, "get");
+ return classApplyDescriptorGet(receiver, descriptor);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecSet.js
new file mode 100644
index 00000000..b0b0cc64
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecSet.js
@@ -0,0 +1,9 @@
+import classApplyDescriptorSet from "./classApplyDescriptorSet.js";
+import classCheckPrivateStaticAccess from "./classCheckPrivateStaticAccess.js";
+import classCheckPrivateStaticFieldDescriptor from "./classCheckPrivateStaticFieldDescriptor.js";
+export default function _classStaticPrivateFieldSpecSet(receiver, classConstructor, descriptor, value) {
+ classCheckPrivateStaticAccess(receiver, classConstructor);
+ classCheckPrivateStaticFieldDescriptor(descriptor, "set");
+ classApplyDescriptorSet(receiver, descriptor, value);
+ return value;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodGet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodGet.js
new file mode 100644
index 00000000..fddc7b2d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodGet.js
@@ -0,0 +1,5 @@
+import classCheckPrivateStaticAccess from "./classCheckPrivateStaticAccess.js";
+export default function _classStaticPrivateMethodGet(receiver, classConstructor, method) {
+ classCheckPrivateStaticAccess(receiver, classConstructor);
+ return method;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodSet.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodSet.js
new file mode 100644
index 00000000..d5ab60a9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodSet.js
@@ -0,0 +1,3 @@
+export default function _classStaticPrivateMethodSet() {
+ throw new TypeError("attempted to set read only static private field");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/construct.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/construct.js
new file mode 100644
index 00000000..0c39835d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/construct.js
@@ -0,0 +1,18 @@
+import setPrototypeOf from "./setPrototypeOf.js";
+import isNativeReflectConstruct from "./isNativeReflectConstruct.js";
+export default function _construct(Parent, args, Class) {
+ if (isNativeReflectConstruct()) {
+ _construct = Reflect.construct;
+ } else {
+ _construct = function _construct(Parent, args, Class) {
+ var a = [null];
+ a.push.apply(a, args);
+ var Constructor = Function.bind.apply(Parent, a);
+ var instance = new Constructor();
+ if (Class) setPrototypeOf(instance, Class.prototype);
+ return instance;
+ };
+ }
+
+ return _construct.apply(null, arguments);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createClass.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createClass.js
new file mode 100644
index 00000000..b3207315
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createClass.js
@@ -0,0 +1,18 @@
+function _defineProperties(target, props) {
+ for (var i = 0; i < props.length; i++) {
+ var descriptor = props[i];
+ descriptor.enumerable = descriptor.enumerable || false;
+ descriptor.configurable = true;
+ if ("value" in descriptor) descriptor.writable = true;
+ Object.defineProperty(target, descriptor.key, descriptor);
+ }
+}
+
+export default function _createClass(Constructor, protoProps, staticProps) {
+ if (protoProps) _defineProperties(Constructor.prototype, protoProps);
+ if (staticProps) _defineProperties(Constructor, staticProps);
+ Object.defineProperty(Constructor, "prototype", {
+ writable: false
+ });
+ return Constructor;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelper.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelper.js
new file mode 100644
index 00000000..a7a2a50a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelper.js
@@ -0,0 +1,57 @@
+import unsupportedIterableToArray from "./unsupportedIterableToArray.js";
+export default function _createForOfIteratorHelper(o, allowArrayLike) {
+ var it = typeof Symbol !== "undefined" && o[Symbol.iterator] || o["@@iterator"];
+
+ if (!it) {
+ if (Array.isArray(o) || (it = unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") {
+ if (it) o = it;
+ var i = 0;
+
+ var F = function F() {};
+
+ return {
+ s: F,
+ n: function n() {
+ if (i >= o.length) return {
+ done: true
+ };
+ return {
+ done: false,
+ value: o[i++]
+ };
+ },
+ e: function e(_e) {
+ throw _e;
+ },
+ f: F
+ };
+ }
+
+ throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+ }
+
+ var normalCompletion = true,
+ didErr = false,
+ err;
+ return {
+ s: function s() {
+ it = it.call(o);
+ },
+ n: function n() {
+ var step = it.next();
+ normalCompletion = step.done;
+ return step;
+ },
+ e: function e(_e2) {
+ didErr = true;
+ err = _e2;
+ },
+ f: function f() {
+ try {
+ if (!normalCompletion && it["return"] != null) it["return"]();
+ } finally {
+ if (didErr) throw err;
+ }
+ }
+ };
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelperLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelperLoose.js
new file mode 100644
index 00000000..640ec683
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelperLoose.js
@@ -0,0 +1,21 @@
+import unsupportedIterableToArray from "./unsupportedIterableToArray.js";
+export default function _createForOfIteratorHelperLoose(o, allowArrayLike) {
+ var it = typeof Symbol !== "undefined" && o[Symbol.iterator] || o["@@iterator"];
+ if (it) return (it = it.call(o)).next.bind(it);
+
+ if (Array.isArray(o) || (it = unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") {
+ if (it) o = it;
+ var i = 0;
+ return function () {
+ if (i >= o.length) return {
+ done: true
+ };
+ return {
+ done: false,
+ value: o[i++]
+ };
+ };
+ }
+
+ throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createSuper.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createSuper.js
new file mode 100644
index 00000000..ea5ea995
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/createSuper.js
@@ -0,0 +1,19 @@
+import getPrototypeOf from "./getPrototypeOf.js";
+import isNativeReflectConstruct from "./isNativeReflectConstruct.js";
+import possibleConstructorReturn from "./possibleConstructorReturn.js";
+export default function _createSuper(Derived) {
+ var hasNativeReflectConstruct = isNativeReflectConstruct();
+ return function _createSuperInternal() {
+ var Super = getPrototypeOf(Derived),
+ result;
+
+ if (hasNativeReflectConstruct) {
+ var NewTarget = getPrototypeOf(this).constructor;
+ result = Reflect.construct(Super, arguments, NewTarget);
+ } else {
+ result = Super.apply(this, arguments);
+ }
+
+ return possibleConstructorReturn(this, result);
+ };
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/decorate.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/decorate.js
new file mode 100644
index 00000000..daf56da2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/decorate.js
@@ -0,0 +1,396 @@
+import toArray from "./toArray.js";
+import toPropertyKey from "./toPropertyKey.js";
+export default function _decorate(decorators, factory, superClass, mixins) {
+ var api = _getDecoratorsApi();
+
+ if (mixins) {
+ for (var i = 0; i < mixins.length; i++) {
+ api = mixins[i](api);
+ }
+ }
+
+ var r = factory(function initialize(O) {
+ api.initializeInstanceElements(O, decorated.elements);
+ }, superClass);
+ var decorated = api.decorateClass(_coalesceClassElements(r.d.map(_createElementDescriptor)), decorators);
+ api.initializeClassElements(r.F, decorated.elements);
+ return api.runClassFinishers(r.F, decorated.finishers);
+}
+
+function _getDecoratorsApi() {
+ _getDecoratorsApi = function _getDecoratorsApi() {
+ return api;
+ };
+
+ var api = {
+ elementsDefinitionOrder: [["method"], ["field"]],
+ initializeInstanceElements: function initializeInstanceElements(O, elements) {
+ ["method", "field"].forEach(function (kind) {
+ elements.forEach(function (element) {
+ if (element.kind === kind && element.placement === "own") {
+ this.defineClassElement(O, element);
+ }
+ }, this);
+ }, this);
+ },
+ initializeClassElements: function initializeClassElements(F, elements) {
+ var proto = F.prototype;
+ ["method", "field"].forEach(function (kind) {
+ elements.forEach(function (element) {
+ var placement = element.placement;
+
+ if (element.kind === kind && (placement === "static" || placement === "prototype")) {
+ var receiver = placement === "static" ? F : proto;
+ this.defineClassElement(receiver, element);
+ }
+ }, this);
+ }, this);
+ },
+ defineClassElement: function defineClassElement(receiver, element) {
+ var descriptor = element.descriptor;
+
+ if (element.kind === "field") {
+ var initializer = element.initializer;
+ descriptor = {
+ enumerable: descriptor.enumerable,
+ writable: descriptor.writable,
+ configurable: descriptor.configurable,
+ value: initializer === void 0 ? void 0 : initializer.call(receiver)
+ };
+ }
+
+ Object.defineProperty(receiver, element.key, descriptor);
+ },
+ decorateClass: function decorateClass(elements, decorators) {
+ var newElements = [];
+ var finishers = [];
+ var placements = {
+ "static": [],
+ prototype: [],
+ own: []
+ };
+ elements.forEach(function (element) {
+ this.addElementPlacement(element, placements);
+ }, this);
+ elements.forEach(function (element) {
+ if (!_hasDecorators(element)) return newElements.push(element);
+ var elementFinishersExtras = this.decorateElement(element, placements);
+ newElements.push(elementFinishersExtras.element);
+ newElements.push.apply(newElements, elementFinishersExtras.extras);
+ finishers.push.apply(finishers, elementFinishersExtras.finishers);
+ }, this);
+
+ if (!decorators) {
+ return {
+ elements: newElements,
+ finishers: finishers
+ };
+ }
+
+ var result = this.decorateConstructor(newElements, decorators);
+ finishers.push.apply(finishers, result.finishers);
+ result.finishers = finishers;
+ return result;
+ },
+ addElementPlacement: function addElementPlacement(element, placements, silent) {
+ var keys = placements[element.placement];
+
+ if (!silent && keys.indexOf(element.key) !== -1) {
+ throw new TypeError("Duplicated element (" + element.key + ")");
+ }
+
+ keys.push(element.key);
+ },
+ decorateElement: function decorateElement(element, placements) {
+ var extras = [];
+ var finishers = [];
+
+ for (var decorators = element.decorators, i = decorators.length - 1; i >= 0; i--) {
+ var keys = placements[element.placement];
+ keys.splice(keys.indexOf(element.key), 1);
+ var elementObject = this.fromElementDescriptor(element);
+ var elementFinisherExtras = this.toElementFinisherExtras((0, decorators[i])(elementObject) || elementObject);
+ element = elementFinisherExtras.element;
+ this.addElementPlacement(element, placements);
+
+ if (elementFinisherExtras.finisher) {
+ finishers.push(elementFinisherExtras.finisher);
+ }
+
+ var newExtras = elementFinisherExtras.extras;
+
+ if (newExtras) {
+ for (var j = 0; j < newExtras.length; j++) {
+ this.addElementPlacement(newExtras[j], placements);
+ }
+
+ extras.push.apply(extras, newExtras);
+ }
+ }
+
+ return {
+ element: element,
+ finishers: finishers,
+ extras: extras
+ };
+ },
+ decorateConstructor: function decorateConstructor(elements, decorators) {
+ var finishers = [];
+
+ for (var i = decorators.length - 1; i >= 0; i--) {
+ var obj = this.fromClassDescriptor(elements);
+ var elementsAndFinisher = this.toClassDescriptor((0, decorators[i])(obj) || obj);
+
+ if (elementsAndFinisher.finisher !== undefined) {
+ finishers.push(elementsAndFinisher.finisher);
+ }
+
+ if (elementsAndFinisher.elements !== undefined) {
+ elements = elementsAndFinisher.elements;
+
+ for (var j = 0; j < elements.length - 1; j++) {
+ for (var k = j + 1; k < elements.length; k++) {
+ if (elements[j].key === elements[k].key && elements[j].placement === elements[k].placement) {
+ throw new TypeError("Duplicated element (" + elements[j].key + ")");
+ }
+ }
+ }
+ }
+ }
+
+ return {
+ elements: elements,
+ finishers: finishers
+ };
+ },
+ fromElementDescriptor: function fromElementDescriptor(element) {
+ var obj = {
+ kind: element.kind,
+ key: element.key,
+ placement: element.placement,
+ descriptor: element.descriptor
+ };
+ var desc = {
+ value: "Descriptor",
+ configurable: true
+ };
+ Object.defineProperty(obj, Symbol.toStringTag, desc);
+ if (element.kind === "field") obj.initializer = element.initializer;
+ return obj;
+ },
+ toElementDescriptors: function toElementDescriptors(elementObjects) {
+ if (elementObjects === undefined) return;
+ return toArray(elementObjects).map(function (elementObject) {
+ var element = this.toElementDescriptor(elementObject);
+ this.disallowProperty(elementObject, "finisher", "An element descriptor");
+ this.disallowProperty(elementObject, "extras", "An element descriptor");
+ return element;
+ }, this);
+ },
+ toElementDescriptor: function toElementDescriptor(elementObject) {
+ var kind = String(elementObject.kind);
+
+ if (kind !== "method" && kind !== "field") {
+ throw new TypeError('An element descriptor\'s .kind property must be either "method" or' + ' "field", but a decorator created an element descriptor with' + ' .kind "' + kind + '"');
+ }
+
+ var key = toPropertyKey(elementObject.key);
+ var placement = String(elementObject.placement);
+
+ if (placement !== "static" && placement !== "prototype" && placement !== "own") {
+ throw new TypeError('An element descriptor\'s .placement property must be one of "static",' + ' "prototype" or "own", but a decorator created an element descriptor' + ' with .placement "' + placement + '"');
+ }
+
+ var descriptor = elementObject.descriptor;
+ this.disallowProperty(elementObject, "elements", "An element descriptor");
+ var element = {
+ kind: kind,
+ key: key,
+ placement: placement,
+ descriptor: Object.assign({}, descriptor)
+ };
+
+ if (kind !== "field") {
+ this.disallowProperty(elementObject, "initializer", "A method descriptor");
+ } else {
+ this.disallowProperty(descriptor, "get", "The property descriptor of a field descriptor");
+ this.disallowProperty(descriptor, "set", "The property descriptor of a field descriptor");
+ this.disallowProperty(descriptor, "value", "The property descriptor of a field descriptor");
+ element.initializer = elementObject.initializer;
+ }
+
+ return element;
+ },
+ toElementFinisherExtras: function toElementFinisherExtras(elementObject) {
+ var element = this.toElementDescriptor(elementObject);
+
+ var finisher = _optionalCallableProperty(elementObject, "finisher");
+
+ var extras = this.toElementDescriptors(elementObject.extras);
+ return {
+ element: element,
+ finisher: finisher,
+ extras: extras
+ };
+ },
+ fromClassDescriptor: function fromClassDescriptor(elements) {
+ var obj = {
+ kind: "class",
+ elements: elements.map(this.fromElementDescriptor, this)
+ };
+ var desc = {
+ value: "Descriptor",
+ configurable: true
+ };
+ Object.defineProperty(obj, Symbol.toStringTag, desc);
+ return obj;
+ },
+ toClassDescriptor: function toClassDescriptor(obj) {
+ var kind = String(obj.kind);
+
+ if (kind !== "class") {
+ throw new TypeError('A class descriptor\'s .kind property must be "class", but a decorator' + ' created a class descriptor with .kind "' + kind + '"');
+ }
+
+ this.disallowProperty(obj, "key", "A class descriptor");
+ this.disallowProperty(obj, "placement", "A class descriptor");
+ this.disallowProperty(obj, "descriptor", "A class descriptor");
+ this.disallowProperty(obj, "initializer", "A class descriptor");
+ this.disallowProperty(obj, "extras", "A class descriptor");
+
+ var finisher = _optionalCallableProperty(obj, "finisher");
+
+ var elements = this.toElementDescriptors(obj.elements);
+ return {
+ elements: elements,
+ finisher: finisher
+ };
+ },
+ runClassFinishers: function runClassFinishers(constructor, finishers) {
+ for (var i = 0; i < finishers.length; i++) {
+ var newConstructor = (0, finishers[i])(constructor);
+
+ if (newConstructor !== undefined) {
+ if (typeof newConstructor !== "function") {
+ throw new TypeError("Finishers must return a constructor.");
+ }
+
+ constructor = newConstructor;
+ }
+ }
+
+ return constructor;
+ },
+ disallowProperty: function disallowProperty(obj, name, objectType) {
+ if (obj[name] !== undefined) {
+ throw new TypeError(objectType + " can't have a ." + name + " property.");
+ }
+ }
+ };
+ return api;
+}
+
+function _createElementDescriptor(def) {
+ var key = toPropertyKey(def.key);
+ var descriptor;
+
+ if (def.kind === "method") {
+ descriptor = {
+ value: def.value,
+ writable: true,
+ configurable: true,
+ enumerable: false
+ };
+ } else if (def.kind === "get") {
+ descriptor = {
+ get: def.value,
+ configurable: true,
+ enumerable: false
+ };
+ } else if (def.kind === "set") {
+ descriptor = {
+ set: def.value,
+ configurable: true,
+ enumerable: false
+ };
+ } else if (def.kind === "field") {
+ descriptor = {
+ configurable: true,
+ writable: true,
+ enumerable: true
+ };
+ }
+
+ var element = {
+ kind: def.kind === "field" ? "field" : "method",
+ key: key,
+ placement: def["static"] ? "static" : def.kind === "field" ? "own" : "prototype",
+ descriptor: descriptor
+ };
+ if (def.decorators) element.decorators = def.decorators;
+ if (def.kind === "field") element.initializer = def.value;
+ return element;
+}
+
+function _coalesceGetterSetter(element, other) {
+ if (element.descriptor.get !== undefined) {
+ other.descriptor.get = element.descriptor.get;
+ } else {
+ other.descriptor.set = element.descriptor.set;
+ }
+}
+
+function _coalesceClassElements(elements) {
+ var newElements = [];
+
+ var isSameElement = function isSameElement(other) {
+ return other.kind === "method" && other.key === element.key && other.placement === element.placement;
+ };
+
+ for (var i = 0; i < elements.length; i++) {
+ var element = elements[i];
+ var other;
+
+ if (element.kind === "method" && (other = newElements.find(isSameElement))) {
+ if (_isDataDescriptor(element.descriptor) || _isDataDescriptor(other.descriptor)) {
+ if (_hasDecorators(element) || _hasDecorators(other)) {
+ throw new ReferenceError("Duplicated methods (" + element.key + ") can't be decorated.");
+ }
+
+ other.descriptor = element.descriptor;
+ } else {
+ if (_hasDecorators(element)) {
+ if (_hasDecorators(other)) {
+ throw new ReferenceError("Decorators can't be placed on different accessors with for " + "the same property (" + element.key + ").");
+ }
+
+ other.decorators = element.decorators;
+ }
+
+ _coalesceGetterSetter(element, other);
+ }
+ } else {
+ newElements.push(element);
+ }
+ }
+
+ return newElements;
+}
+
+function _hasDecorators(element) {
+ return element.decorators && element.decorators.length;
+}
+
+function _isDataDescriptor(desc) {
+ return desc !== undefined && !(desc.value === undefined && desc.writable === undefined);
+}
+
+function _optionalCallableProperty(obj, name) {
+ var value = obj[name];
+
+ if (value !== undefined && typeof value !== "function") {
+ throw new TypeError("Expected '" + name + "' to be a function");
+ }
+
+ return value;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/defaults.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/defaults.js
new file mode 100644
index 00000000..3de1d8ec
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/defaults.js
@@ -0,0 +1,14 @@
+export default function _defaults(obj, defaults) {
+ var keys = Object.getOwnPropertyNames(defaults);
+
+ for (var i = 0; i < keys.length; i++) {
+ var key = keys[i];
+ var value = Object.getOwnPropertyDescriptor(defaults, key);
+
+ if (value && value.configurable && obj[key] === undefined) {
+ Object.defineProperty(obj, key, value);
+ }
+ }
+
+ return obj;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/defineEnumerableProperties.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/defineEnumerableProperties.js
new file mode 100644
index 00000000..7981acd4
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/defineEnumerableProperties.js
@@ -0,0 +1,22 @@
+export default function _defineEnumerableProperties(obj, descs) {
+ for (var key in descs) {
+ var desc = descs[key];
+ desc.configurable = desc.enumerable = true;
+ if ("value" in desc) desc.writable = true;
+ Object.defineProperty(obj, key, desc);
+ }
+
+ if (Object.getOwnPropertySymbols) {
+ var objectSymbols = Object.getOwnPropertySymbols(descs);
+
+ for (var i = 0; i < objectSymbols.length; i++) {
+ var sym = objectSymbols[i];
+ var desc = descs[sym];
+ desc.configurable = desc.enumerable = true;
+ if ("value" in desc) desc.writable = true;
+ Object.defineProperty(obj, sym, desc);
+ }
+ }
+
+ return obj;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/defineProperty.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/defineProperty.js
new file mode 100644
index 00000000..7cf6e59f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/defineProperty.js
@@ -0,0 +1,14 @@
+export default function _defineProperty(obj, key, value) {
+ if (key in obj) {
+ Object.defineProperty(obj, key, {
+ value: value,
+ enumerable: true,
+ configurable: true,
+ writable: true
+ });
+ } else {
+ obj[key] = value;
+ }
+
+ return obj;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/extends.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/extends.js
new file mode 100644
index 00000000..b9b138d8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/extends.js
@@ -0,0 +1,17 @@
+export default function _extends() {
+ _extends = Object.assign || function (target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i];
+
+ for (var key in source) {
+ if (Object.prototype.hasOwnProperty.call(source, key)) {
+ target[key] = source[key];
+ }
+ }
+ }
+
+ return target;
+ };
+
+ return _extends.apply(this, arguments);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/get.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/get.js
new file mode 100644
index 00000000..92038bd1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/get.js
@@ -0,0 +1,20 @@
+import superPropBase from "./superPropBase.js";
+export default function _get() {
+ if (typeof Reflect !== "undefined" && Reflect.get) {
+ _get = Reflect.get;
+ } else {
+ _get = function _get(target, property, receiver) {
+ var base = superPropBase(target, property);
+ if (!base) return;
+ var desc = Object.getOwnPropertyDescriptor(base, property);
+
+ if (desc.get) {
+ return desc.get.call(arguments.length < 3 ? target : receiver);
+ }
+
+ return desc.value;
+ };
+ }
+
+ return _get.apply(this, arguments);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js
new file mode 100644
index 00000000..5abafe38
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js
@@ -0,0 +1,6 @@
+export default function _getPrototypeOf(o) {
+ _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) {
+ return o.__proto__ || Object.getPrototypeOf(o);
+ };
+ return _getPrototypeOf(o);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/identity.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/identity.js
new file mode 100644
index 00000000..a1e7e4cd
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/identity.js
@@ -0,0 +1,3 @@
+export default function _identity(x) {
+ return x;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/inherits.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/inherits.js
new file mode 100644
index 00000000..e099909f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/inherits.js
@@ -0,0 +1,18 @@
+import setPrototypeOf from "./setPrototypeOf.js";
+export default function _inherits(subClass, superClass) {
+ if (typeof superClass !== "function" && superClass !== null) {
+ throw new TypeError("Super expression must either be null or a function");
+ }
+
+ subClass.prototype = Object.create(superClass && superClass.prototype, {
+ constructor: {
+ value: subClass,
+ writable: true,
+ configurable: true
+ }
+ });
+ Object.defineProperty(subClass, "prototype", {
+ writable: false
+ });
+ if (superClass) setPrototypeOf(subClass, superClass);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/inheritsLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/inheritsLoose.js
new file mode 100644
index 00000000..90bb7965
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/inheritsLoose.js
@@ -0,0 +1,6 @@
+import setPrototypeOf from "./setPrototypeOf.js";
+export default function _inheritsLoose(subClass, superClass) {
+ subClass.prototype = Object.create(superClass.prototype);
+ subClass.prototype.constructor = subClass;
+ setPrototypeOf(subClass, superClass);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/initializerDefineProperty.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/initializerDefineProperty.js
new file mode 100644
index 00000000..26fdea08
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/initializerDefineProperty.js
@@ -0,0 +1,9 @@
+export default function _initializerDefineProperty(target, property, descriptor, context) {
+ if (!descriptor) return;
+ Object.defineProperty(target, property, {
+ enumerable: descriptor.enumerable,
+ configurable: descriptor.configurable,
+ writable: descriptor.writable,
+ value: descriptor.initializer ? descriptor.initializer.call(context) : void 0
+ });
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/initializerWarningHelper.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/initializerWarningHelper.js
new file mode 100644
index 00000000..30d518cf
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/initializerWarningHelper.js
@@ -0,0 +1,3 @@
+export default function _initializerWarningHelper(descriptor, context) {
+ throw new Error('Decorating class property failed. Please ensure that ' + 'proposal-class-properties is enabled and runs after the decorators transform.');
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/instanceof.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/instanceof.js
new file mode 100644
index 00000000..8c43b717
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/instanceof.js
@@ -0,0 +1,7 @@
+export default function _instanceof(left, right) {
+ if (right != null && typeof Symbol !== "undefined" && right[Symbol.hasInstance]) {
+ return !!right[Symbol.hasInstance](left);
+ } else {
+ return left instanceof right;
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/interopRequireDefault.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/interopRequireDefault.js
new file mode 100644
index 00000000..c2df7b64
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/interopRequireDefault.js
@@ -0,0 +1,5 @@
+export default function _interopRequireDefault(obj) {
+ return obj && obj.__esModule ? obj : {
+ "default": obj
+ };
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/interopRequireWildcard.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/interopRequireWildcard.js
new file mode 100644
index 00000000..01ee6b3f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/interopRequireWildcard.js
@@ -0,0 +1,51 @@
+import _typeof from "./typeof.js";
+
+function _getRequireWildcardCache(nodeInterop) {
+ if (typeof WeakMap !== "function") return null;
+ var cacheBabelInterop = new WeakMap();
+ var cacheNodeInterop = new WeakMap();
+ return (_getRequireWildcardCache = function _getRequireWildcardCache(nodeInterop) {
+ return nodeInterop ? cacheNodeInterop : cacheBabelInterop;
+ })(nodeInterop);
+}
+
+export default function _interopRequireWildcard(obj, nodeInterop) {
+ if (!nodeInterop && obj && obj.__esModule) {
+ return obj;
+ }
+
+ if (obj === null || _typeof(obj) !== "object" && typeof obj !== "function") {
+ return {
+ "default": obj
+ };
+ }
+
+ var cache = _getRequireWildcardCache(nodeInterop);
+
+ if (cache && cache.has(obj)) {
+ return cache.get(obj);
+ }
+
+ var newObj = {};
+ var hasPropertyDescriptor = Object.defineProperty && Object.getOwnPropertyDescriptor;
+
+ for (var key in obj) {
+ if (key !== "default" && Object.prototype.hasOwnProperty.call(obj, key)) {
+ var desc = hasPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : null;
+
+ if (desc && (desc.get || desc.set)) {
+ Object.defineProperty(newObj, key, desc);
+ } else {
+ newObj[key] = obj[key];
+ }
+ }
+ }
+
+ newObj["default"] = obj;
+
+ if (cache) {
+ cache.set(obj, newObj);
+ }
+
+ return newObj;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/isNativeFunction.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/isNativeFunction.js
new file mode 100644
index 00000000..7b1bc821
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/isNativeFunction.js
@@ -0,0 +1,3 @@
+export default function _isNativeFunction(fn) {
+ return Function.toString.call(fn).indexOf("[native code]") !== -1;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/isNativeReflectConstruct.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/isNativeReflectConstruct.js
new file mode 100644
index 00000000..0da1624e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/isNativeReflectConstruct.js
@@ -0,0 +1,12 @@
+export default function _isNativeReflectConstruct() {
+ if (typeof Reflect === "undefined" || !Reflect.construct) return false;
+ if (Reflect.construct.sham) return false;
+ if (typeof Proxy === "function") return true;
+
+ try {
+ Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {}));
+ return true;
+ } catch (e) {
+ return false;
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/iterableToArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/iterableToArray.js
new file mode 100644
index 00000000..cfe9fbd3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/iterableToArray.js
@@ -0,0 +1,3 @@
+export default function _iterableToArray(iter) {
+ if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null) return Array.from(iter);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimit.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimit.js
new file mode 100644
index 00000000..c72ca94b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimit.js
@@ -0,0 +1,29 @@
+export default function _iterableToArrayLimit(arr, i) {
+ var _i = arr == null ? null : typeof Symbol !== "undefined" && arr[Symbol.iterator] || arr["@@iterator"];
+
+ if (_i == null) return;
+ var _arr = [];
+ var _n = true;
+ var _d = false;
+
+ var _s, _e;
+
+ try {
+ for (_i = _i.call(arr); !(_n = (_s = _i.next()).done); _n = true) {
+ _arr.push(_s.value);
+
+ if (i && _arr.length === i) break;
+ }
+ } catch (err) {
+ _d = true;
+ _e = err;
+ } finally {
+ try {
+ if (!_n && _i["return"] != null) _i["return"]();
+ } finally {
+ if (_d) throw _e;
+ }
+ }
+
+ return _arr;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimitLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimitLoose.js
new file mode 100644
index 00000000..27c15e09
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimitLoose.js
@@ -0,0 +1,14 @@
+export default function _iterableToArrayLimitLoose(arr, i) {
+ var _i = arr && (typeof Symbol !== "undefined" && arr[Symbol.iterator] || arr["@@iterator"]);
+
+ if (_i == null) return;
+ var _arr = [];
+
+ for (_i = _i.call(arr), _step; !(_step = _i.next()).done;) {
+ _arr.push(_step.value);
+
+ if (i && _arr.length === i) break;
+ }
+
+ return _arr;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/jsx.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/jsx.js
new file mode 100644
index 00000000..9a6a94ca
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/jsx.js
@@ -0,0 +1,26 @@
+var REACT_ELEMENT_TYPE;
+export default function _createRawReactElement(type, props, key, children) {
+ REACT_ELEMENT_TYPE || (REACT_ELEMENT_TYPE = "function" == typeof Symbol && Symbol["for"] && Symbol["for"]("react.element") || 60103);
+ var defaultProps = type && type.defaultProps,
+ childrenLength = arguments.length - 3;
+ if (props || 0 === childrenLength || (props = {
+ children: void 0
+ }), 1 === childrenLength) props.children = children;else if (childrenLength > 1) {
+ for (var childArray = new Array(childrenLength), i = 0; i < childrenLength; i++) {
+ childArray[i] = arguments[i + 3];
+ }
+
+ props.children = childArray;
+ }
+ if (props && defaultProps) for (var propName in defaultProps) {
+ void 0 === props[propName] && (props[propName] = defaultProps[propName]);
+ } else props || (props = defaultProps || {});
+ return {
+ $$typeof: REACT_ELEMENT_TYPE,
+ type: type,
+ key: void 0 === key ? null : "" + key,
+ ref: null,
+ props: props,
+ _owner: null
+ };
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/maybeArrayLike.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/maybeArrayLike.js
new file mode 100644
index 00000000..f6879592
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/maybeArrayLike.js
@@ -0,0 +1,9 @@
+import arrayLikeToArray from "./arrayLikeToArray.js";
+export default function _maybeArrayLike(next, arr, i) {
+ if (arr && !Array.isArray(arr) && typeof arr.length === "number") {
+ var len = arr.length;
+ return arrayLikeToArray(arr, i !== void 0 && i < len ? i : len);
+ }
+
+ return next(arr, i);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/newArrowCheck.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/newArrowCheck.js
new file mode 100644
index 00000000..d6cd8643
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/newArrowCheck.js
@@ -0,0 +1,5 @@
+export default function _newArrowCheck(innerThis, boundThis) {
+ if (innerThis !== boundThis) {
+ throw new TypeError("Cannot instantiate an arrow function");
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/nonIterableRest.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/nonIterableRest.js
new file mode 100644
index 00000000..b349d006
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/nonIterableRest.js
@@ -0,0 +1,3 @@
+export default function _nonIterableRest() {
+ throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/nonIterableSpread.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/nonIterableSpread.js
new file mode 100644
index 00000000..82d82961
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/nonIterableSpread.js
@@ -0,0 +1,3 @@
+export default function _nonIterableSpread() {
+ throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectDestructuringEmpty.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectDestructuringEmpty.js
new file mode 100644
index 00000000..82b67d2c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectDestructuringEmpty.js
@@ -0,0 +1,3 @@
+export default function _objectDestructuringEmpty(obj) {
+ if (obj == null) throw new TypeError("Cannot destructure undefined");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectSpread.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectSpread.js
new file mode 100644
index 00000000..889a5f0e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectSpread.js
@@ -0,0 +1,19 @@
+import defineProperty from "./defineProperty.js";
+export default function _objectSpread(target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i] != null ? Object(arguments[i]) : {};
+ var ownKeys = Object.keys(source);
+
+ if (typeof Object.getOwnPropertySymbols === 'function') {
+ ownKeys.push.apply(ownKeys, Object.getOwnPropertySymbols(source).filter(function (sym) {
+ return Object.getOwnPropertyDescriptor(source, sym).enumerable;
+ }));
+ }
+
+ ownKeys.forEach(function (key) {
+ defineProperty(target, key, source[key]);
+ });
+ }
+
+ return target;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectSpread2.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectSpread2.js
new file mode 100644
index 00000000..76f29688
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectSpread2.js
@@ -0,0 +1,27 @@
+import defineProperty from "./defineProperty.js";
+
+function ownKeys(object, enumerableOnly) {
+ var keys = Object.keys(object);
+
+ if (Object.getOwnPropertySymbols) {
+ var symbols = Object.getOwnPropertySymbols(object);
+ enumerableOnly && (symbols = symbols.filter(function (sym) {
+ return Object.getOwnPropertyDescriptor(object, sym).enumerable;
+ })), keys.push.apply(keys, symbols);
+ }
+
+ return keys;
+}
+
+export default function _objectSpread2(target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = null != arguments[i] ? arguments[i] : {};
+ i % 2 ? ownKeys(Object(source), !0).forEach(function (key) {
+ defineProperty(target, key, source[key]);
+ }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys(Object(source)).forEach(function (key) {
+ Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
+ });
+ }
+
+ return target;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js
new file mode 100644
index 00000000..0fef3219
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js
@@ -0,0 +1,19 @@
+import objectWithoutPropertiesLoose from "./objectWithoutPropertiesLoose.js";
+export default function _objectWithoutProperties(source, excluded) {
+ if (source == null) return {};
+ var target = objectWithoutPropertiesLoose(source, excluded);
+ var key, i;
+
+ if (Object.getOwnPropertySymbols) {
+ var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
+
+ for (i = 0; i < sourceSymbolKeys.length; i++) {
+ key = sourceSymbolKeys[i];
+ if (excluded.indexOf(key) >= 0) continue;
+ if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue;
+ target[key] = source[key];
+ }
+ }
+
+ return target;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js
new file mode 100644
index 00000000..c36815ce
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js
@@ -0,0 +1,14 @@
+export default function _objectWithoutPropertiesLoose(source, excluded) {
+ if (source == null) return {};
+ var target = {};
+ var sourceKeys = Object.keys(source);
+ var key, i;
+
+ for (i = 0; i < sourceKeys.length; i++) {
+ key = sourceKeys[i];
+ if (excluded.indexOf(key) >= 0) continue;
+ target[key] = source[key];
+ }
+
+ return target;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/package.json b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/package.json
new file mode 100644
index 00000000..aead43de
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/package.json
@@ -0,0 +1,3 @@
+{
+ "type": "module"
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js
new file mode 100644
index 00000000..56d55445
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js
@@ -0,0 +1,11 @@
+import _typeof from "./typeof.js";
+import assertThisInitialized from "./assertThisInitialized.js";
+export default function _possibleConstructorReturn(self, call) {
+ if (call && (_typeof(call) === "object" || typeof call === "function")) {
+ return call;
+ } else if (call !== void 0) {
+ throw new TypeError("Derived constructors may only return object or undefined");
+ }
+
+ return assertThisInitialized(self);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/readOnlyError.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/readOnlyError.js
new file mode 100644
index 00000000..166e40e5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/readOnlyError.js
@@ -0,0 +1,3 @@
+export default function _readOnlyError(name) {
+ throw new TypeError("\"" + name + "\" is read-only");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/set.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/set.js
new file mode 100644
index 00000000..9c547739
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/set.js
@@ -0,0 +1,51 @@
+import superPropBase from "./superPropBase.js";
+import defineProperty from "./defineProperty.js";
+
+function set(target, property, value, receiver) {
+ if (typeof Reflect !== "undefined" && Reflect.set) {
+ set = Reflect.set;
+ } else {
+ set = function set(target, property, value, receiver) {
+ var base = superPropBase(target, property);
+ var desc;
+
+ if (base) {
+ desc = Object.getOwnPropertyDescriptor(base, property);
+
+ if (desc.set) {
+ desc.set.call(receiver, value);
+ return true;
+ } else if (!desc.writable) {
+ return false;
+ }
+ }
+
+ desc = Object.getOwnPropertyDescriptor(receiver, property);
+
+ if (desc) {
+ if (!desc.writable) {
+ return false;
+ }
+
+ desc.value = value;
+ Object.defineProperty(receiver, property, desc);
+ } else {
+ defineProperty(receiver, property, value);
+ }
+
+ return true;
+ };
+ }
+
+ return set(target, property, value, receiver);
+}
+
+export default function _set(target, property, value, receiver, isStrict) {
+ var s = set(target, property, value, receiver || target);
+
+ if (!s && isStrict) {
+ throw new Error('failed to set property');
+ }
+
+ return value;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js
new file mode 100644
index 00000000..e6ef03e5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js
@@ -0,0 +1,8 @@
+export default function _setPrototypeOf(o, p) {
+ _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {
+ o.__proto__ = p;
+ return o;
+ };
+
+ return _setPrototypeOf(o, p);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/skipFirstGeneratorNext.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/skipFirstGeneratorNext.js
new file mode 100644
index 00000000..cadd9bb5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/skipFirstGeneratorNext.js
@@ -0,0 +1,7 @@
+export default function _skipFirstGeneratorNext(fn) {
+ return function () {
+ var it = fn.apply(this, arguments);
+ it.next();
+ return it;
+ };
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/slicedToArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/slicedToArray.js
new file mode 100644
index 00000000..618200b9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/slicedToArray.js
@@ -0,0 +1,7 @@
+import arrayWithHoles from "./arrayWithHoles.js";
+import iterableToArrayLimit from "./iterableToArrayLimit.js";
+import unsupportedIterableToArray from "./unsupportedIterableToArray.js";
+import nonIterableRest from "./nonIterableRest.js";
+export default function _slicedToArray(arr, i) {
+ return arrayWithHoles(arr) || iterableToArrayLimit(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest();
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/slicedToArrayLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/slicedToArrayLoose.js
new file mode 100644
index 00000000..efc7429e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/slicedToArrayLoose.js
@@ -0,0 +1,7 @@
+import arrayWithHoles from "./arrayWithHoles.js";
+import iterableToArrayLimitLoose from "./iterableToArrayLimitLoose.js";
+import unsupportedIterableToArray from "./unsupportedIterableToArray.js";
+import nonIterableRest from "./nonIterableRest.js";
+export default function _slicedToArrayLoose(arr, i) {
+ return arrayWithHoles(arr) || iterableToArrayLimitLoose(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest();
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/superPropBase.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/superPropBase.js
new file mode 100644
index 00000000..feffe6f7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/superPropBase.js
@@ -0,0 +1,9 @@
+import getPrototypeOf from "./getPrototypeOf.js";
+export default function _superPropBase(object, property) {
+ while (!Object.prototype.hasOwnProperty.call(object, property)) {
+ object = getPrototypeOf(object);
+ if (object === null) break;
+ }
+
+ return object;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteral.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteral.js
new file mode 100644
index 00000000..421f18ab
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteral.js
@@ -0,0 +1,11 @@
+export default function _taggedTemplateLiteral(strings, raw) {
+ if (!raw) {
+ raw = strings.slice(0);
+ }
+
+ return Object.freeze(Object.defineProperties(strings, {
+ raw: {
+ value: Object.freeze(raw)
+ }
+ }));
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteralLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteralLoose.js
new file mode 100644
index 00000000..c8f081e9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteralLoose.js
@@ -0,0 +1,8 @@
+export default function _taggedTemplateLiteralLoose(strings, raw) {
+ if (!raw) {
+ raw = strings.slice(0);
+ }
+
+ strings.raw = raw;
+ return strings;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/tdz.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/tdz.js
new file mode 100644
index 00000000..d5d0adc8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/tdz.js
@@ -0,0 +1,3 @@
+export default function _tdzError(name) {
+ throw new ReferenceError(name + " is not defined - temporal dead zone");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/temporalRef.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/temporalRef.js
new file mode 100644
index 00000000..b25f7c44
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/temporalRef.js
@@ -0,0 +1,5 @@
+import undef from "./temporalUndefined.js";
+import err from "./tdz.js";
+export default function _temporalRef(val, name) {
+ return val === undef ? err(name) : val;
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/temporalUndefined.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/temporalUndefined.js
new file mode 100644
index 00000000..1a357173
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/temporalUndefined.js
@@ -0,0 +1 @@
+export default function _temporalUndefined() {}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toArray.js
new file mode 100644
index 00000000..ad7c871a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toArray.js
@@ -0,0 +1,7 @@
+import arrayWithHoles from "./arrayWithHoles.js";
+import iterableToArray from "./iterableToArray.js";
+import unsupportedIterableToArray from "./unsupportedIterableToArray.js";
+import nonIterableRest from "./nonIterableRest.js";
+export default function _toArray(arr) {
+ return arrayWithHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableRest();
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toConsumableArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toConsumableArray.js
new file mode 100644
index 00000000..bd912855
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toConsumableArray.js
@@ -0,0 +1,7 @@
+import arrayWithoutHoles from "./arrayWithoutHoles.js";
+import iterableToArray from "./iterableToArray.js";
+import unsupportedIterableToArray from "./unsupportedIterableToArray.js";
+import nonIterableSpread from "./nonIterableSpread.js";
+export default function _toConsumableArray(arr) {
+ return arrayWithoutHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableSpread();
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toPrimitive.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toPrimitive.js
new file mode 100644
index 00000000..fa32ddac
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toPrimitive.js
@@ -0,0 +1,13 @@
+import _typeof from "./typeof.js";
+export default function _toPrimitive(input, hint) {
+ if (_typeof(input) !== "object" || input === null) return input;
+ var prim = input[Symbol.toPrimitive];
+
+ if (prim !== undefined) {
+ var res = prim.call(input, hint || "default");
+ if (_typeof(res) !== "object") return res;
+ throw new TypeError("@@toPrimitive must return a primitive value.");
+ }
+
+ return (hint === "string" ? String : Number)(input);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toPropertyKey.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toPropertyKey.js
new file mode 100644
index 00000000..0fcc93b3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/toPropertyKey.js
@@ -0,0 +1,6 @@
+import _typeof from "./typeof.js";
+import toPrimitive from "./toPrimitive.js";
+export default function _toPropertyKey(arg) {
+ var key = toPrimitive(arg, "string");
+ return _typeof(key) === "symbol" ? key : String(key);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/typeof.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/typeof.js
new file mode 100644
index 00000000..92100c66
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/typeof.js
@@ -0,0 +1,9 @@
+export default function _typeof(obj) {
+ "@babel/helpers - typeof";
+
+ return _typeof = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function (obj) {
+ return typeof obj;
+ } : function (obj) {
+ return obj && "function" == typeof Symbol && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
+ }, _typeof(obj);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js
new file mode 100644
index 00000000..c0f63bd5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js
@@ -0,0 +1,9 @@
+import arrayLikeToArray from "./arrayLikeToArray.js";
+export default function _unsupportedIterableToArray(o, minLen) {
+ if (!o) return;
+ if (typeof o === "string") return arrayLikeToArray(o, minLen);
+ var n = Object.prototype.toString.call(o).slice(8, -1);
+ if (n === "Object" && o.constructor) n = o.constructor.name;
+ if (n === "Map" || n === "Set") return Array.from(o);
+ if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return arrayLikeToArray(o, minLen);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/wrapAsyncGenerator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/wrapAsyncGenerator.js
new file mode 100644
index 00000000..723b2dda
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/wrapAsyncGenerator.js
@@ -0,0 +1,6 @@
+import AsyncGenerator from "./AsyncGenerator.js";
+export default function _wrapAsyncGenerator(fn) {
+ return function () {
+ return new AsyncGenerator(fn.apply(this, arguments));
+ };
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/wrapNativeSuper.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/wrapNativeSuper.js
new file mode 100644
index 00000000..512630d0
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/wrapNativeSuper.js
@@ -0,0 +1,37 @@
+import getPrototypeOf from "./getPrototypeOf.js";
+import setPrototypeOf from "./setPrototypeOf.js";
+import isNativeFunction from "./isNativeFunction.js";
+import construct from "./construct.js";
+export default function _wrapNativeSuper(Class) {
+ var _cache = typeof Map === "function" ? new Map() : undefined;
+
+ _wrapNativeSuper = function _wrapNativeSuper(Class) {
+ if (Class === null || !isNativeFunction(Class)) return Class;
+
+ if (typeof Class !== "function") {
+ throw new TypeError("Super expression must either be null or a function");
+ }
+
+ if (typeof _cache !== "undefined") {
+ if (_cache.has(Class)) return _cache.get(Class);
+
+ _cache.set(Class, Wrapper);
+ }
+
+ function Wrapper() {
+ return construct(Class, arguments, getPrototypeOf(this).constructor);
+ }
+
+ Wrapper.prototype = Object.create(Class.prototype, {
+ constructor: {
+ value: Wrapper,
+ enumerable: false,
+ writable: true,
+ configurable: true
+ }
+ });
+ return setPrototypeOf(Wrapper, Class);
+ };
+
+ return _wrapNativeSuper(Class);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/wrapRegExp.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/wrapRegExp.js
new file mode 100644
index 00000000..beac1e13
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/wrapRegExp.js
@@ -0,0 +1,50 @@
+import _typeof from "./typeof.js";
+import setPrototypeOf from "./setPrototypeOf.js";
+import inherits from "./inherits.js";
+export default function _wrapRegExp() {
+ _wrapRegExp = function _wrapRegExp(re, groups) {
+ return new BabelRegExp(re, void 0, groups);
+ };
+
+ var _super = RegExp.prototype,
+ _groups = new WeakMap();
+
+ function BabelRegExp(re, flags, groups) {
+ var _this = new RegExp(re, flags);
+
+ return _groups.set(_this, groups || _groups.get(re)), setPrototypeOf(_this, BabelRegExp.prototype);
+ }
+
+ function buildGroups(result, re) {
+ var g = _groups.get(re);
+
+ return Object.keys(g).reduce(function (groups, name) {
+ return groups[name] = result[g[name]], groups;
+ }, Object.create(null));
+ }
+
+ return inherits(BabelRegExp, RegExp), BabelRegExp.prototype.exec = function (str) {
+ var result = _super.exec.call(this, str);
+
+ return result && (result.groups = buildGroups(result, this)), result;
+ }, BabelRegExp.prototype[Symbol.replace] = function (str, substitution) {
+ if ("string" == typeof substitution) {
+ var groups = _groups.get(this);
+
+ return _super[Symbol.replace].call(this, str, substitution.replace(/\$<([^>]+)>/g, function (_, name) {
+ return "$" + groups[name];
+ }));
+ }
+
+ if ("function" == typeof substitution) {
+ var _this = this;
+
+ return _super[Symbol.replace].call(this, str, function () {
+ var args = arguments;
+ return "object" != _typeof(args[args.length - 1]) && (args = [].slice.call(args)).push(buildGroups(args, _this)), substitution.apply(this, args);
+ });
+ }
+
+ return _super[Symbol.replace].call(this, str, substitution);
+ }, _wrapRegExp.apply(this, arguments);
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/writeOnlyError.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/writeOnlyError.js
new file mode 100644
index 00000000..9170bd45
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/esm/writeOnlyError.js
@@ -0,0 +1,3 @@
+export default function _writeOnlyError(name) {
+ throw new TypeError("\"" + name + "\" is write-only");
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/extends.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/extends.js
new file mode 100644
index 00000000..e8509df1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/extends.js
@@ -0,0 +1,18 @@
+function _extends() {
+ module.exports = _extends = Object.assign || function (target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i];
+
+ for (var key in source) {
+ if (Object.prototype.hasOwnProperty.call(source, key)) {
+ target[key] = source[key];
+ }
+ }
+ }
+
+ return target;
+ }, module.exports.__esModule = true, module.exports["default"] = module.exports;
+ return _extends.apply(this, arguments);
+}
+
+module.exports = _extends, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/get.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/get.js
new file mode 100644
index 00000000..7ddd81bd
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/get.js
@@ -0,0 +1,23 @@
+var superPropBase = require("./superPropBase.js");
+
+function _get() {
+ if (typeof Reflect !== "undefined" && Reflect.get) {
+ module.exports = _get = Reflect.get, module.exports.__esModule = true, module.exports["default"] = module.exports;
+ } else {
+ module.exports = _get = function _get(target, property, receiver) {
+ var base = superPropBase(target, property);
+ if (!base) return;
+ var desc = Object.getOwnPropertyDescriptor(base, property);
+
+ if (desc.get) {
+ return desc.get.call(arguments.length < 3 ? target : receiver);
+ }
+
+ return desc.value;
+ }, module.exports.__esModule = true, module.exports["default"] = module.exports;
+ }
+
+ return _get.apply(this, arguments);
+}
+
+module.exports = _get, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/getPrototypeOf.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/getPrototypeOf.js
new file mode 100644
index 00000000..02da5632
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/getPrototypeOf.js
@@ -0,0 +1,8 @@
+function _getPrototypeOf(o) {
+ module.exports = _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) {
+ return o.__proto__ || Object.getPrototypeOf(o);
+ }, module.exports.__esModule = true, module.exports["default"] = module.exports;
+ return _getPrototypeOf(o);
+}
+
+module.exports = _getPrototypeOf, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/identity.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/identity.js
new file mode 100644
index 00000000..3d00062c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/identity.js
@@ -0,0 +1,5 @@
+function _identity(x) {
+ return x;
+}
+
+module.exports = _identity, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/inherits.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/inherits.js
new file mode 100644
index 00000000..0b10f28e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/inherits.js
@@ -0,0 +1,21 @@
+var setPrototypeOf = require("./setPrototypeOf.js");
+
+function _inherits(subClass, superClass) {
+ if (typeof superClass !== "function" && superClass !== null) {
+ throw new TypeError("Super expression must either be null or a function");
+ }
+
+ subClass.prototype = Object.create(superClass && superClass.prototype, {
+ constructor: {
+ value: subClass,
+ writable: true,
+ configurable: true
+ }
+ });
+ Object.defineProperty(subClass, "prototype", {
+ writable: false
+ });
+ if (superClass) setPrototypeOf(subClass, superClass);
+}
+
+module.exports = _inherits, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/inheritsLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/inheritsLoose.js
new file mode 100644
index 00000000..df6de46a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/inheritsLoose.js
@@ -0,0 +1,9 @@
+var setPrototypeOf = require("./setPrototypeOf.js");
+
+function _inheritsLoose(subClass, superClass) {
+ subClass.prototype = Object.create(superClass.prototype);
+ subClass.prototype.constructor = subClass;
+ setPrototypeOf(subClass, superClass);
+}
+
+module.exports = _inheritsLoose, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/initializerDefineProperty.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/initializerDefineProperty.js
new file mode 100644
index 00000000..5a595a70
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/initializerDefineProperty.js
@@ -0,0 +1,11 @@
+function _initializerDefineProperty(target, property, descriptor, context) {
+ if (!descriptor) return;
+ Object.defineProperty(target, property, {
+ enumerable: descriptor.enumerable,
+ configurable: descriptor.configurable,
+ writable: descriptor.writable,
+ value: descriptor.initializer ? descriptor.initializer.call(context) : void 0
+ });
+}
+
+module.exports = _initializerDefineProperty, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/initializerWarningHelper.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/initializerWarningHelper.js
new file mode 100644
index 00000000..001d8a3a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/initializerWarningHelper.js
@@ -0,0 +1,5 @@
+function _initializerWarningHelper(descriptor, context) {
+ throw new Error('Decorating class property failed. Please ensure that ' + 'proposal-class-properties is enabled and runs after the decorators transform.');
+}
+
+module.exports = _initializerWarningHelper, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/instanceof.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/instanceof.js
new file mode 100644
index 00000000..08eea81b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/instanceof.js
@@ -0,0 +1,9 @@
+function _instanceof(left, right) {
+ if (right != null && typeof Symbol !== "undefined" && right[Symbol.hasInstance]) {
+ return !!right[Symbol.hasInstance](left);
+ } else {
+ return left instanceof right;
+ }
+}
+
+module.exports = _instanceof, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/interopRequireDefault.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/interopRequireDefault.js
new file mode 100644
index 00000000..5faa0e46
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/interopRequireDefault.js
@@ -0,0 +1,7 @@
+function _interopRequireDefault(obj) {
+ return obj && obj.__esModule ? obj : {
+ "default": obj
+ };
+}
+
+module.exports = _interopRequireDefault, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/interopRequireWildcard.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/interopRequireWildcard.js
new file mode 100644
index 00000000..0f8ffbfa
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/interopRequireWildcard.js
@@ -0,0 +1,53 @@
+var _typeof = require("./typeof.js")["default"];
+
+function _getRequireWildcardCache(nodeInterop) {
+ if (typeof WeakMap !== "function") return null;
+ var cacheBabelInterop = new WeakMap();
+ var cacheNodeInterop = new WeakMap();
+ return (_getRequireWildcardCache = function _getRequireWildcardCache(nodeInterop) {
+ return nodeInterop ? cacheNodeInterop : cacheBabelInterop;
+ })(nodeInterop);
+}
+
+function _interopRequireWildcard(obj, nodeInterop) {
+ if (!nodeInterop && obj && obj.__esModule) {
+ return obj;
+ }
+
+ if (obj === null || _typeof(obj) !== "object" && typeof obj !== "function") {
+ return {
+ "default": obj
+ };
+ }
+
+ var cache = _getRequireWildcardCache(nodeInterop);
+
+ if (cache && cache.has(obj)) {
+ return cache.get(obj);
+ }
+
+ var newObj = {};
+ var hasPropertyDescriptor = Object.defineProperty && Object.getOwnPropertyDescriptor;
+
+ for (var key in obj) {
+ if (key !== "default" && Object.prototype.hasOwnProperty.call(obj, key)) {
+ var desc = hasPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : null;
+
+ if (desc && (desc.get || desc.set)) {
+ Object.defineProperty(newObj, key, desc);
+ } else {
+ newObj[key] = obj[key];
+ }
+ }
+ }
+
+ newObj["default"] = obj;
+
+ if (cache) {
+ cache.set(obj, newObj);
+ }
+
+ return newObj;
+}
+
+module.exports = _interopRequireWildcard, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/isNativeFunction.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/isNativeFunction.js
new file mode 100644
index 00000000..5c3d98fc
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/isNativeFunction.js
@@ -0,0 +1,5 @@
+function _isNativeFunction(fn) {
+ return Function.toString.call(fn).indexOf("[native code]") !== -1;
+}
+
+module.exports = _isNativeFunction, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/isNativeReflectConstruct.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/isNativeReflectConstruct.js
new file mode 100644
index 00000000..f07899da
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/isNativeReflectConstruct.js
@@ -0,0 +1,14 @@
+function _isNativeReflectConstruct() {
+ if (typeof Reflect === "undefined" || !Reflect.construct) return false;
+ if (Reflect.construct.sham) return false;
+ if (typeof Proxy === "function") return true;
+
+ try {
+ Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {}));
+ return true;
+ } catch (e) {
+ return false;
+ }
+}
+
+module.exports = _isNativeReflectConstruct, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/iterableToArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/iterableToArray.js
new file mode 100644
index 00000000..5b9038a8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/iterableToArray.js
@@ -0,0 +1,5 @@
+function _iterableToArray(iter) {
+ if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null) return Array.from(iter);
+}
+
+module.exports = _iterableToArray, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/iterableToArrayLimit.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/iterableToArrayLimit.js
new file mode 100644
index 00000000..8d01fb31
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/iterableToArrayLimit.js
@@ -0,0 +1,31 @@
+function _iterableToArrayLimit(arr, i) {
+ var _i = arr == null ? null : typeof Symbol !== "undefined" && arr[Symbol.iterator] || arr["@@iterator"];
+
+ if (_i == null) return;
+ var _arr = [];
+ var _n = true;
+ var _d = false;
+
+ var _s, _e;
+
+ try {
+ for (_i = _i.call(arr); !(_n = (_s = _i.next()).done); _n = true) {
+ _arr.push(_s.value);
+
+ if (i && _arr.length === i) break;
+ }
+ } catch (err) {
+ _d = true;
+ _e = err;
+ } finally {
+ try {
+ if (!_n && _i["return"] != null) _i["return"]();
+ } finally {
+ if (_d) throw _e;
+ }
+ }
+
+ return _arr;
+}
+
+module.exports = _iterableToArrayLimit, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/iterableToArrayLimitLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/iterableToArrayLimitLoose.js
new file mode 100644
index 00000000..bca54521
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/iterableToArrayLimitLoose.js
@@ -0,0 +1,16 @@
+function _iterableToArrayLimitLoose(arr, i) {
+ var _i = arr && (typeof Symbol !== "undefined" && arr[Symbol.iterator] || arr["@@iterator"]);
+
+ if (_i == null) return;
+ var _arr = [];
+
+ for (_i = _i.call(arr), _step; !(_step = _i.next()).done;) {
+ _arr.push(_step.value);
+
+ if (i && _arr.length === i) break;
+ }
+
+ return _arr;
+}
+
+module.exports = _iterableToArrayLimitLoose, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/jsx.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/jsx.js
new file mode 100644
index 00000000..bc19ec4b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/jsx.js
@@ -0,0 +1,29 @@
+var REACT_ELEMENT_TYPE;
+
+function _createRawReactElement(type, props, key, children) {
+ REACT_ELEMENT_TYPE || (REACT_ELEMENT_TYPE = "function" == typeof Symbol && Symbol["for"] && Symbol["for"]("react.element") || 60103);
+ var defaultProps = type && type.defaultProps,
+ childrenLength = arguments.length - 3;
+ if (props || 0 === childrenLength || (props = {
+ children: void 0
+ }), 1 === childrenLength) props.children = children;else if (childrenLength > 1) {
+ for (var childArray = new Array(childrenLength), i = 0; i < childrenLength; i++) {
+ childArray[i] = arguments[i + 3];
+ }
+
+ props.children = childArray;
+ }
+ if (props && defaultProps) for (var propName in defaultProps) {
+ void 0 === props[propName] && (props[propName] = defaultProps[propName]);
+ } else props || (props = defaultProps || {});
+ return {
+ $$typeof: REACT_ELEMENT_TYPE,
+ type: type,
+ key: void 0 === key ? null : "" + key,
+ ref: null,
+ props: props,
+ _owner: null
+ };
+}
+
+module.exports = _createRawReactElement, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/maybeArrayLike.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/maybeArrayLike.js
new file mode 100644
index 00000000..212d68c7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/maybeArrayLike.js
@@ -0,0 +1,12 @@
+var arrayLikeToArray = require("./arrayLikeToArray.js");
+
+function _maybeArrayLike(next, arr, i) {
+ if (arr && !Array.isArray(arr) && typeof arr.length === "number") {
+ var len = arr.length;
+ return arrayLikeToArray(arr, i !== void 0 && i < len ? i : len);
+ }
+
+ return next(arr, i);
+}
+
+module.exports = _maybeArrayLike, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/newArrowCheck.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/newArrowCheck.js
new file mode 100644
index 00000000..86a91f2b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/newArrowCheck.js
@@ -0,0 +1,7 @@
+function _newArrowCheck(innerThis, boundThis) {
+ if (innerThis !== boundThis) {
+ throw new TypeError("Cannot instantiate an arrow function");
+ }
+}
+
+module.exports = _newArrowCheck, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/nonIterableRest.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/nonIterableRest.js
new file mode 100644
index 00000000..e7911087
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/nonIterableRest.js
@@ -0,0 +1,5 @@
+function _nonIterableRest() {
+ throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+}
+
+module.exports = _nonIterableRest, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/nonIterableSpread.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/nonIterableSpread.js
new file mode 100644
index 00000000..64379ea2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/nonIterableSpread.js
@@ -0,0 +1,5 @@
+function _nonIterableSpread() {
+ throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+}
+
+module.exports = _nonIterableSpread, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectDestructuringEmpty.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectDestructuringEmpty.js
new file mode 100644
index 00000000..cb0866e7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectDestructuringEmpty.js
@@ -0,0 +1,5 @@
+function _objectDestructuringEmpty(obj) {
+ if (obj == null) throw new TypeError("Cannot destructure undefined");
+}
+
+module.exports = _objectDestructuringEmpty, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectSpread.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectSpread.js
new file mode 100644
index 00000000..cfb43097
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectSpread.js
@@ -0,0 +1,22 @@
+var defineProperty = require("./defineProperty.js");
+
+function _objectSpread(target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i] != null ? Object(arguments[i]) : {};
+ var ownKeys = Object.keys(source);
+
+ if (typeof Object.getOwnPropertySymbols === 'function') {
+ ownKeys.push.apply(ownKeys, Object.getOwnPropertySymbols(source).filter(function (sym) {
+ return Object.getOwnPropertyDescriptor(source, sym).enumerable;
+ }));
+ }
+
+ ownKeys.forEach(function (key) {
+ defineProperty(target, key, source[key]);
+ });
+ }
+
+ return target;
+}
+
+module.exports = _objectSpread, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectSpread2.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectSpread2.js
new file mode 100644
index 00000000..7e5db07d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectSpread2.js
@@ -0,0 +1,29 @@
+var defineProperty = require("./defineProperty.js");
+
+function ownKeys(object, enumerableOnly) {
+ var keys = Object.keys(object);
+
+ if (Object.getOwnPropertySymbols) {
+ var symbols = Object.getOwnPropertySymbols(object);
+ enumerableOnly && (symbols = symbols.filter(function (sym) {
+ return Object.getOwnPropertyDescriptor(object, sym).enumerable;
+ })), keys.push.apply(keys, symbols);
+ }
+
+ return keys;
+}
+
+function _objectSpread2(target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = null != arguments[i] ? arguments[i] : {};
+ i % 2 ? ownKeys(Object(source), !0).forEach(function (key) {
+ defineProperty(target, key, source[key]);
+ }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys(Object(source)).forEach(function (key) {
+ Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
+ });
+ }
+
+ return target;
+}
+
+module.exports = _objectSpread2, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectWithoutProperties.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectWithoutProperties.js
new file mode 100644
index 00000000..8cf3ab8d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectWithoutProperties.js
@@ -0,0 +1,22 @@
+var objectWithoutPropertiesLoose = require("./objectWithoutPropertiesLoose.js");
+
+function _objectWithoutProperties(source, excluded) {
+ if (source == null) return {};
+ var target = objectWithoutPropertiesLoose(source, excluded);
+ var key, i;
+
+ if (Object.getOwnPropertySymbols) {
+ var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
+
+ for (i = 0; i < sourceSymbolKeys.length; i++) {
+ key = sourceSymbolKeys[i];
+ if (excluded.indexOf(key) >= 0) continue;
+ if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue;
+ target[key] = source[key];
+ }
+ }
+
+ return target;
+}
+
+module.exports = _objectWithoutProperties, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectWithoutPropertiesLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectWithoutPropertiesLoose.js
new file mode 100644
index 00000000..44d5771e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/objectWithoutPropertiesLoose.js
@@ -0,0 +1,16 @@
+function _objectWithoutPropertiesLoose(source, excluded) {
+ if (source == null) return {};
+ var target = {};
+ var sourceKeys = Object.keys(source);
+ var key, i;
+
+ for (i = 0; i < sourceKeys.length; i++) {
+ key = sourceKeys[i];
+ if (excluded.indexOf(key) >= 0) continue;
+ target[key] = source[key];
+ }
+
+ return target;
+}
+
+module.exports = _objectWithoutPropertiesLoose, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/possibleConstructorReturn.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/possibleConstructorReturn.js
new file mode 100644
index 00000000..e1997be4
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/possibleConstructorReturn.js
@@ -0,0 +1,15 @@
+var _typeof = require("./typeof.js")["default"];
+
+var assertThisInitialized = require("./assertThisInitialized.js");
+
+function _possibleConstructorReturn(self, call) {
+ if (call && (_typeof(call) === "object" || typeof call === "function")) {
+ return call;
+ } else if (call !== void 0) {
+ throw new TypeError("Derived constructors may only return object or undefined");
+ }
+
+ return assertThisInitialized(self);
+}
+
+module.exports = _possibleConstructorReturn, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/readOnlyError.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/readOnlyError.js
new file mode 100644
index 00000000..93cb90c6
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/readOnlyError.js
@@ -0,0 +1,5 @@
+function _readOnlyError(name) {
+ throw new TypeError("\"" + name + "\" is read-only");
+}
+
+module.exports = _readOnlyError, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/set.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/set.js
new file mode 100644
index 00000000..6438def2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/set.js
@@ -0,0 +1,54 @@
+var superPropBase = require("./superPropBase.js");
+
+var defineProperty = require("./defineProperty.js");
+
+function set(target, property, value, receiver) {
+ if (typeof Reflect !== "undefined" && Reflect.set) {
+ set = Reflect.set;
+ } else {
+ set = function set(target, property, value, receiver) {
+ var base = superPropBase(target, property);
+ var desc;
+
+ if (base) {
+ desc = Object.getOwnPropertyDescriptor(base, property);
+
+ if (desc.set) {
+ desc.set.call(receiver, value);
+ return true;
+ } else if (!desc.writable) {
+ return false;
+ }
+ }
+
+ desc = Object.getOwnPropertyDescriptor(receiver, property);
+
+ if (desc) {
+ if (!desc.writable) {
+ return false;
+ }
+
+ desc.value = value;
+ Object.defineProperty(receiver, property, desc);
+ } else {
+ defineProperty(receiver, property, value);
+ }
+
+ return true;
+ };
+ }
+
+ return set(target, property, value, receiver);
+}
+
+function _set(target, property, value, receiver, isStrict) {
+ var s = set(target, property, value, receiver || target);
+
+ if (!s && isStrict) {
+ throw new Error('failed to set property');
+ }
+
+ return value;
+}
+
+module.exports = _set, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/setPrototypeOf.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/setPrototypeOf.js
new file mode 100644
index 00000000..7efecade
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/setPrototypeOf.js
@@ -0,0 +1,9 @@
+function _setPrototypeOf(o, p) {
+ module.exports = _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {
+ o.__proto__ = p;
+ return o;
+ }, module.exports.__esModule = true, module.exports["default"] = module.exports;
+ return _setPrototypeOf(o, p);
+}
+
+module.exports = _setPrototypeOf, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/skipFirstGeneratorNext.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/skipFirstGeneratorNext.js
new file mode 100644
index 00000000..88908962
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/skipFirstGeneratorNext.js
@@ -0,0 +1,9 @@
+function _skipFirstGeneratorNext(fn) {
+ return function () {
+ var it = fn.apply(this, arguments);
+ it.next();
+ return it;
+ };
+}
+
+module.exports = _skipFirstGeneratorNext, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/slicedToArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/slicedToArray.js
new file mode 100644
index 00000000..bce5fc0b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/slicedToArray.js
@@ -0,0 +1,13 @@
+var arrayWithHoles = require("./arrayWithHoles.js");
+
+var iterableToArrayLimit = require("./iterableToArrayLimit.js");
+
+var unsupportedIterableToArray = require("./unsupportedIterableToArray.js");
+
+var nonIterableRest = require("./nonIterableRest.js");
+
+function _slicedToArray(arr, i) {
+ return arrayWithHoles(arr) || iterableToArrayLimit(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest();
+}
+
+module.exports = _slicedToArray, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/slicedToArrayLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/slicedToArrayLoose.js
new file mode 100644
index 00000000..cc9ace2f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/slicedToArrayLoose.js
@@ -0,0 +1,13 @@
+var arrayWithHoles = require("./arrayWithHoles.js");
+
+var iterableToArrayLimitLoose = require("./iterableToArrayLimitLoose.js");
+
+var unsupportedIterableToArray = require("./unsupportedIterableToArray.js");
+
+var nonIterableRest = require("./nonIterableRest.js");
+
+function _slicedToArrayLoose(arr, i) {
+ return arrayWithHoles(arr) || iterableToArrayLimitLoose(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest();
+}
+
+module.exports = _slicedToArrayLoose, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/superPropBase.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/superPropBase.js
new file mode 100644
index 00000000..dd47fff7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/superPropBase.js
@@ -0,0 +1,12 @@
+var getPrototypeOf = require("./getPrototypeOf.js");
+
+function _superPropBase(object, property) {
+ while (!Object.prototype.hasOwnProperty.call(object, property)) {
+ object = getPrototypeOf(object);
+ if (object === null) break;
+ }
+
+ return object;
+}
+
+module.exports = _superPropBase, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/taggedTemplateLiteral.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/taggedTemplateLiteral.js
new file mode 100644
index 00000000..6d9738ca
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/taggedTemplateLiteral.js
@@ -0,0 +1,13 @@
+function _taggedTemplateLiteral(strings, raw) {
+ if (!raw) {
+ raw = strings.slice(0);
+ }
+
+ return Object.freeze(Object.defineProperties(strings, {
+ raw: {
+ value: Object.freeze(raw)
+ }
+ }));
+}
+
+module.exports = _taggedTemplateLiteral, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/taggedTemplateLiteralLoose.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/taggedTemplateLiteralLoose.js
new file mode 100644
index 00000000..4f151ca7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/taggedTemplateLiteralLoose.js
@@ -0,0 +1,10 @@
+function _taggedTemplateLiteralLoose(strings, raw) {
+ if (!raw) {
+ raw = strings.slice(0);
+ }
+
+ strings.raw = raw;
+ return strings;
+}
+
+module.exports = _taggedTemplateLiteralLoose, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/tdz.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/tdz.js
new file mode 100644
index 00000000..91ec2b22
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/tdz.js
@@ -0,0 +1,5 @@
+function _tdzError(name) {
+ throw new ReferenceError(name + " is not defined - temporal dead zone");
+}
+
+module.exports = _tdzError, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/temporalRef.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/temporalRef.js
new file mode 100644
index 00000000..6afd9323
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/temporalRef.js
@@ -0,0 +1,9 @@
+var temporalUndefined = require("./temporalUndefined.js");
+
+var tdz = require("./tdz.js");
+
+function _temporalRef(val, name) {
+ return val === temporalUndefined ? tdz(name) : val;
+}
+
+module.exports = _temporalRef, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/temporalUndefined.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/temporalUndefined.js
new file mode 100644
index 00000000..7aca810f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/temporalUndefined.js
@@ -0,0 +1,3 @@
+function _temporalUndefined() {}
+
+module.exports = _temporalUndefined, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toArray.js
new file mode 100644
index 00000000..d0af0e93
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toArray.js
@@ -0,0 +1,13 @@
+var arrayWithHoles = require("./arrayWithHoles.js");
+
+var iterableToArray = require("./iterableToArray.js");
+
+var unsupportedIterableToArray = require("./unsupportedIterableToArray.js");
+
+var nonIterableRest = require("./nonIterableRest.js");
+
+function _toArray(arr) {
+ return arrayWithHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableRest();
+}
+
+module.exports = _toArray, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toConsumableArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toConsumableArray.js
new file mode 100644
index 00000000..9c69072c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toConsumableArray.js
@@ -0,0 +1,13 @@
+var arrayWithoutHoles = require("./arrayWithoutHoles.js");
+
+var iterableToArray = require("./iterableToArray.js");
+
+var unsupportedIterableToArray = require("./unsupportedIterableToArray.js");
+
+var nonIterableSpread = require("./nonIterableSpread.js");
+
+function _toConsumableArray(arr) {
+ return arrayWithoutHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableSpread();
+}
+
+module.exports = _toConsumableArray, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toPrimitive.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toPrimitive.js
new file mode 100644
index 00000000..dc4da81a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toPrimitive.js
@@ -0,0 +1,16 @@
+var _typeof = require("./typeof.js")["default"];
+
+function _toPrimitive(input, hint) {
+ if (_typeof(input) !== "object" || input === null) return input;
+ var prim = input[Symbol.toPrimitive];
+
+ if (prim !== undefined) {
+ var res = prim.call(input, hint || "default");
+ if (_typeof(res) !== "object") return res;
+ throw new TypeError("@@toPrimitive must return a primitive value.");
+ }
+
+ return (hint === "string" ? String : Number)(input);
+}
+
+module.exports = _toPrimitive, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toPropertyKey.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toPropertyKey.js
new file mode 100644
index 00000000..61367cf3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/toPropertyKey.js
@@ -0,0 +1,10 @@
+var _typeof = require("./typeof.js")["default"];
+
+var toPrimitive = require("./toPrimitive.js");
+
+function _toPropertyKey(arg) {
+ var key = toPrimitive(arg, "string");
+ return _typeof(key) === "symbol" ? key : String(key);
+}
+
+module.exports = _toPropertyKey, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/typeof.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/typeof.js
new file mode 100644
index 00000000..6c7860ff
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/typeof.js
@@ -0,0 +1,11 @@
+function _typeof(obj) {
+ "@babel/helpers - typeof";
+
+ return (module.exports = _typeof = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function (obj) {
+ return typeof obj;
+ } : function (obj) {
+ return obj && "function" == typeof Symbol && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
+ }, module.exports.__esModule = true, module.exports["default"] = module.exports), _typeof(obj);
+}
+
+module.exports = _typeof, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/unsupportedIterableToArray.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/unsupportedIterableToArray.js
new file mode 100644
index 00000000..bfe65e40
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/unsupportedIterableToArray.js
@@ -0,0 +1,12 @@
+var arrayLikeToArray = require("./arrayLikeToArray.js");
+
+function _unsupportedIterableToArray(o, minLen) {
+ if (!o) return;
+ if (typeof o === "string") return arrayLikeToArray(o, minLen);
+ var n = Object.prototype.toString.call(o).slice(8, -1);
+ if (n === "Object" && o.constructor) n = o.constructor.name;
+ if (n === "Map" || n === "Set") return Array.from(o);
+ if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return arrayLikeToArray(o, minLen);
+}
+
+module.exports = _unsupportedIterableToArray, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/wrapAsyncGenerator.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/wrapAsyncGenerator.js
new file mode 100644
index 00000000..1fb4fd76
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/wrapAsyncGenerator.js
@@ -0,0 +1,9 @@
+var AsyncGenerator = require("./AsyncGenerator.js");
+
+function _wrapAsyncGenerator(fn) {
+ return function () {
+ return new AsyncGenerator(fn.apply(this, arguments));
+ };
+}
+
+module.exports = _wrapAsyncGenerator, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/wrapNativeSuper.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/wrapNativeSuper.js
new file mode 100644
index 00000000..516220bf
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/wrapNativeSuper.js
@@ -0,0 +1,42 @@
+var getPrototypeOf = require("./getPrototypeOf.js");
+
+var setPrototypeOf = require("./setPrototypeOf.js");
+
+var isNativeFunction = require("./isNativeFunction.js");
+
+var construct = require("./construct.js");
+
+function _wrapNativeSuper(Class) {
+ var _cache = typeof Map === "function" ? new Map() : undefined;
+
+ module.exports = _wrapNativeSuper = function _wrapNativeSuper(Class) {
+ if (Class === null || !isNativeFunction(Class)) return Class;
+
+ if (typeof Class !== "function") {
+ throw new TypeError("Super expression must either be null or a function");
+ }
+
+ if (typeof _cache !== "undefined") {
+ if (_cache.has(Class)) return _cache.get(Class);
+
+ _cache.set(Class, Wrapper);
+ }
+
+ function Wrapper() {
+ return construct(Class, arguments, getPrototypeOf(this).constructor);
+ }
+
+ Wrapper.prototype = Object.create(Class.prototype, {
+ constructor: {
+ value: Wrapper,
+ enumerable: false,
+ writable: true,
+ configurable: true
+ }
+ });
+ return setPrototypeOf(Wrapper, Class);
+ }, module.exports.__esModule = true, module.exports["default"] = module.exports;
+ return _wrapNativeSuper(Class);
+}
+
+module.exports = _wrapNativeSuper, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/wrapRegExp.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/wrapRegExp.js
new file mode 100644
index 00000000..5b8342bd
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/wrapRegExp.js
@@ -0,0 +1,55 @@
+var _typeof = require("./typeof.js")["default"];
+
+var setPrototypeOf = require("./setPrototypeOf.js");
+
+var inherits = require("./inherits.js");
+
+function _wrapRegExp() {
+ module.exports = _wrapRegExp = function _wrapRegExp(re, groups) {
+ return new BabelRegExp(re, void 0, groups);
+ }, module.exports.__esModule = true, module.exports["default"] = module.exports;
+
+ var _super = RegExp.prototype,
+ _groups = new WeakMap();
+
+ function BabelRegExp(re, flags, groups) {
+ var _this = new RegExp(re, flags);
+
+ return _groups.set(_this, groups || _groups.get(re)), setPrototypeOf(_this, BabelRegExp.prototype);
+ }
+
+ function buildGroups(result, re) {
+ var g = _groups.get(re);
+
+ return Object.keys(g).reduce(function (groups, name) {
+ return groups[name] = result[g[name]], groups;
+ }, Object.create(null));
+ }
+
+ return inherits(BabelRegExp, RegExp), BabelRegExp.prototype.exec = function (str) {
+ var result = _super.exec.call(this, str);
+
+ return result && (result.groups = buildGroups(result, this)), result;
+ }, BabelRegExp.prototype[Symbol.replace] = function (str, substitution) {
+ if ("string" == typeof substitution) {
+ var groups = _groups.get(this);
+
+ return _super[Symbol.replace].call(this, str, substitution.replace(/\$<([^>]+)>/g, function (_, name) {
+ return "$" + groups[name];
+ }));
+ }
+
+ if ("function" == typeof substitution) {
+ var _this = this;
+
+ return _super[Symbol.replace].call(this, str, function () {
+ var args = arguments;
+ return "object" != _typeof(args[args.length - 1]) && (args = [].slice.call(args)).push(buildGroups(args, _this)), substitution.apply(this, args);
+ });
+ }
+
+ return _super[Symbol.replace].call(this, str, substitution);
+ }, _wrapRegExp.apply(this, arguments);
+}
+
+module.exports = _wrapRegExp, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/writeOnlyError.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/writeOnlyError.js
new file mode 100644
index 00000000..13294873
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/helpers/writeOnlyError.js
@@ -0,0 +1,5 @@
+function _writeOnlyError(name) {
+ throw new TypeError("\"" + name + "\" is write-only");
+}
+
+module.exports = _writeOnlyError, module.exports.__esModule = true, module.exports["default"] = module.exports;
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/package.json b/temporary_modules/trezor-connect/node_modules/@babel/runtime/package.json
new file mode 100644
index 00000000..2a394c07
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/package.json
@@ -0,0 +1,866 @@
+{
+ "name": "@babel/runtime",
+ "version": "7.17.9",
+ "description": "babel's modular runtime helpers",
+ "license": "MIT",
+ "publishConfig": {
+ "access": "public"
+ },
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/babel/babel.git",
+ "directory": "packages/babel-runtime"
+ },
+ "homepage": "https://babel.dev/docs/en/next/babel-runtime",
+ "author": "The Babel Team (https://babel.dev/team)",
+ "dependencies": {
+ "regenerator-runtime": "^0.13.4"
+ },
+ "exports": {
+ "./helpers/applyDecs": [
+ {
+ "node": "./helpers/applyDecs.js",
+ "import": "./helpers/esm/applyDecs.js",
+ "default": "./helpers/applyDecs.js"
+ },
+ "./helpers/applyDecs.js"
+ ],
+ "./helpers/esm/applyDecs": "./helpers/esm/applyDecs.js",
+ "./helpers/asyncIterator": [
+ {
+ "node": "./helpers/asyncIterator.js",
+ "import": "./helpers/esm/asyncIterator.js",
+ "default": "./helpers/asyncIterator.js"
+ },
+ "./helpers/asyncIterator.js"
+ ],
+ "./helpers/esm/asyncIterator": "./helpers/esm/asyncIterator.js",
+ "./helpers/jsx": [
+ {
+ "node": "./helpers/jsx.js",
+ "import": "./helpers/esm/jsx.js",
+ "default": "./helpers/jsx.js"
+ },
+ "./helpers/jsx.js"
+ ],
+ "./helpers/esm/jsx": "./helpers/esm/jsx.js",
+ "./helpers/objectSpread2": [
+ {
+ "node": "./helpers/objectSpread2.js",
+ "import": "./helpers/esm/objectSpread2.js",
+ "default": "./helpers/objectSpread2.js"
+ },
+ "./helpers/objectSpread2.js"
+ ],
+ "./helpers/esm/objectSpread2": "./helpers/esm/objectSpread2.js",
+ "./helpers/typeof": [
+ {
+ "node": "./helpers/typeof.js",
+ "import": "./helpers/esm/typeof.js",
+ "default": "./helpers/typeof.js"
+ },
+ "./helpers/typeof.js"
+ ],
+ "./helpers/esm/typeof": "./helpers/esm/typeof.js",
+ "./helpers/wrapRegExp": [
+ {
+ "node": "./helpers/wrapRegExp.js",
+ "import": "./helpers/esm/wrapRegExp.js",
+ "default": "./helpers/wrapRegExp.js"
+ },
+ "./helpers/wrapRegExp.js"
+ ],
+ "./helpers/esm/wrapRegExp": "./helpers/esm/wrapRegExp.js",
+ "./helpers/AwaitValue": [
+ {
+ "node": "./helpers/AwaitValue.js",
+ "import": "./helpers/esm/AwaitValue.js",
+ "default": "./helpers/AwaitValue.js"
+ },
+ "./helpers/AwaitValue.js"
+ ],
+ "./helpers/esm/AwaitValue": "./helpers/esm/AwaitValue.js",
+ "./helpers/AsyncGenerator": [
+ {
+ "node": "./helpers/AsyncGenerator.js",
+ "import": "./helpers/esm/AsyncGenerator.js",
+ "default": "./helpers/AsyncGenerator.js"
+ },
+ "./helpers/AsyncGenerator.js"
+ ],
+ "./helpers/esm/AsyncGenerator": "./helpers/esm/AsyncGenerator.js",
+ "./helpers/wrapAsyncGenerator": [
+ {
+ "node": "./helpers/wrapAsyncGenerator.js",
+ "import": "./helpers/esm/wrapAsyncGenerator.js",
+ "default": "./helpers/wrapAsyncGenerator.js"
+ },
+ "./helpers/wrapAsyncGenerator.js"
+ ],
+ "./helpers/esm/wrapAsyncGenerator": "./helpers/esm/wrapAsyncGenerator.js",
+ "./helpers/awaitAsyncGenerator": [
+ {
+ "node": "./helpers/awaitAsyncGenerator.js",
+ "import": "./helpers/esm/awaitAsyncGenerator.js",
+ "default": "./helpers/awaitAsyncGenerator.js"
+ },
+ "./helpers/awaitAsyncGenerator.js"
+ ],
+ "./helpers/esm/awaitAsyncGenerator": "./helpers/esm/awaitAsyncGenerator.js",
+ "./helpers/asyncGeneratorDelegate": [
+ {
+ "node": "./helpers/asyncGeneratorDelegate.js",
+ "import": "./helpers/esm/asyncGeneratorDelegate.js",
+ "default": "./helpers/asyncGeneratorDelegate.js"
+ },
+ "./helpers/asyncGeneratorDelegate.js"
+ ],
+ "./helpers/esm/asyncGeneratorDelegate": "./helpers/esm/asyncGeneratorDelegate.js",
+ "./helpers/asyncToGenerator": [
+ {
+ "node": "./helpers/asyncToGenerator.js",
+ "import": "./helpers/esm/asyncToGenerator.js",
+ "default": "./helpers/asyncToGenerator.js"
+ },
+ "./helpers/asyncToGenerator.js"
+ ],
+ "./helpers/esm/asyncToGenerator": "./helpers/esm/asyncToGenerator.js",
+ "./helpers/classCallCheck": [
+ {
+ "node": "./helpers/classCallCheck.js",
+ "import": "./helpers/esm/classCallCheck.js",
+ "default": "./helpers/classCallCheck.js"
+ },
+ "./helpers/classCallCheck.js"
+ ],
+ "./helpers/esm/classCallCheck": "./helpers/esm/classCallCheck.js",
+ "./helpers/createClass": [
+ {
+ "node": "./helpers/createClass.js",
+ "import": "./helpers/esm/createClass.js",
+ "default": "./helpers/createClass.js"
+ },
+ "./helpers/createClass.js"
+ ],
+ "./helpers/esm/createClass": "./helpers/esm/createClass.js",
+ "./helpers/defineEnumerableProperties": [
+ {
+ "node": "./helpers/defineEnumerableProperties.js",
+ "import": "./helpers/esm/defineEnumerableProperties.js",
+ "default": "./helpers/defineEnumerableProperties.js"
+ },
+ "./helpers/defineEnumerableProperties.js"
+ ],
+ "./helpers/esm/defineEnumerableProperties": "./helpers/esm/defineEnumerableProperties.js",
+ "./helpers/defaults": [
+ {
+ "node": "./helpers/defaults.js",
+ "import": "./helpers/esm/defaults.js",
+ "default": "./helpers/defaults.js"
+ },
+ "./helpers/defaults.js"
+ ],
+ "./helpers/esm/defaults": "./helpers/esm/defaults.js",
+ "./helpers/defineProperty": [
+ {
+ "node": "./helpers/defineProperty.js",
+ "import": "./helpers/esm/defineProperty.js",
+ "default": "./helpers/defineProperty.js"
+ },
+ "./helpers/defineProperty.js"
+ ],
+ "./helpers/esm/defineProperty": "./helpers/esm/defineProperty.js",
+ "./helpers/extends": [
+ {
+ "node": "./helpers/extends.js",
+ "import": "./helpers/esm/extends.js",
+ "default": "./helpers/extends.js"
+ },
+ "./helpers/extends.js"
+ ],
+ "./helpers/esm/extends": "./helpers/esm/extends.js",
+ "./helpers/objectSpread": [
+ {
+ "node": "./helpers/objectSpread.js",
+ "import": "./helpers/esm/objectSpread.js",
+ "default": "./helpers/objectSpread.js"
+ },
+ "./helpers/objectSpread.js"
+ ],
+ "./helpers/esm/objectSpread": "./helpers/esm/objectSpread.js",
+ "./helpers/inherits": [
+ {
+ "node": "./helpers/inherits.js",
+ "import": "./helpers/esm/inherits.js",
+ "default": "./helpers/inherits.js"
+ },
+ "./helpers/inherits.js"
+ ],
+ "./helpers/esm/inherits": "./helpers/esm/inherits.js",
+ "./helpers/inheritsLoose": [
+ {
+ "node": "./helpers/inheritsLoose.js",
+ "import": "./helpers/esm/inheritsLoose.js",
+ "default": "./helpers/inheritsLoose.js"
+ },
+ "./helpers/inheritsLoose.js"
+ ],
+ "./helpers/esm/inheritsLoose": "./helpers/esm/inheritsLoose.js",
+ "./helpers/getPrototypeOf": [
+ {
+ "node": "./helpers/getPrototypeOf.js",
+ "import": "./helpers/esm/getPrototypeOf.js",
+ "default": "./helpers/getPrototypeOf.js"
+ },
+ "./helpers/getPrototypeOf.js"
+ ],
+ "./helpers/esm/getPrototypeOf": "./helpers/esm/getPrototypeOf.js",
+ "./helpers/setPrototypeOf": [
+ {
+ "node": "./helpers/setPrototypeOf.js",
+ "import": "./helpers/esm/setPrototypeOf.js",
+ "default": "./helpers/setPrototypeOf.js"
+ },
+ "./helpers/setPrototypeOf.js"
+ ],
+ "./helpers/esm/setPrototypeOf": "./helpers/esm/setPrototypeOf.js",
+ "./helpers/isNativeReflectConstruct": [
+ {
+ "node": "./helpers/isNativeReflectConstruct.js",
+ "import": "./helpers/esm/isNativeReflectConstruct.js",
+ "default": "./helpers/isNativeReflectConstruct.js"
+ },
+ "./helpers/isNativeReflectConstruct.js"
+ ],
+ "./helpers/esm/isNativeReflectConstruct": "./helpers/esm/isNativeReflectConstruct.js",
+ "./helpers/construct": [
+ {
+ "node": "./helpers/construct.js",
+ "import": "./helpers/esm/construct.js",
+ "default": "./helpers/construct.js"
+ },
+ "./helpers/construct.js"
+ ],
+ "./helpers/esm/construct": "./helpers/esm/construct.js",
+ "./helpers/isNativeFunction": [
+ {
+ "node": "./helpers/isNativeFunction.js",
+ "import": "./helpers/esm/isNativeFunction.js",
+ "default": "./helpers/isNativeFunction.js"
+ },
+ "./helpers/isNativeFunction.js"
+ ],
+ "./helpers/esm/isNativeFunction": "./helpers/esm/isNativeFunction.js",
+ "./helpers/wrapNativeSuper": [
+ {
+ "node": "./helpers/wrapNativeSuper.js",
+ "import": "./helpers/esm/wrapNativeSuper.js",
+ "default": "./helpers/wrapNativeSuper.js"
+ },
+ "./helpers/wrapNativeSuper.js"
+ ],
+ "./helpers/esm/wrapNativeSuper": "./helpers/esm/wrapNativeSuper.js",
+ "./helpers/instanceof": [
+ {
+ "node": "./helpers/instanceof.js",
+ "import": "./helpers/esm/instanceof.js",
+ "default": "./helpers/instanceof.js"
+ },
+ "./helpers/instanceof.js"
+ ],
+ "./helpers/esm/instanceof": "./helpers/esm/instanceof.js",
+ "./helpers/interopRequireDefault": [
+ {
+ "node": "./helpers/interopRequireDefault.js",
+ "import": "./helpers/esm/interopRequireDefault.js",
+ "default": "./helpers/interopRequireDefault.js"
+ },
+ "./helpers/interopRequireDefault.js"
+ ],
+ "./helpers/esm/interopRequireDefault": "./helpers/esm/interopRequireDefault.js",
+ "./helpers/interopRequireWildcard": [
+ {
+ "node": "./helpers/interopRequireWildcard.js",
+ "import": "./helpers/esm/interopRequireWildcard.js",
+ "default": "./helpers/interopRequireWildcard.js"
+ },
+ "./helpers/interopRequireWildcard.js"
+ ],
+ "./helpers/esm/interopRequireWildcard": "./helpers/esm/interopRequireWildcard.js",
+ "./helpers/newArrowCheck": [
+ {
+ "node": "./helpers/newArrowCheck.js",
+ "import": "./helpers/esm/newArrowCheck.js",
+ "default": "./helpers/newArrowCheck.js"
+ },
+ "./helpers/newArrowCheck.js"
+ ],
+ "./helpers/esm/newArrowCheck": "./helpers/esm/newArrowCheck.js",
+ "./helpers/objectDestructuringEmpty": [
+ {
+ "node": "./helpers/objectDestructuringEmpty.js",
+ "import": "./helpers/esm/objectDestructuringEmpty.js",
+ "default": "./helpers/objectDestructuringEmpty.js"
+ },
+ "./helpers/objectDestructuringEmpty.js"
+ ],
+ "./helpers/esm/objectDestructuringEmpty": "./helpers/esm/objectDestructuringEmpty.js",
+ "./helpers/objectWithoutPropertiesLoose": [
+ {
+ "node": "./helpers/objectWithoutPropertiesLoose.js",
+ "import": "./helpers/esm/objectWithoutPropertiesLoose.js",
+ "default": "./helpers/objectWithoutPropertiesLoose.js"
+ },
+ "./helpers/objectWithoutPropertiesLoose.js"
+ ],
+ "./helpers/esm/objectWithoutPropertiesLoose": "./helpers/esm/objectWithoutPropertiesLoose.js",
+ "./helpers/objectWithoutProperties": [
+ {
+ "node": "./helpers/objectWithoutProperties.js",
+ "import": "./helpers/esm/objectWithoutProperties.js",
+ "default": "./helpers/objectWithoutProperties.js"
+ },
+ "./helpers/objectWithoutProperties.js"
+ ],
+ "./helpers/esm/objectWithoutProperties": "./helpers/esm/objectWithoutProperties.js",
+ "./helpers/assertThisInitialized": [
+ {
+ "node": "./helpers/assertThisInitialized.js",
+ "import": "./helpers/esm/assertThisInitialized.js",
+ "default": "./helpers/assertThisInitialized.js"
+ },
+ "./helpers/assertThisInitialized.js"
+ ],
+ "./helpers/esm/assertThisInitialized": "./helpers/esm/assertThisInitialized.js",
+ "./helpers/possibleConstructorReturn": [
+ {
+ "node": "./helpers/possibleConstructorReturn.js",
+ "import": "./helpers/esm/possibleConstructorReturn.js",
+ "default": "./helpers/possibleConstructorReturn.js"
+ },
+ "./helpers/possibleConstructorReturn.js"
+ ],
+ "./helpers/esm/possibleConstructorReturn": "./helpers/esm/possibleConstructorReturn.js",
+ "./helpers/createSuper": [
+ {
+ "node": "./helpers/createSuper.js",
+ "import": "./helpers/esm/createSuper.js",
+ "default": "./helpers/createSuper.js"
+ },
+ "./helpers/createSuper.js"
+ ],
+ "./helpers/esm/createSuper": "./helpers/esm/createSuper.js",
+ "./helpers/superPropBase": [
+ {
+ "node": "./helpers/superPropBase.js",
+ "import": "./helpers/esm/superPropBase.js",
+ "default": "./helpers/superPropBase.js"
+ },
+ "./helpers/superPropBase.js"
+ ],
+ "./helpers/esm/superPropBase": "./helpers/esm/superPropBase.js",
+ "./helpers/get": [
+ {
+ "node": "./helpers/get.js",
+ "import": "./helpers/esm/get.js",
+ "default": "./helpers/get.js"
+ },
+ "./helpers/get.js"
+ ],
+ "./helpers/esm/get": "./helpers/esm/get.js",
+ "./helpers/set": [
+ {
+ "node": "./helpers/set.js",
+ "import": "./helpers/esm/set.js",
+ "default": "./helpers/set.js"
+ },
+ "./helpers/set.js"
+ ],
+ "./helpers/esm/set": "./helpers/esm/set.js",
+ "./helpers/taggedTemplateLiteral": [
+ {
+ "node": "./helpers/taggedTemplateLiteral.js",
+ "import": "./helpers/esm/taggedTemplateLiteral.js",
+ "default": "./helpers/taggedTemplateLiteral.js"
+ },
+ "./helpers/taggedTemplateLiteral.js"
+ ],
+ "./helpers/esm/taggedTemplateLiteral": "./helpers/esm/taggedTemplateLiteral.js",
+ "./helpers/taggedTemplateLiteralLoose": [
+ {
+ "node": "./helpers/taggedTemplateLiteralLoose.js",
+ "import": "./helpers/esm/taggedTemplateLiteralLoose.js",
+ "default": "./helpers/taggedTemplateLiteralLoose.js"
+ },
+ "./helpers/taggedTemplateLiteralLoose.js"
+ ],
+ "./helpers/esm/taggedTemplateLiteralLoose": "./helpers/esm/taggedTemplateLiteralLoose.js",
+ "./helpers/readOnlyError": [
+ {
+ "node": "./helpers/readOnlyError.js",
+ "import": "./helpers/esm/readOnlyError.js",
+ "default": "./helpers/readOnlyError.js"
+ },
+ "./helpers/readOnlyError.js"
+ ],
+ "./helpers/esm/readOnlyError": "./helpers/esm/readOnlyError.js",
+ "./helpers/writeOnlyError": [
+ {
+ "node": "./helpers/writeOnlyError.js",
+ "import": "./helpers/esm/writeOnlyError.js",
+ "default": "./helpers/writeOnlyError.js"
+ },
+ "./helpers/writeOnlyError.js"
+ ],
+ "./helpers/esm/writeOnlyError": "./helpers/esm/writeOnlyError.js",
+ "./helpers/classNameTDZError": [
+ {
+ "node": "./helpers/classNameTDZError.js",
+ "import": "./helpers/esm/classNameTDZError.js",
+ "default": "./helpers/classNameTDZError.js"
+ },
+ "./helpers/classNameTDZError.js"
+ ],
+ "./helpers/esm/classNameTDZError": "./helpers/esm/classNameTDZError.js",
+ "./helpers/temporalUndefined": [
+ {
+ "node": "./helpers/temporalUndefined.js",
+ "import": "./helpers/esm/temporalUndefined.js",
+ "default": "./helpers/temporalUndefined.js"
+ },
+ "./helpers/temporalUndefined.js"
+ ],
+ "./helpers/esm/temporalUndefined": "./helpers/esm/temporalUndefined.js",
+ "./helpers/tdz": [
+ {
+ "node": "./helpers/tdz.js",
+ "import": "./helpers/esm/tdz.js",
+ "default": "./helpers/tdz.js"
+ },
+ "./helpers/tdz.js"
+ ],
+ "./helpers/esm/tdz": "./helpers/esm/tdz.js",
+ "./helpers/temporalRef": [
+ {
+ "node": "./helpers/temporalRef.js",
+ "import": "./helpers/esm/temporalRef.js",
+ "default": "./helpers/temporalRef.js"
+ },
+ "./helpers/temporalRef.js"
+ ],
+ "./helpers/esm/temporalRef": "./helpers/esm/temporalRef.js",
+ "./helpers/slicedToArray": [
+ {
+ "node": "./helpers/slicedToArray.js",
+ "import": "./helpers/esm/slicedToArray.js",
+ "default": "./helpers/slicedToArray.js"
+ },
+ "./helpers/slicedToArray.js"
+ ],
+ "./helpers/esm/slicedToArray": "./helpers/esm/slicedToArray.js",
+ "./helpers/slicedToArrayLoose": [
+ {
+ "node": "./helpers/slicedToArrayLoose.js",
+ "import": "./helpers/esm/slicedToArrayLoose.js",
+ "default": "./helpers/slicedToArrayLoose.js"
+ },
+ "./helpers/slicedToArrayLoose.js"
+ ],
+ "./helpers/esm/slicedToArrayLoose": "./helpers/esm/slicedToArrayLoose.js",
+ "./helpers/toArray": [
+ {
+ "node": "./helpers/toArray.js",
+ "import": "./helpers/esm/toArray.js",
+ "default": "./helpers/toArray.js"
+ },
+ "./helpers/toArray.js"
+ ],
+ "./helpers/esm/toArray": "./helpers/esm/toArray.js",
+ "./helpers/toConsumableArray": [
+ {
+ "node": "./helpers/toConsumableArray.js",
+ "import": "./helpers/esm/toConsumableArray.js",
+ "default": "./helpers/toConsumableArray.js"
+ },
+ "./helpers/toConsumableArray.js"
+ ],
+ "./helpers/esm/toConsumableArray": "./helpers/esm/toConsumableArray.js",
+ "./helpers/arrayWithoutHoles": [
+ {
+ "node": "./helpers/arrayWithoutHoles.js",
+ "import": "./helpers/esm/arrayWithoutHoles.js",
+ "default": "./helpers/arrayWithoutHoles.js"
+ },
+ "./helpers/arrayWithoutHoles.js"
+ ],
+ "./helpers/esm/arrayWithoutHoles": "./helpers/esm/arrayWithoutHoles.js",
+ "./helpers/arrayWithHoles": [
+ {
+ "node": "./helpers/arrayWithHoles.js",
+ "import": "./helpers/esm/arrayWithHoles.js",
+ "default": "./helpers/arrayWithHoles.js"
+ },
+ "./helpers/arrayWithHoles.js"
+ ],
+ "./helpers/esm/arrayWithHoles": "./helpers/esm/arrayWithHoles.js",
+ "./helpers/maybeArrayLike": [
+ {
+ "node": "./helpers/maybeArrayLike.js",
+ "import": "./helpers/esm/maybeArrayLike.js",
+ "default": "./helpers/maybeArrayLike.js"
+ },
+ "./helpers/maybeArrayLike.js"
+ ],
+ "./helpers/esm/maybeArrayLike": "./helpers/esm/maybeArrayLike.js",
+ "./helpers/iterableToArray": [
+ {
+ "node": "./helpers/iterableToArray.js",
+ "import": "./helpers/esm/iterableToArray.js",
+ "default": "./helpers/iterableToArray.js"
+ },
+ "./helpers/iterableToArray.js"
+ ],
+ "./helpers/esm/iterableToArray": "./helpers/esm/iterableToArray.js",
+ "./helpers/iterableToArrayLimit": [
+ {
+ "node": "./helpers/iterableToArrayLimit.js",
+ "import": "./helpers/esm/iterableToArrayLimit.js",
+ "default": "./helpers/iterableToArrayLimit.js"
+ },
+ "./helpers/iterableToArrayLimit.js"
+ ],
+ "./helpers/esm/iterableToArrayLimit": "./helpers/esm/iterableToArrayLimit.js",
+ "./helpers/iterableToArrayLimitLoose": [
+ {
+ "node": "./helpers/iterableToArrayLimitLoose.js",
+ "import": "./helpers/esm/iterableToArrayLimitLoose.js",
+ "default": "./helpers/iterableToArrayLimitLoose.js"
+ },
+ "./helpers/iterableToArrayLimitLoose.js"
+ ],
+ "./helpers/esm/iterableToArrayLimitLoose": "./helpers/esm/iterableToArrayLimitLoose.js",
+ "./helpers/unsupportedIterableToArray": [
+ {
+ "node": "./helpers/unsupportedIterableToArray.js",
+ "import": "./helpers/esm/unsupportedIterableToArray.js",
+ "default": "./helpers/unsupportedIterableToArray.js"
+ },
+ "./helpers/unsupportedIterableToArray.js"
+ ],
+ "./helpers/esm/unsupportedIterableToArray": "./helpers/esm/unsupportedIterableToArray.js",
+ "./helpers/arrayLikeToArray": [
+ {
+ "node": "./helpers/arrayLikeToArray.js",
+ "import": "./helpers/esm/arrayLikeToArray.js",
+ "default": "./helpers/arrayLikeToArray.js"
+ },
+ "./helpers/arrayLikeToArray.js"
+ ],
+ "./helpers/esm/arrayLikeToArray": "./helpers/esm/arrayLikeToArray.js",
+ "./helpers/nonIterableSpread": [
+ {
+ "node": "./helpers/nonIterableSpread.js",
+ "import": "./helpers/esm/nonIterableSpread.js",
+ "default": "./helpers/nonIterableSpread.js"
+ },
+ "./helpers/nonIterableSpread.js"
+ ],
+ "./helpers/esm/nonIterableSpread": "./helpers/esm/nonIterableSpread.js",
+ "./helpers/nonIterableRest": [
+ {
+ "node": "./helpers/nonIterableRest.js",
+ "import": "./helpers/esm/nonIterableRest.js",
+ "default": "./helpers/nonIterableRest.js"
+ },
+ "./helpers/nonIterableRest.js"
+ ],
+ "./helpers/esm/nonIterableRest": "./helpers/esm/nonIterableRest.js",
+ "./helpers/createForOfIteratorHelper": [
+ {
+ "node": "./helpers/createForOfIteratorHelper.js",
+ "import": "./helpers/esm/createForOfIteratorHelper.js",
+ "default": "./helpers/createForOfIteratorHelper.js"
+ },
+ "./helpers/createForOfIteratorHelper.js"
+ ],
+ "./helpers/esm/createForOfIteratorHelper": "./helpers/esm/createForOfIteratorHelper.js",
+ "./helpers/createForOfIteratorHelperLoose": [
+ {
+ "node": "./helpers/createForOfIteratorHelperLoose.js",
+ "import": "./helpers/esm/createForOfIteratorHelperLoose.js",
+ "default": "./helpers/createForOfIteratorHelperLoose.js"
+ },
+ "./helpers/createForOfIteratorHelperLoose.js"
+ ],
+ "./helpers/esm/createForOfIteratorHelperLoose": "./helpers/esm/createForOfIteratorHelperLoose.js",
+ "./helpers/skipFirstGeneratorNext": [
+ {
+ "node": "./helpers/skipFirstGeneratorNext.js",
+ "import": "./helpers/esm/skipFirstGeneratorNext.js",
+ "default": "./helpers/skipFirstGeneratorNext.js"
+ },
+ "./helpers/skipFirstGeneratorNext.js"
+ ],
+ "./helpers/esm/skipFirstGeneratorNext": "./helpers/esm/skipFirstGeneratorNext.js",
+ "./helpers/toPrimitive": [
+ {
+ "node": "./helpers/toPrimitive.js",
+ "import": "./helpers/esm/toPrimitive.js",
+ "default": "./helpers/toPrimitive.js"
+ },
+ "./helpers/toPrimitive.js"
+ ],
+ "./helpers/esm/toPrimitive": "./helpers/esm/toPrimitive.js",
+ "./helpers/toPropertyKey": [
+ {
+ "node": "./helpers/toPropertyKey.js",
+ "import": "./helpers/esm/toPropertyKey.js",
+ "default": "./helpers/toPropertyKey.js"
+ },
+ "./helpers/toPropertyKey.js"
+ ],
+ "./helpers/esm/toPropertyKey": "./helpers/esm/toPropertyKey.js",
+ "./helpers/initializerWarningHelper": [
+ {
+ "node": "./helpers/initializerWarningHelper.js",
+ "import": "./helpers/esm/initializerWarningHelper.js",
+ "default": "./helpers/initializerWarningHelper.js"
+ },
+ "./helpers/initializerWarningHelper.js"
+ ],
+ "./helpers/esm/initializerWarningHelper": "./helpers/esm/initializerWarningHelper.js",
+ "./helpers/initializerDefineProperty": [
+ {
+ "node": "./helpers/initializerDefineProperty.js",
+ "import": "./helpers/esm/initializerDefineProperty.js",
+ "default": "./helpers/initializerDefineProperty.js"
+ },
+ "./helpers/initializerDefineProperty.js"
+ ],
+ "./helpers/esm/initializerDefineProperty": "./helpers/esm/initializerDefineProperty.js",
+ "./helpers/applyDecoratedDescriptor": [
+ {
+ "node": "./helpers/applyDecoratedDescriptor.js",
+ "import": "./helpers/esm/applyDecoratedDescriptor.js",
+ "default": "./helpers/applyDecoratedDescriptor.js"
+ },
+ "./helpers/applyDecoratedDescriptor.js"
+ ],
+ "./helpers/esm/applyDecoratedDescriptor": "./helpers/esm/applyDecoratedDescriptor.js",
+ "./helpers/classPrivateFieldLooseKey": [
+ {
+ "node": "./helpers/classPrivateFieldLooseKey.js",
+ "import": "./helpers/esm/classPrivateFieldLooseKey.js",
+ "default": "./helpers/classPrivateFieldLooseKey.js"
+ },
+ "./helpers/classPrivateFieldLooseKey.js"
+ ],
+ "./helpers/esm/classPrivateFieldLooseKey": "./helpers/esm/classPrivateFieldLooseKey.js",
+ "./helpers/classPrivateFieldLooseBase": [
+ {
+ "node": "./helpers/classPrivateFieldLooseBase.js",
+ "import": "./helpers/esm/classPrivateFieldLooseBase.js",
+ "default": "./helpers/classPrivateFieldLooseBase.js"
+ },
+ "./helpers/classPrivateFieldLooseBase.js"
+ ],
+ "./helpers/esm/classPrivateFieldLooseBase": "./helpers/esm/classPrivateFieldLooseBase.js",
+ "./helpers/classPrivateFieldGet": [
+ {
+ "node": "./helpers/classPrivateFieldGet.js",
+ "import": "./helpers/esm/classPrivateFieldGet.js",
+ "default": "./helpers/classPrivateFieldGet.js"
+ },
+ "./helpers/classPrivateFieldGet.js"
+ ],
+ "./helpers/esm/classPrivateFieldGet": "./helpers/esm/classPrivateFieldGet.js",
+ "./helpers/classPrivateFieldSet": [
+ {
+ "node": "./helpers/classPrivateFieldSet.js",
+ "import": "./helpers/esm/classPrivateFieldSet.js",
+ "default": "./helpers/classPrivateFieldSet.js"
+ },
+ "./helpers/classPrivateFieldSet.js"
+ ],
+ "./helpers/esm/classPrivateFieldSet": "./helpers/esm/classPrivateFieldSet.js",
+ "./helpers/classPrivateFieldDestructureSet": [
+ {
+ "node": "./helpers/classPrivateFieldDestructureSet.js",
+ "import": "./helpers/esm/classPrivateFieldDestructureSet.js",
+ "default": "./helpers/classPrivateFieldDestructureSet.js"
+ },
+ "./helpers/classPrivateFieldDestructureSet.js"
+ ],
+ "./helpers/esm/classPrivateFieldDestructureSet": "./helpers/esm/classPrivateFieldDestructureSet.js",
+ "./helpers/classExtractFieldDescriptor": [
+ {
+ "node": "./helpers/classExtractFieldDescriptor.js",
+ "import": "./helpers/esm/classExtractFieldDescriptor.js",
+ "default": "./helpers/classExtractFieldDescriptor.js"
+ },
+ "./helpers/classExtractFieldDescriptor.js"
+ ],
+ "./helpers/esm/classExtractFieldDescriptor": "./helpers/esm/classExtractFieldDescriptor.js",
+ "./helpers/classStaticPrivateFieldSpecGet": [
+ {
+ "node": "./helpers/classStaticPrivateFieldSpecGet.js",
+ "import": "./helpers/esm/classStaticPrivateFieldSpecGet.js",
+ "default": "./helpers/classStaticPrivateFieldSpecGet.js"
+ },
+ "./helpers/classStaticPrivateFieldSpecGet.js"
+ ],
+ "./helpers/esm/classStaticPrivateFieldSpecGet": "./helpers/esm/classStaticPrivateFieldSpecGet.js",
+ "./helpers/classStaticPrivateFieldSpecSet": [
+ {
+ "node": "./helpers/classStaticPrivateFieldSpecSet.js",
+ "import": "./helpers/esm/classStaticPrivateFieldSpecSet.js",
+ "default": "./helpers/classStaticPrivateFieldSpecSet.js"
+ },
+ "./helpers/classStaticPrivateFieldSpecSet.js"
+ ],
+ "./helpers/esm/classStaticPrivateFieldSpecSet": "./helpers/esm/classStaticPrivateFieldSpecSet.js",
+ "./helpers/classStaticPrivateMethodGet": [
+ {
+ "node": "./helpers/classStaticPrivateMethodGet.js",
+ "import": "./helpers/esm/classStaticPrivateMethodGet.js",
+ "default": "./helpers/classStaticPrivateMethodGet.js"
+ },
+ "./helpers/classStaticPrivateMethodGet.js"
+ ],
+ "./helpers/esm/classStaticPrivateMethodGet": "./helpers/esm/classStaticPrivateMethodGet.js",
+ "./helpers/classStaticPrivateMethodSet": [
+ {
+ "node": "./helpers/classStaticPrivateMethodSet.js",
+ "import": "./helpers/esm/classStaticPrivateMethodSet.js",
+ "default": "./helpers/classStaticPrivateMethodSet.js"
+ },
+ "./helpers/classStaticPrivateMethodSet.js"
+ ],
+ "./helpers/esm/classStaticPrivateMethodSet": "./helpers/esm/classStaticPrivateMethodSet.js",
+ "./helpers/classApplyDescriptorGet": [
+ {
+ "node": "./helpers/classApplyDescriptorGet.js",
+ "import": "./helpers/esm/classApplyDescriptorGet.js",
+ "default": "./helpers/classApplyDescriptorGet.js"
+ },
+ "./helpers/classApplyDescriptorGet.js"
+ ],
+ "./helpers/esm/classApplyDescriptorGet": "./helpers/esm/classApplyDescriptorGet.js",
+ "./helpers/classApplyDescriptorSet": [
+ {
+ "node": "./helpers/classApplyDescriptorSet.js",
+ "import": "./helpers/esm/classApplyDescriptorSet.js",
+ "default": "./helpers/classApplyDescriptorSet.js"
+ },
+ "./helpers/classApplyDescriptorSet.js"
+ ],
+ "./helpers/esm/classApplyDescriptorSet": "./helpers/esm/classApplyDescriptorSet.js",
+ "./helpers/classApplyDescriptorDestructureSet": [
+ {
+ "node": "./helpers/classApplyDescriptorDestructureSet.js",
+ "import": "./helpers/esm/classApplyDescriptorDestructureSet.js",
+ "default": "./helpers/classApplyDescriptorDestructureSet.js"
+ },
+ "./helpers/classApplyDescriptorDestructureSet.js"
+ ],
+ "./helpers/esm/classApplyDescriptorDestructureSet": "./helpers/esm/classApplyDescriptorDestructureSet.js",
+ "./helpers/classStaticPrivateFieldDestructureSet": [
+ {
+ "node": "./helpers/classStaticPrivateFieldDestructureSet.js",
+ "import": "./helpers/esm/classStaticPrivateFieldDestructureSet.js",
+ "default": "./helpers/classStaticPrivateFieldDestructureSet.js"
+ },
+ "./helpers/classStaticPrivateFieldDestructureSet.js"
+ ],
+ "./helpers/esm/classStaticPrivateFieldDestructureSet": "./helpers/esm/classStaticPrivateFieldDestructureSet.js",
+ "./helpers/classCheckPrivateStaticAccess": [
+ {
+ "node": "./helpers/classCheckPrivateStaticAccess.js",
+ "import": "./helpers/esm/classCheckPrivateStaticAccess.js",
+ "default": "./helpers/classCheckPrivateStaticAccess.js"
+ },
+ "./helpers/classCheckPrivateStaticAccess.js"
+ ],
+ "./helpers/esm/classCheckPrivateStaticAccess": "./helpers/esm/classCheckPrivateStaticAccess.js",
+ "./helpers/classCheckPrivateStaticFieldDescriptor": [
+ {
+ "node": "./helpers/classCheckPrivateStaticFieldDescriptor.js",
+ "import": "./helpers/esm/classCheckPrivateStaticFieldDescriptor.js",
+ "default": "./helpers/classCheckPrivateStaticFieldDescriptor.js"
+ },
+ "./helpers/classCheckPrivateStaticFieldDescriptor.js"
+ ],
+ "./helpers/esm/classCheckPrivateStaticFieldDescriptor": "./helpers/esm/classCheckPrivateStaticFieldDescriptor.js",
+ "./helpers/decorate": [
+ {
+ "node": "./helpers/decorate.js",
+ "import": "./helpers/esm/decorate.js",
+ "default": "./helpers/decorate.js"
+ },
+ "./helpers/decorate.js"
+ ],
+ "./helpers/esm/decorate": "./helpers/esm/decorate.js",
+ "./helpers/classPrivateMethodGet": [
+ {
+ "node": "./helpers/classPrivateMethodGet.js",
+ "import": "./helpers/esm/classPrivateMethodGet.js",
+ "default": "./helpers/classPrivateMethodGet.js"
+ },
+ "./helpers/classPrivateMethodGet.js"
+ ],
+ "./helpers/esm/classPrivateMethodGet": "./helpers/esm/classPrivateMethodGet.js",
+ "./helpers/checkPrivateRedeclaration": [
+ {
+ "node": "./helpers/checkPrivateRedeclaration.js",
+ "import": "./helpers/esm/checkPrivateRedeclaration.js",
+ "default": "./helpers/checkPrivateRedeclaration.js"
+ },
+ "./helpers/checkPrivateRedeclaration.js"
+ ],
+ "./helpers/esm/checkPrivateRedeclaration": "./helpers/esm/checkPrivateRedeclaration.js",
+ "./helpers/classPrivateFieldInitSpec": [
+ {
+ "node": "./helpers/classPrivateFieldInitSpec.js",
+ "import": "./helpers/esm/classPrivateFieldInitSpec.js",
+ "default": "./helpers/classPrivateFieldInitSpec.js"
+ },
+ "./helpers/classPrivateFieldInitSpec.js"
+ ],
+ "./helpers/esm/classPrivateFieldInitSpec": "./helpers/esm/classPrivateFieldInitSpec.js",
+ "./helpers/classPrivateMethodInitSpec": [
+ {
+ "node": "./helpers/classPrivateMethodInitSpec.js",
+ "import": "./helpers/esm/classPrivateMethodInitSpec.js",
+ "default": "./helpers/classPrivateMethodInitSpec.js"
+ },
+ "./helpers/classPrivateMethodInitSpec.js"
+ ],
+ "./helpers/esm/classPrivateMethodInitSpec": "./helpers/esm/classPrivateMethodInitSpec.js",
+ "./helpers/classPrivateMethodSet": [
+ {
+ "node": "./helpers/classPrivateMethodSet.js",
+ "import": "./helpers/esm/classPrivateMethodSet.js",
+ "default": "./helpers/classPrivateMethodSet.js"
+ },
+ "./helpers/classPrivateMethodSet.js"
+ ],
+ "./helpers/esm/classPrivateMethodSet": "./helpers/esm/classPrivateMethodSet.js",
+ "./helpers/identity": [
+ {
+ "node": "./helpers/identity.js",
+ "import": "./helpers/esm/identity.js",
+ "default": "./helpers/identity.js"
+ },
+ "./helpers/identity.js"
+ ],
+ "./helpers/esm/identity": "./helpers/esm/identity.js",
+ "./package": "./package.json",
+ "./package.json": "./package.json",
+ "./regenerator": "./regenerator/index.js",
+ "./regenerator/*.js": "./regenerator/*.js",
+ "./regenerator/": "./regenerator/"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@babel/runtime/regenerator/index.js b/temporary_modules/trezor-connect/node_modules/@babel/runtime/regenerator/index.js
new file mode 100644
index 00000000..9fd4158a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@babel/runtime/regenerator/index.js
@@ -0,0 +1 @@
+module.exports = require("regenerator-runtime");
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/CHANGELOG.md
new file mode 100644
index 00000000..9e179a65
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/CHANGELOG.md
@@ -0,0 +1,531 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+# [3.5.0](https://github.com/ionic-team/capacitor/compare/3.4.3...3.5.0) (2022-04-22)
+
+
+### Features
+
+* **cli:** support capacitor portals plugin changes needed ([#5558](https://github.com/ionic-team/capacitor/issues/5558)) ([6810a19](https://github.com/ionic-team/capacitor/commit/6810a19ae2bbda1f4b2afad61d37ca822ca157f5))
+
+
+
+
+
+## [3.4.3](https://github.com/ionic-team/capacitor/compare/3.4.2...3.4.3) (2022-03-04)
+
+
+### Bug Fixes
+
+* **cli:** avoid srcFiles is not iterable on kotlinNeededCheck ([#5481](https://github.com/ionic-team/capacitor/issues/5481)) ([3c2b579](https://github.com/ionic-team/capacitor/commit/3c2b579c6edb1fc69d85689b268eb92067b7821b))
+
+
+
+
+
+## [3.4.2](https://github.com/ionic-team/capacitor/compare/3.4.1...3.4.2) (2022-03-03)
+
+
+### Bug Fixes
+
+* **android:** compatibility with cordova kotlin plugins ([#5438](https://github.com/ionic-team/capacitor/issues/5438)) ([55bf004](https://github.com/ionic-team/capacitor/commit/55bf004897b3feb280ab6b6575d2a2c1a0a183e2))
+
+
+
+
+
+## [3.4.1](https://github.com/ionic-team/capacitor/compare/3.4.0...3.4.1) (2022-02-09)
+
+
+### Bug Fixes
+
+* **cli:** Better error on gradlew permission problems ([#5405](https://github.com/ionic-team/capacitor/issues/5405)) ([9420f08](https://github.com/ionic-team/capacitor/commit/9420f08dedad78cfaa5500cccf8bdbf1a9140684))
+
+
+
+
+
+# [3.4.0](https://github.com/ionic-team/capacitor/compare/3.3.4...3.4.0) (2022-01-19)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+## [3.3.4](https://github.com/ionic-team/capacitor/compare/3.3.3...3.3.4) (2022-01-05)
+
+
+### Bug Fixes
+
+* **cli:** Escape appName from invalid characters on add ([#5325](https://github.com/ionic-team/capacitor/issues/5325)) ([033f4ee](https://github.com/ionic-team/capacitor/commit/033f4eef59fdb7cc32018b162114511448bc46a6))
+* **cli:** sync failing if Info.plist is localized ([#5333](https://github.com/ionic-team/capacitor/issues/5333)) ([df7a104](https://github.com/ionic-team/capacitor/commit/df7a1041c4e2d9a5a1ceef247ed00f9f8467df76))
+
+
+
+
+
+## [3.3.3](https://github.com/ionic-team/capacitor/compare/3.3.2...3.3.3) (2021-12-08)
+
+
+### Bug Fixes
+
+* **android:** restrict android run command to configured flavour ([#5256](https://github.com/ionic-team/capacitor/issues/5256)) ([ba84443](https://github.com/ionic-team/capacitor/commit/ba84443dce9c81e09140def57a60018b527b5bb5))
+* **cli:** Add onesignal-cordova-plugin to the static list again ([#5262](https://github.com/ionic-team/capacitor/issues/5262)) ([e67ca99](https://github.com/ionic-team/capacitor/commit/e67ca9964c5a923d35f5cf41eb802c665563726f))
+
+
+
+
+
+## [3.3.2](https://github.com/ionic-team/capacitor/compare/3.3.1...3.3.2) (2021-11-17)
+
+
+### Bug Fixes
+
+* **cli:** add cordova-plugin-google-analytics to static list ([#5220](https://github.com/ionic-team/capacitor/issues/5220)) ([67a996c](https://github.com/ionic-team/capacitor/commit/67a996c0a6896e32c41ea01822d6435fdd706b84))
+* **cli:** Add plugin to static list if pod has use-frameworks ([#5232](https://github.com/ionic-team/capacitor/issues/5232)) ([8a0518b](https://github.com/ionic-team/capacitor/commit/8a0518be9f6f6a4be4a9f1366cb8dcb191225b9d))
+* **cli:** sync gradle from android folder ([#5233](https://github.com/ionic-team/capacitor/issues/5233)) ([cd779c4](https://github.com/ionic-team/capacitor/commit/cd779c4b6ed4ffc96777be7c94a0af4baca6d6d5))
+
+
+
+
+
+## [3.3.1](https://github.com/ionic-team/capacitor/compare/3.3.0...3.3.1) (2021-11-05)
+
+
+### Bug Fixes
+
+* **cli:** Make config don't error if iOS is missing ([#5212](https://github.com/ionic-team/capacitor/issues/5212)) ([db9f12b](https://github.com/ionic-team/capacitor/commit/db9f12b545994b2ed88098c0168bb051f8191771))
+
+
+
+
+
+# [3.3.0](https://github.com/ionic-team/capacitor/compare/3.2.5...3.3.0) (2021-11-03)
+
+
+### Bug Fixes
+
+* **cli:** Add Batch plugin to static list ([#5138](https://github.com/ionic-team/capacitor/issues/5138)) ([9470633](https://github.com/ionic-team/capacitor/commit/94706338c096b30390fa288c9b107e253923a644))
+* **cli:** Add onesignal-cordova-plugin to static pod list ([#5143](https://github.com/ionic-team/capacitor/issues/5143)) ([937e240](https://github.com/ionic-team/capacitor/commit/937e2408f9bb60691e653b70d8b7cb02f540b251))
+* **cli:** detect and register multiple plugins from same package ([#5098](https://github.com/ionic-team/capacitor/issues/5098)) ([25e770c](https://github.com/ionic-team/capacitor/commit/25e770c3f598bf3a1e05e21d607ab3ad70268674))
+
+
+### Features
+
+* **cli:** add support for 'pod install' in VM based environments ([#5144](https://github.com/ionic-team/capacitor/issues/5144)) ([32ecf22](https://github.com/ionic-team/capacitor/commit/32ecf22de0a550756dbfa68b3b17c2333c89a430))
+* **cli:** Allow to configure access origin tags on cordova config.xml ([#5134](https://github.com/ionic-team/capacitor/issues/5134)) ([0841a09](https://github.com/ionic-team/capacitor/commit/0841a093bf73ed4acac9a90be44a8e8a3aedbcdb))
+* **cli:** Allow users to include Cordova plugins to the static list ([#5175](https://github.com/ionic-team/capacitor/issues/5175)) ([664149a](https://github.com/ionic-team/capacitor/commit/664149aadbe80e66dd757315a826ec1ab305edb9))
+
+
+
+
+
+## [3.2.5](https://github.com/ionic-team/capacitor/compare/3.2.4...3.2.5) (2021-10-13)
+
+
+### Bug Fixes
+
+* **cli:** create only static pod if needed ([#5099](https://github.com/ionic-team/capacitor/issues/5099)) ([8304744](https://github.com/ionic-team/capacitor/commit/83047445562a52cc927c7c77d55b48288cfc1fcc))
+
+
+
+
+
+## [3.2.4](https://github.com/ionic-team/capacitor/compare/3.2.3...3.2.4) (2021-09-27)
+
+
+### Bug Fixes
+
+* **cli:** await sync on add to avoid telemetry hang ([833bc20](https://github.com/ionic-team/capacitor/commit/833bc20525a2558e03cd0e56c6765ce6828cdfac))
+
+
+
+
+
+## [3.2.3](https://github.com/ionic-team/capacitor/compare/3.2.2...3.2.3) (2021-09-15)
+
+
+### Bug Fixes
+
+* Add SalesforceMobileSDK-CordovaPlugin to iOS incompatible list ([#5031](https://github.com/ionic-team/capacitor/issues/5031)) ([6f3f79f](https://github.com/ionic-team/capacitor/commit/6f3f79f412b77b0c90988226ec5ade5d0198c706))
+* Define cordovaConfig gradle variable ([#5024](https://github.com/ionic-team/capacitor/issues/5024)) ([55c217e](https://github.com/ionic-team/capacitor/commit/55c217e6898d0270c23c3a7158a5102e9b84ff40))
+
+
+
+
+
+## [3.2.2](https://github.com/ionic-team/capacitor/compare/3.2.1...3.2.2) (2021-09-02)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+## [3.2.1](https://github.com/ionic-team/capacitor/compare/3.2.0...3.2.1) (2021-09-01)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.2.0](https://github.com/ionic-team/capacitor/compare/3.1.2...3.2.0) (2021-08-18)
+
+
+### Bug Fixes
+
+* **cli:** Put cordova git pod dependencies in Podfile ([#4940](https://github.com/ionic-team/capacitor/issues/4940)) ([642dbf4](https://github.com/ionic-team/capacitor/commit/642dbf433e22bb695e5f782bd685de42eb2afada))
+* **cli:** Separate Swift plugins from ObjC plugins ([#4925](https://github.com/ionic-team/capacitor/issues/4925)) ([43ce803](https://github.com/ionic-team/capacitor/commit/43ce803975ccd66823aab1e8c0d44d0ca81c6b2f))
+
+
+
+
+
+## [3.1.2](https://github.com/ionic-team/capacitor/compare/3.1.1...3.1.2) (2021-07-21)
+
+
+### Bug Fixes
+
+* **cli:** Don't warn about hideLogs on some commands ([#4813](https://github.com/ionic-team/capacitor/issues/4813)) ([dc279cc](https://github.com/ionic-team/capacitor/commit/dc279cc0a4ba8332296c65ca00647829f43ed1d9))
+
+
+
+
+
+## [3.1.1](https://github.com/ionic-team/capacitor/compare/3.1.0...3.1.1) (2021-07-07)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.1.0](https://github.com/ionic-team/capacitor/compare/3.0.2...3.1.0) (2021-07-07)
+
+
+### Bug Fixes
+
+* **cli:** Don't error if there are no scripts ([#4763](https://github.com/ionic-team/capacitor/issues/4763)) ([dec3fb2](https://github.com/ionic-team/capacitor/commit/dec3fb285239912980f2abea1cf48c583da6a163))
+
+
+### Features
+
+* **cli:** Add hooks to call into npm scripts when capacitor commands run ([#4739](https://github.com/ionic-team/capacitor/issues/4739)) ([515230c](https://github.com/ionic-team/capacitor/commit/515230ccefec76d4b7ed03ef1122709d1b63b58a))
+* **cli:** allow run command to use flavors ([#4782](https://github.com/ionic-team/capacitor/issues/4782)) ([05cb853](https://github.com/ionic-team/capacitor/commit/05cb8533d4479efd3dc823b18f48699302f462ba))
+* **ios:** Add limitsNavigationsToAppBoundDomains configuration option ([#4789](https://github.com/ionic-team/capacitor/issues/4789)) ([2b7016f](https://github.com/ionic-team/capacitor/commit/2b7016f3b4d62fd8c9d03fde2745b3d515bf08b2))
+
+
+
+
+
+## [3.0.2](https://github.com/ionic-team/capacitor/compare/3.0.1...3.0.2) (2021-06-23)
+
+
+### Bug Fixes
+
+* **cli:** correctly show EACCES error on run ([#4742](https://github.com/ionic-team/capacitor/issues/4742)) ([2ab8778](https://github.com/ionic-team/capacitor/commit/2ab877881a292bba0aed946b20c3c6bb58808e58))
+* **cli:** Don't error on ios sync on non macOS ([#4723](https://github.com/ionic-team/capacitor/issues/4723)) ([368ffad](https://github.com/ionic-team/capacitor/commit/368ffad03612841a8f228c6a174c141659f5293d))
+
+
+
+
+
+## [3.0.1](https://github.com/ionic-team/capacitor/compare/3.0.0...3.0.1) (2021-06-09)
+
+
+### Bug Fixes
+
+* **cli:** add priority to framework detection ([#4617](https://github.com/ionic-team/capacitor/issues/4617)) ([6a22f03](https://github.com/ionic-team/capacitor/commit/6a22f0375921fc7c015bc72e036dee014b1baed9))
+* **cli:** Better native-run error ([#4676](https://github.com/ionic-team/capacitor/issues/4676)) ([39eebd0](https://github.com/ionic-team/capacitor/commit/39eebd0a2dc45fd5d07f79fb9ad5b919556c5fc5))
+* **cli:** Don't prompt cordova preferences if non interactive ([#4680](https://github.com/ionic-team/capacitor/issues/4680)) ([293527c](https://github.com/ionic-team/capacitor/commit/293527c85296a9b79ce6dbd12e0f3e3e43fbce0b))
+* **cli:** Remove v3 prefix from docs urls ([#4596](https://github.com/ionic-team/capacitor/issues/4596)) ([f99f11a](https://github.com/ionic-team/capacitor/commit/f99f11a6ee65020a8b2e58665e3427de814fba3a))
+* **cli:** Throw error if native-run didn't find targets ([#4681](https://github.com/ionic-team/capacitor/issues/4681)) ([bfbf2b5](https://github.com/ionic-team/capacitor/commit/bfbf2b5ffb48bf1617404385f7407baefcfe3282))
+
+
+
+
+
+# [3.0.0](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.4...3.0.0) (2021-05-18)
+
+
+### Bug Fixes
+
+* **cli:** create-react-app framework detection should not look for react-dev-utils ([#4585](https://github.com/ionic-team/capacitor/issues/4585)) ([9f7910e](https://github.com/ionic-team/capacitor/commit/9f7910ee39ea7721d01428ec65b3d101b8ba963e))
+
+
+
+
+
+# [3.0.0-rc.4](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.3...3.0.0-rc.4) (2021-05-18)
+
+
+### Features
+
+* **cli:** auto detect framework's webDir ([#4550](https://github.com/ionic-team/capacitor/issues/4550)) ([329448a](https://github.com/ionic-team/capacitor/commit/329448a26846b5167b16f9169d62a9ff61eef87d))
+
+
+
+
+
+# [3.0.0-rc.3](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.2...3.0.0-rc.3) (2021-05-11)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.0.0-rc.2](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.1...3.0.0-rc.2) (2021-05-07)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.0.0-rc.1](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.0...3.0.0-rc.1) (2021-04-29)
+
+
+### Bug Fixes
+
+* **cli:** Allow prereleases on node version check ([#4469](https://github.com/ionic-team/capacitor/issues/4469)) ([dd26a98](https://github.com/ionic-team/capacitor/commit/dd26a98bde9c4487178bc4ee45587f86ec53df2a))
+* **cli:** filter targets without id from run device list ([#4397](https://github.com/ionic-team/capacitor/issues/4397)) ([9ec444f](https://github.com/ionic-team/capacitor/commit/9ec444f034d435c7c945e9a20e3ca99a3b1f54d6))
+
+
+### Features
+
+* Unify logging behavior across environments ([#4416](https://github.com/ionic-team/capacitor/issues/4416)) ([bae0f3d](https://github.com/ionic-team/capacitor/commit/bae0f3d2cee84978636d0f589bc7e2f745671baf))
+* **cli:** Add signup prompt on first init ([#4440](https://github.com/ionic-team/capacitor/issues/4440)) ([b3faa97](https://github.com/ionic-team/capacitor/commit/b3faa97d9b0ee542a8d90f433545f7e83402c485))
+
+
+
+
+
+# [3.0.0-rc.0](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.6...3.0.0-rc.0) (2021-03-10)
+
+
+### Bug Fixes
+
+* **cli:** Make tests work on npm 7 ([#4297](https://github.com/ionic-team/capacitor/issues/4297)) ([676c907](https://github.com/ionic-team/capacitor/commit/676c907c7ce84fdc57d00152024144a74d24b137))
+
+
+
+
+
+# [3.0.0-beta.6](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.5...3.0.0-beta.6) (2021-02-27)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.0.0-beta.5](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.4...3.0.0-beta.5) (2021-02-27)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.0.0-beta.4](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.3...3.0.0-beta.4) (2021-02-26)
+
+
+### Bug Fixes
+
+* **cli:** init failure if config.xml is present ([#4227](https://github.com/ionic-team/capacitor/issues/4227)) ([f1703dc](https://github.com/ionic-team/capacitor/commit/f1703dcb3ebaa83df9f2b72ca00eb6721e96dfd9))
+
+
+
+
+
+# [3.0.0-beta.3](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.2...3.0.0-beta.3) (2021-02-18)
+
+
+### Bug Fixes
+
+* **cli:** do not error if webDir is missing when adding platforms ([#4215](https://github.com/ionic-team/capacitor/issues/4215)) ([4583add](https://github.com/ionic-team/capacitor/commit/4583add61f5f7ac60de8722664811d96d4095459))
+
+
+### Features
+
+* **cli:** do not require webDir when server.url is set ([#4200](https://github.com/ionic-team/capacitor/issues/4200)) ([91ddfbd](https://github.com/ionic-team/capacitor/commit/91ddfbd3cd1f598906b2ddc5cab8904420f231f6))
+
+
+
+
+
+# [3.0.0-beta.2](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.1...3.0.0-beta.2) (2021-02-08)
+
+
+### Features
+
+* **cli:** configurable iOS build scheme ([#4073](https://github.com/ionic-team/capacitor/issues/4073)) ([e6374dc](https://github.com/ionic-team/capacitor/commit/e6374dc88c388a30186e8bfea22ce129ca1a9e02))
+* **cli:** send config, rootDir, and webDir to custom platform hooks ([#4084](https://github.com/ionic-team/capacitor/issues/4084)) ([13e9860](https://github.com/ionic-team/capacitor/commit/13e9860468126ba3c37b25d9093ab5f6cce2df2c))
+
+
+
+
+
+# [3.0.0-beta.1](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.0...3.0.0-beta.1) (2021-01-14)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.0.0-beta.0](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.14...3.0.0-beta.0) (2021-01-13)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.0.0-alpha.14](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.13...3.0.0-alpha.14) (2021-01-13)
+
+
+### Bug Fixes
+
+* **cli:** bump minimum node version to 12.4.0 ([#4059](https://github.com/ionic-team/capacitor/issues/4059)) ([61e3be0](https://github.com/ionic-team/capacitor/commit/61e3be0c865a3591a0d6bcfc27d0bbb72ee98395))
+* **cli:** default to new directory instead of crashing ([70fdf0b](https://github.com/ionic-team/capacitor/commit/70fdf0be0e0f06b4f20e20a3ae4bfef4de2374e9))
+
+
+
+
+
+# [3.0.0-alpha.13](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.12...3.0.0-alpha.13) (2021-01-13)
+
+
+### Bug Fixes
+
+* **cli:** use stderr for logs when using --json option ([#4044](https://github.com/ionic-team/capacitor/issues/4044)) ([452a101](https://github.com/ionic-team/capacitor/commit/452a101648fe6da4232d18985c5d814920505920))
+
+
+### Features
+
+* **cli:** create TS configuration files in `init` ([#3999](https://github.com/ionic-team/capacitor/issues/3999)) ([fa7003e](https://github.com/ionic-team/capacitor/commit/fa7003e4ef1d988633abb85b1b109c51b94fda42))
+
+
+
+# [3.0.0-alpha.12](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.11...3.0.0-alpha.12) (2021-01-08)
+
+
+### Bug Fixes
+
+* move `public` into iOS target directory ([#4002](https://github.com/ionic-team/capacitor/issues/4002)) ([4f41296](https://github.com/ionic-team/capacitor/commit/4f41296a109cf73fdf8e695849e95f292a543f85))
+* **cli:** run an actual debug build for iOS ([#4014](https://github.com/ionic-team/capacitor/issues/4014)) ([dc6399c](https://github.com/ionic-team/capacitor/commit/dc6399cf0b5eb6afb50274a84dc71486cd3e4173))
+
+
+### Features
+
+* **cli:** allow 'export default' style TS config files ([#4031](https://github.com/ionic-team/capacitor/issues/4031)) ([9393667](https://github.com/ionic-team/capacitor/commit/9393667bbe629d6c18a22b16fe3f3c6fe83e11f6))
+* **cli:** opt-in anonymous usage data ([#4022](https://github.com/ionic-team/capacitor/issues/4022)) ([3facfb7](https://github.com/ionic-team/capacitor/commit/3facfb790bff79b00ba1ab6dd8cb331989937da7))
+
+
+
+
+
+# [3.0.0-alpha.11](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.10...3.0.0-alpha.11) (2020-12-26)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.0.0-alpha.9](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.8...3.0.0-alpha.9) (2020-12-15)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+
+
+# [3.0.0-alpha.8](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.7...3.0.0-alpha.8) (2020-12-15)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+# [3.0.0-alpha.7](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.6...3.0.0-alpha.7) (2020-12-02)
+
+
+### Bug Fixes
+
+* **cli:** Properly detect cocoapods on multiple platforms ([#3810](https://github.com/ionic-team/capacitor/issues/3810)) ([8753694](https://github.com/ionic-team/capacitor/commit/8753694b12033feb01c82bd5985dce2584bae80c))
+* **cli:** run sync instead of copy during run ([#3816](https://github.com/ionic-team/capacitor/issues/3816)) ([ff45340](https://github.com/ionic-team/capacitor/commit/ff4534064c7f47331721d086889a42a97cf30945))
+* **cli:** use correct path for native-run ([02cf1ba](https://github.com/ionic-team/capacitor/commit/02cf1ba4b7d1c419551b6494f08cb90553fd93be))
+
+
+### Features
+
+* automatically import Android plugins ([#3788](https://github.com/ionic-team/capacitor/issues/3788)) ([aa1e1c6](https://github.com/ionic-team/capacitor/commit/aa1e1c604e260cc8babb0e7f5230f692bdcf6f09))
+* **cli:** add --no-sync option to run ([#3819](https://github.com/ionic-team/capacitor/issues/3819)) ([8def829](https://github.com/ionic-team/capacitor/commit/8def8290bb182436204380fc711d84fa36c17004))
+* **cli:** add config command ([#3817](https://github.com/ionic-team/capacitor/issues/3817)) ([d3d7f89](https://github.com/ionic-team/capacitor/commit/d3d7f893179a170017a36dd76e9ed7bd374a22b3))
+* **cli:** Add configurable pod path ([#3811](https://github.com/ionic-team/capacitor/issues/3811)) ([88f9187](https://github.com/ionic-team/capacitor/commit/88f9187f41f95ef62f6bf854c63f0b1c91dbc2f7))
+* **cli:** extendable plugin configuration types ([#3858](https://github.com/ionic-team/capacitor/issues/3858)) ([f789526](https://github.com/ionic-team/capacitor/commit/f789526e42283c2a166ff32a2b16b70e65b94ba4))
+* **cli:** locate plugins by allowlist ([#3762](https://github.com/ionic-team/capacitor/issues/3762)) ([81963b6](https://github.com/ionic-team/capacitor/commit/81963b615ccbdc8993d0befbefe87173db4ba108))
+* **cli:** STUDIO_PATH environment variable ([#3755](https://github.com/ionic-team/capacitor/issues/3755)) ([65cef53](https://github.com/ionic-team/capacitor/commit/65cef53277444c173ff928dc4ef196f0dae4c8a7))
+* **cli:** support TS/JS config files ([#3756](https://github.com/ionic-team/capacitor/issues/3756)) ([a52775f](https://github.com/ionic-team/capacitor/commit/a52775fb635a5cbcccf2dcaa955ad12804ad5986))
+
+
+
+# [3.0.0-alpha.6](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.5...3.0.0-alpha.6) (2020-10-30)
+
+
+### Features
+
+* **cli:** add `capacitor run` command ([#3599](https://github.com/ionic-team/capacitor/issues/3599)) ([8576b0f](https://github.com/ionic-team/capacitor/commit/8576b0ff6a048981a07cab91135a0071b724e043))
+
+
+
+
+
+# [3.0.0-alpha.5](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.4...3.0.0-alpha.5) (2020-10-06)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+# [3.0.0-alpha.4](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.3...3.0.0-alpha.4) (2020-09-23)
+
+
+### Features
+
+* **cli:** ability to specify custom platform directories ([#3565](https://github.com/ionic-team/capacitor/issues/3565)) ([c6eda55](https://github.com/ionic-team/capacitor/commit/c6eda55482ef56abdfe9a33444e828b771af9386))
+
+
+
+# [3.0.0-alpha.3](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.2...3.0.0-alpha.3) (2020-09-15)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+# [3.0.0-alpha.2](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.1...3.0.0-alpha.2) (2020-08-31)
+
+**Note:** Version bump only for package @capacitor/cli
+
+
+
+# [3.0.0-alpha.1](https://github.com/ionic-team/capacitor/compare/2.4.0...3.0.0-alpha.1) (2020-08-21)
+
+
+### Features
+
+* **cli:** add fmt script to plugin template ([#3354](https://github.com/ionic-team/capacitor/issues/3354)) ([9ca1e72](https://github.com/ionic-team/capacitor/commit/9ca1e723334f5d21706a8586c11d73162b47a13a))
+
+
+
+# [3.0.0-alpha.0](https://github.com/ionic-team/capacitor/compare/2.3.0...3.0.0-alpha.0) (2020-07-23)
+
+
+### Features
+
+* **core:** add `registerPlugin` for importing from plugin packages ([#3305](https://github.com/ionic-team/capacitor/issues/3305)) ([95475cc](https://github.com/ionic-team/capacitor/commit/95475cceb4cbd5be2cc7e18f2cf3045eb6c6f7fd))
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/LICENSE b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/LICENSE
new file mode 100644
index 00000000..94106147
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/LICENSE
@@ -0,0 +1,23 @@
+Copyright 2017-present Ionic
+https://ionic.io
+
+MIT License
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/README.md b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/README.md
new file mode 100644
index 00000000..d758c3ca
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/README.md
@@ -0,0 +1,15 @@
+# Capacitor CLI
+
+The Capacitor command-line interface should be installed locally and executed through `npm` scripts.
+
+```
+npm install @capacitor/cli --save-dev
+```
+
+## Using Capacitor CLI
+
+Consult the Getting Started guide for information on using the CLI and Capacitor scripts.
+
+### License
+
+* [MIT](https://github.com/ionic-team/capacitor/blob/HEAD/LICENSE)
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/android-template.tar.gz b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/android-template.tar.gz
new file mode 100644
index 00000000..7baaff64
Binary files /dev/null and b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/android-template.tar.gz differ
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/capacitor-cordova-android-plugins.tar.gz b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/capacitor-cordova-android-plugins.tar.gz
new file mode 100644
index 00000000..87f61e7a
Binary files /dev/null and b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/capacitor-cordova-android-plugins.tar.gz differ
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/capacitor-cordova-ios-plugins.tar.gz b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/capacitor-cordova-ios-plugins.tar.gz
new file mode 100644
index 00000000..44b9e739
Binary files /dev/null and b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/capacitor-cordova-ios-plugins.tar.gz differ
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/ios-template.tar.gz b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/ios-template.tar.gz
new file mode 100644
index 00000000..1d20c1c2
Binary files /dev/null and b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/assets/ios-template.tar.gz differ
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/bin/capacitor b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/bin/capacitor
new file mode 100644
index 00000000..415b2375
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/bin/capacitor
@@ -0,0 +1,18 @@
+#!/usr/bin/env node
+'use strict';
+
+var satisfies = require('semver/functions/satisfies');
+var packageJson = require('../package.json');
+var requiresNodeVersion = packageJson.engines.node;
+
+if (!satisfies(process.version, requiresNodeVersion, { includePrerelease: true})) {
+ process.stdout.write(
+ '\x1b[31m[fatal]\x1b[39m The Capacitor CLI requires NodeJS ' + requiresNodeVersion + '\n' +
+ ' Please install the latest LTS version.\n'
+ );
+
+ process.exit(1);
+}
+
+var cli = require('../dist/index');
+cli.run();
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/add.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/add.js
new file mode 100644
index 00000000..d16b91ce
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/add.js
@@ -0,0 +1,52 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.createLocalProperties = exports.addAndroid = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const os_1 = require("os");
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const subprocess_1 = require("../util/subprocess");
+const template_1 = require("../util/template");
+async function addAndroid(config) {
+ await common_1.runTask(`Adding native android project in ${colors_1.default.strong(config.android.platformDir)}`, async () => {
+ return template_1.extractTemplate(config.cli.assets.android.platformTemplateArchiveAbs, config.android.platformDirAbs);
+ });
+}
+exports.addAndroid = addAndroid;
+async function createLocalProperties(platformDir) {
+ const defaultAndroidPath = path_1.join(os_1.homedir(), 'Library/Android/sdk');
+ if (await utils_fs_1.pathExists(defaultAndroidPath)) {
+ const localSettings = `
+## This file is automatically generated by Android Studio.
+# Do not modify this file -- YOUR CHANGES WILL BE ERASED!
+#
+# This file should *NOT* be checked into Version Control Systems,
+# as it contains information specific to your local configuration.
+#
+# Location of the SDK. This is only used by Gradle.
+# For customization when using a Version Control System, please read the
+# header note.
+sdk.dir=${defaultAndroidPath}
+ `;
+ await utils_fs_1.writeFile(path_1.join(platformDir, 'local.properties'), localSettings, {
+ encoding: 'utf-8',
+ });
+ // Only sync if we were able to create the local properties above, otherwise
+ // this will fail
+ try {
+ await gradleSync(platformDir);
+ }
+ catch (e) {
+ console.error('Error running gradle sync', e);
+ console.error('Unable to infer default Android SDK settings. This is fine, just run npx cap open android and import and sync gradle manually');
+ }
+ }
+}
+exports.createLocalProperties = createLocalProperties;
+async function gradleSync(platformDir) {
+ await subprocess_1.runCommand(`./gradlew`, [], {
+ cwd: platformDir,
+ });
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/common.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/common.js
new file mode 100644
index 00000000..4908feb8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/common.js
@@ -0,0 +1,99 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.editProjectSettingsAndroid = exports.resolvePlugin = exports.getAndroidPlugins = exports.checkAndroidPackage = void 0;
+const utils_fs_1 = require("@ionic/utils-fs");
+const path_1 = require("path");
+const common_1 = require("../common");
+const cordova_1 = require("../cordova");
+const plugin_1 = require("../plugin");
+const fs_1 = require("../util/fs");
+async function checkAndroidPackage(config) {
+ return common_1.checkCapacitorPlatform(config, 'android');
+}
+exports.checkAndroidPackage = checkAndroidPackage;
+async function getAndroidPlugins(allPlugins) {
+ const resolved = await Promise.all(allPlugins.map(async (plugin) => await resolvePlugin(plugin)));
+ return resolved.filter((plugin) => !!plugin);
+}
+exports.getAndroidPlugins = getAndroidPlugins;
+async function resolvePlugin(plugin) {
+ var _a;
+ const platform = 'android';
+ if ((_a = plugin.manifest) === null || _a === void 0 ? void 0 : _a.android) {
+ let pluginFilesPath = plugin.manifest.android.src
+ ? plugin.manifest.android.src
+ : platform;
+ const absolutePath = path_1.join(plugin.rootPath, pluginFilesPath, plugin.id);
+ // Android folder shouldn't have subfolders, but they used to, so search for them for compatibility reasons
+ if (await utils_fs_1.pathExists(absolutePath)) {
+ pluginFilesPath = path_1.join(platform, plugin.id);
+ }
+ plugin.android = {
+ type: 0 /* Core */,
+ path: fs_1.convertToUnixPath(pluginFilesPath),
+ };
+ }
+ else if (plugin.xml) {
+ plugin.android = {
+ type: 1 /* Cordova */,
+ path: 'src/' + platform,
+ };
+ if (cordova_1.getIncompatibleCordovaPlugins(platform).includes(plugin.id) ||
+ !plugin_1.getPluginPlatform(plugin, platform)) {
+ plugin.android.type = 2 /* Incompatible */;
+ }
+ }
+ else {
+ return null;
+ }
+ return plugin;
+}
+exports.resolvePlugin = resolvePlugin;
+/**
+ * Update an Android project with the desired app name and appId.
+ * This is a little trickier for Android because the appId becomes
+ * the package name.
+ */
+async function editProjectSettingsAndroid(config) {
+ const appId = config.app.appId;
+ const appName = config.app.appName
+ .replace(/&/g, '&')
+ .replace(/ checkGradlew(config),
+ () => checkAppSrcDirs(config),
+ ]);
+ log_1.logSuccess('Android looking great! 👌');
+ }
+ catch (e) {
+ if (!errors_1.isFatal(e)) {
+ errors_1.fatal((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+ throw e;
+ }
+}
+exports.doctorAndroid = doctorAndroid;
+async function checkAppSrcDirs(config) {
+ if (!(await utils_fs_1.pathExists(config.android.appDirAbs))) {
+ return `${colors_1.default.strong(config.android.appDir)} directory is missing in ${colors_1.default.strong(config.android.platformDir)}`;
+ }
+ if (!(await utils_fs_1.pathExists(config.android.srcMainDirAbs))) {
+ return `${colors_1.default.strong(config.android.srcMainDir)} directory is missing in ${colors_1.default.strong(config.android.platformDir)}`;
+ }
+ if (!(await utils_fs_1.pathExists(config.android.assetsDirAbs))) {
+ return `${colors_1.default.strong(config.android.assetsDir)} directory is missing in ${colors_1.default.strong(config.android.platformDir)}`;
+ }
+ if (!(await utils_fs_1.pathExists(config.android.webDirAbs))) {
+ return `${colors_1.default.strong(config.android.webDir)} directory is missing in ${colors_1.default.strong(config.android.platformDir)}`;
+ }
+ const appSrcMainAssetsWwwIndexHtmlDir = path_1.join(config.android.webDirAbs, 'index.html');
+ if (!(await utils_fs_1.pathExists(appSrcMainAssetsWwwIndexHtmlDir))) {
+ return `${colors_1.default.strong('index.html')} file is missing in ${colors_1.default.strong(config.android.webDirAbs)}`;
+ }
+ return checkAndroidManifestFile(config);
+}
+async function checkAndroidManifestFile(config) {
+ const manifestFileName = 'AndroidManifest.xml';
+ const manifestFilePath = path_1.join(config.android.srcMainDirAbs, manifestFileName);
+ if (!(await utils_fs_1.pathExists(manifestFilePath))) {
+ return `${colors_1.default.strong(manifestFileName)} is missing in ${colors_1.default.strong(config.android.srcMainDir)}`;
+ }
+ try {
+ const xmlData = await xml_1.readXML(manifestFilePath);
+ return checkAndroidManifestData(config, xmlData);
+ }
+ catch (e) {
+ return e;
+ }
+}
+async function checkAndroidManifestData(config, xmlData) {
+ const manifestNode = xmlData.manifest;
+ if (!manifestNode) {
+ return `Missing ${colors_1.default.input('')} XML node in ${colors_1.default.strong(config.android.srcMainDir)}`;
+ }
+ const packageId = manifestNode.$['package'];
+ if (!packageId) {
+ return `Missing ${colors_1.default.input('')} attribute in ${colors_1.default.strong(config.android.srcMainDir)}`;
+ }
+ const applicationChildNodes = manifestNode.application;
+ if (!Array.isArray(manifestNode.application)) {
+ return `Missing ${colors_1.default.input('')} XML node as a child node of ${colors_1.default.input('')} in ${colors_1.default.strong(config.android.srcMainDir)}`;
+ }
+ let mainActivityClassPath = '';
+ const mainApplicationNode = applicationChildNodes.find(applicationChildNode => {
+ const activityChildNodes = applicationChildNode.activity;
+ if (!Array.isArray(activityChildNodes)) {
+ return false;
+ }
+ const mainActivityNode = activityChildNodes.find(activityChildNode => {
+ const intentFilterChildNodes = activityChildNode['intent-filter'];
+ if (!Array.isArray(intentFilterChildNodes)) {
+ return false;
+ }
+ return intentFilterChildNodes.find(intentFilterChildNode => {
+ const actionChildNodes = intentFilterChildNode.action;
+ if (!Array.isArray(actionChildNodes)) {
+ return false;
+ }
+ const mainActionChildNode = actionChildNodes.find(actionChildNode => {
+ const androidName = actionChildNode.$['android:name'];
+ return androidName === 'android.intent.action.MAIN';
+ });
+ if (!mainActionChildNode) {
+ return false;
+ }
+ const categoryChildNodes = intentFilterChildNode.category;
+ if (!Array.isArray(categoryChildNodes)) {
+ return false;
+ }
+ return categoryChildNodes.find(categoryChildNode => {
+ const androidName = categoryChildNode.$['android:name'];
+ return androidName === 'android.intent.category.LAUNCHER';
+ });
+ });
+ });
+ if (mainActivityNode) {
+ mainActivityClassPath = mainActivityNode.$['android:name'];
+ }
+ return mainActivityNode;
+ });
+ if (!mainApplicationNode) {
+ return `Missing main ${colors_1.default.input('')} XML node in ${colors_1.default.strong(config.android.srcMainDir)}`;
+ }
+ if (!mainActivityClassPath) {
+ return `Missing ${colors_1.default.input('')} attribute for MainActivity class in ${colors_1.default.strong(config.android.srcMainDir)}`;
+ }
+ return checkPackage(config, packageId, mainActivityClassPath);
+}
+async function checkPackage(config, packageId, mainActivityClassPath) {
+ if (mainActivityClassPath.indexOf(packageId) !== 0) {
+ return (`MainActivity ${mainActivityClassPath} is not in manifest package ${colors_1.default.input(packageId)}.\n` + `Please update the packages to be the same.`);
+ }
+ const appSrcMainJavaDir = path_1.join(config.android.srcMainDirAbs, 'java');
+ if (!(await utils_fs_1.pathExists(appSrcMainJavaDir))) {
+ return `${colors_1.default.strong('java')} directory is missing in ${colors_1.default.strong(appSrcMainJavaDir)}`;
+ }
+ let checkPath = appSrcMainJavaDir;
+ const packageParts = packageId.split('.');
+ for (const packagePart of packageParts) {
+ try {
+ fs_1.accessSync(path_1.join(checkPath, packagePart));
+ checkPath = path_1.join(checkPath, packagePart);
+ }
+ catch (e) {
+ return (`${colors_1.default.strong(packagePart)} is missing in ${checkPath}.\n` +
+ `Please create a directory structure matching the Package ID ${colors_1.default.input(packageId)} within the ${appSrcMainJavaDir} directory.`);
+ }
+ }
+ const mainActivityClassName = mainActivityClassPath.split('.').pop();
+ const mainActivityClassFileName = `${mainActivityClassName}.java`;
+ const mainActivityClassFilePath = path_1.join(checkPath, mainActivityClassFileName);
+ if (!(await utils_fs_1.pathExists(mainActivityClassFilePath))) {
+ return `Main activity file (${mainActivityClassFileName}) is missing in ${checkPath}`;
+ }
+ return checkBuildGradle(config, packageId);
+}
+async function checkBuildGradle(config, packageId) {
+ const fileName = 'build.gradle';
+ const filePath = path_1.join(config.android.appDirAbs, fileName);
+ if (!(await utils_fs_1.pathExists(filePath))) {
+ return `${colors_1.default.strong(fileName)} file is missing in ${colors_1.default.strong(config.android.appDir)}`;
+ }
+ let fileContent = await utils_fs_1.readFile(filePath, { encoding: 'utf-8' });
+ fileContent = fileContent.replace(/'|"/g, '').replace(/\s+/g, ' ');
+ const searchFor = `applicationId ${packageId}`;
+ if (fileContent.indexOf(searchFor) === -1) {
+ return `${colors_1.default.strong('build.gradle')} file missing ${colors_1.default.input(`applicationId "${packageId}"`)} config in ${filePath}`;
+ }
+ return null;
+}
+async function checkGradlew(config) {
+ const fileName = 'gradlew';
+ const filePath = path_1.join(config.android.platformDirAbs, fileName);
+ if (!(await utils_fs_1.pathExists(filePath))) {
+ return `${colors_1.default.strong(fileName)} file is missing in ${colors_1.default.strong(config.android.platformDir)}`;
+ }
+ return null;
+}
+async function checkAndroidInstalled() {
+ /*
+ if (!await isInstalled('android')) {
+ return 'Android is not installed. For information: https://developer.android.com/studio/index.html';
+ }
+ */
+ return null;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/open.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/open.js
new file mode 100644
index 00000000..1b40f337
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/open.js
@@ -0,0 +1,28 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.openAndroid = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const debug_1 = tslib_1.__importDefault(require("debug"));
+const open_1 = tslib_1.__importDefault(require("open"));
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const log_1 = require("../log");
+const debug = debug_1.default('capacitor:android:open');
+async function openAndroid(config) {
+ const androidStudioPath = await config.android.studioPath;
+ const dir = config.android.platformDirAbs;
+ try {
+ if (!(await utils_fs_1.pathExists(androidStudioPath))) {
+ throw new Error(`Android Studio does not exist at: ${androidStudioPath}`);
+ }
+ await open_1.default(dir, { app: androidStudioPath, wait: false });
+ log_1.logger.info(`Opening Android project at: ${colors_1.default.strong(config.android.platformDir)}.`);
+ }
+ catch (e) {
+ debug('Error opening Android Studio: %O', e);
+ log_1.logger.error('Unable to launch Android Studio. Is it installed?\n' +
+ `Attempted to open Android Studio at: ${colors_1.default.strong(androidStudioPath)}\n` +
+ `You can configure this with the ${colors_1.default.input('CAPACITOR_ANDROID_STUDIO_PATH')} environment variable.`);
+ }
+}
+exports.openAndroid = openAndroid;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/run.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/run.js
new file mode 100644
index 00000000..fdce5bb7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/run.js
@@ -0,0 +1,36 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.runAndroid = void 0;
+const tslib_1 = require("tslib");
+const debug_1 = tslib_1.__importDefault(require("debug"));
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const native_run_1 = require("../util/native-run");
+const subprocess_1 = require("../util/subprocess");
+const debug = debug_1.default('capacitor:android:run');
+async function runAndroid(config, { target: selectedTarget }) {
+ var _a;
+ const target = await common_1.promptForPlatformTarget(await native_run_1.getPlatformTargets('android'), selectedTarget);
+ const arg = `assemble${((_a = config.android) === null || _a === void 0 ? void 0 : _a.flavor) || ''}Debug`;
+ const gradleArgs = [arg];
+ debug('Invoking ./gradlew with args: %O', gradleArgs);
+ try {
+ await common_1.runTask('Running Gradle build', async () => subprocess_1.runCommand('./gradlew', gradleArgs, {
+ cwd: config.android.platformDirAbs,
+ }));
+ }
+ catch (e) {
+ if (e.includes('EACCES')) {
+ throw `gradlew file does not have executable permissions. This can happen if the Android platform was added on a Windows machine. Please run ${colors_1.default.strong(`chmod +x ./${config.android.platformDir}/gradlew`)} and try again.`;
+ }
+ else {
+ throw e;
+ }
+ }
+ const apkPath = path_1.resolve(config.android.buildOutputDirAbs, config.android.apkName);
+ const nativeRunArgs = ['android', '--app', apkPath, '--target', target.id];
+ debug('Invoking native-run with args: %O', nativeRunArgs);
+ await common_1.runTask(`Deploying ${colors_1.default.strong(config.android.apkName)} to ${colors_1.default.input(target.id)}`, async () => native_run_1.runNativeRun(nativeRunArgs));
+}
+exports.runAndroid = runAndroid;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/update.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/update.js
new file mode 100644
index 00000000..07e43f5b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/android/update.js
@@ -0,0 +1,315 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.handleCordovaPluginsGradle = exports.installGradlePlugins = exports.updateAndroid = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const debug_1 = tslib_1.__importDefault(require("debug"));
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const cordova_1 = require("../cordova");
+const errors_1 = require("../errors");
+const plugin_1 = require("../plugin");
+const copy_1 = require("../tasks/copy");
+const fs_1 = require("../util/fs");
+const node_1 = require("../util/node");
+const template_1 = require("../util/template");
+const common_2 = require("./common");
+const platform = 'android';
+const debug = debug_1.default('capacitor:android:update');
+async function updateAndroid(config) {
+ const plugins = await getPluginsTask(config);
+ const capacitorPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 0 /* Core */);
+ plugin_1.printPlugins(capacitorPlugins, 'android');
+ await writePluginsJson(config, capacitorPlugins);
+ await removePluginsNativeFiles(config);
+ const cordovaPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 1 /* Cordova */);
+ if (cordovaPlugins.length > 0) {
+ await copyPluginsNativeFiles(config, cordovaPlugins);
+ }
+ if (!(await utils_fs_1.pathExists(config.android.webDirAbs))) {
+ await copy_1.copy(config, platform);
+ }
+ await cordova_1.handleCordovaPluginsJS(cordovaPlugins, config, platform);
+ await cordova_1.checkPluginDependencies(plugins, platform);
+ await installGradlePlugins(config, capacitorPlugins, cordovaPlugins);
+ await handleCordovaPluginsGradle(config, cordovaPlugins);
+ await cordova_1.writeCordovaAndroidManifest(cordovaPlugins, config, platform);
+ const incompatibleCordovaPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 2 /* Incompatible */);
+ plugin_1.printPlugins(incompatibleCordovaPlugins, platform, 'incompatible');
+ await common_1.checkPlatformVersions(config, platform);
+}
+exports.updateAndroid = updateAndroid;
+function getGradlePackageName(id) {
+ return id.replace('@', '').replace('/', '-');
+}
+async function writePluginsJson(config, plugins) {
+ const classes = await findAndroidPluginClasses(plugins);
+ const pluginsJsonPath = path_1.resolve(config.android.assetsDirAbs, 'capacitor.plugins.json');
+ await utils_fs_1.writeJSON(pluginsJsonPath, classes, { spaces: '\t' });
+}
+async function findAndroidPluginClasses(plugins) {
+ const entries = [];
+ for (const plugin of plugins) {
+ entries.push(...(await findAndroidPluginClassesInPlugin(plugin)));
+ }
+ return entries;
+}
+async function findAndroidPluginClassesInPlugin(plugin) {
+ if (!plugin.android || plugin_1.getPluginType(plugin, platform) !== 0 /* Core */) {
+ return [];
+ }
+ const srcPath = path_1.resolve(plugin.rootPath, plugin.android.path, 'src/main');
+ const srcFiles = await utils_fs_1.readdirp(srcPath, {
+ filter: entry => !entry.stats.isDirectory() &&
+ ['.java', '.kt'].includes(path_1.extname(entry.path)),
+ });
+ const classRegex = /^@(?:CapacitorPlugin|NativePlugin)[\s\S]+?class ([\w]+)/gm;
+ const packageRegex = /^package ([\w.]+);?$/gm;
+ debug('Searching %O source files in %O by %O regex', srcFiles.length, srcPath, classRegex);
+ const entries = await Promise.all(srcFiles.map(async (srcFile) => {
+ const srcFileContents = await utils_fs_1.readFile(srcFile, { encoding: 'utf-8' });
+ classRegex.lastIndex = 0;
+ const classMatch = classRegex.exec(srcFileContents);
+ if (classMatch) {
+ const className = classMatch[1];
+ debug('Searching %O for package by %O regex', srcFile, packageRegex);
+ packageRegex.lastIndex = 0;
+ const packageMatch = packageRegex.exec(srcFileContents.substring(0, classMatch.index));
+ if (!packageMatch) {
+ errors_1.fatal(`Package could not be parsed from Android plugin.\n` +
+ `Location: ${colors_1.default.strong(srcFile)}`);
+ }
+ const packageName = packageMatch[1];
+ const classpath = `${packageName}.${className}`;
+ debug('%O is a suitable plugin class', classpath);
+ return {
+ pkg: plugin.id,
+ classpath,
+ };
+ }
+ }));
+ return entries.filter((entry) => !!entry);
+}
+async function installGradlePlugins(config, capacitorPlugins, cordovaPlugins) {
+ const capacitorAndroidPackagePath = node_1.resolveNode(config.app.rootDir, '@capacitor/android', 'package.json');
+ if (!capacitorAndroidPackagePath) {
+ errors_1.fatal(`Unable to find ${colors_1.default.strong('node_modules/@capacitor/android')}.\n` +
+ `Are you sure ${colors_1.default.strong('@capacitor/android')} is installed?`);
+ }
+ const capacitorAndroidPath = path_1.resolve(path_1.dirname(capacitorAndroidPackagePath), 'capacitor');
+ const settingsPath = config.android.platformDirAbs;
+ const dependencyPath = config.android.appDirAbs;
+ const relativeCapcitorAndroidPath = fs_1.convertToUnixPath(path_1.relative(settingsPath, capacitorAndroidPath));
+ const settingsLines = `// DO NOT EDIT THIS FILE! IT IS GENERATED EACH TIME "capacitor update" IS RUN
+include ':capacitor-android'
+project(':capacitor-android').projectDir = new File('${relativeCapcitorAndroidPath}')
+${capacitorPlugins
+ .map(p => {
+ if (!p.android) {
+ return '';
+ }
+ const relativePluginPath = fs_1.convertToUnixPath(path_1.relative(settingsPath, p.rootPath));
+ return `
+include ':${getGradlePackageName(p.id)}'
+project(':${getGradlePackageName(p.id)}').projectDir = new File('${relativePluginPath}/${p.android.path}')
+`;
+ })
+ .join('')}`;
+ const applyArray = [];
+ const frameworksArray = [];
+ let prefsArray = [];
+ cordovaPlugins.map(p => {
+ const relativePluginPath = fs_1.convertToUnixPath(path_1.relative(dependencyPath, p.rootPath));
+ const frameworks = plugin_1.getPlatformElement(p, platform, 'framework');
+ frameworks.map((framework) => {
+ if (framework.$.custom &&
+ framework.$.custom === 'true' &&
+ framework.$.type &&
+ framework.$.type === 'gradleReference') {
+ applyArray.push(`apply from: "${relativePluginPath}/${framework.$.src}"`);
+ }
+ else if (!framework.$.type && !framework.$.custom) {
+ frameworksArray.push(` implementation "${framework.$.src}"`);
+ }
+ });
+ prefsArray = prefsArray.concat(plugin_1.getAllElements(p, platform, 'preference'));
+ });
+ let frameworkString = frameworksArray.join('\n');
+ frameworkString = await replaceFrameworkVariables(config, prefsArray, frameworkString);
+ const dependencyLines = `// DO NOT EDIT THIS FILE! IT IS GENERATED EACH TIME "capacitor update" IS RUN
+
+android {
+ compileOptions {
+ sourceCompatibility JavaVersion.VERSION_1_8
+ targetCompatibility JavaVersion.VERSION_1_8
+ }
+}
+
+apply from: "../capacitor-cordova-android-plugins/cordova.variables.gradle"
+dependencies {
+${capacitorPlugins
+ .map(p => {
+ return ` implementation project(':${getGradlePackageName(p.id)}')`;
+ })
+ .join('\n')}
+${frameworkString}
+}
+${applyArray.join('\n')}
+
+if (hasProperty('postBuildExtras')) {
+ postBuildExtras()
+}
+`;
+ await utils_fs_1.writeFile(path_1.join(settingsPath, 'capacitor.settings.gradle'), settingsLines);
+ await utils_fs_1.writeFile(path_1.join(dependencyPath, 'capacitor.build.gradle'), dependencyLines);
+}
+exports.installGradlePlugins = installGradlePlugins;
+async function handleCordovaPluginsGradle(config, cordovaPlugins) {
+ var _a, _b, _c;
+ const pluginsGradlePath = path_1.join(config.android.cordovaPluginsDirAbs, 'build.gradle');
+ const kotlinNeeded = await kotlinNeededCheck(config, cordovaPlugins);
+ const isKotlinVersionInVariablesGradle = (await getVariablesGradleFile(config)).includes('kotlin_version');
+ const kotlinVersionString = (_c = (_b = (_a = config.app.extConfig.cordova) === null || _a === void 0 ? void 0 : _a.preferences) === null || _b === void 0 ? void 0 : _b.GradlePluginKotlinVersion) !== null && _c !== void 0 ? _c : '1.4.32';
+ const frameworksArray = [];
+ let prefsArray = [];
+ const applyArray = [];
+ applyArray.push(`apply from: "cordova.variables.gradle"`);
+ cordovaPlugins.map(p => {
+ const relativePluginPath = fs_1.convertToUnixPath(path_1.relative(config.android.cordovaPluginsDirAbs, p.rootPath));
+ const frameworks = plugin_1.getPlatformElement(p, platform, 'framework');
+ frameworks.map((framework) => {
+ if (!framework.$.type && !framework.$.custom) {
+ frameworksArray.push(framework.$.src);
+ }
+ else if (framework.$.custom &&
+ framework.$.custom === 'true' &&
+ framework.$.type &&
+ framework.$.type === 'gradleReference') {
+ applyArray.push(`apply from: "${relativePluginPath}/${framework.$.src}"`);
+ }
+ });
+ prefsArray = prefsArray.concat(plugin_1.getAllElements(p, platform, 'preference'));
+ });
+ let frameworkString = frameworksArray
+ .map(f => {
+ return ` implementation "${f}"`;
+ })
+ .join('\n');
+ frameworkString = await replaceFrameworkVariables(config, prefsArray, frameworkString);
+ if (kotlinNeeded) {
+ frameworkString += `\n implementation "androidx.core:core-ktx:$androidxCoreKTXVersion"`;
+ frameworkString += `\n implementation "org.jetbrains.kotlin:kotlin-stdlib:$kotlin_version"`;
+ }
+ const applyString = applyArray.join('\n');
+ let buildGradle = await utils_fs_1.readFile(pluginsGradlePath, { encoding: 'utf-8' });
+ buildGradle = buildGradle.replace(/(SUB-PROJECT DEPENDENCIES START)[\s\S]*(\/\/ SUB-PROJECT DEPENDENCIES END)/, '$1\n' + frameworkString.concat('\n') + ' $2');
+ buildGradle = buildGradle.replace(/(PLUGIN GRADLE EXTENSIONS START)[\s\S]*(\/\/ PLUGIN GRADLE EXTENSIONS END)/, '$1\n' + applyString.concat('\n') + '$2');
+ if (kotlinNeeded) {
+ buildGradle = buildGradle.replace(/(buildscript\s{\n(\t|\s{4})repositories\s{\n((\t{2}|\s{8}).+\n)+(\t|\s{4})}\n(\t|\s{4})dependencies\s{\n(\t{2}|\s{8}).+)\n((\t|\s{4})}\n}\n)/, `$1\n classpath "org.jetbrains.kotlin:kotlin-gradle-plugin:` +
+ (isKotlinVersionInVariablesGradle
+ ? '$kotlin_version'
+ : kotlinVersionString) +
+ `"\n$8`);
+ buildGradle = buildGradle.replace(/(ext\s{)/, `$1\n kotlin_version = project.hasProperty('kotlin_version') ? rootProject.ext.kotlin_version : '${kotlinVersionString}'\n androidxCoreKTXVersion = project.hasProperty('androidxCoreKTXVersion') ? rootProject.ext.androidxCoreKTXVersion : '1.6.0'`);
+ buildGradle = buildGradle.replace(/(apply\splugin:\s'com\.android\.library')/, `$1\napply plugin: 'kotlin-android'`);
+ buildGradle = buildGradle.replace(/(compileOptions\s{\n((\t{2}|\s{8}).+\n)+(\t|\s{4})})\n(})/, `$1\n sourceSets {\n main.java.srcDirs += 'src/main/kotlin'\n }\n$5`);
+ }
+ await utils_fs_1.writeFile(pluginsGradlePath, buildGradle);
+ const cordovaVariables = `// DO NOT EDIT THIS FILE! IT IS GENERATED EACH TIME "capacitor update" IS RUN
+ext {
+ cdvMinSdkVersion = project.hasProperty('minSdkVersion') ? rootProject.ext.minSdkVersion : ${config.android.minVersion}
+ // Plugin gradle extensions can append to this to have code run at the end.
+ cdvPluginPostBuildExtras = []
+ cordovaConfig = [:]
+}`;
+ await utils_fs_1.writeFile(path_1.join(config.android.cordovaPluginsDirAbs, 'cordova.variables.gradle'), cordovaVariables);
+}
+exports.handleCordovaPluginsGradle = handleCordovaPluginsGradle;
+async function kotlinNeededCheck(config, cordovaPlugins) {
+ var _a, _b;
+ if (((_b = (_a = config.app.extConfig.cordova) === null || _a === void 0 ? void 0 : _a.preferences) === null || _b === void 0 ? void 0 : _b.GradlePluginKotlinEnabled) !==
+ 'true') {
+ for (const plugin of cordovaPlugins) {
+ const androidPlatform = plugin_1.getPluginPlatform(plugin, platform);
+ const sourceFiles = androidPlatform['source-file'];
+ if (sourceFiles) {
+ for (const srcFile of sourceFiles) {
+ if (/^.*\.kt$/.test(srcFile['$'].src)) {
+ return true;
+ }
+ }
+ }
+ }
+ return false;
+ }
+ else {
+ return true;
+ }
+}
+async function copyPluginsNativeFiles(config, cordovaPlugins) {
+ const pluginsPath = path_1.join(config.android.cordovaPluginsDirAbs, 'src', 'main');
+ for (const p of cordovaPlugins) {
+ const androidPlatform = plugin_1.getPluginPlatform(p, platform);
+ if (androidPlatform) {
+ const sourceFiles = androidPlatform['source-file'];
+ if (sourceFiles) {
+ for (const sourceFile of sourceFiles) {
+ const fileName = sourceFile.$.src.split('/').pop();
+ let baseFolder = 'java/';
+ if (fileName.split('.').pop() === 'aidl') {
+ baseFolder = 'aidl/';
+ }
+ const target = sourceFile.$['target-dir']
+ .replace('app/src/main/', '')
+ .replace('src/', baseFolder);
+ await utils_fs_1.copy(plugin_1.getFilePath(config, p, sourceFile.$.src), path_1.join(pluginsPath, target, fileName));
+ }
+ }
+ const resourceFiles = androidPlatform['resource-file'];
+ if (resourceFiles) {
+ for (const resourceFile of resourceFiles) {
+ const target = resourceFile.$['target'];
+ if (resourceFile.$.src.split('.').pop() === 'aar') {
+ await utils_fs_1.copy(plugin_1.getFilePath(config, p, resourceFile.$.src), path_1.join(pluginsPath, 'libs', target.split('/').pop()));
+ }
+ else if (target !== '.') {
+ await utils_fs_1.copy(plugin_1.getFilePath(config, p, resourceFile.$.src), path_1.join(pluginsPath, target));
+ }
+ }
+ }
+ const libFiles = plugin_1.getPlatformElement(p, platform, 'lib-file');
+ for (const libFile of libFiles) {
+ await utils_fs_1.copy(plugin_1.getFilePath(config, p, libFile.$.src), path_1.join(pluginsPath, 'libs', libFile.$.src.split('/').pop()));
+ }
+ }
+ }
+}
+async function removePluginsNativeFiles(config) {
+ await utils_fs_1.remove(config.android.cordovaPluginsDirAbs);
+ await template_1.extractTemplate(config.cli.assets.android.cordovaPluginsTemplateArchiveAbs, config.android.cordovaPluginsDirAbs);
+}
+async function getPluginsTask(config) {
+ return await common_1.runTask('Updating Android plugins', async () => {
+ const allPlugins = await plugin_1.getPlugins(config, 'android');
+ const androidPlugins = await common_2.getAndroidPlugins(allPlugins);
+ return androidPlugins;
+ });
+}
+async function getVariablesGradleFile(config) {
+ const variablesFile = path_1.resolve(config.android.platformDirAbs, 'variables.gradle');
+ let variablesGradle = '';
+ if (await utils_fs_1.pathExists(variablesFile)) {
+ variablesGradle = await utils_fs_1.readFile(variablesFile, { encoding: 'utf-8' });
+ }
+ return variablesGradle;
+}
+async function replaceFrameworkVariables(config, prefsArray, frameworkString) {
+ const variablesGradle = await getVariablesGradleFile(config);
+ prefsArray.map((preference) => {
+ if (!variablesGradle.includes(preference.$.name)) {
+ frameworkString = frameworkString.replace(new RegExp(('$' + preference.$.name).replace('$', '\\$&'), 'g'), preference.$.default);
+ }
+ });
+ return frameworkString;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/colors.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/colors.js
new file mode 100644
index 00000000..8fe2c66c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/colors.js
@@ -0,0 +1,26 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.ancillary = exports.failure = exports.success = exports.input = exports.weak = exports.strong = void 0;
+const tslib_1 = require("tslib");
+const kleur_1 = tslib_1.__importDefault(require("kleur"));
+exports.strong = kleur_1.default.bold;
+exports.weak = kleur_1.default.dim;
+exports.input = kleur_1.default.cyan;
+exports.success = kleur_1.default.green;
+exports.failure = kleur_1.default.red;
+exports.ancillary = kleur_1.default.cyan;
+const COLORS = {
+ strong: exports.strong,
+ weak: exports.weak,
+ input: exports.input,
+ success: exports.success,
+ failure: exports.failure,
+ ancillary: exports.ancillary,
+ log: {
+ DEBUG: kleur_1.default.magenta,
+ INFO: kleur_1.default.cyan,
+ WARN: kleur_1.default.yellow,
+ ERROR: kleur_1.default.red,
+ },
+};
+exports.default = COLORS;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/common.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/common.js
new file mode 100644
index 00000000..32e9adf0
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/common.js
@@ -0,0 +1,353 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.resolvePlatform = exports.checkPlatformVersions = exports.getAddedPlatforms = exports.getPlatformTargetName = exports.promptForPlatformTarget = exports.promptForPlatform = exports.isValidEnterprisePlatform = exports.getKnownEnterprisePlatforms = exports.isValidCommunityPlatform = exports.getKnownCommunityPlatforms = exports.isValidPlatform = exports.getKnownPlatforms = exports.selectPlatforms = exports.getProjectPlatformDirectory = exports.getCLIVersion = exports.getCoreVersion = exports.getCapacitorPackageVersion = exports.requireCapacitorPackage = exports.getCapacitorPackage = exports.runTask = exports.runPlatformHook = exports.wait = exports.checkAppName = exports.checkAppId = exports.checkAppDir = exports.checkAppConfig = exports.checkCapacitorPlatform = exports.checkPackage = exports.checkWebDir = exports.check = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const utils_terminal_1 = require("@ionic/utils-terminal");
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("./colors"));
+const errors_1 = require("./errors");
+const log_1 = require("./log");
+const node_1 = require("./util/node");
+async function check(checks) {
+ const results = await Promise.all(checks.map(f => f()));
+ const errors = results.filter(r => r != null);
+ if (errors.length > 0) {
+ throw errors.join('\n');
+ }
+}
+exports.check = check;
+async function checkWebDir(config) {
+ var _a;
+ // We can skip checking the web dir if a server URL is set.
+ if ((_a = config.app.extConfig.server) === null || _a === void 0 ? void 0 : _a.url) {
+ return null;
+ }
+ const invalidFolders = ['', '.', '..', '../', './'];
+ if (invalidFolders.includes(config.app.webDir)) {
+ return `"${config.app.webDir}" is not a valid value for webDir`;
+ }
+ if (!(await utils_fs_1.pathExists(config.app.webDirAbs))) {
+ return (`Could not find the web assets directory: ${colors_1.default.strong(utils_terminal_1.prettyPath(config.app.webDirAbs))}.\n` +
+ `Please create it and make sure it has an ${colors_1.default.strong('index.html')} file. You can change the path of this directory in ${colors_1.default.strong(config.app.extConfigName)} (${colors_1.default.input('webDir')} option). You may need to compile the web assets for your app (typically ${colors_1.default.input('npm run build')}). More info: ${colors_1.default.strong('https://capacitorjs.com/docs/basics/workflow#sync-your-project')}`);
+ }
+ if (!(await utils_fs_1.pathExists(path_1.join(config.app.webDirAbs, 'index.html')))) {
+ return (`The web assets directory (${colors_1.default.strong(utils_terminal_1.prettyPath(config.app.webDirAbs))}) must contain an ${colors_1.default.strong('index.html')} file.\n` +
+ `It will be the entry point for the web portion of the Capacitor app.`);
+ }
+ return null;
+}
+exports.checkWebDir = checkWebDir;
+async function checkPackage() {
+ if (!(await utils_fs_1.pathExists('package.json'))) {
+ return (`The Capacitor CLI needs to run at the root of an npm package.\n` +
+ `Make sure you have a package.json file in the directory where you run the Capacitor CLI.\n` +
+ `More info: ${colors_1.default.strong('https://docs.npmjs.com/cli/init')}`);
+ }
+ return null;
+}
+exports.checkPackage = checkPackage;
+async function checkCapacitorPlatform(config, platform) {
+ const pkg = await getCapacitorPackage(config, platform);
+ if (!pkg) {
+ return (`Could not find the ${colors_1.default.input(platform)} platform.\n` +
+ `You must install it in your project first, e.g. w/ ${colors_1.default.input(`npm install @capacitor/${platform}`)}`);
+ }
+ return null;
+}
+exports.checkCapacitorPlatform = checkCapacitorPlatform;
+async function checkAppConfig(config) {
+ if (!config.app.appId) {
+ return (`Missing ${colors_1.default.input('appId')} for new platform.\n` +
+ `Please add it in ${config.app.extConfigName} or run ${colors_1.default.input('npx cap init')}.`);
+ }
+ if (!config.app.appName) {
+ return (`Missing ${colors_1.default.input('appName')} for new platform.\n` +
+ `Please add it in ${config.app.extConfigName} or run ${colors_1.default.input('npx cap init')}.`);
+ }
+ const appIdError = await checkAppId(config, config.app.appId);
+ if (appIdError) {
+ return appIdError;
+ }
+ const appNameError = await checkAppName(config, config.app.appName);
+ if (appNameError) {
+ return appNameError;
+ }
+ return null;
+}
+exports.checkAppConfig = checkAppConfig;
+async function checkAppDir(config, dir) {
+ if (!/^\S*$/.test(dir)) {
+ return `Your app directory should not contain spaces`;
+ }
+ return null;
+}
+exports.checkAppDir = checkAppDir;
+async function checkAppId(config, id) {
+ if (!id) {
+ return `Invalid App ID. Must be in Java package form with no dashes (ex: com.example.app)`;
+ }
+ if (/^[a-z][a-z0-9_]*(\.[a-z0-9_]+)+$/.test(id.toLowerCase())) {
+ return null;
+ }
+ return `Invalid App ID "${id}". Must be in Java package form with no dashes (ex: com.example.app)`;
+}
+exports.checkAppId = checkAppId;
+async function checkAppName(config, name) {
+ // We allow pretty much anything right now, have fun
+ if (!name || !name.length) {
+ return `Must provide an app name. For example: 'Spacebook'`;
+ }
+ return null;
+}
+exports.checkAppName = checkAppName;
+async function wait(time) {
+ return new Promise(resolve => setTimeout(resolve, time));
+}
+exports.wait = wait;
+async function runPlatformHook(config, platformName, platformDir, hook) {
+ var _a;
+ const { spawn } = await Promise.resolve().then(() => tslib_1.__importStar(require('child_process')));
+ const pkg = await utils_fs_1.readJSON(path_1.join(platformDir, 'package.json'));
+ const cmd = (_a = pkg.scripts) === null || _a === void 0 ? void 0 : _a[hook];
+ if (!cmd) {
+ return;
+ }
+ return new Promise((resolve, reject) => {
+ const p = spawn(cmd, {
+ stdio: 'inherit',
+ shell: true,
+ cwd: platformDir,
+ env: {
+ INIT_CWD: platformDir,
+ CAPACITOR_ROOT_DIR: config.app.rootDir,
+ CAPACITOR_WEB_DIR: config.app.webDirAbs,
+ CAPACITOR_CONFIG: JSON.stringify(config.app.extConfig),
+ CAPACITOR_PLATFORM_NAME: platformName,
+ ...process.env,
+ },
+ });
+ p.on('close', () => {
+ resolve();
+ });
+ p.on('error', err => {
+ reject(err);
+ });
+ });
+}
+exports.runPlatformHook = runPlatformHook;
+async function runTask(title, fn) {
+ const chain = log_1.output.createTaskChain();
+ chain.next(title);
+ try {
+ const value = await fn();
+ chain.end();
+ return value;
+ }
+ catch (e) {
+ chain.fail();
+ throw e;
+ }
+}
+exports.runTask = runTask;
+async function getCapacitorPackage(config, name) {
+ const packagePath = node_1.resolveNode(config.app.rootDir, `@capacitor/${name}`, 'package.json');
+ if (!packagePath) {
+ return null;
+ }
+ return utils_fs_1.readJSON(packagePath);
+}
+exports.getCapacitorPackage = getCapacitorPackage;
+async function requireCapacitorPackage(config, name) {
+ const pkg = await getCapacitorPackage(config, name);
+ if (!pkg) {
+ errors_1.fatal(`Unable to find node_modules/@capacitor/${name}.\n` +
+ `Are you sure ${colors_1.default.strong(`@capacitor/${name}`)} is installed?`);
+ }
+ return pkg;
+}
+exports.requireCapacitorPackage = requireCapacitorPackage;
+async function getCapacitorPackageVersion(config, platform) {
+ return (await requireCapacitorPackage(config, platform)).version;
+}
+exports.getCapacitorPackageVersion = getCapacitorPackageVersion;
+async function getCoreVersion(config) {
+ return getCapacitorPackageVersion(config, 'core');
+}
+exports.getCoreVersion = getCoreVersion;
+async function getCLIVersion(config) {
+ return getCapacitorPackageVersion(config, 'cli');
+}
+exports.getCLIVersion = getCLIVersion;
+function getPlatformDirectory(config, platform) {
+ switch (platform) {
+ case 'android':
+ return config.android.platformDirAbs;
+ case 'ios':
+ return config.ios.platformDirAbs;
+ case 'web':
+ return config.web.platformDirAbs;
+ }
+ return null;
+}
+async function getProjectPlatformDirectory(config, platform) {
+ const platformPath = getPlatformDirectory(config, platform);
+ if (platformPath && (await utils_fs_1.pathExists(platformPath))) {
+ return platformPath;
+ }
+ return null;
+}
+exports.getProjectPlatformDirectory = getProjectPlatformDirectory;
+async function selectPlatforms(config, selectedPlatformName) {
+ if (selectedPlatformName) {
+ // already passed in a platform name
+ const platformName = selectedPlatformName.toLowerCase().trim();
+ if (!(await isValidPlatform(platformName))) {
+ errors_1.fatal(`Invalid platform: ${colors_1.default.input(platformName)}`);
+ }
+ else if (!(await getProjectPlatformDirectory(config, platformName))) {
+ if (platformName === 'web') {
+ errors_1.fatal(`Could not find the web platform directory.\n` +
+ `Make sure ${colors_1.default.strong(config.app.webDir)} exists.`);
+ }
+ errors_1.fatal(`${colors_1.default.strong(platformName)} platform has not been added yet.\n` +
+ `See the docs for adding the ${colors_1.default.strong(platformName)} platform: ${colors_1.default.strong(`https://capacitorjs.com/docs/${platformName}#adding-the-${platformName}-platform`)}`);
+ }
+ // return the platform in an string array
+ return [platformName];
+ }
+ // wasn't given a platform name, so let's
+ // get the platforms that have already been created
+ return getAddedPlatforms(config);
+}
+exports.selectPlatforms = selectPlatforms;
+async function getKnownPlatforms() {
+ return ['web', 'android', 'ios'];
+}
+exports.getKnownPlatforms = getKnownPlatforms;
+async function isValidPlatform(platform) {
+ return (await getKnownPlatforms()).includes(platform);
+}
+exports.isValidPlatform = isValidPlatform;
+async function getKnownCommunityPlatforms() {
+ return ['electron'];
+}
+exports.getKnownCommunityPlatforms = getKnownCommunityPlatforms;
+async function isValidCommunityPlatform(platform) {
+ return (await getKnownCommunityPlatforms()).includes(platform);
+}
+exports.isValidCommunityPlatform = isValidCommunityPlatform;
+async function getKnownEnterprisePlatforms() {
+ return ['windows'];
+}
+exports.getKnownEnterprisePlatforms = getKnownEnterprisePlatforms;
+async function isValidEnterprisePlatform(platform) {
+ return (await getKnownEnterprisePlatforms()).includes(platform);
+}
+exports.isValidEnterprisePlatform = isValidEnterprisePlatform;
+async function promptForPlatform(platforms, promptMessage, selectedPlatformName) {
+ const { prompt } = await Promise.resolve().then(() => tslib_1.__importStar(require('prompts')));
+ if (!selectedPlatformName) {
+ const answers = await prompt([
+ {
+ type: 'select',
+ name: 'mode',
+ message: promptMessage,
+ choices: platforms.map(p => ({ title: p, value: p })),
+ },
+ ], { onCancel: () => process.exit(1) });
+ return answers.mode.toLowerCase().trim();
+ }
+ const platformName = selectedPlatformName.toLowerCase().trim();
+ if (!(await isValidPlatform(platformName))) {
+ const knownPlatforms = await getKnownPlatforms();
+ errors_1.fatal(`Invalid platform: ${colors_1.default.input(platformName)}.\n` +
+ `Valid platforms include: ${knownPlatforms.join(', ')}`);
+ }
+ return platformName;
+}
+exports.promptForPlatform = promptForPlatform;
+async function promptForPlatformTarget(targets, selectedTarget) {
+ const { prompt } = await Promise.resolve().then(() => tslib_1.__importStar(require('prompts')));
+ const validTargets = targets.filter(t => t.id !== undefined);
+ if (!selectedTarget) {
+ if (validTargets.length === 1) {
+ return validTargets[0];
+ }
+ else {
+ const answers = await prompt([
+ {
+ type: 'select',
+ name: 'target',
+ message: 'Please choose a target device:',
+ choices: validTargets.map(t => ({
+ title: `${getPlatformTargetName(t)} (${t.id})`,
+ value: t,
+ })),
+ },
+ ], { onCancel: () => process.exit(1) });
+ return answers.target;
+ }
+ }
+ const targetID = selectedTarget.trim();
+ const target = targets.find(t => t.id === targetID);
+ if (!target) {
+ errors_1.fatal(`Invalid target ID: ${colors_1.default.input(targetID)}.\n` +
+ `Valid targets are: ${targets.map(t => t.id).join(', ')}`);
+ }
+ return target;
+}
+exports.promptForPlatformTarget = promptForPlatformTarget;
+function getPlatformTargetName(target) {
+ var _a, _b, _c;
+ return `${(_c = (_b = (_a = target.name) !== null && _a !== void 0 ? _a : target.model) !== null && _b !== void 0 ? _b : target.id) !== null && _c !== void 0 ? _c : '?'}${target.virtual
+ ? ` (${target.platform === 'ios' ? 'simulator' : 'emulator'})`
+ : ''}`;
+}
+exports.getPlatformTargetName = getPlatformTargetName;
+async function getAddedPlatforms(config) {
+ const platforms = [];
+ if (await getProjectPlatformDirectory(config, config.android.name)) {
+ platforms.push(config.android.name);
+ }
+ if (await getProjectPlatformDirectory(config, config.ios.name)) {
+ platforms.push(config.ios.name);
+ }
+ platforms.push(config.web.name);
+ return platforms;
+}
+exports.getAddedPlatforms = getAddedPlatforms;
+async function checkPlatformVersions(config, platform) {
+ const semver = await Promise.resolve().then(() => tslib_1.__importStar(require('semver')));
+ const coreVersion = await getCoreVersion(config);
+ const platformVersion = await getCapacitorPackageVersion(config, platform);
+ if (semver.diff(coreVersion, platformVersion) === 'minor' ||
+ semver.diff(coreVersion, platformVersion) === 'major') {
+ log_1.logger.warn(`${colors_1.default.strong('@capacitor/core')}${colors_1.default.weak(`@${coreVersion}`)} version doesn't match ${colors_1.default.strong(`@capacitor/${platform}`)}${colors_1.default.weak(`@${platformVersion}`)} version.\n` +
+ `Consider updating to a matching version, e.g. w/ ${colors_1.default.input(`npm install @capacitor/core@${platformVersion}`)}`);
+ }
+}
+exports.checkPlatformVersions = checkPlatformVersions;
+function resolvePlatform(config, platform) {
+ if (platform[0] !== '@') {
+ const core = node_1.resolveNode(config.app.rootDir, `@capacitor/${platform}`, 'package.json');
+ if (core) {
+ return path_1.dirname(core);
+ }
+ const community = node_1.resolveNode(config.app.rootDir, `@capacitor-community/${platform}`, 'package.json');
+ if (community) {
+ return path_1.dirname(community);
+ }
+ const enterprise = node_1.resolveNode(config.app.rootDir, `@ionic-enterprise/capacitor-${platform}`, 'package.json');
+ if (enterprise) {
+ return path_1.dirname(enterprise);
+ }
+ }
+ // third-party
+ const thirdParty = node_1.resolveNode(config.app.rootDir, platform, 'package.json');
+ if (thirdParty) {
+ return path_1.dirname(thirdParty);
+ }
+ return null;
+}
+exports.resolvePlatform = resolvePlatform;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/config.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/config.js
new file mode 100644
index 00000000..19e9c727
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/config.js
@@ -0,0 +1,334 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.checkExternalConfig = exports.writeConfig = exports.loadConfig = exports.CONFIG_FILE_NAME_JSON = exports.CONFIG_FILE_NAME_JS = exports.CONFIG_FILE_NAME_TS = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const debug_1 = tslib_1.__importDefault(require("debug"));
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("./colors"));
+const errors_1 = require("./errors");
+const log_1 = require("./log");
+const fn_1 = require("./util/fn");
+const js_1 = require("./util/js");
+const node_1 = require("./util/node");
+const promise_1 = require("./util/promise");
+const debug = debug_1.default('capacitor:config');
+exports.CONFIG_FILE_NAME_TS = 'capacitor.config.ts';
+exports.CONFIG_FILE_NAME_JS = 'capacitor.config.js';
+exports.CONFIG_FILE_NAME_JSON = 'capacitor.config.json';
+async function loadConfig() {
+ var _a, _b, _c, _d, _e;
+ const appRootDir = process.cwd();
+ const cliRootDir = path_1.dirname(__dirname);
+ const conf = await loadExtConfig(appRootDir);
+ const appId = (_a = conf.extConfig.appId) !== null && _a !== void 0 ? _a : '';
+ const appName = (_b = conf.extConfig.appName) !== null && _b !== void 0 ? _b : '';
+ const webDir = (_c = conf.extConfig.webDir) !== null && _c !== void 0 ? _c : 'www';
+ const cli = await loadCLIConfig(cliRootDir);
+ const config = {
+ android: await loadAndroidConfig(appRootDir, conf.extConfig, cli),
+ ios: await loadIOSConfig(appRootDir, conf.extConfig),
+ web: await loadWebConfig(appRootDir, webDir),
+ cli,
+ app: {
+ rootDir: appRootDir,
+ appId,
+ appName,
+ webDir,
+ webDirAbs: path_1.resolve(appRootDir, webDir),
+ package: (_d = (await fn_1.tryFn(utils_fs_1.readJSON, path_1.resolve(appRootDir, 'package.json')))) !== null && _d !== void 0 ? _d : {
+ name: appName,
+ version: '1.0.0',
+ },
+ ...conf,
+ bundledWebRuntime: (_e = conf.extConfig.bundledWebRuntime) !== null && _e !== void 0 ? _e : false,
+ },
+ };
+ debug('config: %O', config);
+ return config;
+}
+exports.loadConfig = loadConfig;
+async function writeConfig(extConfig, extConfigFilePath) {
+ switch (path_1.extname(extConfigFilePath)) {
+ case '.json': {
+ await utils_fs_1.writeJSON(extConfigFilePath, extConfig, { spaces: 2 });
+ break;
+ }
+ case '.ts': {
+ await utils_fs_1.writeFile(extConfigFilePath, formatConfigTS(extConfig));
+ break;
+ }
+ }
+}
+exports.writeConfig = writeConfig;
+async function loadExtConfigTS(rootDir, extConfigName, extConfigFilePath) {
+ var _a, _b;
+ try {
+ const tsPath = node_1.resolveNode(rootDir, 'typescript');
+ if (!tsPath) {
+ errors_1.fatal('Could not find installation of TypeScript.\n' +
+ `To use ${colors_1.default.strong(extConfigName)} files, you must install TypeScript in your project, e.g. w/ ${colors_1.default.input('npm install -D typescript')}`);
+ }
+ const ts = require(tsPath); // eslint-disable-line @typescript-eslint/no-var-requires
+ const extConfigObject = node_1.requireTS(ts, extConfigFilePath);
+ const extConfig = (_a = extConfigObject.default) !== null && _a !== void 0 ? _a : extConfigObject;
+ return {
+ extConfigType: 'ts',
+ extConfigName,
+ extConfigFilePath: extConfigFilePath,
+ extConfig,
+ };
+ }
+ catch (e) {
+ if (!errors_1.isFatal(e)) {
+ errors_1.fatal(`Parsing ${colors_1.default.strong(extConfigName)} failed.\n\n${(_b = e.stack) !== null && _b !== void 0 ? _b : e}`);
+ }
+ throw e;
+ }
+}
+async function loadExtConfigJS(rootDir, extConfigName, extConfigFilePath) {
+ var _a;
+ try {
+ return {
+ extConfigType: 'js',
+ extConfigName,
+ extConfigFilePath: extConfigFilePath,
+ extConfig: require(extConfigFilePath),
+ };
+ }
+ catch (e) {
+ errors_1.fatal(`Parsing ${colors_1.default.strong(extConfigName)} failed.\n\n${(_a = e.stack) !== null && _a !== void 0 ? _a : e}`);
+ }
+}
+async function loadExtConfig(rootDir) {
+ var _a;
+ const extConfigFilePathTS = path_1.resolve(rootDir, exports.CONFIG_FILE_NAME_TS);
+ if (await utils_fs_1.pathExists(extConfigFilePathTS)) {
+ return loadExtConfigTS(rootDir, exports.CONFIG_FILE_NAME_TS, extConfigFilePathTS);
+ }
+ const extConfigFilePathJS = path_1.resolve(rootDir, exports.CONFIG_FILE_NAME_JS);
+ if (await utils_fs_1.pathExists(extConfigFilePathJS)) {
+ return loadExtConfigJS(rootDir, exports.CONFIG_FILE_NAME_JS, extConfigFilePathJS);
+ }
+ const extConfigFilePath = path_1.resolve(rootDir, exports.CONFIG_FILE_NAME_JSON);
+ return {
+ extConfigType: 'json',
+ extConfigName: exports.CONFIG_FILE_NAME_JSON,
+ extConfigFilePath: extConfigFilePath,
+ extConfig: (_a = (await fn_1.tryFn(utils_fs_1.readJSON, extConfigFilePath))) !== null && _a !== void 0 ? _a : {},
+ };
+}
+async function loadCLIConfig(rootDir) {
+ const assetsDir = 'assets';
+ const assetsDirAbs = path_1.join(rootDir, assetsDir);
+ const iosPlatformTemplateArchive = 'ios-template.tar.gz';
+ const iosCordovaPluginsTemplateArchive = 'capacitor-cordova-ios-plugins.tar.gz';
+ const androidPlatformTemplateArchive = 'android-template.tar.gz';
+ const androidCordovaPluginsTemplateArchive = 'capacitor-cordova-android-plugins.tar.gz';
+ return {
+ rootDir,
+ assetsDir,
+ assetsDirAbs,
+ assets: {
+ ios: {
+ platformTemplateArchive: iosPlatformTemplateArchive,
+ platformTemplateArchiveAbs: path_1.resolve(assetsDirAbs, iosPlatformTemplateArchive),
+ cordovaPluginsTemplateArchive: iosCordovaPluginsTemplateArchive,
+ cordovaPluginsTemplateArchiveAbs: path_1.resolve(assetsDirAbs, iosCordovaPluginsTemplateArchive),
+ },
+ android: {
+ platformTemplateArchive: androidPlatformTemplateArchive,
+ platformTemplateArchiveAbs: path_1.resolve(assetsDirAbs, androidPlatformTemplateArchive),
+ cordovaPluginsTemplateArchive: androidCordovaPluginsTemplateArchive,
+ cordovaPluginsTemplateArchiveAbs: path_1.resolve(assetsDirAbs, androidCordovaPluginsTemplateArchive),
+ },
+ },
+ package: await utils_fs_1.readJSON(path_1.resolve(rootDir, 'package.json')),
+ os: determineOS(process.platform),
+ };
+}
+async function loadAndroidConfig(rootDir, extConfig, cliConfig) {
+ var _a, _b, _c, _d, _e, _f;
+ const name = 'android';
+ const platformDir = (_b = (_a = extConfig.android) === null || _a === void 0 ? void 0 : _a.path) !== null && _b !== void 0 ? _b : 'android';
+ const platformDirAbs = path_1.resolve(rootDir, platformDir);
+ const appDir = 'app';
+ const srcDir = `${appDir}/src`;
+ const srcMainDir = `${srcDir}/main`;
+ const assetsDir = `${srcMainDir}/assets`;
+ const webDir = `${assetsDir}/public`;
+ const resDir = `${srcMainDir}/res`;
+ let apkPath = `${appDir}/build/outputs/apk/`;
+ let flavorPrefix = '';
+ const flavor = ((_c = extConfig.android) === null || _c === void 0 ? void 0 : _c.flavor) || '';
+ if ((_d = extConfig.android) === null || _d === void 0 ? void 0 : _d.flavor) {
+ apkPath = `${apkPath}/${(_e = extConfig.android) === null || _e === void 0 ? void 0 : _e.flavor}`;
+ flavorPrefix = `-${(_f = extConfig.android) === null || _f === void 0 ? void 0 : _f.flavor}`;
+ }
+ const apkName = `app${flavorPrefix}-debug.apk`;
+ const buildOutputDir = `${apkPath}/debug`;
+ const cordovaPluginsDir = 'capacitor-cordova-android-plugins';
+ const studioPath = promise_1.lazy(() => determineAndroidStudioPath(cliConfig.os));
+ return {
+ name,
+ minVersion: '21',
+ studioPath,
+ platformDir,
+ platformDirAbs,
+ cordovaPluginsDir,
+ cordovaPluginsDirAbs: path_1.resolve(platformDirAbs, cordovaPluginsDir),
+ appDir,
+ appDirAbs: path_1.resolve(platformDirAbs, appDir),
+ srcDir,
+ srcDirAbs: path_1.resolve(platformDirAbs, srcDir),
+ srcMainDir,
+ srcMainDirAbs: path_1.resolve(platformDirAbs, srcMainDir),
+ assetsDir,
+ assetsDirAbs: path_1.resolve(platformDirAbs, assetsDir),
+ webDir,
+ webDirAbs: path_1.resolve(platformDirAbs, webDir),
+ resDir,
+ resDirAbs: path_1.resolve(platformDirAbs, resDir),
+ apkName,
+ buildOutputDir,
+ buildOutputDirAbs: path_1.resolve(platformDirAbs, buildOutputDir),
+ flavor,
+ };
+}
+async function loadIOSConfig(rootDir, extConfig) {
+ var _a, _b, _c, _d;
+ const name = 'ios';
+ const podPath = determineCocoapodPath();
+ const platformDir = (_b = (_a = extConfig.ios) === null || _a === void 0 ? void 0 : _a.path) !== null && _b !== void 0 ? _b : 'ios';
+ const platformDirAbs = path_1.resolve(rootDir, platformDir);
+ const scheme = (_d = (_c = extConfig.ios) === null || _c === void 0 ? void 0 : _c.scheme) !== null && _d !== void 0 ? _d : 'App';
+ const nativeProjectDir = 'App';
+ const nativeProjectDirAbs = path_1.resolve(platformDirAbs, nativeProjectDir);
+ const nativeTargetDir = `${nativeProjectDir}/App`;
+ const nativeTargetDirAbs = path_1.resolve(platformDirAbs, nativeTargetDir);
+ const nativeXcodeProjDir = `${nativeProjectDir}/App.xcodeproj`;
+ const nativeXcodeProjDirAbs = path_1.resolve(platformDirAbs, nativeXcodeProjDir);
+ const nativeXcodeWorkspaceDirAbs = promise_1.lazy(() => determineXcodeWorkspaceDirAbs(nativeProjectDirAbs));
+ const webDirAbs = promise_1.lazy(() => determineIOSWebDirAbs(nativeProjectDirAbs, nativeTargetDirAbs, nativeXcodeProjDirAbs));
+ const cordovaPluginsDir = 'capacitor-cordova-ios-plugins';
+ return {
+ name,
+ minVersion: '12.0',
+ platformDir,
+ platformDirAbs,
+ scheme,
+ cordovaPluginsDir,
+ cordovaPluginsDirAbs: path_1.resolve(platformDirAbs, cordovaPluginsDir),
+ nativeProjectDir,
+ nativeProjectDirAbs,
+ nativeTargetDir,
+ nativeTargetDirAbs,
+ nativeXcodeProjDir,
+ nativeXcodeProjDirAbs,
+ nativeXcodeWorkspaceDir: promise_1.lazy(async () => path_1.relative(platformDirAbs, await nativeXcodeWorkspaceDirAbs)),
+ nativeXcodeWorkspaceDirAbs,
+ webDir: promise_1.lazy(async () => path_1.relative(platformDirAbs, await webDirAbs)),
+ webDirAbs,
+ podPath,
+ };
+}
+async function loadWebConfig(rootDir, webDir) {
+ const platformDir = webDir;
+ const platformDirAbs = path_1.resolve(rootDir, platformDir);
+ return {
+ name: 'web',
+ platformDir,
+ platformDirAbs,
+ };
+}
+function determineOS(os) {
+ switch (os) {
+ case 'darwin':
+ return "mac" /* Mac */;
+ case 'win32':
+ return "windows" /* Windows */;
+ case 'linux':
+ return "linux" /* Linux */;
+ }
+ return "unknown" /* Unknown */;
+}
+async function determineXcodeWorkspaceDirAbs(nativeProjectDirAbs) {
+ return path_1.resolve(nativeProjectDirAbs, 'App.xcworkspace');
+}
+async function determineIOSWebDirAbs(nativeProjectDirAbs, nativeTargetDirAbs, nativeXcodeProjDirAbs) {
+ const re = /path\s=\spublic[\s\S]+?sourceTree\s=\s([^;]+)/;
+ const pbxprojPath = path_1.resolve(nativeXcodeProjDirAbs, 'project.pbxproj');
+ try {
+ const pbxproj = await utils_fs_1.readFile(pbxprojPath, { encoding: 'utf8' });
+ const m = pbxproj.match(re);
+ if (m && m[1] === 'SOURCE_ROOT') {
+ log_1.logger.warn(`Using the iOS project root for the ${colors_1.default.strong('public')} directory is deprecated.\n` +
+ `Please follow the Upgrade Guide to move ${colors_1.default.strong('public')} inside the iOS target directory: ${colors_1.default.strong('https://capacitorjs.com/docs/updating/3-0#move-public-into-the-ios-target-directory')}`);
+ return path_1.resolve(nativeProjectDirAbs, 'public');
+ }
+ }
+ catch (e) {
+ // ignore
+ }
+ return path_1.resolve(nativeTargetDirAbs, 'public');
+}
+async function determineAndroidStudioPath(os) {
+ if (process.env.CAPACITOR_ANDROID_STUDIO_PATH) {
+ return process.env.CAPACITOR_ANDROID_STUDIO_PATH;
+ }
+ switch (os) {
+ case "mac" /* Mac */:
+ return '/Applications/Android Studio.app';
+ case "windows" /* Windows */: {
+ const { runCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./util/subprocess')));
+ let p = 'C:\\Program Files\\Android\\Android Studio\\bin\\studio64.exe';
+ try {
+ if (!(await utils_fs_1.pathExists(p))) {
+ let commandResult = await runCommand('REG', [
+ 'QUERY',
+ 'HKEY_LOCAL_MACHINE\\SOFTWARE\\Android Studio',
+ '/v',
+ 'Path',
+ ]);
+ commandResult = commandResult.replace(/(\r\n|\n|\r)/gm, '');
+ const i = commandResult.indexOf('REG_SZ');
+ if (i > 0) {
+ p = commandResult.substring(i + 6).trim() + '\\bin\\studio64.exe';
+ }
+ }
+ }
+ catch (e) {
+ debug(`Error checking registry for Android Studio path: %O`, e);
+ break;
+ }
+ return p;
+ }
+ case "linux" /* Linux */:
+ return '/usr/local/android-studio/bin/studio.sh';
+ }
+ return '';
+}
+function determineCocoapodPath() {
+ if (process.env.CAPACITOR_COCOAPODS_PATH) {
+ return process.env.CAPACITOR_COCOAPODS_PATH;
+ }
+ return 'pod';
+}
+function formatConfigTS(extConfig) {
+ // TODO: tags
+ return `import { CapacitorConfig } from '@capacitor/cli';
+
+const config: CapacitorConfig = ${js_1.formatJSObject(extConfig)};
+
+export default config;\n`;
+}
+function checkExternalConfig(config) {
+ var _a, _b;
+ if (typeof config.extConfig.hideLogs !== 'undefined' ||
+ typeof ((_a = config.extConfig.android) === null || _a === void 0 ? void 0 : _a.hideLogs) !== 'undefined' ||
+ typeof ((_b = config.extConfig.ios) === null || _b === void 0 ? void 0 : _b.hideLogs) !== 'undefined') {
+ log_1.logger.warn(`The ${colors_1.default.strong('hideLogs')} configuration option has been deprecated. ` +
+ `Please update to use ${colors_1.default.strong('loggingBehavior')} instead.`);
+ }
+}
+exports.checkExternalConfig = checkExternalConfig;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/cordova.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/cordova.js
new file mode 100644
index 00000000..7ecdbe0b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/cordova.js
@@ -0,0 +1,561 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.writeCordovaAndroidManifest = exports.getCordovaPreferences = exports.needsStaticPod = exports.getIncompatibleCordovaPlugins = exports.checkPluginDependencies = exports.logCordovaManualSteps = exports.getCordovaPlugins = exports.handleCordovaPluginsJS = exports.autoGenerateConfig = exports.removePluginFiles = exports.createEmptyCordovaJS = exports.copyCordovaJS = exports.copyPluginsJS = exports.generateCordovaPluginsJSFile = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const path_1 = require("path");
+const plist_1 = tslib_1.__importDefault(require("plist"));
+const prompts_1 = tslib_1.__importDefault(require("prompts"));
+const common_1 = require("./android/common");
+const colors_1 = tslib_1.__importDefault(require("./colors"));
+const errors_1 = require("./errors");
+const common_2 = require("./ios/common");
+const log_1 = require("./log");
+const plugin_1 = require("./plugin");
+const node_1 = require("./util/node");
+const term_1 = require("./util/term");
+const xml_1 = require("./util/xml");
+/**
+ * Build the root cordova_plugins.js file referencing each Plugin JS file.
+ */
+function generateCordovaPluginsJSFile(config, plugins, platform) {
+ const pluginModules = [];
+ const pluginExports = [];
+ plugins.map(p => {
+ const pluginId = p.xml.$.id;
+ const jsModules = plugin_1.getJSModules(p, platform);
+ jsModules.map((jsModule) => {
+ const clobbers = [];
+ const merges = [];
+ let clobbersModule = '';
+ let mergesModule = '';
+ let runsModule = '';
+ let clobberKey = '';
+ let mergeKey = '';
+ if (jsModule.clobbers) {
+ jsModule.clobbers.map((clobber) => {
+ clobbers.push(clobber.$.target);
+ clobberKey = clobber.$.target;
+ });
+ clobbersModule = `,
+ "clobbers": [
+ "${clobbers.join('",\n "')}"
+ ]`;
+ }
+ if (jsModule.merges) {
+ jsModule.merges.map((merge) => {
+ merges.push(merge.$.target);
+ mergeKey = merge.$.target;
+ });
+ mergesModule = `,
+ "merges": [
+ "${merges.join('",\n "')}"
+ ]`;
+ }
+ if (jsModule.runs) {
+ runsModule = ',\n "runs": true';
+ }
+ const pluginModule = {
+ clobber: clobberKey,
+ merge: mergeKey,
+ // mimics Cordova's module name logic if the name attr is missing
+ pluginContent: `{
+ "id": "${pluginId +
+ '.' +
+ (jsModule.$.name || jsModule.$.src.match(/([^/]+)\.js/)[1])}",
+ "file": "plugins/${pluginId}/${jsModule.$.src}",
+ "pluginId": "${pluginId}"${clobbersModule}${mergesModule}${runsModule}
+ }`,
+ };
+ pluginModules.push(pluginModule);
+ });
+ pluginExports.push(`"${pluginId}": "${p.xml.$.version}"`);
+ });
+ return `
+ cordova.define('cordova/plugin_list', function(require, exports, module) {
+ module.exports = [
+ ${pluginModules
+ .sort((a, b) => a.clobber && b.clobber // Clobbers in alpha order
+ ? a.clobber.localeCompare(b.clobber)
+ : a.clobber || b.clobber // Clobbers before anything else
+ ? b.clobber.localeCompare(a.clobber)
+ : a.merge.localeCompare(b.merge))
+ .map(e => e.pluginContent)
+ .join(',\n ')}
+ ];
+ module.exports.metadata =
+ // TOP OF METADATA
+ {
+ ${pluginExports.join(',\n ')}
+ };
+ // BOTTOM OF METADATA
+ });
+ `;
+}
+exports.generateCordovaPluginsJSFile = generateCordovaPluginsJSFile;
+/**
+ * Build the plugins/* files for each Cordova plugin installed.
+ */
+async function copyPluginsJS(config, cordovaPlugins, platform) {
+ const webDir = await getWebDir(config, platform);
+ const pluginsDir = path_1.join(webDir, 'plugins');
+ const cordovaPluginsJSFile = path_1.join(webDir, 'cordova_plugins.js');
+ await removePluginFiles(config, platform);
+ await Promise.all(cordovaPlugins.map(async (p) => {
+ const pluginId = p.xml.$.id;
+ const pluginDir = path_1.join(pluginsDir, pluginId, 'www');
+ await utils_fs_1.ensureDir(pluginDir);
+ const jsModules = plugin_1.getJSModules(p, platform);
+ await Promise.all(jsModules.map(async (jsModule) => {
+ const filePath = path_1.join(webDir, 'plugins', pluginId, jsModule.$.src);
+ await utils_fs_1.copy(path_1.join(p.rootPath, jsModule.$.src), filePath);
+ let data = await utils_fs_1.readFile(filePath, { encoding: 'utf-8' });
+ data = data.trim();
+ // mimics Cordova's module name logic if the name attr is missing
+ const name = pluginId +
+ '.' +
+ (jsModule.$.name ||
+ path_1.basename(jsModule.$.src, path_1.extname(jsModule.$.src)));
+ data = `cordova.define("${name}", function(require, exports, module) { \n${data}\n});`;
+ data = data.replace(/)<[^<]*)*<\/script\s*>/gi, '');
+ await utils_fs_1.writeFile(filePath, data, { encoding: 'utf-8' });
+ }));
+ const assets = plugin_1.getAssets(p, platform);
+ await Promise.all(assets.map(async (asset) => {
+ const filePath = path_1.join(webDir, asset.$.target);
+ await utils_fs_1.copy(path_1.join(p.rootPath, asset.$.src), filePath);
+ }));
+ }));
+ await utils_fs_1.writeFile(cordovaPluginsJSFile, generateCordovaPluginsJSFile(config, cordovaPlugins, platform));
+}
+exports.copyPluginsJS = copyPluginsJS;
+async function copyCordovaJS(config, platform) {
+ const cordovaPath = node_1.resolveNode(config.app.rootDir, '@capacitor/core', 'cordova.js');
+ if (!cordovaPath) {
+ errors_1.fatal(`Unable to find ${colors_1.default.strong('node_modules/@capacitor/core/cordova.js')}.\n` + `Are you sure ${colors_1.default.strong('@capacitor/core')} is installed?`);
+ }
+ return utils_fs_1.copy(cordovaPath, path_1.join(await getWebDir(config, platform), 'cordova.js'));
+}
+exports.copyCordovaJS = copyCordovaJS;
+async function createEmptyCordovaJS(config, platform) {
+ const webDir = await getWebDir(config, platform);
+ await utils_fs_1.writeFile(path_1.join(webDir, 'cordova.js'), '');
+ await utils_fs_1.writeFile(path_1.join(webDir, 'cordova_plugins.js'), '');
+}
+exports.createEmptyCordovaJS = createEmptyCordovaJS;
+async function removePluginFiles(config, platform) {
+ const webDir = await getWebDir(config, platform);
+ const pluginsDir = path_1.join(webDir, 'plugins');
+ const cordovaPluginsJSFile = path_1.join(webDir, 'cordova_plugins.js');
+ await utils_fs_1.remove(pluginsDir);
+ await utils_fs_1.remove(cordovaPluginsJSFile);
+}
+exports.removePluginFiles = removePluginFiles;
+async function autoGenerateConfig(config, cordovaPlugins, platform) {
+ var _a, _b, _c, _d;
+ let xmlDir = path_1.join(config.android.resDirAbs, 'xml');
+ const fileName = 'config.xml';
+ if (platform === 'ios') {
+ xmlDir = config.ios.nativeTargetDirAbs;
+ }
+ await utils_fs_1.ensureDir(xmlDir);
+ const cordovaConfigXMLFile = path_1.join(xmlDir, fileName);
+ await utils_fs_1.remove(cordovaConfigXMLFile);
+ const pluginEntries = [];
+ cordovaPlugins.map(p => {
+ const currentPlatform = plugin_1.getPluginPlatform(p, platform);
+ if (currentPlatform) {
+ const configFiles = currentPlatform['config-file'];
+ if (configFiles) {
+ const configXMLEntries = configFiles.filter(function (item) {
+ var _a;
+ return (_a = item.$) === null || _a === void 0 ? void 0 : _a.target.includes(fileName);
+ });
+ configXMLEntries.map((entry) => {
+ if (entry.feature) {
+ const feature = { feature: entry.feature };
+ pluginEntries.push(feature);
+ }
+ });
+ }
+ }
+ });
+ let accessOriginString = [];
+ if ((_b = (_a = config.app.extConfig) === null || _a === void 0 ? void 0 : _a.cordova) === null || _b === void 0 ? void 0 : _b.accessOrigins) {
+ accessOriginString = await Promise.all(config.app.extConfig.cordova.accessOrigins.map(async (host) => {
+ return `
+ `;
+ }));
+ }
+ else {
+ accessOriginString.push(``);
+ }
+ const pluginEntriesString = await Promise.all(pluginEntries.map(async (item) => {
+ const xmlString = await xml_1.writeXML(item);
+ return xmlString;
+ }));
+ let pluginPreferencesString = [];
+ if ((_d = (_c = config.app.extConfig) === null || _c === void 0 ? void 0 : _c.cordova) === null || _d === void 0 ? void 0 : _d.preferences) {
+ pluginPreferencesString = await Promise.all(Object.entries(config.app.extConfig.cordova.preferences).map(async ([key, value]) => {
+ return `
+ `;
+ }));
+ }
+ const content = `
+
+ ${accessOriginString.join('')}
+ ${pluginEntriesString.join('')}
+ ${pluginPreferencesString.join('')}
+`;
+ await utils_fs_1.writeFile(cordovaConfigXMLFile, content);
+}
+exports.autoGenerateConfig = autoGenerateConfig;
+async function getWebDir(config, platform) {
+ if (platform === 'ios') {
+ return config.ios.webDirAbs;
+ }
+ if (platform === 'android') {
+ return config.android.webDirAbs;
+ }
+ return '';
+}
+async function handleCordovaPluginsJS(cordovaPlugins, config, platform) {
+ const webDir = await getWebDir(config, platform);
+ await utils_fs_1.mkdirp(webDir);
+ if (cordovaPlugins.length > 0) {
+ plugin_1.printPlugins(cordovaPlugins, platform, 'cordova');
+ await copyCordovaJS(config, platform);
+ await copyPluginsJS(config, cordovaPlugins, platform);
+ }
+ else {
+ await removePluginFiles(config, platform);
+ await createEmptyCordovaJS(config, platform);
+ }
+ await autoGenerateConfig(config, cordovaPlugins, platform);
+}
+exports.handleCordovaPluginsJS = handleCordovaPluginsJS;
+async function getCordovaPlugins(config, platform) {
+ const allPlugins = await plugin_1.getPlugins(config, platform);
+ let plugins = [];
+ if (platform === config.ios.name) {
+ plugins = await common_2.getIOSPlugins(allPlugins);
+ }
+ else if (platform === config.android.name) {
+ plugins = await common_1.getAndroidPlugins(allPlugins);
+ }
+ return plugins.filter(p => plugin_1.getPluginType(p, platform) === 1 /* Cordova */);
+}
+exports.getCordovaPlugins = getCordovaPlugins;
+async function logCordovaManualSteps(cordovaPlugins, config, platform) {
+ cordovaPlugins.map(p => {
+ const editConfig = plugin_1.getPlatformElement(p, platform, 'edit-config');
+ const configFile = plugin_1.getPlatformElement(p, platform, 'config-file');
+ editConfig.concat(configFile).map(async (configElement) => {
+ if (configElement.$ && !configElement.$.target.includes('config.xml')) {
+ if (platform === config.ios.name) {
+ if (configElement.$.target.includes('Info.plist')) {
+ logiOSPlist(configElement, config, p);
+ }
+ }
+ }
+ });
+ });
+}
+exports.logCordovaManualSteps = logCordovaManualSteps;
+async function logiOSPlist(configElement, config, plugin) {
+ let plistPath = path_1.resolve(config.ios.nativeTargetDirAbs, 'Info.plist');
+ if (!(await utils_fs_1.pathExists(plistPath))) {
+ plistPath = path_1.resolve(config.ios.nativeTargetDirAbs, 'Base.lproj', 'Info.plist');
+ }
+ if (await utils_fs_1.pathExists(plistPath)) {
+ const xmlMeta = await xml_1.readXML(plistPath);
+ const data = await utils_fs_1.readFile(plistPath, { encoding: 'utf-8' });
+ const plistData = plist_1.default.parse(data);
+ const dict = xmlMeta.plist.dict.pop();
+ if (!dict.key.includes(configElement.$.parent)) {
+ let xml = buildConfigFileXml(configElement);
+ xml = `${configElement.$.parent}${getConfigFileTagContent(xml)}`;
+ log_1.logger.warn(`Configuration required for ${colors_1.default.strong(plugin.id)}.\n` +
+ `Add the following to Info.plist:\n` +
+ xml);
+ }
+ else if (configElement.array || configElement.dict) {
+ if (configElement.array &&
+ configElement.array.length > 0 &&
+ configElement.array[0].string) {
+ let xml = '';
+ configElement.array[0].string.map((element) => {
+ const d = plistData[configElement.$.parent];
+ if (Array.isArray(d) && !d.includes(element)) {
+ xml = xml.concat(`${element}\n`);
+ }
+ });
+ if (xml.length > 0) {
+ log_1.logger.warn(`Configuration required for ${colors_1.default.strong(plugin.id)}.\n` +
+ `Add the following in the existing ${colors_1.default.strong(configElement.$.parent)} array of your Info.plist:\n` +
+ xml);
+ }
+ }
+ else {
+ logPossibleMissingItem(configElement, plugin);
+ }
+ }
+ }
+ else {
+ logPossibleMissingItem(configElement, plugin);
+ }
+}
+function logPossibleMissingItem(configElement, plugin) {
+ let xml = buildConfigFileXml(configElement);
+ xml = getConfigFileTagContent(xml);
+ xml = removeOuterTags(xml);
+ log_1.logger.warn(`Configuration might be missing for ${colors_1.default.strong(plugin.id)}.\n` +
+ `Add the following to the existing ${colors_1.default.strong(configElement.$.parent)} entry of Info.plist:\n` +
+ xml);
+}
+function buildConfigFileXml(configElement) {
+ return xml_1.buildXmlElement(configElement, 'config-file');
+}
+function getConfigFileTagContent(str) {
+ return str.replace(/|<\/config-file>/g, '');
+}
+function removeOuterTags(str) {
+ const start = str.indexOf('>') + 1;
+ const end = str.lastIndexOf('<');
+ return str.substring(start, end);
+}
+async function checkPluginDependencies(plugins, platform) {
+ const pluginDeps = new Map();
+ const cordovaPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 1 /* Cordova */);
+ const incompatible = plugins.filter(p => plugin_1.getPluginType(p, platform) === 2 /* Incompatible */);
+ await Promise.all(cordovaPlugins.map(async (p) => {
+ let allDependencies = [];
+ allDependencies = allDependencies.concat(plugin_1.getPlatformElement(p, platform, 'dependency'));
+ if (p.xml['dependency']) {
+ allDependencies = allDependencies.concat(p.xml['dependency']);
+ }
+ allDependencies = allDependencies.filter((dep) => !getIncompatibleCordovaPlugins(platform).includes(dep.$.id) &&
+ incompatible.filter(p => p.id === dep.$.id || p.xml.$.id === dep.$.id)
+ .length === 0);
+ if (allDependencies) {
+ await Promise.all(allDependencies.map(async (dep) => {
+ var _a;
+ let plugin = dep.$.id;
+ let version = dep.$.version;
+ if (plugin.includes('@') && plugin.indexOf('@') !== 0) {
+ [plugin, version] = plugin.split('@');
+ }
+ if (cordovaPlugins.filter(p => p.id === plugin || p.xml.$.id === plugin).length === 0) {
+ if ((_a = dep.$.url) === null || _a === void 0 ? void 0 : _a.startsWith('http')) {
+ plugin = dep.$.url;
+ version = dep.$.commit;
+ }
+ const deps = pluginDeps.get(p.id) || [];
+ deps.push(`${plugin}${version ? colors_1.default.weak(` (${version})`) : ''}`);
+ pluginDeps.set(p.id, deps);
+ }
+ }));
+ }
+ }));
+ if (pluginDeps.size > 0) {
+ let msg = `${colors_1.default.failure(colors_1.default.strong('Plugins are missing dependencies.'))}\n` +
+ `Cordova plugin dependencies must be installed in your project (e.g. w/ ${colors_1.default.input('npm install')}).\n`;
+ for (const [plugin, deps] of pluginDeps.entries()) {
+ msg +=
+ `\n ${colors_1.default.strong(plugin)} is missing dependencies:\n` +
+ deps.map(d => ` - ${d}`).join('\n');
+ }
+ log_1.logger.warn(`${msg}\n`);
+ }
+}
+exports.checkPluginDependencies = checkPluginDependencies;
+function getIncompatibleCordovaPlugins(platform) {
+ const pluginList = [
+ 'cordova-plugin-splashscreen',
+ 'cordova-plugin-ionic-webview',
+ 'cordova-plugin-crosswalk-webview',
+ 'cordova-plugin-wkwebview-engine',
+ 'cordova-plugin-console',
+ 'cordova-plugin-music-controls',
+ 'cordova-plugin-add-swift-support',
+ 'cordova-plugin-ionic-keyboard',
+ 'cordova-plugin-braintree',
+ '@ionic-enterprise/filesystem',
+ '@ionic-enterprise/keyboard',
+ '@ionic-enterprise/splashscreen',
+ 'cordova-support-google-services',
+ ];
+ if (platform === 'ios') {
+ pluginList.push('cordova-plugin-statusbar', '@ionic-enterprise/statusbar', 'SalesforceMobileSDK-CordovaPlugin');
+ }
+ if (platform === 'android') {
+ pluginList.push('cordova-plugin-compat');
+ }
+ return pluginList;
+}
+exports.getIncompatibleCordovaPlugins = getIncompatibleCordovaPlugins;
+function needsStaticPod(plugin, config) {
+ var _a, _b, _c, _d;
+ let pluginList = [
+ 'phonegap-plugin-push',
+ '@batch.com/cordova-plugin',
+ 'onesignal-cordova-plugin',
+ ];
+ if ((_b = (_a = config.app.extConfig) === null || _a === void 0 ? void 0 : _a.cordova) === null || _b === void 0 ? void 0 : _b.staticPlugins) {
+ pluginList = pluginList.concat((_d = (_c = config.app.extConfig) === null || _c === void 0 ? void 0 : _c.cordova) === null || _d === void 0 ? void 0 : _d.staticPlugins);
+ }
+ return pluginList.includes(plugin.id) || useFrameworks(plugin);
+}
+exports.needsStaticPod = needsStaticPod;
+function useFrameworks(plugin) {
+ const podspecs = plugin_1.getPlatformElement(plugin, 'ios', 'podspec');
+ const frameworkPods = podspecs.filter((podspec) => podspec.pods.filter((pods) => pods.$ && pods.$['use-frameworks'] === 'true').length > 0);
+ return frameworkPods.length > 0;
+}
+async function getCordovaPreferences(config) {
+ var _a, _b, _c, _d, _e;
+ const configXml = path_1.join(config.app.rootDir, 'config.xml');
+ let cordova = {};
+ if (await utils_fs_1.pathExists(configXml)) {
+ cordova.preferences = {};
+ const xmlMeta = await xml_1.readXML(configXml);
+ if (xmlMeta.widget.preference) {
+ xmlMeta.widget.preference.map((pref) => {
+ cordova.preferences[pref.$.name] = pref.$.value;
+ });
+ }
+ }
+ if (cordova.preferences && Object.keys(cordova.preferences).length > 0) {
+ if (term_1.isInteractive()) {
+ const answers = await log_1.logPrompt(`${colors_1.default.strong(`Cordova preferences can be automatically ported to ${colors_1.default.strong(config.app.extConfigName)}.`)}\n` +
+ `Keep in mind: Not all values can be automatically migrated from ${colors_1.default.strong('config.xml')}. There may be more work to do.\n` +
+ `More info: ${colors_1.default.strong('https://capacitorjs.com/docs/cordova/migrating-from-cordova-to-capacitor')}`, {
+ type: 'confirm',
+ name: 'confirm',
+ message: `Migrate Cordova preferences from config.xml?`,
+ initial: true,
+ });
+ if (answers.confirm) {
+ if ((_b = (_a = config.app.extConfig) === null || _a === void 0 ? void 0 : _a.cordova) === null || _b === void 0 ? void 0 : _b.preferences) {
+ const answers = await prompts_1.default([
+ {
+ type: 'confirm',
+ name: 'confirm',
+ message: `${config.app.extConfigName} already contains Cordova preferences. Overwrite?`,
+ },
+ ], { onCancel: () => process.exit(1) });
+ if (!answers.confirm) {
+ cordova = (_c = config.app.extConfig) === null || _c === void 0 ? void 0 : _c.cordova;
+ }
+ }
+ }
+ else {
+ cordova = (_d = config.app.extConfig) === null || _d === void 0 ? void 0 : _d.cordova;
+ }
+ }
+ }
+ else {
+ cordova = (_e = config.app.extConfig) === null || _e === void 0 ? void 0 : _e.cordova;
+ }
+ return cordova;
+}
+exports.getCordovaPreferences = getCordovaPreferences;
+async function writeCordovaAndroidManifest(cordovaPlugins, config, platform) {
+ var _a;
+ const manifestPath = path_1.join(config.android.cordovaPluginsDirAbs, 'src', 'main', 'AndroidManifest.xml');
+ const rootXMLEntries = [];
+ const applicationXMLEntries = [];
+ const applicationXMLAttributes = [];
+ let prefsArray = [];
+ cordovaPlugins.map(async (p) => {
+ const editConfig = plugin_1.getPlatformElement(p, platform, 'edit-config');
+ const configFile = plugin_1.getPlatformElement(p, platform, 'config-file');
+ prefsArray = prefsArray.concat(plugin_1.getAllElements(p, platform, 'preference'));
+ editConfig.concat(configFile).map(async (configElement) => {
+ var _a, _b;
+ if (configElement.$ &&
+ (((_a = configElement.$.target) === null || _a === void 0 ? void 0 : _a.includes('AndroidManifest.xml')) || ((_b = configElement.$.file) === null || _b === void 0 ? void 0 : _b.includes('AndroidManifest.xml')))) {
+ const keys = Object.keys(configElement).filter(k => k !== '$');
+ keys.map(k => {
+ configElement[k].map((e) => {
+ const xmlElement = xml_1.buildXmlElement(e, k);
+ const pathParts = getPathParts(configElement.$.parent || configElement.$.target);
+ if (pathParts.length > 1) {
+ if (pathParts.pop() === 'application') {
+ if (configElement.$.mode &&
+ configElement.$.mode === 'merge' &&
+ xmlElement.startsWith(' {
+ applicationXMLAttributes.push(`${ek}="${e.$[ek]}"`);
+ });
+ }
+ else if (!applicationXMLEntries.includes(xmlElement) &&
+ !contains(applicationXMLEntries, xmlElement, k)) {
+ applicationXMLEntries.push(xmlElement);
+ }
+ }
+ else {
+ log_1.logger.warn(`Configuration required for ${colors_1.default.strong(p.id)}.\n` +
+ `Add the following to AndroidManifest.xml:\n` +
+ xmlElement);
+ }
+ }
+ else {
+ if (!rootXMLEntries.includes(xmlElement) &&
+ !contains(rootXMLEntries, xmlElement, k)) {
+ rootXMLEntries.push(xmlElement);
+ }
+ }
+ });
+ });
+ }
+ });
+ });
+ const cleartextString = 'android:usesCleartextTraffic="true"';
+ const cleartext = ((_a = config.app.extConfig.server) === null || _a === void 0 ? void 0 : _a.cleartext) &&
+ !applicationXMLAttributes.includes(cleartextString)
+ ? cleartextString
+ : '';
+ let content = `
+
+
+${applicationXMLEntries.join('\n')}
+
+${rootXMLEntries.join('\n')}
+`;
+ content = content.replace(new RegExp('$PACKAGE_NAME'.replace('$', '\\$&'), 'g'), '${applicationId}');
+ for (const preference of prefsArray) {
+ content = content.replace(new RegExp(('$' + preference.$.name).replace('$', '\\$&'), 'g'), preference.$.default);
+ }
+ if (await utils_fs_1.pathExists(manifestPath)) {
+ await utils_fs_1.writeFile(manifestPath, content);
+ }
+}
+exports.writeCordovaAndroidManifest = writeCordovaAndroidManifest;
+function getPathParts(path) {
+ const rootPath = 'manifest';
+ path = path.replace('/*', rootPath);
+ const parts = path.split('/').filter(part => part !== '');
+ if (parts.length > 1 || parts.includes(rootPath)) {
+ return parts;
+ }
+ return [rootPath, path];
+}
+function contains(entries, obj, k) {
+ const element = xml_1.parseXML(obj);
+ for (const entry of entries) {
+ const current = xml_1.parseXML(entry);
+ if (element &&
+ current &&
+ current[k] &&
+ element[k] &&
+ current[k].$ &&
+ element[k].$ &&
+ element[k].$['android:name'] === current[k].$['android:name']) {
+ return true;
+ }
+ }
+ return false;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/declarations.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/declarations.d.ts
new file mode 100644
index 00000000..f55e4e48
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/declarations.d.ts
@@ -0,0 +1,458 @@
+export interface CapacitorConfig {
+ /**
+ * The unique identifier of your packaged app.
+ *
+ * This is also known as the Bundle ID in iOS and the Application ID in
+ * Android. It must be in reverse domain name notation, generally
+ * representing a domain name that you or your company owns.
+ *
+ * @since 1.0.0
+ */
+ appId?: string;
+ /**
+ * The human-friendly name of your app.
+ *
+ * This should be what you'd see in the App Store, but can be changed after
+ * within each native platform after it is generated.
+ *
+ * @since 1.0.0
+ */
+ appName?: string;
+ /**
+ * The directory of your compiled web assets.
+ *
+ * This directory should contain the final `index.html` of your app.
+ *
+ * @since 1.0.0
+ */
+ webDir?: string;
+ /**
+ * Whether to copy the Capacitor runtime bundle or not.
+ *
+ * If your app is not using a bundler, set this to `true`, then Capacitor
+ * will create a `capacitor.js` file that you'll need to add as a script in
+ * your `index.html` file.
+ *
+ * @since 1.0.0
+ * @default false
+ */
+ bundledWebRuntime?: boolean;
+ /**
+ * Hide or show the native logs for iOS and Android.
+ *
+ * @since 2.1.0
+ * @deprecated 3.0.0
+ * @default false
+ */
+ hideLogs?: boolean;
+ /**
+ * The build configuration (as defined by the native app) under which Capacitor
+ * will send statements to the log system. This applies to log statements in
+ * native code as well as statements redirected from JavaScript (`console.debug`,
+ * `console.error`, etc.). Enabling logging will let statements render in the
+ * Xcode and Android Studio windows but can leak information on device if enabled
+ * in released builds.
+ *
+ * 'none' = logs are never produced
+ * 'debug' = logs are produced in debug builds but not production builds
+ * 'production' = logs are always produced
+ *
+ * @since 3.0.0
+ * @default debug
+ */
+ loggingBehavior?: 'none' | 'debug' | 'production';
+ /**
+ * User agent of Capacitor Web View.
+ *
+ * @since 1.4.0
+ */
+ overrideUserAgent?: string;
+ /**
+ * String to append to the original user agent of Capacitor Web View.
+ *
+ * This is disregarded if `overrideUserAgent` is used.
+ *
+ * @since 1.4.0
+ */
+ appendUserAgent?: string;
+ /**
+ * Background color of the Capacitor Web View.
+ *
+ * @since 1.1.0
+ */
+ backgroundColor?: string;
+ android?: {
+ /**
+ * Specify a custom path to the native Android project.
+ *
+ * @since 3.0.0
+ * @default android
+ */
+ path?: string;
+ /**
+ * User agent of Capacitor Web View on Android.
+ *
+ * Overrides global `overrideUserAgent` option.
+ *
+ * @since 1.4.0
+ */
+ overrideUserAgent?: string;
+ /**
+ * String to append to the original user agent of Capacitor Web View for Android.
+ *
+ * Overrides global `appendUserAgent` option.
+ *
+ * This is disregarded if `overrideUserAgent` is used.
+ *
+ * @since 1.4.0
+ */
+ appendUserAgent?: string;
+ /**
+ * Background color of the Capacitor Web View for Android.
+ *
+ * Overrides global `backgroundColor` option.
+ *
+ * @since 1.1.0
+ */
+ backgroundColor?: string;
+ /**
+ * Enable mixed content in the Capacitor Web View for Android.
+ *
+ * [Mixed
+ * content](https://developer.mozilla.org/en-US/docs/Web/Security/Mixed_content)
+ * is disabled by default for security. During development, you may need to
+ * enable it to allow the Web View to load files from different schemes.
+ *
+ * **This is not intended for use in production.**
+ *
+ * @since 1.0.0
+ * @default false
+ */
+ allowMixedContent?: boolean;
+ /**
+ * This enables a simpler keyboard which may have some limitations.
+ *
+ * This will capture JS keys using an alternative
+ * [`InputConnection`](https://developer.android.com/reference/android/view/inputmethod/InputConnection).
+ *
+ * @since 1.0.0
+ * @default false
+ */
+ captureInput?: boolean;
+ /**
+ * Always enable debuggable web content.
+ *
+ * This is automatically enabled during development.
+ *
+ * @since 1.0.0
+ * @default false
+ */
+ webContentsDebuggingEnabled?: boolean;
+ /**
+ * Hide or show the native logs for Android.
+ *
+ * Overrides global `hideLogs` option.
+ *
+ * @since 2.1.0
+ * @deprecated 3.0.0
+ * @default false
+ */
+ hideLogs?: boolean;
+ /**
+ * The build configuration under which Capacitor will generate logs on Android.
+ *
+ * Overrides global `loggingBehavior` option.
+ *
+ * @since 3.0.0
+ * @default debug
+ */
+ loggingBehavior?: 'none' | 'debug' | 'production';
+ /**
+ * Allowlist of plugins to include during `npx cap sync` for Android.
+ *
+ * Overrides global `includePlugins` option.
+ *
+ * @since 3.0.0
+ */
+ includePlugins?: string[];
+ /**
+ * Android flavor to use.
+ *
+ * If the app has flavors declared in the `build.gradle`
+ * configure the flavor you want to run with `npx cap run` command.
+ *
+ * @since 3.1.0
+ */
+ flavor?: string;
+ };
+ ios?: {
+ /**
+ * Specify a custom path to the native iOS project.
+ *
+ * @since 3.0.0
+ * @default ios
+ */
+ path?: string;
+ /**
+ * iOS build scheme to use.
+ *
+ * Usually this matches your app's target in Xcode. You can use the
+ * following command to list schemes:
+ *
+ * ```shell
+ * xcodebuild -workspace ios/App/App.xcworkspace -list
+ * ```
+ *
+ * @since 3.0.0
+ * @default App
+ */
+ scheme?: string;
+ /**
+ * User agent of Capacitor Web View on iOS.
+ *
+ * Overrides global `overrideUserAgent` option.
+ *
+ * @since 1.4.0
+ */
+ overrideUserAgent?: string;
+ /**
+ * String to append to the original user agent of Capacitor Web View for iOS.
+ *
+ * Overrides global `appendUserAgent` option.
+ *
+ * This is disregarded if `overrideUserAgent` is used.
+ *
+ * @since 1.4.0
+ */
+ appendUserAgent?: string;
+ /**
+ * Background color of the Capacitor Web View for iOS.
+ *
+ * Overrides global `backgroundColor` option.
+ *
+ * @since 1.1.0
+ */
+ backgroundColor?: string;
+ /**
+ * Configure the scroll view's content inset adjustment behavior.
+ *
+ * This will set the
+ * [`contentInsetAdjustmentBehavior`](https://developer.apple.com/documentation/uikit/uiscrollview/2902261-contentinsetadjustmentbehavior)
+ * property on the Web View's
+ * [`UIScrollView`](https://developer.apple.com/documentation/uikit/uiscrollview).
+ *
+ * @since 2.0.0
+ * @default never
+ */
+ contentInset?: 'automatic' | 'scrollableAxes' | 'never' | 'always';
+ /**
+ * Configure whether the scroll view is scrollable.
+ *
+ * This will set the
+ * [`isScrollEnabled`](https://developer.apple.com/documentation/uikit/uiscrollview/1619395-isscrollenabled)
+ * property on the Web View's
+ * [`UIScrollView`](https://developer.apple.com/documentation/uikit/uiscrollview).
+ *
+ * @since 1.0.0
+ */
+ scrollEnabled?: boolean;
+ /**
+ * Configure custom linker flags for compiling Cordova plugins.
+ *
+ * @since 1.0.0
+ * @default []
+ */
+ cordovaLinkerFlags?: string[];
+ /**
+ * Allow destination previews when pressing on links.
+ *
+ * This will set the
+ * [`allowsLinkPreview`](https://developer.apple.com/documentation/webkit/wkwebview/1415000-allowslinkpreview)
+ * property on the Web View, instead of using the default value.
+ *
+ * @since 2.0.0
+ */
+ allowsLinkPreview?: boolean;
+ /**
+ * Hide or show the native logs for iOS.
+ *
+ * Overrides global `hideLogs` option.
+ *
+ * @since 1.1.0
+ * @deprecated 3.0.0
+ * @default false
+ */
+ hideLogs?: boolean;
+ /**
+ * The build configuration under which Capacitor will generate logs on iOS.
+ *
+ * Overrides global `loggingBehavior` option.
+ *
+ * @since 3.0.0
+ * @default debug
+ */
+ loggingBehavior?: 'none' | 'debug' | 'production';
+ /**
+ * Allowlist of plugins to include during `npx cap sync` for iOS.
+ *
+ * Overrides global `includePlugins` option.
+ *
+ * @since 3.0.0
+ */
+ includePlugins?: string[];
+ /**
+ * Sets WKWebView configuration for limitsNavigationsToAppBoundDomains.
+ *
+ * If the Info.plist file includes `WKAppBoundDomains` key, it's recommended to
+ * set this option to true, otherwise some features won't work.
+ * But as side effect, it blocks navigation outside the domains in the
+ * `WKAppBoundDomains` list.
+ * `localhost` (or the value configured as `server.hostname`) also needs to be
+ * added to the `WKAppBoundDomains` list.
+ *
+ * @since 3.1.0
+ * @default false
+ */
+ limitsNavigationsToAppBoundDomains?: boolean;
+ };
+ server?: {
+ /**
+ * Configure the local hostname of the device.
+ *
+ * It is recommended to keep this as `localhost` as it allows the use of
+ * Web APIs that would otherwise require a [secure
+ * context](https://developer.mozilla.org/en-US/docs/Web/Security/Secure_Contexts)
+ * such as
+ * [`navigator.geolocation`](https://developer.mozilla.org/en-US/docs/Web/API/Navigator/geolocation)
+ * and
+ * [`MediaDevices.getUserMedia`](https://developer.mozilla.org/en-US/docs/Web/API/MediaDevices/getUserMedia).
+ *
+ * @since 1.0.0
+ * @default localhost
+ */
+ hostname?: string;
+ /**
+ * Configure the local scheme on iOS.
+ *
+ * This can be useful when migrating from
+ * [`cordova-plugin-ionic-webview`](https://github.com/ionic-team/cordova-plugin-ionic-webview),
+ * where the default scheme on iOS is `ionic`.
+ *
+ * @since 1.2.0
+ * @default capacitor
+ */
+ iosScheme?: string;
+ /**
+ * Configure the local scheme on Android.
+ *
+ * @since 1.2.0
+ * @default http
+ */
+ androidScheme?: string;
+ /**
+ * Load an external URL in the Web View.
+ *
+ * This is intended for use with live-reload servers.
+ *
+ * **This is not intended for use in production.**
+ *
+ * @since 1.0.0
+ */
+ url?: string;
+ /**
+ * Allow cleartext traffic in the Web View.
+ *
+ * On Android, all cleartext traffic is disabled by default as of API 28.
+ *
+ * This is intended for use with live-reload servers where unencrypted HTTP
+ * traffic is often used.
+ *
+ * **This is not intended for use in production.**
+ *
+ * @since 1.5.0
+ * @default false
+ */
+ cleartext?: boolean;
+ /**
+ * Set additional URLs the Web View can navigate to.
+ *
+ * By default, all external URLs are opened in the external browser (not
+ * the Web View).
+ *
+ * **This is not intended for use in production.**
+ *
+ * @since 1.0.0
+ * @default []
+ */
+ allowNavigation?: string[];
+ };
+ cordova?: {
+ /**
+ * Populates tags in the config.xml with the origin set to
+ * the values entered here.
+ * If not provided, a single tag gets included.
+ * It only has effect on a few Cordova plugins that respect the whitelist.
+ *
+ * @since 3.3.0
+ */
+ accessOrigins?: string[];
+ /**
+ * Configure Cordova preferences.
+ *
+ * @since 1.3.0
+ */
+ preferences?: {
+ [key: string]: string | undefined;
+ };
+ /**
+ * List of Cordova plugins that need to be static but are not
+ * already in the static plugin list.
+ *
+ * @since 3.3.0
+ */
+ staticPlugins?: string[];
+ };
+ /**
+ * Configure plugins.
+ *
+ * This is an object with configuration values specified by plugin class
+ * name.
+ *
+ * @since 1.0.0
+ */
+ plugins?: PluginsConfig;
+ /**
+ * Allowlist of plugins to include during `npx cap sync`.
+ *
+ * This should be an array of strings representing the npm package name of
+ * plugins to include when running `npx cap sync`. If unset, Capacitor will
+ * inspect `package.json` for a list of potential plugins.
+ *
+ * @since 3.0.0
+ */
+ includePlugins?: string[];
+}
+export interface Portal {
+ name: string;
+ webDir: string;
+ appId?: string;
+}
+export interface PluginsConfig {
+ /**
+ * Plugin configuration by class name.
+ *
+ * @since 1.0.0
+ */
+ [key: string]: {
+ [key: string]: any;
+ } | undefined;
+ /**
+ * Capacitor Portals plugin configuration
+ *
+ * @since 3.5.0
+ */
+ Portals?: {
+ shell: Portal;
+ apps: Portal[];
+ };
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/declarations.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/declarations.js
new file mode 100644
index 00000000..c8ad2e54
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/declarations.js
@@ -0,0 +1,2 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/definitions.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/definitions.js
new file mode 100644
index 00000000..c8ad2e54
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/definitions.js
@@ -0,0 +1,2 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/errors.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/errors.js
new file mode 100644
index 00000000..061c9a91
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/errors.js
@@ -0,0 +1,27 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.isFatal = exports.fatal = exports.FatalException = exports.BaseException = void 0;
+class BaseException extends Error {
+ constructor(message, code) {
+ super(message);
+ this.message = message;
+ this.code = code;
+ }
+}
+exports.BaseException = BaseException;
+class FatalException extends BaseException {
+ constructor(message, exitCode = 1) {
+ super(message, 'FATAL');
+ this.message = message;
+ this.exitCode = exitCode;
+ }
+}
+exports.FatalException = FatalException;
+function fatal(message) {
+ throw new FatalException(message);
+}
+exports.fatal = fatal;
+function isFatal(e) {
+ return e && e instanceof FatalException;
+}
+exports.isFatal = isFatal;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/framework-configs.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/framework-configs.js
new file mode 100644
index 00000000..bd80db9d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/framework-configs.js
@@ -0,0 +1,103 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.detectFramework = void 0;
+const FRAMEWORK_CONFIGS = [
+ {
+ name: 'Angular',
+ isMatch: config => hasDependency(config, '@angular/cli'),
+ webDir: 'dist',
+ priority: 3,
+ },
+ {
+ name: 'Create React App',
+ isMatch: config => hasDependency(config, 'react-scripts'),
+ webDir: 'build',
+ priority: 3,
+ },
+ {
+ name: 'Ember',
+ isMatch: config => hasDependency(config, 'ember-cli'),
+ webDir: 'dist',
+ priority: 3,
+ },
+ {
+ name: 'Gatsby',
+ isMatch: config => hasDependency(config, 'gatsby'),
+ webDir: 'public',
+ priority: 2,
+ },
+ {
+ name: 'Ionic Angular',
+ isMatch: config => hasDependency(config, '@ionic/angular'),
+ webDir: 'www',
+ priority: 1,
+ },
+ {
+ name: 'Ionic React',
+ isMatch: config => hasDependency(config, '@ionic/react'),
+ webDir: 'build',
+ priority: 1,
+ },
+ {
+ name: 'Ionic Vue',
+ isMatch: config => hasDependency(config, '@ionic/vue'),
+ webDir: 'public',
+ priority: 1,
+ },
+ {
+ name: 'Next',
+ isMatch: config => hasDependency(config, 'next'),
+ webDir: 'public',
+ priority: 2,
+ },
+ {
+ name: 'Preact',
+ isMatch: config => hasDependency(config, 'preact-cli'),
+ webDir: 'build',
+ priority: 3,
+ },
+ {
+ name: 'Stencil',
+ isMatch: config => hasDependency(config, '@stencil/core'),
+ webDir: 'www',
+ priority: 3,
+ },
+ {
+ name: 'Svelte',
+ isMatch: config => hasDependency(config, 'svelte') && hasDependency(config, 'sirv-cli'),
+ webDir: 'public',
+ priority: 3,
+ },
+ {
+ name: 'Vue',
+ isMatch: config => hasDependency(config, '@vue/cli-service'),
+ webDir: 'dist',
+ priority: 3,
+ },
+];
+function detectFramework(config) {
+ const frameworks = FRAMEWORK_CONFIGS.filter(f => f.isMatch(config)).sort((a, b) => {
+ if (a.priority < b.priority)
+ return -1;
+ if (a.priority > b.priority)
+ return 1;
+ return 0;
+ });
+ return frameworks[0];
+}
+exports.detectFramework = detectFramework;
+function hasDependency(config, depName) {
+ const deps = getDependencies(config);
+ return deps.includes(depName);
+}
+function getDependencies(config) {
+ var _a, _b, _c, _d;
+ const deps = [];
+ if ((_b = (_a = config === null || config === void 0 ? void 0 : config.app) === null || _a === void 0 ? void 0 : _a.package) === null || _b === void 0 ? void 0 : _b.dependencies) {
+ deps.push(...Object.keys(config.app.package.dependencies));
+ }
+ if ((_d = (_c = config === null || config === void 0 ? void 0 : config.app) === null || _c === void 0 ? void 0 : _c.package) === null || _d === void 0 ? void 0 : _d.devDependencies) {
+ deps.push(...Object.keys(config.app.package.devDependencies));
+ }
+ return deps;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/index.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/index.js
new file mode 100644
index 00000000..469caabf
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/index.js
@@ -0,0 +1,161 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.runProgram = exports.run = void 0;
+const tslib_1 = require("tslib");
+const commander_1 = tslib_1.__importDefault(require("commander"));
+const colors_1 = tslib_1.__importDefault(require("./colors"));
+const config_1 = require("./config");
+const errors_1 = require("./errors");
+const ipc_1 = require("./ipc");
+const log_1 = require("./log");
+const telemetry_1 = require("./telemetry");
+const cli_1 = require("./util/cli");
+const emoji_1 = require("./util/emoji");
+process.on('unhandledRejection', error => {
+ console.error(colors_1.default.failure('[fatal]'), error);
+});
+process.on('message', ipc_1.receive);
+async function run() {
+ try {
+ const config = await config_1.loadConfig();
+ runProgram(config);
+ }
+ catch (e) {
+ process.exitCode = errors_1.isFatal(e) ? e.exitCode : 1;
+ log_1.logger.error(e.message ? e.message : String(e));
+ }
+}
+exports.run = run;
+function runProgram(config) {
+ commander_1.default.version(config.cli.package.version);
+ commander_1.default
+ .command('config', { hidden: true })
+ .description(`print evaluated Capacitor config`)
+ .option('--json', 'Print in JSON format')
+ .action(cli_1.wrapAction(async ({ json }) => {
+ const { configCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/config')));
+ await configCommand(config, json);
+ }));
+ commander_1.default
+ .command('create [directory] [name] [id]', { hidden: true })
+ .description('Creates a new Capacitor project')
+ .action(cli_1.wrapAction(async () => {
+ const { createCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/create')));
+ await createCommand();
+ }));
+ commander_1.default
+ .command('init [appName] [appId]')
+ .description(`Initialize Capacitor configuration`)
+ .option('--web-dir ', 'Optional: Directory of your projects built web assets')
+ .action(cli_1.wrapAction(telemetry_1.telemetryAction(config, async (appName, appId, { webDir }) => {
+ const { initCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/init')));
+ await initCommand(config, appName, appId, webDir);
+ })));
+ commander_1.default
+ .command('serve', { hidden: true })
+ .description('Serves a Capacitor Progressive Web App in the browser')
+ .action(cli_1.wrapAction(async () => {
+ const { serveCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/serve')));
+ await serveCommand();
+ }));
+ commander_1.default
+ .command('sync [platform]')
+ .description(`${colors_1.default.input('copy')} + ${colors_1.default.input('update')}`)
+ .option('--deployment', "Optional: if provided, Podfile.lock won't be deleted and pod install will use --deployment option")
+ .action(cli_1.wrapAction(telemetry_1.telemetryAction(config, async (platform, { deployment }) => {
+ config_1.checkExternalConfig(config.app);
+ const { syncCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/sync')));
+ await syncCommand(config, platform, deployment);
+ })));
+ commander_1.default
+ .command('update [platform]')
+ .description(`updates the native plugins and dependencies based on ${colors_1.default.strong('package.json')}`)
+ .option('--deployment', "Optional: if provided, Podfile.lock won't be deleted and pod install will use --deployment option")
+ .action(cli_1.wrapAction(telemetry_1.telemetryAction(config, async (platform, { deployment }) => {
+ config_1.checkExternalConfig(config.app);
+ const { updateCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/update')));
+ await updateCommand(config, platform, deployment);
+ })));
+ commander_1.default
+ .command('copy [platform]')
+ .description('copies the web app build into the native app')
+ .action(cli_1.wrapAction(telemetry_1.telemetryAction(config, async (platform) => {
+ config_1.checkExternalConfig(config.app);
+ const { copyCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/copy')));
+ await copyCommand(config, platform);
+ })));
+ commander_1.default
+ .command(`run [platform]`)
+ .description(`runs ${colors_1.default.input('sync')}, then builds and deploys the native app`)
+ .option('--list', 'list targets, then quit')
+ // TODO: remove once --json is a hidden option (https://github.com/tj/commander.js/issues/1106)
+ .allowUnknownOption(true)
+ .option('--target ', 'use a specific target')
+ .option('--no-sync', `do not run ${colors_1.default.input('sync')}`)
+ .action(cli_1.wrapAction(telemetry_1.telemetryAction(config, async (platform, { list, target, sync }) => {
+ const { runCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/run')));
+ await runCommand(config, platform, { list, target, sync });
+ })));
+ commander_1.default
+ .command('open [platform]')
+ .description('opens the native project workspace (Xcode for iOS)')
+ .action(cli_1.wrapAction(telemetry_1.telemetryAction(config, async (platform) => {
+ const { openCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/open')));
+ await openCommand(config, platform);
+ })));
+ commander_1.default
+ .command('add [platform]')
+ .description('add a native platform project')
+ .action(cli_1.wrapAction(telemetry_1.telemetryAction(config, async (platform) => {
+ config_1.checkExternalConfig(config.app);
+ const { addCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/add')));
+ await addCommand(config, platform);
+ })));
+ commander_1.default
+ .command('ls [platform]')
+ .description('list installed Cordova and Capacitor plugins')
+ .action(cli_1.wrapAction(telemetry_1.telemetryAction(config, async (platform) => {
+ config_1.checkExternalConfig(config.app);
+ const { listCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/list')));
+ await listCommand(config, platform);
+ })));
+ commander_1.default
+ .command('doctor [platform]')
+ .description('checks the current setup for common errors')
+ .action(cli_1.wrapAction(telemetry_1.telemetryAction(config, async (platform) => {
+ config_1.checkExternalConfig(config.app);
+ const { doctorCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/doctor')));
+ await doctorCommand(config, platform);
+ })));
+ commander_1.default
+ .command('telemetry [on|off]', { hidden: true })
+ .description('enable or disable telemetry')
+ .action(cli_1.wrapAction(async (onOrOff) => {
+ const { telemetryCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/telemetry')));
+ await telemetryCommand(onOrOff);
+ }));
+ commander_1.default
+ .command('📡', { hidden: true })
+ .description('IPC receiver command')
+ .action(() => {
+ // no-op: IPC messages are received via `process.on('message')`
+ });
+ commander_1.default
+ .command('plugin:generate', { hidden: true })
+ .description('start a new Capacitor plugin')
+ .action(cli_1.wrapAction(async () => {
+ const { newPluginCommand } = await Promise.resolve().then(() => tslib_1.__importStar(require('./tasks/new-plugin')));
+ await newPluginCommand();
+ }));
+ commander_1.default.arguments('[command]').action(cli_1.wrapAction(async (cmd) => {
+ if (typeof cmd === 'undefined') {
+ log_1.output.write(`\n ${emoji_1.emoji('⚡️', '--')} ${colors_1.default.strong('Capacitor - Cross-Platform apps with JavaScript and the Web')} ${emoji_1.emoji('⚡️', '--')}\n\n`);
+ commander_1.default.outputHelp();
+ }
+ else {
+ errors_1.fatal(`Unknown command: ${colors_1.default.input(cmd)}`);
+ }
+ }));
+ commander_1.default.parse(process.argv);
+}
+exports.runProgram = runProgram;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/add.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/add.js
new file mode 100644
index 00000000..4eb05577
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/add.js
@@ -0,0 +1,13 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.addIOS = void 0;
+const tslib_1 = require("tslib");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const template_1 = require("../util/template");
+async function addIOS(config) {
+ await common_1.runTask(`Adding native Xcode project in ${colors_1.default.strong(config.ios.platformDir)}`, () => {
+ return template_1.extractTemplate(config.cli.assets.ios.platformTemplateArchiveAbs, config.ios.platformDirAbs);
+ });
+}
+exports.addIOS = addIOS;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/common.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/common.js
new file mode 100644
index 00000000..15c48b95
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/common.js
@@ -0,0 +1,74 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.editProjectSettingsIOS = exports.resolvePlugin = exports.getIOSPlugins = exports.checkCocoaPods = exports.checkIOSPackage = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const cordova_1 = require("../cordova");
+const plugin_1 = require("../plugin");
+const subprocess_1 = require("../util/subprocess");
+async function checkIOSPackage(config) {
+ return common_1.checkCapacitorPlatform(config, 'ios');
+}
+exports.checkIOSPackage = checkIOSPackage;
+async function checkCocoaPods(config) {
+ if (!(await subprocess_1.isInstalled(config.ios.podPath)) && config.cli.os === "mac" /* Mac */) {
+ return (`CocoaPods is not installed.\n` +
+ `See this install guide: ${colors_1.default.strong('https://guides.cocoapods.org/using/getting-started.html#installation')}`);
+ }
+ return null;
+}
+exports.checkCocoaPods = checkCocoaPods;
+async function getIOSPlugins(allPlugins) {
+ const resolved = await Promise.all(allPlugins.map(async (plugin) => await resolvePlugin(plugin)));
+ return resolved.filter((plugin) => !!plugin);
+}
+exports.getIOSPlugins = getIOSPlugins;
+async function resolvePlugin(plugin) {
+ var _a, _b;
+ const platform = 'ios';
+ if ((_a = plugin.manifest) === null || _a === void 0 ? void 0 : _a.ios) {
+ plugin.ios = {
+ name: plugin.name,
+ type: 0 /* Core */,
+ path: (_b = plugin.manifest.ios.src) !== null && _b !== void 0 ? _b : platform,
+ };
+ }
+ else if (plugin.xml) {
+ plugin.ios = {
+ name: plugin.name,
+ type: 1 /* Cordova */,
+ path: 'src/' + platform,
+ };
+ if (cordova_1.getIncompatibleCordovaPlugins(platform).includes(plugin.id) ||
+ !plugin_1.getPluginPlatform(plugin, platform)) {
+ plugin.ios.type = 2 /* Incompatible */;
+ }
+ }
+ else {
+ return null;
+ }
+ return plugin;
+}
+exports.resolvePlugin = resolvePlugin;
+/**
+ * Update the native project files with the desired app id and app name
+ */
+async function editProjectSettingsIOS(config) {
+ const appId = config.app.appId;
+ const appName = config.app.appName
+ .replace(/&/g, '&')
+ .replace(//g, '>');
+ const pbxPath = `${config.ios.nativeXcodeProjDirAbs}/project.pbxproj`;
+ const plistPath = path_1.resolve(config.ios.nativeTargetDirAbs, 'Info.plist');
+ let plistContent = await utils_fs_1.readFile(plistPath, { encoding: 'utf-8' });
+ plistContent = plistContent.replace(/CFBundleDisplayName<\/key>[\s\S]?\s+([^<]*)<\/string>/, `CFBundleDisplayName\n ${appName}`);
+ let pbxContent = await utils_fs_1.readFile(pbxPath, { encoding: 'utf-8' });
+ pbxContent = pbxContent.replace(/PRODUCT_BUNDLE_IDENTIFIER = ([^;]+)/g, `PRODUCT_BUNDLE_IDENTIFIER = ${appId}`);
+ await utils_fs_1.writeFile(plistPath, plistContent, { encoding: 'utf-8' });
+ await utils_fs_1.writeFile(pbxPath, pbxContent, { encoding: 'utf-8' });
+}
+exports.editProjectSettingsIOS = editProjectSettingsIOS;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/doctor.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/doctor.js
new file mode 100644
index 00000000..d989eb39
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/doctor.js
@@ -0,0 +1,49 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.doctorIOS = void 0;
+const common_1 = require("../common");
+const errors_1 = require("../errors");
+const log_1 = require("../log");
+const subprocess_1 = require("../util/subprocess");
+const common_2 = require("./common");
+async function doctorIOS(config) {
+ var _a;
+ // DOCTOR ideas for iOS:
+ // plugin specific warnings
+ // check cocoapods installed
+ // check projects exist
+ // check content in www === ios/www
+ // check CLI versions
+ // check plugins versions
+ // check native project deps are up-to-date === npm install
+ // check if npm install was updated
+ // check online datebase of common errors
+ // check if www folder is empty (index.html does not exist)
+ try {
+ await common_1.check([
+ () => common_2.checkCocoaPods(config),
+ () => common_1.checkWebDir(config),
+ checkXcode,
+ ]);
+ log_1.logSuccess('iOS looking great! 👌');
+ }
+ catch (e) {
+ errors_1.fatal((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+}
+exports.doctorIOS = doctorIOS;
+async function checkXcode() {
+ if (!(await subprocess_1.isInstalled('xcodebuild'))) {
+ return `Xcode is not installed`;
+ }
+ // const matches = output.match(/^Xcode (.*)/);
+ // if (matches && matches.length === 2) {
+ // const minVersion = '9.0.0';
+ // const semver = await import('semver');
+ // console.log(matches[1]);
+ // if (semver.gt(minVersion, matches[1])) {
+ // return `Xcode version is too old, ${minVersion} is required`;
+ // }
+ // }
+ return null;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/open.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/open.js
new file mode 100644
index 00000000..3d37e8bf
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/open.js
@@ -0,0 +1,11 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.openIOS = void 0;
+const tslib_1 = require("tslib");
+const open_1 = tslib_1.__importDefault(require("open"));
+const common_1 = require("../common");
+async function openIOS(config) {
+ await open_1.default(await config.ios.nativeXcodeWorkspaceDirAbs, { wait: false });
+ await common_1.wait(3000);
+}
+exports.openIOS = openIOS;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/run.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/run.js
new file mode 100644
index 00000000..d584bd00
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/run.js
@@ -0,0 +1,37 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.runIOS = void 0;
+const tslib_1 = require("tslib");
+const debug_1 = tslib_1.__importDefault(require("debug"));
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const native_run_1 = require("../util/native-run");
+const subprocess_1 = require("../util/subprocess");
+const debug = debug_1.default('capacitor:ios:run');
+async function runIOS(config, { target: selectedTarget }) {
+ const target = await common_1.promptForPlatformTarget(await native_run_1.getPlatformTargets('ios'), selectedTarget);
+ const derivedDataPath = path_1.resolve(config.ios.platformDirAbs, 'DerivedData', target.id);
+ const xcodebuildArgs = [
+ '-workspace',
+ path_1.basename(await config.ios.nativeXcodeWorkspaceDirAbs),
+ '-scheme',
+ config.ios.scheme,
+ '-configuration',
+ 'Debug',
+ '-destination',
+ `id=${target.id}`,
+ '-derivedDataPath',
+ derivedDataPath,
+ ];
+ debug('Invoking xcodebuild with args: %O', xcodebuildArgs);
+ await common_1.runTask('Running xcodebuild', async () => subprocess_1.runCommand('xcrun', ['xcodebuild', ...xcodebuildArgs], {
+ cwd: config.ios.nativeProjectDirAbs,
+ }));
+ const appName = `${config.ios.scheme}.app`;
+ const appPath = path_1.resolve(derivedDataPath, 'Build/Products', target.virtual ? 'Debug-iphonesimulator' : 'Debug-iphoneos', appName);
+ const nativeRunArgs = ['ios', '--app', appPath, '--target', target.id];
+ debug('Invoking native-run with args: %O', nativeRunArgs);
+ await common_1.runTask(`Deploying ${colors_1.default.strong(appName)} to ${colors_1.default.input(target.id)}`, async () => native_run_1.runNativeRun(nativeRunArgs));
+}
+exports.runIOS = runIOS;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/update.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/update.js
new file mode 100644
index 00000000..4f5a1f50
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ios/update.js
@@ -0,0 +1,387 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.installCocoaPodsPlugins = exports.updateIOS = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const cordova_1 = require("../cordova");
+const errors_1 = require("../errors");
+const log_1 = require("../log");
+const plugin_1 = require("../plugin");
+const copy_1 = require("../tasks/copy");
+const fs_1 = require("../util/fs");
+const node_1 = require("../util/node");
+const subprocess_1 = require("../util/subprocess");
+const template_1 = require("../util/template");
+const common_2 = require("./common");
+const platform = 'ios';
+async function updateIOS(config, deployment) {
+ const plugins = await getPluginsTask(config);
+ const capacitorPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 0 /* Core */);
+ plugin_1.printPlugins(capacitorPlugins, 'ios');
+ await removePluginsNativeFiles(config);
+ const cordovaPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 1 /* Cordova */);
+ if (cordovaPlugins.length > 0) {
+ await copyPluginsNativeFiles(config, cordovaPlugins);
+ }
+ if (!(await utils_fs_1.pathExists(await config.ios.webDirAbs))) {
+ await copy_1.copy(config, platform);
+ }
+ await cordova_1.handleCordovaPluginsJS(cordovaPlugins, config, platform);
+ await cordova_1.checkPluginDependencies(plugins, platform);
+ await generateCordovaPodspecs(cordovaPlugins, config);
+ await installCocoaPodsPlugins(config, plugins, deployment);
+ await cordova_1.logCordovaManualSteps(cordovaPlugins, config, platform);
+ const incompatibleCordovaPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 2 /* Incompatible */);
+ plugin_1.printPlugins(incompatibleCordovaPlugins, platform, 'incompatible');
+ await common_1.checkPlatformVersions(config, platform);
+}
+exports.updateIOS = updateIOS;
+async function installCocoaPodsPlugins(config, plugins, deployment) {
+ await common_1.runTask(`Updating iOS native dependencies with ${colors_1.default.input(`${config.ios.podPath} install`)}`, () => {
+ return updatePodfile(config, plugins, deployment);
+ });
+}
+exports.installCocoaPodsPlugins = installCocoaPodsPlugins;
+async function updatePodfile(config, plugins, deployment) {
+ const dependenciesContent = await generatePodFile(config, plugins);
+ const podfilePath = path_1.join(config.ios.nativeProjectDirAbs, 'Podfile');
+ const podfileLockPath = path_1.join(config.ios.nativeProjectDirAbs, 'Podfile.lock');
+ let podfileContent = await utils_fs_1.readFile(podfilePath, { encoding: 'utf-8' });
+ podfileContent = podfileContent.replace(/(def capacitor_pods)[\s\S]+?(\nend)/, `$1${dependenciesContent}$2`);
+ await utils_fs_1.writeFile(podfilePath, podfileContent, { encoding: 'utf-8' });
+ const podCommandExists = await subprocess_1.isInstalled('pod');
+ if (podCommandExists) {
+ if (!deployment) {
+ await utils_fs_1.remove(podfileLockPath);
+ }
+ await subprocess_1.runCommand(config.ios.podPath, ['install', ...(deployment ? ['--deployment'] : [])], { cwd: config.ios.nativeProjectDirAbs });
+ }
+ else {
+ log_1.logger.warn('Skipping pod install because CocoaPods is not installed');
+ }
+ const isXcodebuildAvailable = await subprocess_1.isInstalled('xcodebuild');
+ if (isXcodebuildAvailable) {
+ await subprocess_1.runCommand('xcodebuild', ['-project', path_1.basename(`${config.ios.nativeXcodeProjDirAbs}`), 'clean'], {
+ cwd: config.ios.nativeProjectDirAbs,
+ });
+ }
+ else {
+ log_1.logger.warn('Unable to find "xcodebuild". Skipping xcodebuild clean step...');
+ }
+}
+async function generatePodFile(config, plugins) {
+ const capacitoriOSPath = node_1.resolveNode(config.app.rootDir, '@capacitor/ios', 'package.json');
+ if (!capacitoriOSPath) {
+ errors_1.fatal(`Unable to find ${colors_1.default.strong('node_modules/@capacitor/ios')}.\n` +
+ `Are you sure ${colors_1.default.strong('@capacitor/ios')} is installed?`);
+ }
+ const podfilePath = config.ios.nativeProjectDirAbs;
+ const relativeCapacitoriOSPath = fs_1.convertToUnixPath(path_1.relative(podfilePath, await utils_fs_1.realpath(path_1.dirname(capacitoriOSPath))));
+ const capacitorPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 0 /* Core */);
+ const pods = await Promise.all(capacitorPlugins.map(async (p) => {
+ if (!p.ios) {
+ return '';
+ }
+ return ` pod '${p.ios.name}', :path => '${path_1.relative(podfilePath, await utils_fs_1.realpath(p.rootPath))}'\n`;
+ }));
+ const cordovaPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 1 /* Cordova */);
+ cordovaPlugins.map(async (p) => {
+ const podspecs = plugin_1.getPlatformElement(p, platform, 'podspec');
+ podspecs.map((podspec) => {
+ podspec.pods.map((pPods) => {
+ pPods.pod.map((pod) => {
+ if (pod.$.git) {
+ let gitRef = '';
+ if (pod.$.tag) {
+ gitRef = `, :tag => '${pod.$.tag}'`;
+ }
+ else if (pod.$.branch) {
+ gitRef = `, :branch => '${pod.$.branch}'`;
+ }
+ else if (pod.$.commit) {
+ gitRef = `, :commit => '${pod.$.commit}'`;
+ }
+ pods.push(` pod '${pod.$.name}', :git => '${pod.$.git}'${gitRef}\n`);
+ }
+ });
+ });
+ });
+ });
+ const staticPlugins = cordovaPlugins.filter(p => cordova_1.needsStaticPod(p, config));
+ const noStaticPlugins = cordovaPlugins.filter(el => !staticPlugins.includes(el));
+ if (noStaticPlugins.length > 0) {
+ pods.push(` pod 'CordovaPlugins', :path => '../capacitor-cordova-ios-plugins'\n`);
+ }
+ if (staticPlugins.length > 0) {
+ pods.push(` pod 'CordovaPluginsStatic', :path => '../capacitor-cordova-ios-plugins'\n`);
+ }
+ const resourcesPlugins = cordovaPlugins.filter(filterResources);
+ if (resourcesPlugins.length > 0) {
+ pods.push(` pod 'CordovaPluginsResources', :path => '../capacitor-cordova-ios-plugins'\n`);
+ }
+ return `
+ pod 'Capacitor', :path => '${relativeCapacitoriOSPath}'
+ pod 'CapacitorCordova', :path => '${relativeCapacitoriOSPath}'
+${pods.join('').trimRight()}`;
+}
+function getFrameworkName(framework) {
+ if (isFramework(framework)) {
+ if (framework.$.custom && framework.$.custom === 'true') {
+ return framework.$.src;
+ }
+ return framework.$.src.substr(0, framework.$.src.indexOf('.'));
+ }
+ return framework.$.src
+ .substr(0, framework.$.src.indexOf('.'))
+ .replace('lib', '');
+}
+function isFramework(framework) {
+ return framework.$.src.split('.').pop().includes('framework');
+}
+async function generateCordovaPodspecs(cordovaPlugins, config) {
+ const staticPlugins = cordovaPlugins.filter(p => cordova_1.needsStaticPod(p, config));
+ const noStaticPlugins = cordovaPlugins.filter(el => !staticPlugins.includes(el));
+ generateCordovaPodspec(noStaticPlugins, config, false);
+ generateCordovaPodspec(staticPlugins, config, true);
+}
+async function generateCordovaPodspec(cordovaPlugins, config, isStatic) {
+ const weakFrameworks = [];
+ const linkedFrameworks = [];
+ const customFrameworks = [];
+ const systemLibraries = [];
+ const sourceFrameworks = [];
+ const frameworkDeps = [];
+ const compilerFlags = [];
+ let prefsArray = [];
+ let name = 'CordovaPlugins';
+ let sourcesFolderName = 'sources';
+ if (isStatic) {
+ name += 'Static';
+ frameworkDeps.push('s.static_framework = true');
+ sourcesFolderName += 'static';
+ }
+ cordovaPlugins.map((plugin) => {
+ const frameworks = plugin_1.getPlatformElement(plugin, platform, 'framework');
+ frameworks.map((framework) => {
+ if (!framework.$.type) {
+ const name = getFrameworkName(framework);
+ if (isFramework(framework)) {
+ if (framework.$.weak && framework.$.weak === 'true') {
+ if (!weakFrameworks.includes(name)) {
+ weakFrameworks.push(name);
+ }
+ }
+ else if (framework.$.custom && framework.$.custom === 'true') {
+ const frameworktPath = path_1.join(sourcesFolderName, plugin.name, name);
+ if (!customFrameworks.includes(frameworktPath)) {
+ customFrameworks.push(frameworktPath);
+ }
+ }
+ else {
+ if (!linkedFrameworks.includes(name)) {
+ linkedFrameworks.push(name);
+ }
+ }
+ }
+ else {
+ if (!systemLibraries.includes(name)) {
+ systemLibraries.push(name);
+ }
+ }
+ }
+ else if (framework.$.type && framework.$.type === 'podspec') {
+ let depString = `s.dependency '${framework.$.src}'`;
+ if (framework.$.spec && framework.$.spec !== '') {
+ depString += `, '${framework.$.spec}'`;
+ }
+ if (!frameworkDeps.includes(depString)) {
+ frameworkDeps.push(depString);
+ }
+ }
+ });
+ prefsArray = prefsArray.concat(plugin_1.getAllElements(plugin, platform, 'preference'));
+ const podspecs = plugin_1.getPlatformElement(plugin, platform, 'podspec');
+ podspecs.map((podspec) => {
+ podspec.pods.map((pods) => {
+ pods.pod.map((pod) => {
+ let depString = `s.dependency '${pod.$.name}'`;
+ if (pod.$.spec && pod.$.spec !== '') {
+ depString += `, '${pod.$.spec}'`;
+ }
+ if (!frameworkDeps.includes(depString)) {
+ frameworkDeps.push(depString);
+ }
+ });
+ });
+ });
+ const sourceFiles = plugin_1.getPlatformElement(plugin, platform, 'source-file');
+ sourceFiles.map((sourceFile) => {
+ if (sourceFile.$.framework && sourceFile.$.framework === 'true') {
+ let fileName = sourceFile.$.src.split('/').pop();
+ if (!fileName.startsWith('lib')) {
+ fileName = 'lib' + fileName;
+ }
+ const frameworktPath = path_1.join(sourcesFolderName, plugin.name, fileName);
+ if (!sourceFrameworks.includes(frameworktPath)) {
+ sourceFrameworks.push(frameworktPath);
+ }
+ }
+ else if (sourceFile.$['compiler-flags']) {
+ const cFlag = sourceFile.$['compiler-flags'];
+ if (!compilerFlags.includes(cFlag)) {
+ compilerFlags.push(cFlag);
+ }
+ }
+ });
+ });
+ const onlySystemLibraries = systemLibraries.filter(library => removeNoSystem(library, sourceFrameworks));
+ if (weakFrameworks.length > 0) {
+ frameworkDeps.push(`s.weak_frameworks = '${weakFrameworks.join(`', '`)}'`);
+ }
+ if (linkedFrameworks.length > 0) {
+ frameworkDeps.push(`s.frameworks = '${linkedFrameworks.join(`', '`)}'`);
+ }
+ if (onlySystemLibraries.length > 0) {
+ frameworkDeps.push(`s.libraries = '${onlySystemLibraries.join(`', '`)}'`);
+ }
+ if (customFrameworks.length > 0) {
+ frameworkDeps.push(`s.vendored_frameworks = '${customFrameworks.join(`', '`)}'`);
+ frameworkDeps.push(`s.exclude_files = 'sources/**/*.framework/Headers/*.h'`);
+ }
+ if (sourceFrameworks.length > 0) {
+ frameworkDeps.push(`s.vendored_libraries = '${sourceFrameworks.join(`', '`)}'`);
+ }
+ if (compilerFlags.length > 0) {
+ frameworkDeps.push(`s.compiler_flags = '${compilerFlags.join(' ')}'`);
+ }
+ const arcPlugins = cordovaPlugins.filter(filterARCFiles);
+ if (arcPlugins.length > 0) {
+ frameworkDeps.push(`s.subspec 'noarc' do |sna|
+ sna.requires_arc = false
+ sna.source_files = 'noarc/**/*.{swift,h,m,c,cc,mm,cpp}'
+ end`);
+ }
+ let frameworksString = frameworkDeps.join('\n ');
+ frameworksString = await replaceFrameworkVariables(config, prefsArray, frameworksString);
+ const content = `
+ Pod::Spec.new do |s|
+ s.name = '${name}'
+ s.version = '${config.cli.package.version}'
+ s.summary = 'Autogenerated spec'
+ s.license = 'Unknown'
+ s.homepage = 'https://example.com'
+ s.authors = { 'Capacitor Generator' => 'hi@example.com' }
+ s.source = { :git => 'https://github.com/ionic-team/does-not-exist.git', :tag => '${config.cli.package.version}' }
+ s.source_files = '${sourcesFolderName}/**/*.{swift,h,m,c,cc,mm,cpp}'
+ s.ios.deployment_target = '${config.ios.minVersion}'
+ s.xcconfig = {'GCC_PREPROCESSOR_DEFINITIONS' => '$(inherited) COCOAPODS=1 WK_WEB_VIEW_ONLY=1' }
+ s.dependency 'CapacitorCordova'${getLinkerFlags(config)}
+ s.swift_version = '5.1'
+ ${frameworksString}
+ end`;
+ await utils_fs_1.writeFile(path_1.join(config.ios.cordovaPluginsDirAbs, `${name}.podspec`), content);
+}
+function getLinkerFlags(config) {
+ var _a;
+ if ((_a = config.app.extConfig.ios) === null || _a === void 0 ? void 0 : _a.cordovaLinkerFlags) {
+ return `\n s.pod_target_xcconfig = { 'OTHER_LDFLAGS' => '${config.app.extConfig.ios.cordovaLinkerFlags.join(' ')}' }`;
+ }
+ return '';
+}
+async function copyPluginsNativeFiles(config, cordovaPlugins) {
+ for (const p of cordovaPlugins) {
+ const sourceFiles = plugin_1.getPlatformElement(p, platform, 'source-file');
+ const headerFiles = plugin_1.getPlatformElement(p, platform, 'header-file');
+ const codeFiles = sourceFiles.concat(headerFiles);
+ const frameworks = plugin_1.getPlatformElement(p, platform, 'framework');
+ let sourcesFolderName = 'sources';
+ if (cordova_1.needsStaticPod(p, config)) {
+ sourcesFolderName += 'static';
+ }
+ const sourcesFolder = path_1.join(config.ios.cordovaPluginsDirAbs, sourcesFolderName, p.name);
+ for (const codeFile of codeFiles) {
+ let fileName = codeFile.$.src.split('/').pop();
+ const fileExt = codeFile.$.src.split('.').pop();
+ if (fileExt === 'a' && !fileName.startsWith('lib')) {
+ fileName = 'lib' + fileName;
+ }
+ let destFolder = sourcesFolderName;
+ if (codeFile.$['compiler-flags'] &&
+ codeFile.$['compiler-flags'] === '-fno-objc-arc') {
+ destFolder = 'noarc';
+ }
+ const filePath = plugin_1.getFilePath(config, p, codeFile.$.src);
+ const fileDest = path_1.join(config.ios.cordovaPluginsDirAbs, destFolder, p.name, fileName);
+ await utils_fs_1.copy(filePath, fileDest);
+ if (!codeFile.$.framework) {
+ let fileContent = await utils_fs_1.readFile(fileDest, { encoding: 'utf-8' });
+ if (fileExt === 'swift') {
+ fileContent = 'import Cordova\n' + fileContent;
+ await utils_fs_1.writeFile(fileDest, fileContent, { encoding: 'utf-8' });
+ }
+ else {
+ if (fileContent.includes('@import Firebase;')) {
+ fileContent = fileContent.replace('@import Firebase;', '#import ');
+ await utils_fs_1.writeFile(fileDest, fileContent, { encoding: 'utf-8' });
+ }
+ if (fileContent.includes('[NSBundle bundleForClass:[self class]]') ||
+ fileContent.includes('[NSBundle bundleForClass:[CDVCapture class]]')) {
+ fileContent = fileContent.replace('[NSBundle bundleForClass:[self class]]', '[NSBundle mainBundle]');
+ fileContent = fileContent.replace('[NSBundle bundleForClass:[CDVCapture class]]', '[NSBundle mainBundle]');
+ await utils_fs_1.writeFile(fileDest, fileContent, { encoding: 'utf-8' });
+ }
+ if (fileContent.includes('[self.webView superview]') ||
+ fileContent.includes('self.webView.superview')) {
+ fileContent = fileContent.replace(/\[self.webView superview\]/g, 'self.viewController.view');
+ fileContent = fileContent.replace(/self.webView.superview/g, 'self.viewController.view');
+ await utils_fs_1.writeFile(fileDest, fileContent, { encoding: 'utf-8' });
+ }
+ }
+ }
+ }
+ const resourceFiles = plugin_1.getPlatformElement(p, platform, 'resource-file');
+ for (const resourceFile of resourceFiles) {
+ const fileName = resourceFile.$.src.split('/').pop();
+ await utils_fs_1.copy(plugin_1.getFilePath(config, p, resourceFile.$.src), path_1.join(config.ios.cordovaPluginsDirAbs, 'resources', fileName));
+ }
+ for (const framework of frameworks) {
+ if (framework.$.custom && framework.$.custom === 'true') {
+ await utils_fs_1.copy(plugin_1.getFilePath(config, p, framework.$.src), path_1.join(sourcesFolder, framework.$.src));
+ }
+ }
+ }
+}
+async function removePluginsNativeFiles(config) {
+ await utils_fs_1.remove(config.ios.cordovaPluginsDirAbs);
+ await template_1.extractTemplate(config.cli.assets.ios.cordovaPluginsTemplateArchiveAbs, config.ios.cordovaPluginsDirAbs);
+}
+function filterResources(plugin) {
+ const resources = plugin_1.getPlatformElement(plugin, platform, 'resource-file');
+ return resources.length > 0;
+}
+function filterARCFiles(plugin) {
+ const sources = plugin_1.getPlatformElement(plugin, platform, 'source-file');
+ const sourcesARC = sources.filter((sourceFile) => sourceFile.$['compiler-flags'] &&
+ sourceFile.$['compiler-flags'] === '-fno-objc-arc');
+ return sourcesARC.length > 0;
+}
+function removeNoSystem(library, sourceFrameworks) {
+ const libraries = sourceFrameworks.filter(framework => framework.includes(library));
+ return libraries.length === 0;
+}
+async function getPluginsTask(config) {
+ return await common_1.runTask('Updating iOS plugins', async () => {
+ const allPlugins = await plugin_1.getPlugins(config, 'ios');
+ const iosPlugins = await common_2.getIOSPlugins(allPlugins);
+ return iosPlugins;
+ });
+}
+async function replaceFrameworkVariables(config, prefsArray, frameworkString) {
+ prefsArray.map((preference) => {
+ frameworkString = frameworkString.replace(new RegExp(('$' + preference.$.name).replace('$', '\\$&'), 'g'), preference.$.default);
+ });
+ return frameworkString;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ipc.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ipc.js
new file mode 100644
index 00000000..8ccaa132
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/ipc.js
@@ -0,0 +1,61 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.receive = exports.send = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const utils_subprocess_1 = require("@ionic/utils-subprocess");
+const debug_1 = tslib_1.__importDefault(require("debug"));
+const https_1 = require("https");
+const path_1 = require("path");
+const cli_1 = require("./util/cli");
+const debug = debug_1.default('capacitor:ipc');
+/**
+ * Send an IPC message to a forked process.
+ */
+async function send(msg) {
+ const dir = cli_1.ENV_PATHS.log;
+ await utils_fs_1.mkdirp(dir);
+ const logPath = path_1.resolve(dir, 'ipc.log');
+ debug('Sending %O IPC message to forked process (logs: %O)', msg.type, logPath);
+ const fd = await utils_fs_1.open(logPath, 'a');
+ const p = utils_subprocess_1.fork(process.argv[1], ['📡'], { stdio: ['ignore', fd, fd, 'ipc'] });
+ p.send(msg);
+ p.disconnect();
+ p.unref();
+}
+exports.send = send;
+/**
+ * Receive and handle an IPC message.
+ *
+ * Assume minimal context and keep external dependencies to a minimum.
+ */
+async function receive(msg) {
+ debug('Received %O IPC message', msg.type);
+ if (msg.type === 'telemetry') {
+ const now = new Date().toISOString();
+ const { data } = msg;
+ // This request is only made if telemetry is on.
+ const req = https_1.request({
+ hostname: 'api.ionicjs.com',
+ port: 443,
+ path: '/events/metrics',
+ method: 'POST',
+ headers: {
+ 'Content-Type': 'application/json',
+ },
+ }, response => {
+ debug('Sent %O metric to events service (status: %O)', data.name, response.statusCode);
+ if (response.statusCode !== 204) {
+ response.on('data', chunk => {
+ debug('Bad response from events service. Request body: %O', chunk.toString());
+ });
+ }
+ });
+ const body = {
+ metrics: [data],
+ sent_at: now,
+ };
+ req.end(JSON.stringify(body));
+ }
+}
+exports.receive = receive;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/log.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/log.js
new file mode 100644
index 00000000..65929791
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/log.js
@@ -0,0 +1,41 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.logSuccess = exports.logPrompt = exports.logger = exports.output = void 0;
+const tslib_1 = require("tslib");
+const cli_framework_output_1 = require("@ionic/cli-framework-output");
+const colors_1 = tslib_1.__importDefault(require("./colors"));
+const term_1 = require("./util/term");
+const options = {
+ colors: colors_1.default,
+ stream: process.argv.includes('--json') ? process.stderr : process.stdout,
+};
+exports.output = term_1.isInteractive()
+ ? new cli_framework_output_1.TTYOutputStrategy(options)
+ : new cli_framework_output_1.StreamOutputStrategy(options);
+exports.logger = cli_framework_output_1.createDefaultLogger({
+ output: exports.output,
+ formatterOptions: {
+ titleize: false,
+ tags: new Map([
+ [cli_framework_output_1.LOGGER_LEVELS.DEBUG, colors_1.default.log.DEBUG('[debug]')],
+ [cli_framework_output_1.LOGGER_LEVELS.INFO, colors_1.default.log.INFO('[info]')],
+ [cli_framework_output_1.LOGGER_LEVELS.WARN, colors_1.default.log.WARN('[warn]')],
+ [cli_framework_output_1.LOGGER_LEVELS.ERROR, colors_1.default.log.ERROR('[error]')],
+ ]),
+ },
+});
+async function logPrompt(msg, promptObject) {
+ const { wordWrap } = await Promise.resolve().then(() => tslib_1.__importStar(require('@ionic/cli-framework-output')));
+ const { prompt } = await Promise.resolve().then(() => tslib_1.__importStar(require('prompts')));
+ exports.logger.log({
+ msg: `${colors_1.default.input('[?]')} ${wordWrap(msg, { indentation: 4 })}`,
+ logger: exports.logger,
+ format: false,
+ });
+ return prompt(promptObject, { onCancel: () => process.exit(1) });
+}
+exports.logPrompt = logPrompt;
+function logSuccess(msg) {
+ exports.logger.msg(`${colors_1.default.success('[success]')} ${msg}`);
+}
+exports.logSuccess = logSuccess;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/plugin.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/plugin.js
new file mode 100644
index 00000000..6f5b86e8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/plugin.js
@@ -0,0 +1,186 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.getAllElements = exports.getFilePath = exports.getAssets = exports.getJSModules = exports.getPluginType = exports.getPlatformElement = exports.getPluginPlatform = exports.printPlugins = exports.fixName = exports.getDependencies = exports.resolvePlugin = exports.getPlugins = exports.getIncludedPluginPackages = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("./colors"));
+const errors_1 = require("./errors");
+const log_1 = require("./log");
+const node_1 = require("./util/node");
+const xml_1 = require("./util/xml");
+function getIncludedPluginPackages(config, platform) {
+ var _a, _b, _c, _d;
+ const { extConfig } = config.app;
+ switch (platform) {
+ case 'android':
+ return (_b = (_a = extConfig.android) === null || _a === void 0 ? void 0 : _a.includePlugins) !== null && _b !== void 0 ? _b : extConfig.includePlugins;
+ case 'ios':
+ return (_d = (_c = extConfig.ios) === null || _c === void 0 ? void 0 : _c.includePlugins) !== null && _d !== void 0 ? _d : extConfig.includePlugins;
+ }
+}
+exports.getIncludedPluginPackages = getIncludedPluginPackages;
+async function getPlugins(config, platform) {
+ var _a;
+ const possiblePlugins = (_a = getIncludedPluginPackages(config, platform)) !== null && _a !== void 0 ? _a : getDependencies(config);
+ const resolvedPlugins = await Promise.all(possiblePlugins.map(async (p) => resolvePlugin(config, p)));
+ return resolvedPlugins.filter((p) => !!p);
+}
+exports.getPlugins = getPlugins;
+async function resolvePlugin(config, name) {
+ try {
+ const packagePath = node_1.resolveNode(config.app.rootDir, name, 'package.json');
+ if (!packagePath) {
+ errors_1.fatal(`Unable to find ${colors_1.default.strong(`node_modules/${name}`)}.\n` +
+ `Are you sure ${colors_1.default.strong(name)} is installed?`);
+ }
+ const rootPath = path_1.dirname(packagePath);
+ const meta = await utils_fs_1.readJSON(packagePath);
+ if (!meta) {
+ return null;
+ }
+ if (meta.capacitor) {
+ return {
+ id: name,
+ name: fixName(name),
+ version: meta.version,
+ rootPath,
+ repository: meta.repository,
+ manifest: meta.capacitor,
+ };
+ }
+ const pluginXMLPath = path_1.join(rootPath, 'plugin.xml');
+ const xmlMeta = await xml_1.readXML(pluginXMLPath);
+ return {
+ id: name,
+ name: fixName(name),
+ version: meta.version,
+ rootPath: rootPath,
+ repository: meta.repository,
+ xml: xmlMeta.plugin,
+ };
+ }
+ catch (e) {
+ // ignore
+ }
+ return null;
+}
+exports.resolvePlugin = resolvePlugin;
+function getDependencies(config) {
+ var _a, _b;
+ return [
+ ...Object.keys((_a = config.app.package.dependencies) !== null && _a !== void 0 ? _a : {}),
+ ...Object.keys((_b = config.app.package.devDependencies) !== null && _b !== void 0 ? _b : {}),
+ ];
+}
+exports.getDependencies = getDependencies;
+function fixName(name) {
+ name = name
+ .replace(/\//g, '_')
+ .replace(/-/g, '_')
+ .replace(/@/g, '')
+ .replace(/_\w/g, m => m[1].toUpperCase());
+ return name.charAt(0).toUpperCase() + name.slice(1);
+}
+exports.fixName = fixName;
+function printPlugins(plugins, platform, type = 'capacitor') {
+ if (plugins.length === 0) {
+ return;
+ }
+ let msg;
+ const plural = plugins.length === 1 ? '' : 's';
+ switch (type) {
+ case 'cordova':
+ msg = `Found ${plugins.length} Cordova plugin${plural} for ${colors_1.default.strong(platform)}:\n`;
+ break;
+ case 'incompatible':
+ msg = `Found ${plugins.length} incompatible Cordova plugin${plural} for ${colors_1.default.strong(platform)}, skipped install:\n`;
+ break;
+ case 'capacitor':
+ msg = `Found ${plugins.length} Capacitor plugin${plural} for ${colors_1.default.strong(platform)}:\n`;
+ break;
+ }
+ msg += plugins.map(p => `${p.id}${colors_1.default.weak(`@${p.version}`)}`).join('\n');
+ log_1.logger.info(msg);
+}
+exports.printPlugins = printPlugins;
+function getPluginPlatform(p, platform) {
+ const platforms = p.xml.platform;
+ if (platforms) {
+ const platforms = p.xml.platform.filter(function (item) {
+ return item.$.name === platform;
+ });
+ return platforms[0];
+ }
+ return [];
+}
+exports.getPluginPlatform = getPluginPlatform;
+function getPlatformElement(p, platform, elementName) {
+ const platformTag = getPluginPlatform(p, platform);
+ if (platformTag) {
+ const element = platformTag[elementName];
+ if (element) {
+ return element;
+ }
+ }
+ return [];
+}
+exports.getPlatformElement = getPlatformElement;
+function getPluginType(p, platform) {
+ var _a, _b, _c, _d;
+ switch (platform) {
+ case 'ios':
+ return (_b = (_a = p.ios) === null || _a === void 0 ? void 0 : _a.type) !== null && _b !== void 0 ? _b : 0 /* Core */;
+ case 'android':
+ return (_d = (_c = p.android) === null || _c === void 0 ? void 0 : _c.type) !== null && _d !== void 0 ? _d : 0 /* Core */;
+ }
+ return 0 /* Core */;
+}
+exports.getPluginType = getPluginType;
+/**
+ * Get each JavaScript Module for the given plugin
+ */
+function getJSModules(p, platform) {
+ return getAllElements(p, platform, 'js-module');
+}
+exports.getJSModules = getJSModules;
+/**
+ * Get each asset tag for the given plugin
+ */
+function getAssets(p, platform) {
+ return getAllElements(p, platform, 'asset');
+}
+exports.getAssets = getAssets;
+function getFilePath(config, plugin, path) {
+ if (path.startsWith('node_modules')) {
+ let pathSegments = path.split('/').slice(1);
+ if (pathSegments[0].startsWith('@')) {
+ pathSegments = [
+ pathSegments[0] + '/' + pathSegments[1],
+ ...pathSegments.slice(2),
+ ];
+ }
+ const filePath = node_1.resolveNode(config.app.rootDir, ...pathSegments);
+ if (!filePath) {
+ throw new Error(`Can't resolve module ${pathSegments[0]}`);
+ }
+ return filePath;
+ }
+ return path_1.join(plugin.rootPath, path);
+}
+exports.getFilePath = getFilePath;
+/**
+ * For a given plugin, return all the plugin.xml elements with elementName, checking root and specified platform
+ */
+function getAllElements(p, platform, elementName) {
+ let modules = [];
+ if (p.xml[elementName]) {
+ modules = modules.concat(p.xml[elementName]);
+ }
+ const platformModules = getPluginPlatform(p, platform);
+ if (platformModules === null || platformModules === void 0 ? void 0 : platformModules[elementName]) {
+ modules = modules.concat(platformModules[elementName]);
+ }
+ return modules;
+}
+exports.getAllElements = getAllElements;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/sysconfig.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/sysconfig.js
new file mode 100644
index 00000000..9ab326a0
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/sysconfig.js
@@ -0,0 +1,35 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.writeConfig = exports.readConfig = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const debug_1 = tslib_1.__importDefault(require("debug"));
+const path_1 = require("path");
+const cli_1 = require("./util/cli");
+const uuid_1 = require("./util/uuid");
+const debug = debug_1.default('capacitor:sysconfig');
+const SYSCONFIG_FILE = 'sysconfig.json';
+const SYSCONFIG_PATH = path_1.resolve(cli_1.ENV_PATHS.config, SYSCONFIG_FILE);
+async function readConfig() {
+ debug('Reading from %O', SYSCONFIG_PATH);
+ try {
+ return await utils_fs_1.readJSON(SYSCONFIG_PATH);
+ }
+ catch (e) {
+ if (e.code !== 'ENOENT') {
+ throw e;
+ }
+ const sysconfig = {
+ machine: uuid_1.uuidv4(),
+ };
+ await writeConfig(sysconfig);
+ return sysconfig;
+ }
+}
+exports.readConfig = readConfig;
+async function writeConfig(sysconfig) {
+ debug('Writing to %O', SYSCONFIG_PATH);
+ await utils_fs_1.mkdirp(path_1.dirname(SYSCONFIG_PATH));
+ await utils_fs_1.writeJSON(SYSCONFIG_PATH, sysconfig, { spaces: '\t' });
+}
+exports.writeConfig = writeConfig;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/add.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/add.js
new file mode 100644
index 00000000..8fd51eef
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/add.js
@@ -0,0 +1,119 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.addCommand = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const utils_terminal_1 = require("@ionic/utils-terminal");
+const add_1 = require("../android/add");
+const common_1 = require("../android/common");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_2 = require("../common");
+const errors_1 = require("../errors");
+const add_2 = require("../ios/add");
+const common_3 = require("../ios/common");
+const log_1 = require("../log");
+const sync_1 = require("./sync");
+async function addCommand(config, selectedPlatformName) {
+ var _a;
+ if (selectedPlatformName && !(await common_2.isValidPlatform(selectedPlatformName))) {
+ const platformDir = common_2.resolvePlatform(config, selectedPlatformName);
+ if (platformDir) {
+ await common_2.runPlatformHook(config, selectedPlatformName, platformDir, 'capacitor:add');
+ }
+ else {
+ let msg = `Platform ${colors_1.default.input(selectedPlatformName)} not found.`;
+ if (await common_2.isValidCommunityPlatform(selectedPlatformName)) {
+ msg += `\nTry installing ${colors_1.default.strong(`@capacitor-community/${selectedPlatformName}`)} and adding the platform again.`;
+ }
+ if (await common_2.isValidEnterprisePlatform(selectedPlatformName)) {
+ msg +=
+ `\nThis is an enterprise platform and @ionic-enterprise/capacitor-${selectedPlatformName} is not installed.\n` +
+ `To learn how to use this platform, visit https://ionic.io/docs/${selectedPlatformName}`;
+ }
+ log_1.logger.error(msg);
+ }
+ }
+ else {
+ const knownPlatforms = await common_2.getKnownPlatforms();
+ const platformName = await common_2.promptForPlatform(knownPlatforms, `Please choose a platform to add:`, selectedPlatformName);
+ if (platformName === config.web.name) {
+ webWarning();
+ return;
+ }
+ const existingPlatformDir = await common_2.getProjectPlatformDirectory(config, platformName);
+ if (existingPlatformDir) {
+ errors_1.fatal(`${colors_1.default.input(platformName)} platform already exists.\n` +
+ `To re-add this platform, first remove ${colors_1.default.strong(utils_terminal_1.prettyPath(existingPlatformDir))}, then run this command again.\n` +
+ `${colors_1.default.strong('WARNING')}: Your native project will be completely removed.`);
+ }
+ try {
+ await common_2.check([
+ () => common_2.checkPackage(),
+ () => common_2.checkAppConfig(config),
+ ...addChecks(config, platformName),
+ ]);
+ await doAdd(config, platformName);
+ await editPlatforms(config, platformName);
+ if (await utils_fs_1.pathExists(config.app.webDirAbs)) {
+ await sync_1.sync(config, platformName, false);
+ if (platformName === config.android.name) {
+ await common_2.runTask('Syncing Gradle', async () => {
+ return add_1.createLocalProperties(config.android.platformDirAbs);
+ });
+ }
+ }
+ else {
+ log_1.logger.warn(`${colors_1.default.success(colors_1.default.strong('sync'))} could not run--missing ${colors_1.default.strong(config.app.webDir)} directory.`);
+ }
+ printNextSteps(platformName);
+ }
+ catch (e) {
+ if (!errors_1.isFatal(e)) {
+ errors_1.fatal((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+ throw e;
+ }
+ }
+}
+exports.addCommand = addCommand;
+function printNextSteps(platformName) {
+ log_1.logSuccess(`${colors_1.default.strong(platformName)} platform added!`);
+ log_1.output.write(`Follow the Developer Workflow guide to get building:\n${colors_1.default.strong(`https://capacitorjs.com/docs/basics/workflow`)}\n`);
+}
+function addChecks(config, platformName) {
+ if (platformName === config.ios.name) {
+ return [() => common_3.checkIOSPackage(config), () => common_3.checkCocoaPods(config)];
+ }
+ else if (platformName === config.android.name) {
+ return [() => common_1.checkAndroidPackage(config)];
+ }
+ else if (platformName === config.web.name) {
+ return [];
+ }
+ else {
+ throw `Platform ${platformName} is not valid.`;
+ }
+}
+async function doAdd(config, platformName) {
+ await common_2.runTask(colors_1.default.success(colors_1.default.strong('add')), async () => {
+ if (platformName === config.ios.name) {
+ await add_2.addIOS(config);
+ }
+ else if (platformName === config.android.name) {
+ await add_1.addAndroid(config);
+ }
+ });
+}
+async function editPlatforms(config, platformName) {
+ if (platformName === config.ios.name) {
+ await common_3.editProjectSettingsIOS(config);
+ }
+ else if (platformName === config.android.name) {
+ await common_1.editProjectSettingsAndroid(config);
+ }
+}
+function webWarning() {
+ log_1.logger.error(`Not adding platform ${colors_1.default.strong('web')}.\n` +
+ `In Capacitor, the web platform is just your web app! For example, if you have a React or Angular project, the web platform is that project.\n` +
+ `To add Capacitor functionality to your web app, follow the Web Getting Started Guide: ${colors_1.default.strong('https://capacitorjs.com/docs/web')}`);
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/config.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/config.js
new file mode 100644
index 00000000..6e9ac0ac
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/config.js
@@ -0,0 +1,31 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.configCommand = void 0;
+const tslib_1 = require("tslib");
+const util_1 = tslib_1.__importDefault(require("util"));
+const log_1 = require("../log");
+async function configCommand(config, json) {
+ const evaluatedConfig = await deepAwait(config);
+ if (json) {
+ process.stdout.write(`${JSON.stringify(evaluatedConfig)}\n`);
+ }
+ else {
+ log_1.output.write(`${util_1.default.inspect(evaluatedConfig, { depth: Infinity, colors: true })}\n`);
+ }
+}
+exports.configCommand = configCommand;
+async function deepAwait(obj) {
+ if (obj &&
+ !Array.isArray(obj) &&
+ typeof obj === 'object' &&
+ obj.constructor === Object) {
+ const o = {};
+ for (const [k, v] of Object.entries(obj)) {
+ o[k] = await deepAwait(v);
+ }
+ return o;
+ }
+ else {
+ return await obj;
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/copy.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/copy.js
new file mode 100644
index 00000000..4d87c926
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/copy.js
@@ -0,0 +1,135 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.copy = exports.copyCommand = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const cordova_1 = require("../cordova");
+const errors_1 = require("../errors");
+const log_1 = require("../log");
+const plugin_1 = require("../plugin");
+const promise_1 = require("../util/promise");
+const copy_1 = require("../web/copy");
+async function copyCommand(config, selectedPlatformName) {
+ var _a;
+ if (selectedPlatformName && !(await common_1.isValidPlatform(selectedPlatformName))) {
+ const platformDir = common_1.resolvePlatform(config, selectedPlatformName);
+ if (platformDir) {
+ await common_1.runPlatformHook(config, selectedPlatformName, platformDir, 'capacitor:copy');
+ }
+ else {
+ log_1.logger.error(`Platform ${colors_1.default.input(selectedPlatformName)} not found.`);
+ }
+ }
+ else {
+ const platforms = await common_1.selectPlatforms(config, selectedPlatformName);
+ try {
+ await promise_1.allSerial(platforms.map(platformName => () => copy(config, platformName)));
+ }
+ catch (e) {
+ if (errors_1.isFatal(e)) {
+ throw e;
+ }
+ log_1.logger.error((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+ }
+}
+exports.copyCommand = copyCommand;
+async function copy(config, platformName) {
+ await common_1.runTask(colors_1.default.success(colors_1.default.strong(`copy ${platformName}`)), async () => {
+ const result = await common_1.checkWebDir(config);
+ if (result) {
+ throw result;
+ }
+ await common_1.runPlatformHook(config, platformName, config.app.rootDir, 'capacitor:copy:before');
+ const allPlugins = await plugin_1.getPlugins(config, platformName);
+ let usesCapacitorPortals = false;
+ if (allPlugins.filter(plugin => plugin.id === '@ionic-enterprise/capacitor-portals').length > 0) {
+ usesCapacitorPortals = true;
+ }
+ if (platformName === config.ios.name) {
+ if (usesCapacitorPortals) {
+ await copyFederatedWebDirs(config, await config.ios.webDirAbs);
+ }
+ else {
+ await copyWebDir(config, await config.ios.webDirAbs, config.app.webDirAbs);
+ }
+ await copyCapacitorConfig(config, config.ios.nativeTargetDirAbs);
+ const cordovaPlugins = await cordova_1.getCordovaPlugins(config, platformName);
+ await cordova_1.handleCordovaPluginsJS(cordovaPlugins, config, platformName);
+ }
+ else if (platformName === config.android.name) {
+ if (usesCapacitorPortals) {
+ await copyFederatedWebDirs(config, config.android.webDirAbs);
+ }
+ else {
+ await copyWebDir(config, config.android.webDirAbs, config.app.webDirAbs);
+ }
+ await copyCapacitorConfig(config, config.android.assetsDirAbs);
+ const cordovaPlugins = await cordova_1.getCordovaPlugins(config, platformName);
+ await cordova_1.handleCordovaPluginsJS(cordovaPlugins, config, platformName);
+ await cordova_1.writeCordovaAndroidManifest(cordovaPlugins, config, platformName);
+ }
+ else if (platformName === config.web.name) {
+ if (usesCapacitorPortals) {
+ log_1.logger.info('Capacitor Portals Plugin installed, skipping web bundling...');
+ }
+ else {
+ await copy_1.copyWeb(config);
+ }
+ }
+ else {
+ throw `Platform ${platformName} is not valid.`;
+ }
+ });
+ await common_1.runPlatformHook(config, platformName, config.app.rootDir, 'capacitor:copy:after');
+}
+exports.copy = copy;
+async function copyCapacitorConfig(config, nativeAbsDir) {
+ const nativeRelDir = path_1.relative(config.app.rootDir, nativeAbsDir);
+ const nativeConfigFile = 'capacitor.config.json';
+ const nativeConfigFilePath = path_1.join(nativeAbsDir, nativeConfigFile);
+ await common_1.runTask(`Creating ${colors_1.default.strong(nativeConfigFile)} in ${nativeRelDir}`, async () => {
+ await utils_fs_1.writeJSON(nativeConfigFilePath, config.app.extConfig, {
+ spaces: '\t',
+ });
+ });
+}
+async function copyWebDir(config, nativeAbsDir, webAbsDir) {
+ var _a;
+ const webRelDir = path_1.basename(webAbsDir);
+ const nativeRelDir = path_1.relative(config.app.rootDir, nativeAbsDir);
+ if (((_a = config.app.extConfig.server) === null || _a === void 0 ? void 0 : _a.url) && !(await utils_fs_1.pathExists(webAbsDir))) {
+ log_1.logger.warn(`Cannot copy web assets from ${colors_1.default.strong(webRelDir)} to ${nativeRelDir}\n` +
+ `Web asset directory specified by ${colors_1.default.input('webDir')} does not exist. This is not an error because ${colors_1.default.input('server.url')} is set in config.`);
+ return;
+ }
+ await common_1.runTask(`Copying web assets from ${colors_1.default.strong(webRelDir)} to ${nativeRelDir}`, async () => {
+ await utils_fs_1.remove(nativeAbsDir);
+ return utils_fs_1.copy(webAbsDir, nativeAbsDir);
+ });
+}
+async function copyFederatedWebDirs(config, nativeAbsDir) {
+ var _a, _b;
+ log_1.logger.info('Capacitor Portals Plugin Loaded - Copying Web Assets');
+ if (!((_b = (_a = config.app.extConfig) === null || _a === void 0 ? void 0 : _a.plugins) === null || _b === void 0 ? void 0 : _b.Portals)) {
+ throw `Capacitor Portals plugin is present but no valid config is defined.`;
+ }
+ const portalsConfig = config.app.extConfig.plugins.Portals;
+ if (!isPortal(portalsConfig.shell)) {
+ throw `Capacitor Portals plugin is present but no valid Shell application is defined in the config.`;
+ }
+ if (!portalsConfig.apps.every(isPortal)) {
+ throw `Capacitor Portals plugin is present but there is a problem with the apps defined in the config.`;
+ }
+ await Promise.all([...portalsConfig.apps, portalsConfig.shell].map(app => {
+ const appDir = path_1.resolve(config.app.rootDir, app.webDir);
+ return copyWebDir(config, path_1.resolve(nativeAbsDir, app.name), appDir);
+ }));
+}
+function isPortal(config) {
+ return (config.webDir !== undefined &&
+ config.name !== undefined);
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/create.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/create.js
new file mode 100644
index 00000000..b1073b38
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/create.js
@@ -0,0 +1,11 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.createCommand = void 0;
+const tslib_1 = require("tslib");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const errors_1 = require("../errors");
+async function createCommand() {
+ errors_1.fatal(`The create command has been removed.\n` +
+ `Use ${colors_1.default.input('npm init @capacitor/app')}`);
+}
+exports.createCommand = createCommand;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/doctor.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/doctor.js
new file mode 100644
index 00000000..b1628c2f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/doctor.js
@@ -0,0 +1,73 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.doctor = exports.doctorCore = exports.doctorCommand = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const doctor_1 = require("../android/doctor");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const doctor_2 = require("../ios/doctor");
+const log_1 = require("../log");
+const emoji_1 = require("../util/emoji");
+const node_1 = require("../util/node");
+const subprocess_1 = require("../util/subprocess");
+async function doctorCommand(config, selectedPlatformName) {
+ log_1.output.write(`${emoji_1.emoji('💊', '')} ${colors_1.default.strong('Capacitor Doctor')} ${emoji_1.emoji('💊', '')} \n\n`);
+ await doctorCore(config);
+ const platforms = await common_1.selectPlatforms(config, selectedPlatformName);
+ await Promise.all(platforms.map(platformName => {
+ return doctor(config, platformName);
+ }));
+}
+exports.doctorCommand = doctorCommand;
+async function doctorCore(config) {
+ const [cliVersion, coreVersion, androidVersion, iosVersion] = await Promise.all([
+ subprocess_1.getCommandOutput('npm', ['info', '@capacitor/cli', 'version']),
+ subprocess_1.getCommandOutput('npm', ['info', '@capacitor/core', 'version']),
+ subprocess_1.getCommandOutput('npm', ['info', '@capacitor/android', 'version']),
+ subprocess_1.getCommandOutput('npm', ['info', '@capacitor/ios', 'version']),
+ ]);
+ log_1.output.write(`${colors_1.default.strong('Latest Dependencies:')}\n\n` +
+ ` @capacitor/cli: ${colors_1.default.weak(cliVersion !== null && cliVersion !== void 0 ? cliVersion : 'unknown')}\n` +
+ ` @capacitor/core: ${colors_1.default.weak(coreVersion !== null && coreVersion !== void 0 ? coreVersion : 'unknown')}\n` +
+ ` @capacitor/android: ${colors_1.default.weak(androidVersion !== null && androidVersion !== void 0 ? androidVersion : 'unknown')}\n` +
+ ` @capacitor/ios: ${colors_1.default.weak(iosVersion !== null && iosVersion !== void 0 ? iosVersion : 'unknown')}\n\n` +
+ `${colors_1.default.strong('Installed Dependencies:')}\n\n`);
+ await printInstalledPackages(config);
+ log_1.output.write('\n');
+}
+exports.doctorCore = doctorCore;
+async function printInstalledPackages(config) {
+ const packageNames = [
+ '@capacitor/cli',
+ '@capacitor/core',
+ '@capacitor/android',
+ '@capacitor/ios',
+ ];
+ await Promise.all(packageNames.map(async (packageName) => {
+ const packagePath = node_1.resolveNode(config.app.rootDir, packageName, 'package.json');
+ await printPackageVersion(packageName, packagePath);
+ }));
+}
+async function printPackageVersion(packageName, packagePath) {
+ let version;
+ if (packagePath) {
+ version = (await utils_fs_1.readJSON(packagePath)).version;
+ }
+ log_1.output.write(` ${packageName}: ${colors_1.default.weak(version || 'not installed')}\n`);
+}
+async function doctor(config, platformName) {
+ if (platformName === config.ios.name) {
+ await doctor_2.doctorIOS(config);
+ }
+ else if (platformName === config.android.name) {
+ await doctor_1.doctorAndroid(config);
+ }
+ else if (platformName === config.web.name) {
+ return Promise.resolve();
+ }
+ else {
+ throw `Platform ${platformName} is not valid.`;
+ }
+}
+exports.doctor = doctor;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/init.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/init.js
new file mode 100644
index 00000000..7410314a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/init.js
@@ -0,0 +1,140 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.initCommand = void 0;
+const tslib_1 = require("tslib");
+const open_1 = tslib_1.__importDefault(require("open"));
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const config_1 = require("../config");
+const cordova_1 = require("../cordova");
+const errors_1 = require("../errors");
+const framework_configs_1 = require("../framework-configs");
+const log_1 = require("../log");
+const sysconfig_1 = require("../sysconfig");
+const node_1 = require("../util/node");
+const term_1 = require("../util/term");
+async function initCommand(config, name, id, webDirFromCLI) {
+ var _a, _b;
+ try {
+ if (!term_1.checkInteractive(name, id)) {
+ return;
+ }
+ if (config.app.extConfigType !== 'json') {
+ errors_1.fatal(`Cannot run ${colors_1.default.input('init')} for a project using a non-JSON configuration file.\n` +
+ `Delete ${colors_1.default.strong(config.app.extConfigName)} and try again.`);
+ }
+ const isNewConfig = Object.keys(config.app.extConfig).length === 0;
+ const tsInstalled = !!node_1.resolveNode(config.app.rootDir, 'typescript');
+ const appName = await getName(config, name);
+ const appId = await getAppId(config, id);
+ const webDir = term_1.isInteractive()
+ ? await getWebDir(config, webDirFromCLI)
+ : (_a = webDirFromCLI !== null && webDirFromCLI !== void 0 ? webDirFromCLI : config.app.extConfig.webDir) !== null && _a !== void 0 ? _a : 'www';
+ await common_1.check([
+ () => common_1.checkAppName(config, appName),
+ () => common_1.checkAppId(config, appId),
+ ]);
+ const cordova = await cordova_1.getCordovaPreferences(config);
+ await runMergeConfig(config, {
+ appId,
+ appName,
+ webDir,
+ bundledWebRuntime: false,
+ cordova,
+ }, isNewConfig && tsInstalled ? 'ts' : 'json');
+ }
+ catch (e) {
+ if (!errors_1.isFatal(e)) {
+ log_1.output.write('Usage: npx cap init appName appId\n' +
+ 'Example: npx cap init "My App" "com.example.myapp"\n\n');
+ errors_1.fatal((_b = e.stack) !== null && _b !== void 0 ? _b : e);
+ }
+ throw e;
+ }
+}
+exports.initCommand = initCommand;
+async function getName(config, name) {
+ var _a;
+ if (!name) {
+ const answers = await log_1.logPrompt(`${colors_1.default.strong(`What is the name of your app?`)}\n` +
+ `This should be a human-friendly app name, like what you'd see in the App Store.`, {
+ type: 'text',
+ name: 'name',
+ message: `Name`,
+ initial: config.app.appName
+ ? config.app.appName
+ : (_a = config.app.package.name) !== null && _a !== void 0 ? _a : 'App',
+ });
+ return answers.name;
+ }
+ return name;
+}
+async function getAppId(config, id) {
+ if (!id) {
+ const answers = await log_1.logPrompt(`${colors_1.default.strong(`What should be the Package ID for your app?`)}\n` +
+ `Package IDs (aka Bundle ID in iOS and Application ID in Android) are unique identifiers for apps. They must be in reverse domain name notation, generally representing a domain name that you or your company owns.`, {
+ type: 'text',
+ name: 'id',
+ message: `Package ID`,
+ initial: config.app.appId ? config.app.appId : 'com.example.app',
+ });
+ return answers.id;
+ }
+ return id;
+}
+async function getWebDir(config, webDir) {
+ if (!webDir) {
+ const framework = framework_configs_1.detectFramework(config);
+ if (framework === null || framework === void 0 ? void 0 : framework.webDir) {
+ return framework.webDir;
+ }
+ const answers = await log_1.logPrompt(`${colors_1.default.strong(`What is the web asset directory for your app?`)}\n` +
+ `This directory should contain the final ${colors_1.default.strong('index.html')} of your app.`, {
+ type: 'text',
+ name: 'webDir',
+ message: `Web asset directory`,
+ initial: config.app.webDir ? config.app.webDir : 'www',
+ });
+ return answers.webDir;
+ }
+ return webDir;
+}
+async function runMergeConfig(config, extConfig, type) {
+ const configDirectory = path_1.dirname(config.app.extConfigFilePath);
+ const newConfigPath = path_1.resolve(configDirectory, type === 'ts' ? config_1.CONFIG_FILE_NAME_TS : config_1.CONFIG_FILE_NAME_JSON);
+ await common_1.runTask(`Creating ${colors_1.default.strong(path_1.basename(newConfigPath))} in ${colors_1.default.input(config.app.rootDir)}`, async () => {
+ await mergeConfig(config, extConfig, newConfigPath);
+ });
+ printNextSteps(path_1.basename(newConfigPath));
+ if (term_1.isInteractive()) {
+ let sysconfig = await sysconfig_1.readConfig();
+ if (typeof sysconfig.signup === 'undefined') {
+ const signup = await promptToSignup();
+ sysconfig = { ...sysconfig, signup };
+ await sysconfig_1.writeConfig(sysconfig);
+ }
+ }
+}
+async function mergeConfig(config, extConfig, newConfigPath) {
+ const oldConfig = { ...config.app.extConfig };
+ const newConfig = { ...oldConfig, ...extConfig };
+ await config_1.writeConfig(newConfig, newConfigPath);
+}
+function printNextSteps(newConfigName) {
+ log_1.logSuccess(`${colors_1.default.strong(newConfigName)} created!`);
+ log_1.output.write(`\nNext steps: \n${colors_1.default.strong(`https://capacitorjs.com/docs/getting-started#where-to-go-next`)}\n`);
+}
+async function promptToSignup() {
+ const answers = await log_1.logPrompt(`Join the Ionic Community! 💙\n` +
+ `Connect with millions of developers on the Ionic Forum and get access to live events, news updates, and more.`, {
+ type: 'confirm',
+ name: 'create',
+ message: `Create free Ionic account?`,
+ initial: true,
+ });
+ if (answers.create) {
+ open_1.default(`http://ionicframework.com/signup?source=capacitor`);
+ }
+ return answers.create;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/list.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/list.js
new file mode 100644
index 00000000..0a21a976
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/list.js
@@ -0,0 +1,50 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.list = exports.listCommand = void 0;
+const tslib_1 = require("tslib");
+const common_1 = require("../android/common");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_2 = require("../common");
+const errors_1 = require("../errors");
+const common_3 = require("../ios/common");
+const log_1 = require("../log");
+const plugin_1 = require("../plugin");
+const promise_1 = require("../util/promise");
+async function listCommand(config, selectedPlatformName) {
+ var _a;
+ const platforms = await common_2.selectPlatforms(config, selectedPlatformName);
+ try {
+ await promise_1.allSerial(platforms.map(platformName => () => list(config, platformName)));
+ }
+ catch (e) {
+ if (errors_1.isFatal(e)) {
+ throw e;
+ }
+ log_1.logger.error((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+}
+exports.listCommand = listCommand;
+async function list(config, platform) {
+ const allPlugins = await plugin_1.getPlugins(config, platform);
+ let plugins = [];
+ if (platform === config.ios.name) {
+ plugins = await common_3.getIOSPlugins(allPlugins);
+ }
+ else if (platform === config.android.name) {
+ plugins = await common_1.getAndroidPlugins(allPlugins);
+ }
+ else if (platform === config.web.name) {
+ log_1.logger.info(`Listing plugins for ${colors_1.default.input(platform)} is not possible.`);
+ return;
+ }
+ else {
+ throw `Platform ${colors_1.default.input(platform)} is not valid.`;
+ }
+ const capacitorPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 0 /* Core */);
+ plugin_1.printPlugins(capacitorPlugins, platform);
+ const cordovaPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 1 /* Cordova */);
+ plugin_1.printPlugins(cordovaPlugins, platform, 'cordova');
+ const incompatibleCordovaPlugins = plugins.filter(p => plugin_1.getPluginType(p, platform) === 2 /* Incompatible */);
+ plugin_1.printPlugins(incompatibleCordovaPlugins, platform, 'incompatible');
+}
+exports.list = list;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/new-plugin.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/new-plugin.js
new file mode 100644
index 00000000..48a8af60
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/new-plugin.js
@@ -0,0 +1,11 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.newPluginCommand = void 0;
+const tslib_1 = require("tslib");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const errors_1 = require("../errors");
+async function newPluginCommand() {
+ errors_1.fatal(`The plugin:generate command has been removed.\n` +
+ `Use ${colors_1.default.input('npm init @capacitor/plugin')}`);
+}
+exports.newPluginCommand = newPluginCommand;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/open.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/open.js
new file mode 100644
index 00000000..f0e67048
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/open.js
@@ -0,0 +1,62 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.open = exports.openCommand = void 0;
+const tslib_1 = require("tslib");
+const open_1 = require("../android/open");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const errors_1 = require("../errors");
+const open_2 = require("../ios/open");
+const log_1 = require("../log");
+async function openCommand(config, selectedPlatformName) {
+ var _a;
+ if (selectedPlatformName && !(await common_1.isValidPlatform(selectedPlatformName))) {
+ const platformDir = common_1.resolvePlatform(config, selectedPlatformName);
+ if (platformDir) {
+ await common_1.runPlatformHook(config, selectedPlatformName, platformDir, 'capacitor:open');
+ }
+ else {
+ log_1.logger.error(`Platform ${colors_1.default.input(selectedPlatformName)} not found.`);
+ }
+ }
+ else {
+ const platforms = await common_1.selectPlatforms(config, selectedPlatformName);
+ let platformName;
+ if (platforms.length === 1) {
+ platformName = platforms[0];
+ }
+ else {
+ platformName = await common_1.promptForPlatform(platforms.filter(createOpenablePlatformFilter(config)), `Please choose a platform to open:`);
+ }
+ try {
+ await open(config, platformName);
+ }
+ catch (e) {
+ if (!errors_1.isFatal(e)) {
+ errors_1.fatal((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+ throw e;
+ }
+ }
+}
+exports.openCommand = openCommand;
+function createOpenablePlatformFilter(config) {
+ return platform => platform === config.ios.name || platform === config.android.name;
+}
+async function open(config, platformName) {
+ if (platformName === config.ios.name) {
+ await common_1.runTask('Opening the Xcode workspace...', () => {
+ return open_2.openIOS(config);
+ });
+ }
+ else if (platformName === config.android.name) {
+ return open_1.openAndroid(config);
+ }
+ else if (platformName === config.web.name) {
+ return Promise.resolve();
+ }
+ else {
+ throw `Platform ${platformName} is not valid.`;
+ }
+}
+exports.open = open;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/run.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/run.js
new file mode 100644
index 00000000..c7a2a1db
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/run.js
@@ -0,0 +1,89 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.run = exports.runCommand = void 0;
+const tslib_1 = require("tslib");
+const utils_terminal_1 = require("@ionic/utils-terminal");
+const run_1 = require("../android/run");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const errors_1 = require("../errors");
+const run_2 = require("../ios/run");
+const log_1 = require("../log");
+const native_run_1 = require("../util/native-run");
+const sync_1 = require("./sync");
+async function runCommand(config, selectedPlatformName, options) {
+ var _a;
+ if (selectedPlatformName && !(await common_1.isValidPlatform(selectedPlatformName))) {
+ const platformDir = common_1.resolvePlatform(config, selectedPlatformName);
+ if (platformDir) {
+ await common_1.runPlatformHook(config, selectedPlatformName, platformDir, 'capacitor:run');
+ }
+ else {
+ log_1.logger.error(`Platform ${colors_1.default.input(selectedPlatformName)} not found.`);
+ }
+ }
+ else {
+ const platforms = await common_1.selectPlatforms(config, selectedPlatformName);
+ let platformName;
+ if (platforms.length === 1) {
+ platformName = platforms[0];
+ }
+ else {
+ platformName = await common_1.promptForPlatform(platforms.filter(createRunnablePlatformFilter(config)), `Please choose a platform to run:`);
+ }
+ if (options.list) {
+ const targets = await native_run_1.getPlatformTargets(platformName);
+ const outputTargets = targets.map(t => {
+ var _a;
+ return ({
+ name: common_1.getPlatformTargetName(t),
+ api: `${t.platform === 'ios' ? 'iOS' : 'API'} ${t.sdkVersion}`,
+ id: (_a = t.id) !== null && _a !== void 0 ? _a : '?',
+ });
+ });
+ // TODO: make hidden commander option (https://github.com/tj/commander.js/issues/1106)
+ if (process.argv.includes('--json')) {
+ process.stdout.write(`${JSON.stringify(outputTargets)}\n`);
+ }
+ else {
+ const rows = outputTargets.map(t => [t.name, t.api, t.id]);
+ log_1.output.write(`${utils_terminal_1.columnar(rows, {
+ headers: ['Name', 'API', 'Target ID'],
+ vsep: ' ',
+ })}\n`);
+ }
+ return;
+ }
+ try {
+ if (options.sync) {
+ await sync_1.sync(config, platformName, false);
+ }
+ await run(config, platformName, options);
+ }
+ catch (e) {
+ if (!errors_1.isFatal(e)) {
+ errors_1.fatal((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+ throw e;
+ }
+ }
+}
+exports.runCommand = runCommand;
+async function run(config, platformName, options) {
+ if (platformName == config.ios.name) {
+ await run_2.runIOS(config, options);
+ }
+ else if (platformName === config.android.name) {
+ await run_1.runAndroid(config, options);
+ }
+ else if (platformName === config.web.name) {
+ return;
+ }
+ else {
+ throw `Platform ${platformName} is not valid.`;
+ }
+}
+exports.run = run;
+function createRunnablePlatformFilter(config) {
+ return platform => platform === config.ios.name || platform === config.android.name;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/serve.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/serve.js
new file mode 100644
index 00000000..2199c158
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/serve.js
@@ -0,0 +1,11 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.serveCommand = void 0;
+const tslib_1 = require("tslib");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const errors_1 = require("../errors");
+async function serveCommand() {
+ errors_1.fatal(`The serve command has been removed.\n` +
+ `Use a third-party tool for serving single page apps, such as ${colors_1.default.strong('serve')}: ${colors_1.default.strong('https://www.npmjs.com/package/serve')}`);
+}
+exports.serveCommand = serveCommand;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/sync.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/sync.js
new file mode 100644
index 00000000..34591d55
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/sync.js
@@ -0,0 +1,59 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.sync = exports.syncCommand = void 0;
+const common_1 = require("../common");
+const errors_1 = require("../errors");
+const log_1 = require("../log");
+const promise_1 = require("../util/promise");
+const copy_1 = require("./copy");
+const update_1 = require("./update");
+/**
+ * Sync is a copy and an update in one.
+ */
+async function syncCommand(config, selectedPlatformName, deployment) {
+ var _a, _b;
+ if (selectedPlatformName && !(await common_1.isValidPlatform(selectedPlatformName))) {
+ try {
+ await copy_1.copyCommand(config, selectedPlatformName);
+ }
+ catch (e) {
+ log_1.logger.error((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+ await update_1.updateCommand(config, selectedPlatformName, deployment);
+ }
+ else {
+ const then = +new Date();
+ const platforms = await common_1.selectPlatforms(config, selectedPlatformName);
+ try {
+ await common_1.check([
+ () => common_1.checkPackage(),
+ () => common_1.checkWebDir(config),
+ ...update_1.updateChecks(config, platforms),
+ ]);
+ await promise_1.allSerial(platforms.map(platformName => () => sync(config, platformName, deployment)));
+ const now = +new Date();
+ const diff = (now - then) / 1000;
+ log_1.logger.info(`Sync finished in ${diff}s`);
+ }
+ catch (e) {
+ if (!errors_1.isFatal(e)) {
+ errors_1.fatal((_b = e.stack) !== null && _b !== void 0 ? _b : e);
+ }
+ throw e;
+ }
+ }
+}
+exports.syncCommand = syncCommand;
+async function sync(config, platformName, deployment) {
+ var _a;
+ await common_1.runPlatformHook(config, platformName, config.app.rootDir, 'capacitor:sync:before');
+ try {
+ await copy_1.copy(config, platformName);
+ }
+ catch (e) {
+ log_1.logger.error((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+ await update_1.update(config, platformName, deployment);
+ await common_1.runPlatformHook(config, platformName, config.app.rootDir, 'capacitor:sync:after');
+}
+exports.sync = sync;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/telemetry.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/telemetry.js
new file mode 100644
index 00000000..2d9b47c9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/telemetry.js
@@ -0,0 +1,40 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.telemetryCommand = void 0;
+const tslib_1 = require("tslib");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const errors_1 = require("../errors");
+const log_1 = require("../log");
+const sysconfig_1 = require("../sysconfig");
+const telemetry_1 = require("../telemetry");
+async function telemetryCommand(onOrOff) {
+ const sysconfig = await sysconfig_1.readConfig();
+ const enabled = interpretEnabled(onOrOff);
+ if (typeof enabled === 'boolean') {
+ if (sysconfig.telemetry === enabled) {
+ log_1.logger.info(`Telemetry is already ${colors_1.default.strong(enabled ? 'on' : 'off')}`);
+ }
+ else {
+ await sysconfig_1.writeConfig({ ...sysconfig, telemetry: enabled });
+ log_1.logSuccess(`You have ${colors_1.default.strong(`opted ${enabled ? 'in' : 'out'}`)} ${enabled ? 'for' : 'of'} telemetry on this machine.`);
+ if (enabled) {
+ log_1.output.write(telemetry_1.THANK_YOU);
+ }
+ }
+ }
+ else {
+ log_1.logger.info(`Telemetry is ${colors_1.default.strong(sysconfig.telemetry ? 'on' : 'off')}`);
+ }
+}
+exports.telemetryCommand = telemetryCommand;
+function interpretEnabled(onOrOff) {
+ switch (onOrOff) {
+ case 'on':
+ return true;
+ case 'off':
+ return false;
+ case undefined:
+ return undefined;
+ }
+ errors_1.fatal(`Argument must be ${colors_1.default.strong('on')} or ${colors_1.default.strong('off')} (or left unspecified)`);
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/update.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/update.js
new file mode 100644
index 00000000..5635daf7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/tasks/update.js
@@ -0,0 +1,74 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.update = exports.updateChecks = exports.updateCommand = void 0;
+const tslib_1 = require("tslib");
+const update_1 = require("../android/update");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const errors_1 = require("../errors");
+const common_2 = require("../ios/common");
+const update_2 = require("../ios/update");
+const log_1 = require("../log");
+const promise_1 = require("../util/promise");
+async function updateCommand(config, selectedPlatformName, deployment) {
+ var _a;
+ if (selectedPlatformName && !(await common_1.isValidPlatform(selectedPlatformName))) {
+ const platformDir = common_1.resolvePlatform(config, selectedPlatformName);
+ if (platformDir) {
+ await common_1.runPlatformHook(config, selectedPlatformName, platformDir, 'capacitor:update');
+ }
+ else {
+ log_1.logger.error(`Platform ${colors_1.default.input(selectedPlatformName)} not found.`);
+ }
+ }
+ else {
+ const then = +new Date();
+ const platforms = await common_1.selectPlatforms(config, selectedPlatformName);
+ try {
+ await common_1.check([() => common_1.checkPackage(), ...updateChecks(config, platforms)]);
+ await promise_1.allSerial(platforms.map(platformName => async () => await update(config, platformName, deployment)));
+ const now = +new Date();
+ const diff = (now - then) / 1000;
+ log_1.logger.info(`Update finished in ${diff}s`);
+ }
+ catch (e) {
+ if (!errors_1.isFatal(e)) {
+ errors_1.fatal((_a = e.stack) !== null && _a !== void 0 ? _a : e);
+ }
+ throw e;
+ }
+ }
+}
+exports.updateCommand = updateCommand;
+function updateChecks(config, platforms) {
+ const checks = [];
+ for (const platformName of platforms) {
+ if (platformName === config.ios.name) {
+ checks.push(() => common_2.checkCocoaPods(config));
+ }
+ else if (platformName === config.android.name) {
+ continue;
+ }
+ else if (platformName === config.web.name) {
+ continue;
+ }
+ else {
+ throw `Platform ${platformName} is not valid.`;
+ }
+ }
+ return checks;
+}
+exports.updateChecks = updateChecks;
+async function update(config, platformName, deployment) {
+ await common_1.runTask(colors_1.default.success(colors_1.default.strong(`update ${platformName}`)), async () => {
+ await common_1.runPlatformHook(config, platformName, config.app.rootDir, 'capacitor:update:before');
+ if (platformName === config.ios.name) {
+ await update_2.updateIOS(config, deployment);
+ }
+ else if (platformName === config.android.name) {
+ await update_1.updateAndroid(config);
+ }
+ await common_1.runPlatformHook(config, platformName, config.app.rootDir, 'capacitor:update:after');
+ });
+}
+exports.update = update;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/telemetry.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/telemetry.js
new file mode 100644
index 00000000..09d50427
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/telemetry.js
@@ -0,0 +1,130 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.sendMetric = exports.telemetryAction = exports.THANK_YOU = void 0;
+const tslib_1 = require("tslib");
+const commander_1 = require("commander");
+const debug_1 = tslib_1.__importDefault(require("debug"));
+const colors_1 = tslib_1.__importDefault(require("./colors"));
+const ipc_1 = require("./ipc");
+const log_1 = require("./log");
+const sysconfig_1 = require("./sysconfig");
+const subprocess_1 = require("./util/subprocess");
+const term_1 = require("./util/term");
+const debug = debug_1.default('capacitor:telemetry');
+exports.THANK_YOU = `\nThank you for helping to make Capacitor better! 💖` +
+ `\nInformation about the data we collect is available on our website: ${colors_1.default.strong('https://capacitorjs.com/telemetry')}\n`;
+function telemetryAction(config, action) {
+ return async (...actionArgs) => {
+ const start = new Date();
+ // This is how commanderjs works--the command object is either the last
+ // element or second to last if there are additional options (via `.allowUnknownOption()`)
+ const lastArg = actionArgs[actionArgs.length - 1];
+ const cmd = lastArg instanceof commander_1.Command ? lastArg : actionArgs[actionArgs.length - 2];
+ const command = getFullCommandName(cmd);
+ let error;
+ try {
+ await action(...actionArgs);
+ }
+ catch (e) {
+ error = e;
+ }
+ const end = new Date();
+ const duration = end.getTime() - start.getTime();
+ const packages = Object.entries({
+ ...config.app.package.devDependencies,
+ ...config.app.package.dependencies,
+ });
+ // Only collect packages in the capacitor org:
+ // https://www.npmjs.com/org/capacitor
+ const capacitorPackages = packages.filter(([k]) => k.startsWith('@capacitor/'));
+ const versions = capacitorPackages.map(([k, v]) => [
+ `${k.replace(/^@capacitor\//, '').replace(/-/g, '_')}_version`,
+ v,
+ ]);
+ const data = {
+ app_id: await getAppIdentifier(config),
+ command,
+ arguments: cmd.args.join(' '),
+ options: JSON.stringify(cmd.opts()),
+ duration,
+ error: error ? (error.message ? error.message : String(error)) : null,
+ node_version: process.version,
+ os: config.cli.os,
+ ...Object.fromEntries(versions),
+ };
+ if (term_1.isInteractive()) {
+ let sysconfig = await sysconfig_1.readConfig();
+ if (!error && typeof sysconfig.telemetry === 'undefined') {
+ const confirm = await promptForTelemetry();
+ sysconfig = { ...sysconfig, telemetry: confirm };
+ await sysconfig_1.writeConfig(sysconfig);
+ }
+ await sendMetric(sysconfig, 'capacitor_cli_command', data);
+ }
+ if (error) {
+ throw error;
+ }
+ };
+}
+exports.telemetryAction = telemetryAction;
+/**
+ * If telemetry is enabled, send a metric via IPC to a forked process for uploading.
+ */
+async function sendMetric(sysconfig, name, data) {
+ if (sysconfig.telemetry && term_1.isInteractive()) {
+ const message = {
+ name,
+ timestamp: new Date().toISOString(),
+ session_id: sysconfig.machine,
+ source: 'capacitor_cli',
+ value: data,
+ };
+ await ipc_1.send({ type: 'telemetry', data: message });
+ }
+ else {
+ debug('Telemetry is off (user choice, non-interactive terminal, or CI)--not sending metric');
+ }
+}
+exports.sendMetric = sendMetric;
+async function promptForTelemetry() {
+ const { confirm } = await log_1.logPrompt(`${colors_1.default.strong('Would you like to help improve Capacitor by sharing anonymous usage data? 💖')}\n` +
+ `Read more about what is being collected and why here: ${colors_1.default.strong('https://capacitorjs.com/telemetry')}. You can change your mind at any time by using the ${colors_1.default.input('npx cap telemetry')} command.`, {
+ type: 'confirm',
+ name: 'confirm',
+ message: 'Share anonymous usage data?',
+ initial: true,
+ });
+ if (confirm) {
+ log_1.output.write(exports.THANK_YOU);
+ }
+ return confirm;
+}
+/**
+ * Get a unique anonymous identifier for this app.
+ */
+async function getAppIdentifier(config) {
+ const { createHash } = await Promise.resolve().then(() => tslib_1.__importStar(require('crypto')));
+ // get the first commit hash, which should be universally unique
+ const output = await subprocess_1.getCommandOutput('git', ['rev-list', '--max-parents=0', 'HEAD'], { cwd: config.app.rootDir });
+ const firstLine = output === null || output === void 0 ? void 0 : output.split('\n')[0];
+ if (!firstLine) {
+ debug('Could not obtain unique app identifier');
+ return null;
+ }
+ // use sha1 to create a one-way hash to anonymize
+ const id = createHash('sha1').update(firstLine).digest('hex');
+ return id;
+}
+/**
+ * Walk through the command's parent tree and construct a space-separated name.
+ *
+ * Probably overkill because we don't have nested commands, but whatever.
+ */
+function getFullCommandName(cmd) {
+ const names = [];
+ while (cmd.parent !== null) {
+ names.push(cmd.name());
+ cmd = cmd.parent;
+ }
+ return names.reverse().join(' ');
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/cli.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/cli.js
new file mode 100644
index 00000000..55f8cbb7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/cli.js
@@ -0,0 +1,25 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.wrapAction = exports.ENV_PATHS = void 0;
+const tslib_1 = require("tslib");
+const env_paths_1 = tslib_1.__importDefault(require("env-paths"));
+const errors_1 = require("../errors");
+const log_1 = require("../log");
+exports.ENV_PATHS = env_paths_1.default('capacitor', { suffix: '' });
+function wrapAction(action) {
+ return async (...args) => {
+ try {
+ await action(...args);
+ }
+ catch (e) {
+ if (errors_1.isFatal(e)) {
+ process.exitCode = e.exitCode;
+ log_1.logger.error(e.message);
+ }
+ else {
+ throw e;
+ }
+ }
+ };
+}
+exports.wrapAction = wrapAction;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/emoji.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/emoji.js
new file mode 100644
index 00000000..00a9dbc8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/emoji.js
@@ -0,0 +1,13 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.emoji = void 0;
+// Emoji falback, right now just uses fallback on windows,
+// but could expand to be more sophisticated to allow emoji
+// on Hyper term on windows, for example.
+const emoji = (x, fallback) => {
+ if (process.platform === 'win32') {
+ return fallback;
+ }
+ return x;
+};
+exports.emoji = emoji;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/fn.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/fn.js
new file mode 100644
index 00000000..9c99b90e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/fn.js
@@ -0,0 +1,13 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.tryFn = void 0;
+const tryFn = async (fn, ...args) => {
+ try {
+ return await fn(...args);
+ }
+ catch {
+ // ignore
+ }
+ return null;
+};
+exports.tryFn = tryFn;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/fs.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/fs.js
new file mode 100644
index 00000000..1901c14d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/fs.js
@@ -0,0 +1,7 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.convertToUnixPath = void 0;
+const convertToUnixPath = (path) => {
+ return path.replace(/\\/g, '/');
+};
+exports.convertToUnixPath = convertToUnixPath;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/js.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/js.js
new file mode 100644
index 00000000..ceabcda1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/js.js
@@ -0,0 +1,21 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.formatJSObject = void 0;
+const tslib_1 = require("tslib");
+const util_1 = tslib_1.__importDefault(require("util"));
+function formatJSObject(o) {
+ try {
+ o = JSON.parse(JSON.stringify(o));
+ }
+ catch (e) {
+ throw new Error(`Cannot parse object as JSON: ${e.stack ? e.stack : e}`);
+ }
+ return util_1.default.inspect(o, {
+ compact: false,
+ breakLength: Infinity,
+ depth: Infinity,
+ maxArrayLength: Infinity,
+ maxStringLength: Infinity,
+ });
+}
+exports.formatJSObject = formatJSObject;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/native-run.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/native-run.js
new file mode 100644
index 00000000..f2422882
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/native-run.js
@@ -0,0 +1,53 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.getPlatformTargets = exports.runNativeRun = void 0;
+const tslib_1 = require("tslib");
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const errors_1 = require("../errors");
+const node_1 = require("./node");
+const subprocess_1 = require("./subprocess");
+async function runNativeRun(args, options = {}) {
+ const p = node_1.resolveNode(__dirname, path_1.dirname('native-run/package'), 'bin/native-run');
+ if (!p) {
+ errors_1.fatal(`${colors_1.default.input('native-run')} not found.`);
+ }
+ return await subprocess_1.runCommand(p, args, options);
+}
+exports.runNativeRun = runNativeRun;
+async function getPlatformTargets(platformName) {
+ const errors = [];
+ try {
+ const output = await runNativeRun([platformName, '--list', '--json']);
+ const parsedOutput = JSON.parse(output);
+ if (parsedOutput.devices.length || parsedOutput.virtualDevices.length) {
+ return [
+ ...parsedOutput.devices.map((t) => ({ ...t, virtual: false })),
+ ...parsedOutput.virtualDevices.map((t) => ({
+ ...t,
+ virtual: true,
+ })),
+ ];
+ }
+ else {
+ parsedOutput.errors.map((e) => {
+ errors.push(e);
+ });
+ }
+ }
+ catch (e) {
+ const err = JSON.parse(e);
+ errors.push(err);
+ }
+ const plural = errors.length > 1 ? 's' : '';
+ const errMsg = `${colors_1.default.strong('native-run')} failed with error${plural}\n
+ ${errors
+ .map((e) => {
+ return `\t${colors_1.default.strong(e.code)}: ${e.error}`;
+ })
+ .join('\n')}
+ \n\tMore details for this error${plural} may be available online: ${colors_1.default.strong('https://github.com/ionic-team/native-run/wiki/Android-Errors')}
+ `;
+ throw errMsg;
+}
+exports.getPlatformTargets = getPlatformTargets;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/node.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/node.js
new file mode 100644
index 00000000..2aedf718
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/node.js
@@ -0,0 +1,49 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.resolveNode = exports.requireTS = void 0;
+const utils_fs_1 = require("@ionic/utils-fs");
+const path_1 = require("path");
+/**
+ * @see https://github.com/ionic-team/stencil/blob/HEAD/src/compiler/sys/node-require.ts
+ */
+const requireTS = (ts, p) => {
+ const id = path_1.resolve(p);
+ delete require.cache[id];
+ require.extensions['.ts'] = (module, fileName) => {
+ var _a;
+ let sourceText = utils_fs_1.readFileSync(fileName, 'utf8');
+ if (fileName.endsWith('.ts')) {
+ const tsResults = ts.transpileModule(sourceText, {
+ fileName,
+ compilerOptions: {
+ module: ts.ModuleKind.CommonJS,
+ moduleResolution: ts.ModuleResolutionKind.NodeJs,
+ esModuleInterop: true,
+ strict: true,
+ target: ts.ScriptTarget.ES2017,
+ },
+ reportDiagnostics: true,
+ });
+ sourceText = tsResults.outputText;
+ }
+ else {
+ // quick hack to turn a modern es module
+ // into and old school commonjs module
+ sourceText = sourceText.replace(/export\s+\w+\s+(\w+)/gm, 'exports.$1');
+ }
+ (_a = module._compile) === null || _a === void 0 ? void 0 : _a.call(module, sourceText, fileName);
+ };
+ const m = require(id); // eslint-disable-line @typescript-eslint/no-var-requires
+ delete require.extensions['.ts'];
+ return m;
+};
+exports.requireTS = requireTS;
+function resolveNode(root, ...pathSegments) {
+ try {
+ return require.resolve(pathSegments.join('/'), { paths: [root] });
+ }
+ catch (e) {
+ return null;
+ }
+}
+exports.resolveNode = resolveNode;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/promise.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/promise.js
new file mode 100644
index 00000000..05c86c67
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/promise.js
@@ -0,0 +1,35 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.lazy = exports.LazyPromise = exports.allSerial = void 0;
+function allSerial(funcs) {
+ return funcs.reduce((promise, func) => promise.then(result => func().then(x => result.concat(x))), Promise.resolve([]));
+}
+exports.allSerial = allSerial;
+class LazyPromise extends Promise {
+ constructor(executor) {
+ super(() => {
+ /* ignore */
+ });
+ this._executor = executor;
+ }
+ then(onfulfilled, onrejected) {
+ this._promise = this._promise || new Promise(this._executor);
+ return this._promise.then(onfulfilled, onrejected);
+ }
+ catch(onrejected) {
+ this._promise = this._promise || new Promise(this._executor);
+ return this._promise.catch(onrejected);
+ }
+}
+exports.LazyPromise = LazyPromise;
+function lazy(fn) {
+ return new LazyPromise(async (resolve, reject) => {
+ try {
+ resolve(await fn());
+ }
+ catch (e) {
+ reject(e);
+ }
+ });
+}
+exports.lazy = lazy;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/subprocess.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/subprocess.js
new file mode 100644
index 00000000..37f4f657
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/subprocess.js
@@ -0,0 +1,43 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.isInstalled = exports.getCommandOutput = exports.runCommand = void 0;
+const utils_subprocess_1 = require("@ionic/utils-subprocess");
+async function runCommand(command, args, options = {}) {
+ const p = new utils_subprocess_1.Subprocess(command, args, options);
+ try {
+ return await p.output();
+ }
+ catch (e) {
+ if (e instanceof utils_subprocess_1.SubprocessError) {
+ // old behavior of just throwing the stdout/stderr strings
+ throw e.output
+ ? e.output
+ : e.code
+ ? e.code
+ : e.error
+ ? e.error.message
+ : 'Unknown error';
+ }
+ throw e;
+ }
+}
+exports.runCommand = runCommand;
+async function getCommandOutput(command, args, options = {}) {
+ try {
+ return (await runCommand(command, args, options)).trim();
+ }
+ catch (e) {
+ return null;
+ }
+}
+exports.getCommandOutput = getCommandOutput;
+async function isInstalled(command) {
+ try {
+ await utils_subprocess_1.which(command);
+ }
+ catch (e) {
+ return false;
+ }
+ return true;
+}
+exports.isInstalled = isInstalled;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/template.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/template.js
new file mode 100644
index 00000000..a94d9691
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/template.js
@@ -0,0 +1,11 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.extractTemplate = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const tar_1 = tslib_1.__importDefault(require("tar"));
+async function extractTemplate(src, dir) {
+ await utils_fs_1.mkdirp(dir);
+ await tar_1.default.extract({ file: src, cwd: dir });
+}
+exports.extractTemplate = extractTemplate;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/term.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/term.js
new file mode 100644
index 00000000..08c59fc6
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/term.js
@@ -0,0 +1,30 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.isInteractive = exports.checkInteractive = void 0;
+const tslib_1 = require("tslib");
+const utils_terminal_1 = require("@ionic/utils-terminal");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const log_1 = require("../log");
+// Given input variables to a command, make sure all are provided if the terminal
+// is not interactive (because we won't be able to prompt the user)
+const checkInteractive = (...args) => {
+ if (exports.isInteractive()) {
+ return true;
+ }
+ // Fail if no args are provided, treat this as just a check of whether the term is
+ // interactive or not.
+ if (!args.length) {
+ return false;
+ }
+ // Make sure none of the provided args are empty, otherwise print the interactive
+ // warning and return false
+ if (args.filter(arg => !arg).length) {
+ log_1.logger.error(`Non-interactive shell detected.\n` +
+ `Run the command with ${colors_1.default.input('--help')} to see a list of arguments that must be provided.`);
+ return false;
+ }
+ return true;
+};
+exports.checkInteractive = checkInteractive;
+const isInteractive = () => utils_terminal_1.TERMINAL_INFO.tty && !utils_terminal_1.TERMINAL_INFO.ci;
+exports.isInteractive = isInteractive;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/uuid.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/uuid.js
new file mode 100644
index 00000000..5391cb82
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/uuid.js
@@ -0,0 +1,11 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.uuidv4 = void 0;
+function uuidv4() {
+ return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, c => {
+ const r = (Math.random() * 16) | 0;
+ const v = c == 'x' ? r : (r & 0x3) | 0x8;
+ return v.toString(16);
+ });
+}
+exports.uuidv4 = uuidv4;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/xml.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/xml.js
new file mode 100644
index 00000000..7f63f412
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/util/xml.js
@@ -0,0 +1,54 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.buildXmlElement = exports.writeXML = exports.parseXML = exports.readXML = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const xml2js_1 = tslib_1.__importDefault(require("xml2js"));
+async function readXML(path) {
+ var _a;
+ try {
+ const xmlStr = await utils_fs_1.readFile(path, { encoding: 'utf-8' });
+ try {
+ return await xml2js_1.default.parseStringPromise(xmlStr);
+ }
+ catch (e) {
+ throw `Error parsing: ${path}, ${(_a = e.stack) !== null && _a !== void 0 ? _a : e}`;
+ }
+ }
+ catch (e) {
+ throw `Unable to read: ${path}`;
+ }
+}
+exports.readXML = readXML;
+function parseXML(xmlStr) {
+ let xmlObj;
+ xml2js_1.default.parseString(xmlStr, (err, result) => {
+ if (!err) {
+ xmlObj = result;
+ }
+ });
+ return xmlObj;
+}
+exports.parseXML = parseXML;
+async function writeXML(object) {
+ return new Promise(resolve => {
+ const builder = new xml2js_1.default.Builder({
+ headless: true,
+ explicitRoot: false,
+ rootName: 'deleteme',
+ });
+ let xml = builder.buildObject(object);
+ xml = xml.replace('', '').replace('', '');
+ resolve(xml);
+ });
+}
+exports.writeXML = writeXML;
+function buildXmlElement(configElement, rootName) {
+ const builder = new xml2js_1.default.Builder({
+ headless: true,
+ explicitRoot: false,
+ rootName: rootName,
+ });
+ return builder.buildObject(configElement);
+}
+exports.buildXmlElement = buildXmlElement;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/web/copy.js b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/web/copy.js
new file mode 100644
index 00000000..7f8bfe33
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/dist/web/copy.js
@@ -0,0 +1,22 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.copyWeb = void 0;
+const tslib_1 = require("tslib");
+const utils_fs_1 = require("@ionic/utils-fs");
+const path_1 = require("path");
+const colors_1 = tslib_1.__importDefault(require("../colors"));
+const common_1 = require("../common");
+const errors_1 = require("../errors");
+const node_1 = require("../util/node");
+async function copyWeb(config) {
+ if (config.app.bundledWebRuntime) {
+ const runtimePath = node_1.resolveNode(config.app.rootDir, '@capacitor/core', 'dist', 'capacitor.js');
+ if (!runtimePath) {
+ errors_1.fatal(`Unable to find ${colors_1.default.strong('node_modules/@capacitor/core/dist/capacitor.js')}.\n` + `Are you sure ${colors_1.default.strong('@capacitor/core')} is installed?`);
+ }
+ return common_1.runTask(`Copying ${colors_1.default.strong('capacitor.js')} to web dir`, () => {
+ return utils_fs_1.copy(runtimePath, path_1.join(config.app.webDirAbs, 'capacitor.js'));
+ });
+ }
+}
+exports.copyWeb = copyWeb;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/cli/package.json b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/package.json
new file mode 100644
index 00000000..3c1d74c3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/cli/package.json
@@ -0,0 +1,89 @@
+{
+ "name": "@capacitor/cli",
+ "version": "3.5.0",
+ "description": "Capacitor: Cross-platform apps with JavaScript and the web",
+ "homepage": "https://capacitorjs.com",
+ "author": "Ionic Team (https://ionic.io)",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/ionic-team/capacitor.git"
+ },
+ "bugs": {
+ "url": "https://github.com/ionic-team/capacitor/issues"
+ },
+ "files": [
+ "assets/",
+ "bin/",
+ "dist/**/*.js",
+ "dist/declarations.d.ts"
+ ],
+ "keywords": [
+ "ionic",
+ "ionic framework",
+ "capacitor",
+ "universal app",
+ "progressive web apps",
+ "cross platform"
+ ],
+ "engines": {
+ "node": ">=12.4.0"
+ },
+ "main": "dist/index.js",
+ "types": "dist/declarations.d.ts",
+ "bin": {
+ "capacitor": "./bin/capacitor",
+ "cap": "./bin/capacitor"
+ },
+ "scripts": {
+ "build": "npm run clean && npm run assets && tsc",
+ "clean": "rimraf ./dist",
+ "assets": "node ../scripts/pack-cli-assets.mjs",
+ "prepublishOnly": "npm run build",
+ "test": "jest -i",
+ "watch": "npm run assets && tsc -w"
+ },
+ "dependencies": {
+ "@ionic/cli-framework-output": "^2.2.1",
+ "@ionic/utils-fs": "^3.1.5",
+ "@ionic/utils-subprocess": "^2.1.6",
+ "@ionic/utils-terminal": "^2.3.0",
+ "commander": "^6.0.0",
+ "debug": "^4.2.0",
+ "env-paths": "^2.2.0",
+ "kleur": "^4.1.1",
+ "native-run": "^1.5.0",
+ "open": "^7.4.2",
+ "plist": "^3.0.2",
+ "prompts": "^2.3.2",
+ "semver": "^7.3.2",
+ "tar": "^6.1.11",
+ "tslib": "^2.1.0",
+ "xml2js": "^0.4.23"
+ },
+ "devDependencies": {
+ "@types/debug": "^4.1.5",
+ "@types/fs-extra": "^9.0.1",
+ "@types/jest": "^26.0.4",
+ "@types/open": "^6.1.0",
+ "@types/plist": "^3.0.2",
+ "@types/prompts": "^2.0.8",
+ "@types/semver": "^7.3.1",
+ "@types/slice-ansi": "^4.0.0",
+ "@types/tar": "^4.0.4",
+ "@types/tmp": "^0.2.0",
+ "@types/xml2js": "0.4.5",
+ "jest": "^26.1.0",
+ "rimraf": "^3.0.2",
+ "tmp": "^0.2.1",
+ "ts-jest": "^26.1.3",
+ "typescript": "~4.1.2"
+ },
+ "jest": {
+ "preset": "ts-jest"
+ },
+ "publishConfig": {
+ "access": "public"
+ },
+ "gitHead": "f03e1a67140c8af25288456f9e99dd6234b50f25"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@capacitor/core/CHANGELOG.md
new file mode 100644
index 00000000..7c5ef69f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/CHANGELOG.md
@@ -0,0 +1,409 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+# [3.5.0](https://github.com/ionic-team/capacitor/compare/3.4.3...3.5.0) (2022-04-22)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.4.3](https://github.com/ionic-team/capacitor/compare/3.4.2...3.4.3) (2022-03-04)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.4.2](https://github.com/ionic-team/capacitor/compare/3.4.1...3.4.2) (2022-03-03)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.4.1](https://github.com/ionic-team/capacitor/compare/3.4.0...3.4.1) (2022-02-09)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.4.0](https://github.com/ionic-team/capacitor/compare/3.3.4...3.4.0) (2022-01-19)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.3.4](https://github.com/ionic-team/capacitor/compare/3.3.3...3.3.4) (2022-01-05)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.3.3](https://github.com/ionic-team/capacitor/compare/3.3.2...3.3.3) (2021-12-08)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.3.2](https://github.com/ionic-team/capacitor/compare/3.3.1...3.3.2) (2021-11-17)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.3.1](https://github.com/ionic-team/capacitor/compare/3.3.0...3.3.1) (2021-11-05)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.3.0](https://github.com/ionic-team/capacitor/compare/3.2.5...3.3.0) (2021-11-03)
+
+
+### Bug Fixes
+
+* **core:** avoid crash on logging circular objects ([#5186](https://github.com/ionic-team/capacitor/issues/5186)) ([1451ec8](https://github.com/ionic-team/capacitor/commit/1451ec850a9ef73267a032638e73f1fc440647b9))
+
+
+
+
+
+## [3.2.5](https://github.com/ionic-team/capacitor/compare/3.2.4...3.2.5) (2021-10-13)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.2.4](https://github.com/ionic-team/capacitor/compare/3.2.3...3.2.4) (2021-09-27)
+
+
+### Bug Fixes
+
+* **ios:** show correct line number on console logs ([#5073](https://github.com/ionic-team/capacitor/issues/5073)) ([ec41e74](https://github.com/ionic-team/capacitor/commit/ec41e743aa4ba81e791ad446fac461b7f43b46ed))
+
+
+
+
+
+## [3.2.3](https://github.com/ionic-team/capacitor/compare/3.2.2...3.2.3) (2021-09-15)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.2.2](https://github.com/ionic-team/capacitor/compare/3.2.1...3.2.2) (2021-09-02)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.2.1](https://github.com/ionic-team/capacitor/compare/3.2.0...3.2.1) (2021-09-01)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.2.0](https://github.com/ionic-team/capacitor/compare/3.1.2...3.2.0) (2021-08-18)
+
+
+### Features
+
+* **core:** implement CapacitorCustomPlatform for 3rd party platforms ([#4771](https://github.com/ionic-team/capacitor/issues/4771)) ([12c6294](https://github.com/ionic-team/capacitor/commit/12c6294b9eb82976b1322f00da9ba5a6004f7977))
+
+
+
+
+
+## [3.1.2](https://github.com/ionic-team/capacitor/compare/3.1.1...3.1.2) (2021-07-21)
+
+
+### Bug Fixes
+
+* **core:** handle toJSON() in plugin objects ([#4823](https://github.com/ionic-team/capacitor/issues/4823)) ([0479822](https://github.com/ionic-team/capacitor/commit/04798221666437408f22947253a18ccb4f9e409e))
+* **core:** Modify safeStringify to allow multiple null values ([#4853](https://github.com/ionic-team/capacitor/issues/4853)) ([854539b](https://github.com/ionic-team/capacitor/commit/854539b62a658e484954edbe38b25eea1b0b6f10))
+
+
+
+
+
+## [3.1.1](https://github.com/ionic-team/capacitor/compare/3.1.0...3.1.1) (2021-07-07)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.1.0](https://github.com/ionic-team/capacitor/compare/3.0.2...3.1.0) (2021-07-07)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+## [3.0.2](https://github.com/ionic-team/capacitor/compare/3.0.1...3.0.2) (2021-06-23)
+
+
+### Bug Fixes
+
+* **core:** cordova events not firing ([#4712](https://github.com/ionic-team/capacitor/issues/4712)) ([ca4e3b6](https://github.com/ionic-team/capacitor/commit/ca4e3b62dba6a40e593a1404ba2fe2b416a4ac14))
+
+
+
+
+
+## [3.0.1](https://github.com/ionic-team/capacitor/compare/3.0.0...3.0.1) (2021-06-09)
+
+
+### Bug Fixes
+
+* Make isPluginAvailable available on bridge ([#4589](https://github.com/ionic-team/capacitor/issues/4589)) ([151e7a8](https://github.com/ionic-team/capacitor/commit/151e7a899d9646dbd5625a2539fd3f2297349bc5))
+
+
+
+
+
+# [3.0.0](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.4...3.0.0) (2021-05-18)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.0.0-rc.4](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.3...3.0.0-rc.4) (2021-05-18)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.0.0-rc.3](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.2...3.0.0-rc.3) (2021-05-11)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.0.0-rc.2](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.1...3.0.0-rc.2) (2021-05-07)
+
+
+### Bug Fixes
+
+* **bridge:** Fix type errors with new Platforms API ([#4524](https://github.com/ionic-team/capacitor/issues/4524)) ([7bbaea8](https://github.com/ionic-team/capacitor/commit/7bbaea85494c53a950abab40bb77f37087e22abe))
+* **bridge:** Safely JSON.Stringify circular json on log ([#4507](https://github.com/ionic-team/capacitor/issues/4507)) ([e4c8fe4](https://github.com/ionic-team/capacitor/commit/e4c8fe41ec3992df5c20e4d0d3b69240ce672e44)), closes [#4506](https://github.com/ionic-team/capacitor/issues/4506)
+
+
+### Features
+
+* **core:** platforms api ([#4255](https://github.com/ionic-team/capacitor/issues/4255)) ([7d62713](https://github.com/ionic-team/capacitor/commit/7d6271369cb15eeab07c0bc7f606de6447a17cd4))
+
+
+
+
+
+# [3.0.0-rc.1](https://github.com/ionic-team/capacitor/compare/3.0.0-rc.0...3.0.0-rc.1) (2021-04-29)
+
+
+### Bug Fixes
+
+* **core:** Call native implementation before web implementation ([#4493](https://github.com/ionic-team/capacitor/issues/4493)) ([febd606](https://github.com/ionic-team/capacitor/commit/febd60617ab60a3b34132f68f212e9a867d1b434))
+* **core:** Use web listener if there is no native implementation ([#4488](https://github.com/ionic-team/capacitor/issues/4488)) ([196d843](https://github.com/ionic-team/capacitor/commit/196d843a3c9442c5dc6cf61bfe3494fa399dec4f))
+
+
+### Features
+
+* Unify logging behavior across environments ([#4416](https://github.com/ionic-team/capacitor/issues/4416)) ([bae0f3d](https://github.com/ionic-team/capacitor/commit/bae0f3d2cee84978636d0f589bc7e2f745671baf))
+
+
+
+
+
+# [3.0.0-rc.0](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.6...3.0.0-rc.0) (2021-03-10)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.0.0-beta.6](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.5...3.0.0-beta.6) (2021-02-27)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.0.0-beta.5](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.4...3.0.0-beta.5) (2021-02-27)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.0.0-beta.3](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.2...3.0.0-beta.3) (2021-02-18)
+
+
+### Bug Fixes
+
+* **core:** do not add window.cordova on web apps ([#4214](https://github.com/ionic-team/capacitor/issues/4214)) ([6d673ef](https://github.com/ionic-team/capacitor/commit/6d673ef7076f00c37eac0f801c4c487415df6d4d))
+
+
+
+
+
+# [3.0.0-beta.2](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.1...3.0.0-beta.2) (2021-02-08)
+
+
+### Bug Fixes
+
+* **core:** handle js.error messages to fix window error handler ([#4124](https://github.com/ionic-team/capacitor/issues/4124)) ([c0deb1d](https://github.com/ionic-team/capacitor/commit/c0deb1de349f5631af08eecbffc0ea4dea97c60d))
+* address bug in `isPluginAvailable()` for web and native ([#4114](https://github.com/ionic-team/capacitor/issues/4114)) ([2fbd954](https://github.com/ionic-team/capacitor/commit/2fbd95465a321b8f4c50d4daf22a63d8043cee9b))
+* **core:** fix another $$typeof issue ([#4113](https://github.com/ionic-team/capacitor/issues/4113)) ([4cbae41](https://github.com/ionic-team/capacitor/commit/4cbae41908670ab843bea5850da7a2cf1082afdb))
+
+
+
+
+
+# [3.0.0-beta.1](https://github.com/ionic-team/capacitor/compare/3.0.0-beta.0...3.0.0-beta.1) (2021-01-14)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.0.0-beta.0](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.14...3.0.0-beta.0) (2021-01-13)
+
+
+### Features
+
+* **core:** add commonjs output format ([#4064](https://github.com/ionic-team/capacitor/issues/4064)) ([74b7be8](https://github.com/ionic-team/capacitor/commit/74b7be89ef1bbf13ccd103410037cfe81c8fc124))
+
+
+
+
+
+# [3.0.0-alpha.12](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.11...3.0.0-alpha.12) (2021-01-08)
+
+
+### Bug Fixes
+
+* **core:** fix $$typeof() not implemented error ([#4013](https://github.com/ionic-team/capacitor/issues/4013)) ([c7f80b5](https://github.com/ionic-team/capacitor/commit/c7f80b577c1de60cd0a105f3aaf0d1c314f3150d))
+
+
+
+
+
+# [3.0.0-alpha.9](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.8...3.0.0-alpha.9) (2020-12-15)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+
+
+# [3.0.0-alpha.8](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.7...3.0.0-alpha.8) (2020-12-15)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+# [3.0.0-alpha.7](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.6...3.0.0-alpha.7) (2020-12-02)
+
+
+### Bug Fixes
+
+* **core:** export PermissionState ([#3775](https://github.com/ionic-team/capacitor/issues/3775)) ([2d5ac96](https://github.com/ionic-team/capacitor/commit/2d5ac963d131a704628f8a421be8429b9f63cf61))
+
+
+
+# [3.0.0-alpha.6](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.5...3.0.0-alpha.6) (2020-10-30)
+
+
+### Features
+
+* improve permissions ([eec61a6](https://github.com/ionic-team/capacitor/commit/eec61a6d8d8edfe94aea1a361787d1e6c736e20d))
+* unified errors and error codes ([#3673](https://github.com/ionic-team/capacitor/issues/3673)) ([f9e0803](https://github.com/ionic-team/capacitor/commit/f9e08038aa88f7453e8235f380d2767a12a7a073))
+
+
+
+
+
+# [3.0.0-alpha.5](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.4...3.0.0-alpha.5) (2020-10-06)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+# [3.0.0-alpha.4](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.3...3.0.0-alpha.4) (2020-09-23)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+# [3.0.0-alpha.3](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.2...3.0.0-alpha.3) (2020-09-15)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+# [3.0.0-alpha.2](https://github.com/ionic-team/capacitor/compare/3.0.0-alpha.1...3.0.0-alpha.2) (2020-08-31)
+
+**Note:** Version bump only for package @capacitor/core
+
+
+
+# [3.0.0-alpha.1](https://github.com/ionic-team/capacitor/compare/2.4.0...3.0.0-alpha.1) (2020-08-21)
+
+
+### Bug Fixes
+
+* **core:** provide mock implementation for unimplemented platforms ([#3352](https://github.com/ionic-team/capacitor/issues/3352)) ([befe230](https://github.com/ionic-team/capacitor/commit/befe2300435dbd54b22882fb6586c722f5ef466d))
+* **core:** use more explicit result for Browser plugin events ([#3349](https://github.com/ionic-team/capacitor/issues/3349)) ([75f99d4](https://github.com/ionic-team/capacitor/commit/75f99d4de62a6afb2da0ff876ed3b0d351040184))
+* **core:** use own type for backButton event result ([#3348](https://github.com/ionic-team/capacitor/issues/3348)) ([05d0e45](https://github.com/ionic-team/capacitor/commit/05d0e457eb69d5d39c8bb1d0117bc3d31afdca93))
+
+
+### Features
+
+* **core:** add unsupported browser exception ([#3389](https://github.com/ionic-team/capacitor/issues/3389)) ([c51e8f8](https://github.com/ionic-team/capacitor/commit/c51e8f8960c795421b35ad1fdd1cd6afbd7a7dfc))
+
+
+
+# [3.0.0-alpha.0](https://github.com/ionic-team/capacitor/compare/2.3.0...3.0.0-alpha.0) (2020-07-23)
+
+
+### Features
+
+* **core:** add `registerPlugin` for importing from plugin packages ([#3305](https://github.com/ionic-team/capacitor/issues/3305)) ([95475cc](https://github.com/ionic-team/capacitor/commit/95475cceb4cbd5be2cc7e18f2cf3045eb6c6f7fd))
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/LICENSE b/temporary_modules/trezor-connect/node_modules/@capacitor/core/LICENSE
new file mode 100644
index 00000000..94106147
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/LICENSE
@@ -0,0 +1,23 @@
+Copyright 2017-present Ionic
+https://ionic.io
+
+MIT License
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/README.md b/temporary_modules/trezor-connect/node_modules/@capacitor/core/README.md
new file mode 100644
index 00000000..e877ef3a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/README.md
@@ -0,0 +1,3 @@
+# Capacitor Core JS
+
+See the [Capacitor website](https://capacitorjs.com) for more information.
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/cordova.js b/temporary_modules/trezor-connect/node_modules/@capacitor/core/cordova.js
new file mode 100644
index 00000000..0e46e669
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/cordova.js
@@ -0,0 +1,1689 @@
+// Platform: Capacitor
+/*
+ Licensed to the Apache Software Foundation (ASF) under one
+ or more contributor license agreements. See the NOTICE file
+ distributed with this work for additional information
+ regarding copyright ownership. The ASF licenses this file
+ to you under the Apache License, Version 2.0 (the
+ "License"); you may not use this file except in compliance
+ with the License. You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing,
+ software distributed under the License is distributed on an
+ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ KIND, either express or implied. See the License for the
+ specific language governing permissions and limitations
+ under the License.
+*/
+(function () {
+ var PLATFORM_VERSION_BUILD_LABEL = '1.0.0';
+ // file: src/scripts/require.js
+
+ /* jshint -W079 */
+ /* jshint -W020 */
+
+ var require;
+ var define;
+
+ (function () {
+ var modules = {};
+ // Stack of moduleIds currently being built.
+ var requireStack = [];
+ // Map of module ID -> index into requireStack of modules currently being built.
+ var inProgressModules = {};
+ var SEPARATOR = '.';
+
+ function build(module) {
+ var factory = module.factory;
+ var localRequire = function (id) {
+ var resultantId = id;
+ // Its a relative path, so lop off the last portion and add the id (minus "./")
+ if (id.charAt(0) === '.') {
+ resultantId =
+ module.id.slice(0, module.id.lastIndexOf(SEPARATOR)) +
+ SEPARATOR +
+ id.slice(2);
+ }
+ return require(resultantId);
+ };
+ module.exports = {};
+ delete module.factory;
+ factory(localRequire, module.exports, module);
+ return module.exports;
+ }
+
+ require = function (id) {
+ if (!modules[id]) {
+ throw 'module ' + id + ' not found';
+ } else if (id in inProgressModules) {
+ var cycle =
+ requireStack.slice(inProgressModules[id]).join('->') + '->' + id;
+ throw 'Cycle in require graph: ' + cycle;
+ }
+ if (modules[id].factory) {
+ try {
+ inProgressModules[id] = requireStack.length;
+ requireStack.push(id);
+ return build(modules[id]);
+ } finally {
+ delete inProgressModules[id];
+ requireStack.pop();
+ }
+ }
+ return modules[id].exports;
+ };
+
+ define = function (id, factory) {
+ if (modules[id]) {
+ throw 'module ' + id + ' already defined';
+ }
+
+ modules[id] = {
+ id: id,
+ factory: factory,
+ };
+ };
+
+ define.remove = function (id) {
+ delete modules[id];
+ };
+
+ define.moduleMap = modules;
+ })();
+
+ // Export for use in node
+ if (typeof module === 'object' && typeof require === 'function') {
+ module.exports.require = require;
+ module.exports.define = define;
+ }
+
+ // file: src/cordova.js
+ define('cordova', function (require, exports, module) {
+ var channel = require('cordova/channel');
+ var platform = require('cordova/platform');
+
+ /**
+ * Intercept calls to addEventListener + removeEventListener and handle deviceready,
+ * resume, and pause events.
+ */
+ var m_document_addEventListener = document.addEventListener;
+ var m_document_removeEventListener = document.removeEventListener;
+ var m_window_addEventListener = window.addEventListener;
+ var m_window_removeEventListener = window.removeEventListener;
+
+ /**
+ * Houses custom event handlers to intercept on document + window event listeners.
+ */
+ var documentEventHandlers = {};
+ var windowEventHandlers = {};
+
+ document.addEventListener = function (evt, handler, capture) {
+ var e = evt.toLowerCase();
+ if (typeof documentEventHandlers[e] !== 'undefined') {
+ documentEventHandlers[e].subscribe(handler);
+ } else {
+ m_document_addEventListener.call(document, evt, handler, capture);
+ }
+ };
+
+ window.addEventListener = function (evt, handler, capture) {
+ var e = evt.toLowerCase();
+ if (typeof windowEventHandlers[e] !== 'undefined') {
+ windowEventHandlers[e].subscribe(handler);
+ } else {
+ m_window_addEventListener.call(window, evt, handler, capture);
+ }
+ };
+
+ document.removeEventListener = function (evt, handler, capture) {
+ var e = evt.toLowerCase();
+ // If unsubscribing from an event that is handled by a plugin
+ if (typeof documentEventHandlers[e] !== 'undefined') {
+ documentEventHandlers[e].unsubscribe(handler);
+ } else {
+ m_document_removeEventListener.call(document, evt, handler, capture);
+ }
+ };
+
+ window.removeEventListener = function (evt, handler, capture) {
+ var e = evt.toLowerCase();
+ // If unsubscribing from an event that is handled by a plugin
+ if (typeof windowEventHandlers[e] !== 'undefined') {
+ windowEventHandlers[e].unsubscribe(handler);
+ } else {
+ m_window_removeEventListener.call(window, evt, handler, capture);
+ }
+ };
+
+ /* eslint-disable no-undef */
+ var cordova = {
+ define: define,
+ require: require,
+ version: PLATFORM_VERSION_BUILD_LABEL,
+ platformVersion: PLATFORM_VERSION_BUILD_LABEL,
+ platformId: platform.id,
+
+ /* eslint-enable no-undef */
+
+ /**
+ * Methods to add/remove your own addEventListener hijacking on document + window.
+ */
+ addWindowEventHandler: function (event) {
+ return (windowEventHandlers[event] = channel.create(event));
+ },
+ addStickyDocumentEventHandler: function (event) {
+ return (documentEventHandlers[event] = channel.createSticky(event));
+ },
+ addDocumentEventHandler: function (event) {
+ return (documentEventHandlers[event] = channel.create(event));
+ },
+ removeWindowEventHandler: function (event) {
+ delete windowEventHandlers[event];
+ },
+ removeDocumentEventHandler: function (event) {
+ delete documentEventHandlers[event];
+ },
+ /**
+ * Retrieve original event handlers that were replaced by Cordova
+ *
+ * @return object
+ */
+ getOriginalHandlers: function () {
+ return {
+ document: {
+ addEventListener: m_document_addEventListener,
+ removeEventListener: m_document_removeEventListener,
+ },
+ window: {
+ addEventListener: m_window_addEventListener,
+ removeEventListener: m_window_removeEventListener,
+ },
+ };
+ },
+ /**
+ * Method to fire event from native code
+ * bNoDetach is required for events which cause an exception which needs to be caught in native code
+ */
+ fireDocumentEvent: function (type, data, bNoDetach) {
+ var evt = Capacitor.createEvent(type, data);
+ if (typeof documentEventHandlers[type] !== 'undefined') {
+ if (bNoDetach) {
+ documentEventHandlers[type].fire(evt);
+ } else {
+ setTimeout(function () {
+ // Fire deviceready on listeners that were registered before cordova.js was loaded.
+ if (type === 'deviceready') {
+ document.dispatchEvent(evt);
+ }
+ documentEventHandlers[type].fire(evt);
+ }, 0);
+ }
+ } else {
+ document.dispatchEvent(evt);
+ }
+ },
+ fireWindowEvent: function (type, data) {
+ var evt = Capacitor.createEvent(type, data);
+ if (typeof windowEventHandlers[type] !== 'undefined') {
+ setTimeout(function () {
+ windowEventHandlers[type].fire(evt);
+ }, 0);
+ } else {
+ window.dispatchEvent(evt);
+ }
+ },
+
+ /**
+ * Plugin callback mechanism.
+ */
+ // Randomize the starting callbackId to avoid collisions after refreshing or navigating.
+ // This way, it's very unlikely that any new callback would get the same callbackId as an old callback.
+ callbackId: Math.floor(Math.random() * 2000000000),
+ callbacks: {},
+ callbackStatus: {
+ NO_RESULT: 0,
+ OK: 1,
+ CLASS_NOT_FOUND_EXCEPTION: 2,
+ ILLEGAL_ACCESS_EXCEPTION: 3,
+ INSTANTIATION_EXCEPTION: 4,
+ MALFORMED_URL_EXCEPTION: 5,
+ IO_EXCEPTION: 6,
+ INVALID_ACTION: 7,
+ JSON_EXCEPTION: 8,
+ ERROR: 9,
+ },
+
+ /**
+ * Called by native code when returning successful result from an action.
+ */
+ callbackSuccess: function (callbackId, args) {
+ cordova.callbackFromNative(
+ callbackId,
+ true,
+ args.status,
+ [args.message],
+ args.keepCallback,
+ );
+ },
+
+ /**
+ * Called by native code when returning error result from an action.
+ */
+ callbackError: function (callbackId, args) {
+ // TODO: Deprecate callbackSuccess and callbackError in favour of callbackFromNative.
+ // Derive success from status.
+ cordova.callbackFromNative(
+ callbackId,
+ false,
+ args.status,
+ [args.message],
+ args.keepCallback,
+ );
+ },
+
+ /**
+ * Called by native code when returning the result from an action.
+ */
+ callbackFromNative: function (
+ callbackId,
+ isSuccess,
+ status,
+ args,
+ keepCallback,
+ ) {
+ try {
+ var callback = cordova.callbacks[callbackId];
+ if (callback) {
+ if (isSuccess && status === cordova.callbackStatus.OK) {
+ callback.success && callback.success.apply(null, args);
+ } else if (!isSuccess) {
+ callback.fail && callback.fail.apply(null, args);
+ }
+ /*
+ else
+ Note, this case is intentionally not caught.
+ this can happen if isSuccess is true, but callbackStatus is NO_RESULT
+ which is used to remove a callback from the list without calling the callbacks
+ typically keepCallback is false in this case
+ */
+ // Clear callback if not expecting any more results
+ if (!keepCallback) {
+ delete cordova.callbacks[callbackId];
+ }
+ }
+ } catch (err) {
+ var msg =
+ 'Error in ' +
+ (isSuccess ? 'Success' : 'Error') +
+ ' callbackId: ' +
+ callbackId +
+ ' : ' +
+ err;
+ console && console.log && console.log(msg);
+ cordova.fireWindowEvent('cordovacallbackerror', { message: msg });
+ throw err;
+ }
+ },
+ addConstructor: function (func) {
+ channel.onCordovaReady.subscribe(function () {
+ try {
+ func();
+ } catch (e) {
+ console.log('Failed to run constructor: ' + e);
+ }
+ });
+ },
+ };
+
+ module.exports = cordova;
+ });
+
+ // file: src/common/argscheck.js
+ define('cordova/argscheck', function (require, exports, module) {
+ var utils = require('cordova/utils');
+
+ var moduleExports = module.exports;
+
+ var typeMap = {
+ A: 'Array',
+ D: 'Date',
+ N: 'Number',
+ S: 'String',
+ F: 'Function',
+ O: 'Object',
+ };
+
+ function extractParamName(callee, argIndex) {
+ return /.*?\((.*?)\)/.exec(callee)[1].split(', ')[argIndex];
+ }
+
+ function checkArgs(spec, functionName, args, opt_callee) {
+ if (!moduleExports.enableChecks) {
+ return;
+ }
+ var errMsg = null;
+ var typeName;
+ for (var i = 0; i < spec.length; ++i) {
+ var c = spec.charAt(i);
+ var cUpper = c.toUpperCase();
+ var arg = args[i];
+ // Asterix means allow anything.
+ if (c === '*') {
+ continue;
+ }
+ typeName = utils.typeName(arg);
+ if ((arg === null || arg === undefined) && c === cUpper) {
+ continue;
+ }
+ if (typeName !== typeMap[cUpper]) {
+ errMsg = 'Expected ' + typeMap[cUpper];
+ break;
+ }
+ }
+ if (errMsg) {
+ errMsg += ', but got ' + typeName + '.';
+ errMsg =
+ 'Wrong type for parameter "' +
+ extractParamName(opt_callee || args.callee, i) +
+ '" of ' +
+ functionName +
+ ': ' +
+ errMsg;
+ // Don't log when running unit tests.
+ if (typeof jasmine === 'undefined') {
+ console.error(errMsg);
+ }
+ throw TypeError(errMsg);
+ }
+ }
+
+ function getValue(value, defaultValue) {
+ return value === undefined ? defaultValue : value;
+ }
+
+ moduleExports.checkArgs = checkArgs;
+ moduleExports.getValue = getValue;
+ moduleExports.enableChecks = true;
+ });
+
+ // file: src/common/base64.js
+ define('cordova/base64', function (require, exports, module) {
+ var base64 = exports;
+
+ base64.fromArrayBuffer = function (arrayBuffer) {
+ var array = new Uint8Array(arrayBuffer);
+ return uint8ToBase64(array);
+ };
+
+ base64.toArrayBuffer = function (str) {
+ var decodedStr =
+ typeof atob !== 'undefined'
+ ? atob(str)
+ : Buffer.from(str, 'base64').toString('binary'); // eslint-disable-line no-undef
+ var arrayBuffer = new ArrayBuffer(decodedStr.length);
+ var array = new Uint8Array(arrayBuffer);
+ for (var i = 0, len = decodedStr.length; i < len; i++) {
+ array[i] = decodedStr.charCodeAt(i);
+ }
+ return arrayBuffer;
+ };
+
+ // ------------------------------------------------------------------------------
+
+ /* This code is based on the performance tests at http://jsperf.com/b64tests
+ * This 12-bit-at-a-time algorithm was the best performing version on all
+ * platforms tested.
+ */
+
+ var b64_6bit =
+ 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
+ var b64_12bit;
+
+ var b64_12bitTable = function () {
+ b64_12bit = [];
+ for (var i = 0; i < 64; i++) {
+ for (var j = 0; j < 64; j++) {
+ b64_12bit[i * 64 + j] = b64_6bit[i] + b64_6bit[j];
+ }
+ }
+ b64_12bitTable = function () {
+ return b64_12bit;
+ };
+ return b64_12bit;
+ };
+
+ function uint8ToBase64(rawData) {
+ var numBytes = rawData.byteLength;
+ var output = '';
+ var segment;
+ var table = b64_12bitTable();
+ for (var i = 0; i < numBytes - 2; i += 3) {
+ segment = (rawData[i] << 16) + (rawData[i + 1] << 8) + rawData[i + 2];
+ output += table[segment >> 12];
+ output += table[segment & 0xfff];
+ }
+ if (numBytes - i === 2) {
+ segment = (rawData[i] << 16) + (rawData[i + 1] << 8);
+ output += table[segment >> 12];
+ output += b64_6bit[(segment & 0xfff) >> 6];
+ output += '=';
+ } else if (numBytes - i === 1) {
+ segment = rawData[i] << 16;
+ output += table[segment >> 12];
+ output += '==';
+ }
+ return output;
+ }
+ });
+
+ // file: src/common/builder.js
+ define('cordova/builder', function (require, exports, module) {
+ var utils = require('cordova/utils');
+
+ function each(objects, func, context) {
+ for (var prop in objects) {
+ if (objects.hasOwnProperty(prop)) {
+ func.apply(context, [objects[prop], prop]);
+ }
+ }
+ }
+
+ function clobber(obj, key, value) {
+ exports.replaceHookForTesting(obj, key);
+ var needsProperty = false;
+ try {
+ obj[key] = value;
+ } catch (e) {
+ needsProperty = true;
+ }
+ // Getters can only be overridden by getters.
+ if (needsProperty || obj[key] !== value) {
+ utils.defineGetter(obj, key, function () {
+ return value;
+ });
+ }
+ }
+
+ function assignOrWrapInDeprecateGetter(obj, key, value, message) {
+ if (message) {
+ utils.defineGetter(obj, key, function () {
+ console.log(message);
+ delete obj[key];
+ clobber(obj, key, value);
+ return value;
+ });
+ } else {
+ clobber(obj, key, value);
+ }
+ }
+
+ function include(parent, objects, clobber, merge) {
+ each(objects, function (obj, key) {
+ try {
+ var result = obj.path ? require(obj.path) : {};
+
+ if (clobber) {
+ // Clobber if it doesn't exist.
+ if (typeof parent[key] === 'undefined') {
+ assignOrWrapInDeprecateGetter(
+ parent,
+ key,
+ result,
+ obj.deprecated,
+ );
+ } else if (typeof obj.path !== 'undefined') {
+ // If merging, merge properties onto parent, otherwise, clobber.
+ if (merge) {
+ recursiveMerge(parent[key], result);
+ } else {
+ assignOrWrapInDeprecateGetter(
+ parent,
+ key,
+ result,
+ obj.deprecated,
+ );
+ }
+ }
+ result = parent[key];
+ } else {
+ // Overwrite if not currently defined.
+ if (typeof parent[key] === 'undefined') {
+ assignOrWrapInDeprecateGetter(
+ parent,
+ key,
+ result,
+ obj.deprecated,
+ );
+ } else {
+ // Set result to what already exists, so we can build children into it if they exist.
+ result = parent[key];
+ }
+ }
+
+ if (obj.children) {
+ include(result, obj.children, clobber, merge);
+ }
+ } catch (e) {
+ utils.alert(
+ 'Exception building Cordova JS globals: ' +
+ e +
+ ' for key "' +
+ key +
+ '"',
+ );
+ }
+ });
+ }
+
+ /**
+ * Merge properties from one object onto another recursively. Properties from
+ * the src object will overwrite existing target property.
+ *
+ * @param target Object to merge properties into.
+ * @param src Object to merge properties from.
+ */
+ function recursiveMerge(target, src) {
+ for (var prop in src) {
+ if (src.hasOwnProperty(prop)) {
+ if (target.prototype && target.prototype.constructor === target) {
+ // If the target object is a constructor override off prototype.
+ clobber(target.prototype, prop, src[prop]);
+ } else {
+ if (
+ typeof src[prop] === 'object' &&
+ typeof target[prop] === 'object'
+ ) {
+ recursiveMerge(target[prop], src[prop]);
+ } else {
+ clobber(target, prop, src[prop]);
+ }
+ }
+ }
+ }
+ }
+
+ exports.buildIntoButDoNotClobber = function (objects, target) {
+ include(target, objects, false, false);
+ };
+ exports.buildIntoAndClobber = function (objects, target) {
+ include(target, objects, true, false);
+ };
+ exports.buildIntoAndMerge = function (objects, target) {
+ include(target, objects, true, true);
+ };
+ exports.recursiveMerge = recursiveMerge;
+ exports.assignOrWrapInDeprecateGetter = assignOrWrapInDeprecateGetter;
+ exports.replaceHookForTesting = function () {};
+ });
+
+ // file: src/common/channel.js
+ define('cordova/channel', function (require, exports, module) {
+ var utils = require('cordova/utils');
+ var nextGuid = 1;
+
+ /**
+ * Custom pub-sub "channel" that can have functions subscribed to it
+ * This object is used to define and control firing of events for
+ * cordova initialization, as well as for custom events thereafter.
+ *
+ * The order of events during page load and Cordova startup is as follows:
+ *
+ * onDOMContentLoaded* Internal event that is received when the web page is loaded and parsed.
+ * onNativeReady* Internal event that indicates the Cordova native side is ready.
+ * onCordovaReady* Internal event fired when all Cordova JavaScript objects have been created.
+ * onDeviceReady* User event fired to indicate that Cordova is ready
+ * onResume User event fired to indicate a start/resume lifecycle event
+ * onPause User event fired to indicate a pause lifecycle event
+ *
+ * The events marked with an * are sticky. Once they have fired, they will stay in the fired state.
+ * All listeners that subscribe after the event is fired will be executed right away.
+ *
+ * The only Cordova events that user code should register for are:
+ * deviceready Cordova native code is initialized and Cordova APIs can be called from JavaScript
+ * pause App has moved to background
+ * resume App has returned to foreground
+ *
+ * Listeners can be registered as:
+ * document.addEventListener("deviceready", myDeviceReadyListener, false);
+ * document.addEventListener("resume", myResumeListener, false);
+ * document.addEventListener("pause", myPauseListener, false);
+ *
+ * The DOM lifecycle events should be used for saving and restoring state
+ * window.onload
+ * window.onunload
+ *
+ */
+
+ /**
+ * Channel
+ * @constructor
+ * @param type String the channel name
+ */
+ var Channel = function (type, sticky) {
+ this.type = type;
+ // Map of guid -> function.
+ this.handlers = {};
+ // 0 = Non-sticky, 1 = Sticky non-fired, 2 = Sticky fired.
+ this.state = sticky ? 1 : 0;
+ // Used in sticky mode to remember args passed to fire().
+ this.fireArgs = null;
+ // Used by onHasSubscribersChange to know if there are any listeners.
+ this.numHandlers = 0;
+ // Function that is called when the first listener is subscribed, or when
+ // the last listener is unsubscribed.
+ this.onHasSubscribersChange = null;
+ };
+ var channel = {
+ /**
+ * Calls the provided function only after all of the channels specified
+ * have been fired. All channels must be sticky channels.
+ */
+ join: function (h, c) {
+ var len = c.length;
+ var i = len;
+ var f = function () {
+ if (!--i) h();
+ };
+ for (var j = 0; j < len; j++) {
+ if (c[j].state === 0) {
+ throw Error('Can only use join with sticky channels.');
+ }
+ c[j].subscribe(f);
+ }
+ if (!len) h();
+ },
+ /* eslint-disable no-return-assign */
+ create: function (type) {
+ return (channel[type] = new Channel(type, false));
+ },
+ createSticky: function (type) {
+ return (channel[type] = new Channel(type, true));
+ },
+ /* eslint-enable no-return-assign */
+ /**
+ * cordova Channels that must fire before "deviceready" is fired.
+ */
+ deviceReadyChannelsArray: [],
+ deviceReadyChannelsMap: {},
+
+ /**
+ * Indicate that a feature needs to be initialized before it is ready to be used.
+ * This holds up Cordova's "deviceready" event until the feature has been initialized
+ * and Cordova.initComplete(feature) is called.
+ *
+ * @param feature {String} The unique feature name
+ */
+ waitForInitialization: function (feature) {
+ if (feature) {
+ var c = channel[feature] || this.createSticky(feature);
+ this.deviceReadyChannelsMap[feature] = c;
+ this.deviceReadyChannelsArray.push(c);
+ }
+ },
+
+ /**
+ * Indicate that initialization code has completed and the feature is ready to be used.
+ *
+ * @param feature {String} The unique feature name
+ */
+ initializationComplete: function (feature) {
+ var c = this.deviceReadyChannelsMap[feature];
+ if (c) {
+ c.fire();
+ }
+ },
+ };
+
+ function checkSubscriptionArgument(argument) {
+ if (
+ typeof argument !== 'function' &&
+ typeof argument.handleEvent !== 'function'
+ ) {
+ throw new Error(
+ 'Must provide a function or an EventListener object ' +
+ 'implementing the handleEvent interface.',
+ );
+ }
+ }
+
+ /**
+ * Subscribes the given function to the channel. Any time that
+ * Channel.fire is called so too will the function.
+ * Optionally specify an execution context for the function
+ * and a guid that can be used to stop subscribing to the channel.
+ * Returns the guid.
+ */
+ Channel.prototype.subscribe = function (
+ eventListenerOrFunction,
+ eventListener,
+ ) {
+ checkSubscriptionArgument(eventListenerOrFunction);
+ var handleEvent, guid;
+
+ if (
+ eventListenerOrFunction &&
+ typeof eventListenerOrFunction === 'object'
+ ) {
+ // Received an EventListener object implementing the handleEvent interface
+ handleEvent = eventListenerOrFunction.handleEvent;
+ eventListener = eventListenerOrFunction;
+ } else {
+ // Received a function to handle event
+ handleEvent = eventListenerOrFunction;
+ }
+
+ if (this.state === 2) {
+ handleEvent.apply(eventListener || this, this.fireArgs);
+ return;
+ }
+
+ guid = eventListenerOrFunction.observer_guid;
+ if (typeof eventListener === 'object') {
+ handleEvent = utils.close(eventListener, handleEvent);
+ }
+
+ if (!guid) {
+ // First time any channel has seen this subscriber
+ guid = '' + nextGuid++;
+ }
+ handleEvent.observer_guid = guid;
+ eventListenerOrFunction.observer_guid = guid;
+
+ // Don't add the same handler more than once.
+ if (!this.handlers[guid]) {
+ this.handlers[guid] = handleEvent;
+ this.numHandlers++;
+ if (this.numHandlers === 1) {
+ this.onHasSubscribersChange && this.onHasSubscribersChange();
+ }
+ }
+ };
+
+ /**
+ * Unsubscribes the function with the given guid from the channel.
+ */
+ Channel.prototype.unsubscribe = function (eventListenerOrFunction) {
+ checkSubscriptionArgument(eventListenerOrFunction);
+ var handleEvent, guid, handler;
+
+ if (
+ eventListenerOrFunction &&
+ typeof eventListenerOrFunction === 'object'
+ ) {
+ // Received an EventListener object implementing the handleEvent interface
+ handleEvent = eventListenerOrFunction.handleEvent;
+ } else {
+ // Received a function to handle event
+ handleEvent = eventListenerOrFunction;
+ }
+
+ guid = handleEvent.observer_guid;
+ handler = this.handlers[guid];
+ if (handler) {
+ delete this.handlers[guid];
+ this.numHandlers--;
+ if (this.numHandlers === 0) {
+ this.onHasSubscribersChange && this.onHasSubscribersChange();
+ }
+ }
+ };
+
+ /**
+ * Calls all functions subscribed to this channel.
+ */
+ Channel.prototype.fire = function (e) {
+ var fail = false; // eslint-disable-line no-unused-vars
+ var fireArgs = Array.prototype.slice.call(arguments);
+ // Apply stickiness.
+ if (this.state === 1) {
+ this.state = 2;
+ this.fireArgs = fireArgs;
+ }
+ if (this.numHandlers) {
+ // Copy the values first so that it is safe to modify it from within
+ // callbacks.
+ var toCall = [];
+ for (var item in this.handlers) {
+ toCall.push(this.handlers[item]);
+ }
+ for (var i = 0; i < toCall.length; ++i) {
+ toCall[i].apply(this, fireArgs);
+ }
+ if (this.state === 2 && this.numHandlers) {
+ this.numHandlers = 0;
+ this.handlers = {};
+ this.onHasSubscribersChange && this.onHasSubscribersChange();
+ }
+ }
+ };
+
+ // defining them here so they are ready super fast!
+ // DOM event that is received when the web page is loaded and parsed.
+ channel.createSticky('onDOMContentLoaded');
+
+ // Event to indicate the Cordova native side is ready.
+ channel.createSticky('onNativeReady');
+
+ // Event to indicate that all Cordova JavaScript objects have been created
+ // and it's time to run plugin constructors.
+ channel.createSticky('onCordovaReady');
+
+ // Event to indicate that all automatically loaded JS plugins are loaded and ready.
+ // FIXME remove this
+ channel.createSticky('onPluginsReady');
+
+ // Event to indicate that Cordova is ready
+ channel.createSticky('onDeviceReady');
+
+ // Event to indicate a resume lifecycle event
+ channel.create('onResume');
+
+ // Event to indicate a pause lifecycle event
+ channel.create('onPause');
+
+ // Channels that must fire before "deviceready" is fired.
+ channel.waitForInitialization('onCordovaReady');
+ channel.waitForInitialization('onDOMContentLoaded');
+
+ module.exports = channel;
+ });
+
+ define('cordova/exec', function (require, exports, module) {
+ /*global require, module, atob, document */
+
+ /**
+ * Creates a gap bridge iframe used to notify the native code about queued
+ * commands.
+ */
+ var cordova = require('cordova'),
+ utils = require('cordova/utils'),
+ base64 = require('cordova/base64'),
+ execIframe,
+ commandQueue = [], // Contains pending JS->Native messages.
+ isInContextOfEvalJs = 0,
+ failSafeTimerId = 0;
+
+ function massageArgsJsToNative(args) {
+ if (window.androidBridge) {
+ for (var i = 0; i < args.length; i++) {
+ if (utils.typeName(args[i]) == 'ArrayBuffer') {
+ args[i] = base64.fromArrayBuffer(args[i]);
+ }
+ }
+ return args;
+ } else {
+ if (!args || utils.typeName(args) !== 'Array') {
+ return args;
+ }
+ var ret = [];
+ args.forEach(function (arg, i) {
+ if (utils.typeName(arg) === 'ArrayBuffer') {
+ ret.push({
+ CDVType: 'ArrayBuffer',
+ data: base64.fromArrayBuffer(arg),
+ });
+ } else {
+ ret.push(arg);
+ }
+ });
+ return ret;
+ }
+ }
+
+ function massageMessageNativeToJs(message) {
+ if (message.CDVType === 'ArrayBuffer') {
+ var stringToArrayBuffer = function (str) {
+ var ret = new Uint8Array(str.length);
+ for (var i = 0; i < str.length; i++) {
+ ret[i] = str.charCodeAt(i);
+ }
+ return ret.buffer;
+ };
+ var base64ToArrayBuffer = function (b64) {
+ return stringToArrayBuffer(atob(b64)); // eslint-disable-line no-undef
+ };
+ message = base64ToArrayBuffer(message.data);
+ }
+ return message;
+ }
+
+ function convertMessageToArgsNativeToJs(message) {
+ var args = [];
+ if (!message || !message.hasOwnProperty('CDVType')) {
+ args.push(message);
+ } else if (message.CDVType === 'MultiPart') {
+ message.messages.forEach(function (e) {
+ args.push(massageMessageNativeToJs(e));
+ });
+ } else {
+ args.push(massageMessageNativeToJs(message));
+ }
+ return args;
+ }
+
+ var capacitorExec = function () {
+ // detect change in bridge, if there is a change, we forward to new bridge
+
+ var successCallback, failCallback, service, action, actionArgs;
+ var callbackId = null;
+ if (typeof arguments[0] !== 'string') {
+ // FORMAT ONE
+ successCallback = arguments[0];
+ failCallback = arguments[1];
+ service = arguments[2];
+ action = arguments[3];
+ actionArgs = arguments[4];
+
+ // Since we need to maintain backwards compatibility, we have to pass
+ // an invalid callbackId even if no callback was provided since plugins
+ // will be expecting it. The Cordova.exec() implementation allocates
+ // an invalid callbackId and passes it even if no callbacks were given.
+ callbackId = 'INVALID';
+ } else {
+ throw new Error(
+ 'The old format of this exec call has been removed (deprecated since 2.1). Change to: ' + // eslint-disable-line
+ "cordova.exec(null, null, 'Service', 'action', [ arg1, arg2 ]);",
+ );
+ }
+
+ // If actionArgs is not provided, default to an empty array
+ actionArgs = actionArgs || [];
+
+ // Register the callbacks and add the callbackId to the positional
+ // arguments if given.
+ if (successCallback || failCallback) {
+ callbackId = service + cordova.callbackId++;
+ cordova.callbacks[callbackId] = {
+ success: successCallback,
+ fail: failCallback,
+ };
+ }
+
+ // Properly encode ArrayBuffer action arguments
+ actionArgs = massageArgsJsToNative(actionArgs);
+ actionArgs = JSON.parse(JSON.stringify(actionArgs));
+ var command = {
+ type: 'cordova',
+ callbackId: callbackId,
+ service: service,
+ action: action,
+ actionArgs: actionArgs,
+ };
+ if (window.androidBridge) {
+ window.androidBridge.postMessage(JSON.stringify(command));
+ } else if (
+ window.webkit &&
+ window.webkit.messageHandlers &&
+ window.webkit.messageHandlers.bridge
+ ) {
+ window.webkit.messageHandlers.bridge.postMessage(command);
+ }
+ };
+
+ // CB-10530
+ function proxyChanged() {
+ var cexec = cordovaExec();
+
+ return (
+ execProxy !== cexec && capacitorExec !== cexec // proxy objects are different // proxy object is not the current capacitorExec
+ );
+ }
+
+ // CB-10106
+ function handleBridgeChange() {
+ if (proxyChanged()) {
+ var commandString = commandQueue.shift();
+ while (commandString) {
+ var command = JSON.parse(commandString);
+ var callbackId = command[0];
+ var service = command[1];
+ var action = command[2];
+ var actionArgs = command[3];
+ var callbacks = cordova.callbacks[callbackId] || {};
+
+ execProxy(
+ callbacks.success,
+ callbacks.fail,
+ service,
+ action,
+ actionArgs,
+ );
+
+ commandString = commandQueue.shift();
+ }
+ return true;
+ }
+
+ return false;
+ }
+
+ function pokeNative() {
+ // CB-5488 - Don't attempt to create iframe before document.body is available.
+ if (!document.body) {
+ setTimeout(pokeNative);
+ return;
+ }
+
+ // Check if they've removed it from the DOM, and put it back if so.
+ if (execIframe && execIframe.contentWindow) {
+ execIframe.contentWindow.location = 'gap://ready';
+ } else {
+ execIframe = document.createElement('iframe');
+ execIframe.style.display = 'none';
+ execIframe.src = 'gap://ready';
+ document.body.appendChild(execIframe);
+ }
+ // Use a timer to protect against iframe being unloaded during the poke (CB-7735).
+ // This makes the bridge ~ 7% slower, but works around the poke getting lost
+ // when the iframe is removed from the DOM.
+ // An onunload listener could be used in the case where the iframe has just been
+ // created, but since unload events fire only once, it doesn't work in the normal
+ // case of iframe reuse (where unload will have already fired due to the attempted
+ // navigation of the page).
+ failSafeTimerId = setTimeout(function () {
+ if (commandQueue.length) {
+ // CB-10106 - flush the queue on bridge change
+ if (!handleBridgeChange()) {
+ pokeNative();
+ }
+ }
+ }, 50); // Making this > 0 improves performance (marginally) in the normal case (where it doesn't fire).
+ }
+
+ capacitorExec.nativeFetchMessages = function () {
+ // Stop listing for window detatch once native side confirms poke.
+ if (failSafeTimerId) {
+ clearTimeout(failSafeTimerId);
+ failSafeTimerId = 0;
+ }
+ // Each entry in commandQueue is a JSON string already.
+ if (!commandQueue.length) {
+ return '';
+ }
+ var json = '[' + commandQueue.join(',') + ']';
+ commandQueue.length = 0;
+ return json;
+ };
+
+ capacitorExec.nativeCallback = function (
+ callbackId,
+ status,
+ message,
+ keepCallback,
+ debug,
+ ) {
+ var success = status === 0 || status === 1;
+ var args = convertMessageToArgsNativeToJs(message);
+ setTimeout(function () {
+ cordova.callbackFromNative(
+ callbackId,
+ success,
+ status,
+ args,
+ keepCallback,
+ ); // eslint-disable-line
+ }, 0);
+ };
+
+ // for backwards compatibility
+ capacitorExec.nativeEvalAndFetch = function (func) {
+ try {
+ func();
+ } catch (e) {
+ console.log(e);
+ }
+ };
+
+ // Proxy the exec for bridge changes. See CB-10106
+ function cordovaExec() {
+ var cexec = require('cordova/exec');
+ var cexec_valid =
+ typeof cexec.nativeFetchMessages === 'function' &&
+ typeof cexec.nativeEvalAndFetch === 'function' &&
+ typeof cexec.nativeCallback === 'function';
+ return cexec_valid && execProxy !== cexec ? cexec : capacitorExec;
+ }
+ function execProxy() {
+ cordovaExec().apply(null, arguments);
+ }
+
+ execProxy.nativeFetchMessages = function () {
+ return cordovaExec().nativeFetchMessages.apply(null, arguments);
+ };
+
+ execProxy.nativeEvalAndFetch = function () {
+ return cordovaExec().nativeEvalAndFetch.apply(null, arguments);
+ };
+
+ execProxy.nativeCallback = function () {
+ return cordovaExec().nativeCallback.apply(null, arguments);
+ };
+
+ module.exports = execProxy;
+ });
+
+ // file: src/common/exec/proxy.js
+ define('cordova/exec/proxy', function (require, exports, module) {
+ // internal map of proxy function
+ var CommandProxyMap = {};
+
+ module.exports = {
+ // example: cordova.commandProxy.add("Accelerometer",{getCurrentAcceleration: function(successCallback, errorCallback, options) {...},...);
+ add: function (id, proxyObj) {
+ console.log('adding proxy for ' + id);
+ CommandProxyMap[id] = proxyObj;
+ return proxyObj;
+ },
+
+ // cordova.commandProxy.remove("Accelerometer");
+ remove: function (id) {
+ var proxy = CommandProxyMap[id];
+ delete CommandProxyMap[id];
+ CommandProxyMap[id] = null;
+ return proxy;
+ },
+
+ get: function (service, action) {
+ return CommandProxyMap[service]
+ ? CommandProxyMap[service][action]
+ : null;
+ },
+ };
+ });
+
+ // file: src/common/init.js
+ define('cordova/init', function (require, exports, module) {
+ var channel = require('cordova/channel');
+ var cordova = require('cordova');
+ var modulemapper = require('cordova/modulemapper');
+ var platform = require('cordova/platform');
+ var pluginloader = require('cordova/pluginloader');
+ var utils = require('cordova/utils');
+
+ var platformInitChannelsArray = [
+ channel.onNativeReady,
+ channel.onPluginsReady,
+ ];
+
+ function logUnfiredChannels(arr) {
+ for (var i = 0; i < arr.length; ++i) {
+ if (arr[i].state !== 2) {
+ console.log('Channel not fired: ' + arr[i].type);
+ }
+ }
+ }
+
+ window.setTimeout(function () {
+ if (channel.onDeviceReady.state !== 2) {
+ console.log('deviceready has not fired after 5 seconds.');
+ logUnfiredChannels(platformInitChannelsArray);
+ logUnfiredChannels(channel.deviceReadyChannelsArray);
+ }
+ }, 5000);
+
+ // Replace navigator before any modules are required(), to ensure it happens as soon as possible.
+ // We replace it so that properties that can't be clobbered can instead be overridden.
+ function replaceNavigator(origNavigator) {
+ var CordovaNavigator = function () {};
+ CordovaNavigator.prototype = origNavigator;
+ var newNavigator = new CordovaNavigator();
+ // This work-around really only applies to new APIs that are newer than Function.bind.
+ // Without it, APIs such as getGamepads() break.
+ if (CordovaNavigator.bind) {
+ for (var key in origNavigator) {
+ if (typeof origNavigator[key] === 'function') {
+ newNavigator[key] = origNavigator[key].bind(origNavigator);
+ } else {
+ (function (k) {
+ utils.defineGetterSetter(newNavigator, key, function () {
+ return origNavigator[k];
+ });
+ })(key);
+ }
+ }
+ }
+ return newNavigator;
+ }
+
+ if (window.navigator) {
+ window.navigator = replaceNavigator(window.navigator);
+ }
+
+ // Register pause, resume and deviceready channels as events on document.
+ channel.onPause = cordova.addDocumentEventHandler('pause');
+ channel.onResume = cordova.addDocumentEventHandler('resume');
+ channel.onActivated = cordova.addDocumentEventHandler('activated');
+ channel.onDeviceReady =
+ cordova.addStickyDocumentEventHandler('deviceready');
+
+ // Listen for DOMContentLoaded and notify our channel subscribers.
+ if (
+ document.readyState === 'complete' ||
+ document.readyState === 'interactive'
+ ) {
+ channel.onDOMContentLoaded.fire();
+ } else {
+ document.addEventListener(
+ 'DOMContentLoaded',
+ function () {
+ channel.onDOMContentLoaded.fire();
+ },
+ false,
+ );
+ }
+
+ // _nativeReady is global variable that the native side can set
+ // to signify that the native code is ready. It is a global since
+ // it may be called before any cordova JS is ready.
+ if (window._nativeReady) {
+ channel.onNativeReady.fire();
+ }
+
+ modulemapper.clobbers('cordova', 'cordova');
+ modulemapper.clobbers('cordova/exec', 'cordova.exec');
+ modulemapper.clobbers('cordova/exec', 'Cordova.exec');
+
+ // Call the platform-specific initialization.
+ platform.bootstrap && platform.bootstrap();
+
+ // Wrap in a setTimeout to support the use-case of having plugin JS appended to cordova.js.
+ // The delay allows the attached modules to be defined before the plugin loader looks for them.
+ setTimeout(function () {
+ pluginloader.load(function () {
+ channel.onPluginsReady.fire();
+ });
+ }, 0);
+
+ /**
+ * Create all cordova objects once native side is ready.
+ */
+ channel.join(function () {
+ modulemapper.mapModules(window);
+
+ platform.initialize && platform.initialize();
+
+ // Fire event to notify that all objects are created
+ channel.onCordovaReady.fire();
+
+ // Fire onDeviceReady event once page has fully loaded, all
+ // constructors have run and cordova info has been received from native
+ // side.
+ channel.join(function () {
+ require('cordova').fireDocumentEvent('deviceready');
+ }, channel.deviceReadyChannelsArray);
+ }, platformInitChannelsArray);
+ });
+
+ // file: src/common/modulemapper.js
+ define('cordova/modulemapper', function (require, exports, module) {
+ var builder = require('cordova/builder');
+ var moduleMap = define.moduleMap; // eslint-disable-line no-undef
+ var symbolList;
+ var deprecationMap;
+
+ exports.reset = function () {
+ symbolList = [];
+ deprecationMap = {};
+ };
+
+ function addEntry(
+ strategy,
+ moduleName,
+ symbolPath,
+ opt_deprecationMessage,
+ ) {
+ if (!(moduleName in moduleMap)) {
+ throw new Error('Module ' + moduleName + ' does not exist.');
+ }
+ symbolList.push(strategy, moduleName, symbolPath);
+ if (opt_deprecationMessage) {
+ deprecationMap[symbolPath] = opt_deprecationMessage;
+ }
+ }
+
+ // Note: Android 2.3 does have Function.bind().
+ exports.clobbers = function (
+ moduleName,
+ symbolPath,
+ opt_deprecationMessage,
+ ) {
+ addEntry('c', moduleName, symbolPath, opt_deprecationMessage);
+ };
+
+ exports.merges = function (moduleName, symbolPath, opt_deprecationMessage) {
+ addEntry('m', moduleName, symbolPath, opt_deprecationMessage);
+ };
+
+ exports.defaults = function (
+ moduleName,
+ symbolPath,
+ opt_deprecationMessage,
+ ) {
+ addEntry('d', moduleName, symbolPath, opt_deprecationMessage);
+ };
+
+ exports.runs = function (moduleName) {
+ addEntry('r', moduleName, null);
+ };
+
+ function prepareNamespace(symbolPath, context) {
+ if (!symbolPath) {
+ return context;
+ }
+ var parts = symbolPath.split('.');
+ var cur = context;
+ for (var i = 0, part; (part = parts[i]); ++i) {
+ // eslint-disable-line no-cond-assign
+ cur = cur[part] = cur[part] || {};
+ }
+ return cur;
+ }
+
+ exports.mapModules = function (context) {
+ var origSymbols = {};
+ context.CDV_origSymbols = origSymbols;
+ for (var i = 0, len = symbolList.length; i < len; i += 3) {
+ var strategy = symbolList[i];
+ var moduleName = symbolList[i + 1];
+ var module = require(moduleName);
+ //
+ if (strategy === 'r') {
+ continue;
+ }
+ var symbolPath = symbolList[i + 2];
+ var lastDot = symbolPath.lastIndexOf('.');
+ var namespace = symbolPath.substr(0, lastDot);
+ var lastName = symbolPath.substr(lastDot + 1);
+
+ var deprecationMsg =
+ symbolPath in deprecationMap
+ ? 'Access made to deprecated symbol: ' +
+ symbolPath +
+ '. ' +
+ deprecationMsg
+ : null;
+ var parentObj = prepareNamespace(namespace, context);
+ var target = parentObj[lastName];
+
+ if (strategy === 'm' && target) {
+ builder.recursiveMerge(target, module);
+ } else if ((strategy === 'd' && !target) || strategy !== 'd') {
+ if (!(symbolPath in origSymbols)) {
+ origSymbols[symbolPath] = target;
+ }
+ builder.assignOrWrapInDeprecateGetter(
+ parentObj,
+ lastName,
+ module,
+ deprecationMsg,
+ );
+ }
+ }
+ };
+
+ exports.getOriginalSymbol = function (context, symbolPath) {
+ var origSymbols = context.CDV_origSymbols;
+ if (origSymbols && symbolPath in origSymbols) {
+ return origSymbols[symbolPath];
+ }
+ var parts = symbolPath.split('.');
+ var obj = context;
+ for (var i = 0; i < parts.length; ++i) {
+ obj = obj && obj[parts[i]];
+ }
+ return obj;
+ };
+
+ exports.reset();
+ });
+
+ define('cordova/platform', function (require, exports, module) {
+ module.exports = {
+ id: Capacitor.platform,
+ bootstrap: function () {
+ require('cordova/channel').onNativeReady.fire();
+ },
+ };
+ });
+
+ // file: src/common/pluginloader.js
+ define('cordova/pluginloader', function (require, exports, module) {
+ var modulemapper = require('cordova/modulemapper');
+
+ function onScriptLoadingComplete(moduleList, finishPluginLoading) {
+ console.log('onscript loading complete');
+ // Loop through all the plugins and then through their clobbers and merges.
+ for (var i = 0, module; (module = moduleList[i]); i++) {
+ // eslint-disable-line no-cond-assign
+ if (module.clobbers && module.clobbers.length) {
+ for (var j = 0; j < module.clobbers.length; j++) {
+ modulemapper.clobbers(module.id, module.clobbers[j]);
+ }
+ }
+
+ if (module.merges && module.merges.length) {
+ for (var k = 0; k < module.merges.length; k++) {
+ modulemapper.merges(module.id, module.merges[k]);
+ }
+ }
+
+ // Finally, if runs is truthy we want to simply require() the module.
+ if (module.runs) {
+ modulemapper.runs(module.id);
+ }
+ }
+
+ finishPluginLoading();
+ }
+
+ // Tries to load all plugins' js-modules.
+ // This is an async process, but onDeviceReady is blocked on onPluginsReady.
+ // onPluginsReady is fired when there are no plugins to load, or they are all done.
+ exports.load = function (callback) {
+ var moduleList = require('cordova/plugin_list');
+ onScriptLoadingComplete(moduleList, callback);
+ };
+ });
+
+ // file: src/common/urlutil.js
+ define('cordova/urlutil', function (require, exports, module) {
+ /**
+ * For already absolute URLs, returns what is passed in.
+ * For relative URLs, converts them to absolute ones.
+ */
+ exports.makeAbsolute = function makeAbsolute(url) {
+ var anchorEl = document.createElement('a');
+ anchorEl.href = url;
+ return anchorEl.href;
+ };
+ });
+
+ // file: src/common/utils.js
+ define('cordova/utils', function (require, exports, module) {
+ var utils = exports;
+
+ /**
+ * Defines a property getter / setter for obj[key].
+ */
+ utils.defineGetterSetter = function (obj, key, getFunc, opt_setFunc) {
+ if (Object.defineProperty) {
+ var desc = {
+ get: getFunc,
+ configurable: true,
+ };
+ if (opt_setFunc) {
+ desc.set = opt_setFunc;
+ }
+ Object.defineProperty(obj, key, desc);
+ } else {
+ obj.__defineGetter__(key, getFunc);
+ if (opt_setFunc) {
+ obj.__defineSetter__(key, opt_setFunc);
+ }
+ }
+ };
+
+ /**
+ * Defines a property getter for obj[key].
+ */
+ utils.defineGetter = utils.defineGetterSetter;
+
+ utils.arrayIndexOf = function (a, item) {
+ if (a.indexOf) {
+ return a.indexOf(item);
+ }
+ var len = a.length;
+ for (var i = 0; i < len; ++i) {
+ if (a[i] === item) {
+ return i;
+ }
+ }
+ return -1;
+ };
+
+ /**
+ * Returns whether the item was found in the array.
+ */
+ utils.arrayRemove = function (a, item) {
+ var index = utils.arrayIndexOf(a, item);
+ if (index !== -1) {
+ a.splice(index, 1);
+ }
+ return index !== -1;
+ };
+
+ utils.typeName = function (val) {
+ return Object.prototype.toString.call(val).slice(8, -1);
+ };
+
+ /**
+ * Returns an indication of whether the argument is an array or not
+ */
+ utils.isArray =
+ Array.isArray ||
+ function (a) {
+ return utils.typeName(a) === 'Array';
+ };
+
+ /**
+ * Returns an indication of whether the argument is a Date or not
+ */
+ utils.isDate = function (d) {
+ return d instanceof Date;
+ };
+
+ /**
+ * Does a deep clone of the object.
+ */
+ utils.clone = function (obj) {
+ if (
+ !obj ||
+ typeof obj === 'function' ||
+ utils.isDate(obj) ||
+ typeof obj !== 'object'
+ ) {
+ return obj;
+ }
+
+ var retVal, i;
+
+ if (utils.isArray(obj)) {
+ retVal = [];
+ for (i = 0; i < obj.length; ++i) {
+ retVal.push(utils.clone(obj[i]));
+ }
+ return retVal;
+ }
+
+ retVal = {};
+ for (i in obj) {
+ // https://issues.apache.org/jira/browse/CB-11522 'unknown' type may be returned in
+ // custom protocol activation case on Windows Phone 8.1 causing "No such interface supported" exception
+ // on cloning.
+ if (
+ (!(i in retVal) || retVal[i] !== obj[i]) &&
+ typeof obj[i] !== 'undefined' &&
+ typeof obj[i] !== 'unknown'
+ ) {
+ // eslint-disable-line valid-typeof
+ retVal[i] = utils.clone(obj[i]);
+ }
+ }
+ return retVal;
+ };
+
+ /**
+ * Returns a wrapped version of the function
+ */
+ utils.close = function (context, func, params) {
+ return function () {
+ var args = params || arguments;
+ return func.apply(context, args);
+ };
+ };
+
+ // ------------------------------------------------------------------------------
+ function UUIDcreatePart(length) {
+ var uuidpart = '';
+ for (var i = 0; i < length; i++) {
+ var uuidchar = parseInt(Math.random() * 256, 10).toString(16);
+ if (uuidchar.length === 1) {
+ uuidchar = '0' + uuidchar;
+ }
+ uuidpart += uuidchar;
+ }
+ return uuidpart;
+ }
+
+ /**
+ * Create a UUID
+ */
+ utils.createUUID = function () {
+ return (
+ UUIDcreatePart(4) +
+ '-' +
+ UUIDcreatePart(2) +
+ '-' +
+ UUIDcreatePart(2) +
+ '-' +
+ UUIDcreatePart(2) +
+ '-' +
+ UUIDcreatePart(6)
+ );
+ };
+
+ /**
+ * Extends a child object from a parent object using classical inheritance
+ * pattern.
+ */
+ utils.extend = (function () {
+ // proxy used to establish prototype chain
+ var F = function () {};
+ // extend Child from Parent
+ return function (Child, Parent) {
+ F.prototype = Parent.prototype;
+ Child.prototype = new F();
+ Child.__super__ = Parent.prototype;
+ Child.prototype.constructor = Child;
+ };
+ })();
+
+ /**
+ * Alerts a message in any available way: alert or console.log.
+ */
+ utils.alert = function (msg) {
+ if (window.alert) {
+ window.alert(msg);
+ } else if (console && console.log) {
+ console.log(msg);
+ }
+ };
+ });
+
+ window.cordova = require('cordova');
+ // file: src/scripts/bootstrap.js
+
+ require('cordova/init');
+})();
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/capacitor.js b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/capacitor.js
new file mode 100644
index 00000000..a7802f4e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/capacitor.js
@@ -0,0 +1,3 @@
+/*! Capacitor: https://capacitorjs.com/ - MIT License */
+const capacitorExports=function(e){"use strict";const n=(e=>e.CapacitorPlatforms=(e=>{const n=new Map;n.set("web",{name:"web"});const t=e.CapacitorPlatforms||{currentPlatform:{name:"web"},platforms:n};return t.addPlatform=(e,n)=>{t.platforms.set(e,n)},t.setPlatform=e=>{t.platforms.has(e)&&(t.currentPlatform=t.platforms.get(e))},t})(e))("undefined"!=typeof globalThis?globalThis:"undefined"!=typeof self?self:"undefined"!=typeof window?window:"undefined"!=typeof global?global:{}),t=n.addPlatform,i=n.setPlatform;var r;e.ExceptionCode=void 0,(r=e.ExceptionCode||(e.ExceptionCode={})).Unimplemented="UNIMPLEMENTED",r.Unavailable="UNAVAILABLE";class o extends Error{constructor(e,n){super(e),this.message=e,this.code=n}}const s=n=>{var t,i,r,s,a;const l=n.CapacitorCustomPlatform||null,d=n.Capacitor||{},c=d.Plugins=d.Plugins||{},u=n.CapacitorPlatforms,m=(null===(t=null==u?void 0:u.currentPlatform)||void 0===t?void 0:t.getPlatform)||(()=>null!==l?l.name:(e=>{var n,t;return(null==e?void 0:e.androidBridge)?"android":(null===(t=null===(n=null==e?void 0:e.webkit)||void 0===n?void 0:n.messageHandlers)||void 0===t?void 0:t.bridge)?"ios":"web"})(n)),f=(null===(i=null==u?void 0:u.currentPlatform)||void 0===i?void 0:i.isNativePlatform)||(()=>"web"!==m()),g=(null===(r=null==u?void 0:u.currentPlatform)||void 0===r?void 0:r.isPluginAvailable)||(e=>{const n=w.get(e);return!!(null==n?void 0:n.platforms.has(m()))||!!v(e)}),v=(null===(s=null==u?void 0:u.currentPlatform)||void 0===s?void 0:s.getPluginHeader)||(e=>{var n;return null===(n=d.PluginHeaders)||void 0===n?void 0:n.find((n=>n.name===e))}),w=new Map,p=(null===(a=null==u?void 0:u.currentPlatform)||void 0===a?void 0:a.registerPlugin)||((n,t={})=>{const i=w.get(n);if(i)return console.warn(`Capacitor plugin "${n}" already registered. Cannot register plugins twice.`),i.proxy;const r=m(),s=v(n);let a;const u=i=>{let c;const u=(...u)=>{const m=(async()=>(!a&&r in t?a=a="function"==typeof t[r]?await t[r]():t[r]:null!==l&&!a&&"web"in t&&(a=a="function"==typeof t.web?await t.web():t.web),a))().then((t=>{const a=((t,i)=>{var a,l;if(!s){if(t)return null===(l=t[i])||void 0===l?void 0:l.bind(t);throw new o(`"${n}" plugin is not implemented on ${r}`,e.ExceptionCode.Unimplemented)}{const e=null==s?void 0:s.methods.find((e=>i===e.name));if(e)return"promise"===e.rtype?e=>d.nativePromise(n,i.toString(),e):(e,t)=>d.nativeCallback(n,i.toString(),e,t);if(t)return null===(a=t[i])||void 0===a?void 0:a.bind(t)}})(t,i);if(a){const e=a(...u);return c=null==e?void 0:e.remove,e}throw new o(`"${n}.${i}()" is not implemented on ${r}`,e.ExceptionCode.Unimplemented)}));return"addListener"===i&&(m.remove=async()=>c()),m};return u.toString=()=>`${i.toString()}() { [capacitor code] }`,Object.defineProperty(u,"name",{value:i,writable:!1,configurable:!1}),u},f=u("addListener"),g=u("removeListener"),p=(e,n)=>{const t=f({eventName:e},n),i=async()=>{const i=await t;g({eventName:e,callbackId:i},n)},r=new Promise((e=>t.then((()=>e({remove:i})))));return r.remove=async()=>{console.warn("Using addListener() without 'await' is deprecated."),await i()},r},h=new Proxy({},{get(e,n){switch(n){case"$$typeof":return;case"toJSON":return()=>({});case"addListener":return s?p:f;case"removeListener":return g;default:return u(n)}}});return c[n]=h,w.set(n,{name:n,proxy:h,platforms:new Set([...Object.keys(t),...s?[r]:[]])}),h});return d.convertFileSrc||(d.convertFileSrc=e=>e),d.getPlatform=m,d.handleError=e=>n.console.error(e),d.isNativePlatform=f,d.isPluginAvailable=g,d.pluginMethodNoop=(e,n,t)=>Promise.reject(`${t} does not have an implementation of "${n}".`),d.registerPlugin=p,d.Exception=o,d.DEBUG=!!d.DEBUG,d.isLoggingEnabled=!!d.isLoggingEnabled,d.platform=d.getPlatform(),d.isNative=d.isNativePlatform(),d},a=(e=>e.Capacitor=s(e))("undefined"!=typeof globalThis?globalThis:"undefined"!=typeof self?self:"undefined"!=typeof window?window:"undefined"!=typeof global?global:{}),l=a.registerPlugin,d=a.Plugins;const c=l("WebView");return e.Capacitor=a,e.CapacitorException=o,e.CapacitorPlatforms=n,e.Plugins=d,e.WebPlugin=class{constructor(e){this.listeners={},this.windowListeners={},e&&(console.warn(`Capacitor WebPlugin "${e.name}" config object was deprecated in v3 and will be removed in v4.`),this.config=e)}addListener(e,n){this.listeners[e]||(this.listeners[e]=[]),this.listeners[e].push(n);const t=this.windowListeners[e];t&&!t.registered&&this.addWindowListener(t);const i=async()=>this.removeListener(e,n),r=Promise.resolve({remove:i});return Object.defineProperty(r,"remove",{value:async()=>{console.warn("Using addListener() without 'await' is deprecated."),await i()}}),r}async removeAllListeners(){this.listeners={};for(const e in this.windowListeners)this.removeWindowListener(this.windowListeners[e]);this.windowListeners={}}notifyListeners(e,n){const t=this.listeners[e];t&&t.forEach((e=>e(n)))}hasListeners(e){return!!this.listeners[e].length}registerWindowListener(e,n){this.windowListeners[n]={registered:!1,windowEventName:e,pluginEventName:n,handler:e=>{this.notifyListeners(n,e)}}}unimplemented(n="not implemented"){return new a.Exception(n,e.ExceptionCode.Unimplemented)}unavailable(n="not available"){return new a.Exception(n,e.ExceptionCode.Unavailable)}async removeListener(e,n){const t=this.listeners[e];if(!t)return;const i=t.indexOf(n);this.listeners[e].splice(i,1),this.listeners[e].length||this.removeWindowListener(this.windowListeners[e])}addWindowListener(e){window.addEventListener(e.windowEventName,e.handler),e.registered=!0}removeWindowListener(e){e&&(window.removeEventListener(e.windowEventName,e.handler),e.registered=!1)}},e.WebView=c,e.addPlatform=t,e.registerPlugin=l,e.registerWebPlugin=e=>((e,n)=>{var t;const i=n.config,r=e.Plugins;if(!i||!i.name)throw new Error('Capacitor WebPlugin is using the deprecated "registerWebPlugin()" function, but without the config. Please use "registerPlugin()" instead to register this web plugin."');console.warn(`Capacitor plugin "${i.name}" is using the deprecated "registerWebPlugin()" function`),r[i.name]&&!(null===(t=null==i?void 0:i.platforms)||void 0===t?void 0:t.includes(e.getPlatform()))||(r[i.name]=n)})(a,e),e.setPlatform=i,Object.defineProperty(e,"__esModule",{value:!0}),e}({});
+//# sourceMappingURL=capacitor.js.map
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/capacitor.js.map b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/capacitor.js.map
new file mode 100644
index 00000000..0407745d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/capacitor.js.map
@@ -0,0 +1 @@
+{"version":3,"file":"capacitor.js","sources":["../build/platforms.js","../build/util.js","../build/runtime.js","../build/global.js","../build/core-plugins.js","../build/web-plugin.js","../build/legacy/legacy-web-plugin-merge.js"],"sourcesContent":["const createCapacitorPlatforms = (win) => {\n const defaultPlatformMap = new Map();\n defaultPlatformMap.set('web', { name: 'web' });\n const capPlatforms = win.CapacitorPlatforms || {\n currentPlatform: { name: 'web' },\n platforms: defaultPlatformMap,\n };\n const addPlatform = (name, platform) => {\n capPlatforms.platforms.set(name, platform);\n };\n const setPlatform = (name) => {\n if (capPlatforms.platforms.has(name)) {\n capPlatforms.currentPlatform = capPlatforms.platforms.get(name);\n }\n };\n capPlatforms.addPlatform = addPlatform;\n capPlatforms.setPlatform = setPlatform;\n return capPlatforms;\n};\nconst initPlatforms = (win) => (win.CapacitorPlatforms = createCapacitorPlatforms(win));\n/**\n * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead\n */\nexport const CapacitorPlatforms = /*#__PURE__*/ initPlatforms((typeof globalThis !== 'undefined'\n ? globalThis\n : typeof self !== 'undefined'\n ? self\n : typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined'\n ? global\n : {}));\n/**\n * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead\n */\nexport const addPlatform = CapacitorPlatforms.addPlatform;\n/**\n * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead\n */\nexport const setPlatform = CapacitorPlatforms.setPlatform;\n//# sourceMappingURL=platforms.js.map","export var ExceptionCode;\n(function (ExceptionCode) {\n /**\n * API is not implemented.\n *\n * This usually means the API can't be used because it is not implemented for\n * the current platform.\n */\n ExceptionCode[\"Unimplemented\"] = \"UNIMPLEMENTED\";\n /**\n * API is not available.\n *\n * This means the API can't be used right now because:\n * - it is currently missing a prerequisite, such as network connectivity\n * - it requires a particular platform or browser version\n */\n ExceptionCode[\"Unavailable\"] = \"UNAVAILABLE\";\n})(ExceptionCode || (ExceptionCode = {}));\nexport class CapacitorException extends Error {\n constructor(message, code) {\n super(message);\n this.message = message;\n this.code = code;\n }\n}\nexport const getPlatformId = (win) => {\n var _a, _b;\n if (win === null || win === void 0 ? void 0 : win.androidBridge) {\n return 'android';\n }\n else if ((_b = (_a = win === null || win === void 0 ? void 0 : win.webkit) === null || _a === void 0 ? void 0 : _a.messageHandlers) === null || _b === void 0 ? void 0 : _b.bridge) {\n return 'ios';\n }\n else {\n return 'web';\n }\n};\n//# sourceMappingURL=util.js.map","import { CapacitorException, getPlatformId, ExceptionCode } from './util';\nexport const createCapacitor = (win) => {\n var _a, _b, _c, _d, _e;\n const capCustomPlatform = win.CapacitorCustomPlatform || null;\n const cap = win.Capacitor || {};\n const Plugins = (cap.Plugins = cap.Plugins || {});\n /**\n * @deprecated Use `capCustomPlatform` instead, default functions like registerPlugin will function with the new object.\n */\n const capPlatforms = win.CapacitorPlatforms;\n const defaultGetPlatform = () => {\n return capCustomPlatform !== null\n ? capCustomPlatform.name\n : getPlatformId(win);\n };\n const getPlatform = ((_a = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _a === void 0 ? void 0 : _a.getPlatform) || defaultGetPlatform;\n const defaultIsNativePlatform = () => getPlatform() !== 'web';\n const isNativePlatform = ((_b = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _b === void 0 ? void 0 : _b.isNativePlatform) || defaultIsNativePlatform;\n const defaultIsPluginAvailable = (pluginName) => {\n const plugin = registeredPlugins.get(pluginName);\n if (plugin === null || plugin === void 0 ? void 0 : plugin.platforms.has(getPlatform())) {\n // JS implementation available for the current platform.\n return true;\n }\n if (getPluginHeader(pluginName)) {\n // Native implementation available.\n return true;\n }\n return false;\n };\n const isPluginAvailable = ((_c = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _c === void 0 ? void 0 : _c.isPluginAvailable) ||\n defaultIsPluginAvailable;\n const defaultGetPluginHeader = (pluginName) => { var _a; return (_a = cap.PluginHeaders) === null || _a === void 0 ? void 0 : _a.find(h => h.name === pluginName); };\n const getPluginHeader = ((_d = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _d === void 0 ? void 0 : _d.getPluginHeader) || defaultGetPluginHeader;\n const handleError = (err) => win.console.error(err);\n const pluginMethodNoop = (_target, prop, pluginName) => {\n return Promise.reject(`${pluginName} does not have an implementation of \"${prop}\".`);\n };\n const registeredPlugins = new Map();\n const defaultRegisterPlugin = (pluginName, jsImplementations = {}) => {\n const registeredPlugin = registeredPlugins.get(pluginName);\n if (registeredPlugin) {\n console.warn(`Capacitor plugin \"${pluginName}\" already registered. Cannot register plugins twice.`);\n return registeredPlugin.proxy;\n }\n const platform = getPlatform();\n const pluginHeader = getPluginHeader(pluginName);\n let jsImplementation;\n const loadPluginImplementation = async () => {\n if (!jsImplementation && platform in jsImplementations) {\n jsImplementation =\n typeof jsImplementations[platform] === 'function'\n ? (jsImplementation = await jsImplementations[platform]())\n : (jsImplementation = jsImplementations[platform]);\n }\n else if (capCustomPlatform !== null &&\n !jsImplementation &&\n 'web' in jsImplementations) {\n jsImplementation =\n typeof jsImplementations['web'] === 'function'\n ? (jsImplementation = await jsImplementations['web']())\n : (jsImplementation = jsImplementations['web']);\n }\n return jsImplementation;\n };\n const createPluginMethod = (impl, prop) => {\n var _a, _b;\n if (pluginHeader) {\n const methodHeader = pluginHeader === null || pluginHeader === void 0 ? void 0 : pluginHeader.methods.find(m => prop === m.name);\n if (methodHeader) {\n if (methodHeader.rtype === 'promise') {\n return (options) => cap.nativePromise(pluginName, prop.toString(), options);\n }\n else {\n return (options, callback) => cap.nativeCallback(pluginName, prop.toString(), options, callback);\n }\n }\n else if (impl) {\n return (_a = impl[prop]) === null || _a === void 0 ? void 0 : _a.bind(impl);\n }\n }\n else if (impl) {\n return (_b = impl[prop]) === null || _b === void 0 ? void 0 : _b.bind(impl);\n }\n else {\n throw new CapacitorException(`\"${pluginName}\" plugin is not implemented on ${platform}`, ExceptionCode.Unimplemented);\n }\n };\n const createPluginMethodWrapper = (prop) => {\n let remove;\n const wrapper = (...args) => {\n const p = loadPluginImplementation().then(impl => {\n const fn = createPluginMethod(impl, prop);\n if (fn) {\n const p = fn(...args);\n remove = p === null || p === void 0 ? void 0 : p.remove;\n return p;\n }\n else {\n throw new CapacitorException(`\"${pluginName}.${prop}()\" is not implemented on ${platform}`, ExceptionCode.Unimplemented);\n }\n });\n if (prop === 'addListener') {\n p.remove = async () => remove();\n }\n return p;\n };\n // Some flair ✨\n wrapper.toString = () => `${prop.toString()}() { [capacitor code] }`;\n Object.defineProperty(wrapper, 'name', {\n value: prop,\n writable: false,\n configurable: false,\n });\n return wrapper;\n };\n const addListener = createPluginMethodWrapper('addListener');\n const removeListener = createPluginMethodWrapper('removeListener');\n const addListenerNative = (eventName, callback) => {\n const call = addListener({ eventName }, callback);\n const remove = async () => {\n const callbackId = await call;\n removeListener({\n eventName,\n callbackId,\n }, callback);\n };\n const p = new Promise(resolve => call.then(() => resolve({ remove })));\n p.remove = async () => {\n console.warn(`Using addListener() without 'await' is deprecated.`);\n await remove();\n };\n return p;\n };\n const proxy = new Proxy({}, {\n get(_, prop) {\n switch (prop) {\n // https://github.com/facebook/react/issues/20030\n case '$$typeof':\n return undefined;\n case 'toJSON':\n return () => ({});\n case 'addListener':\n return pluginHeader ? addListenerNative : addListener;\n case 'removeListener':\n return removeListener;\n default:\n return createPluginMethodWrapper(prop);\n }\n },\n });\n Plugins[pluginName] = proxy;\n registeredPlugins.set(pluginName, {\n name: pluginName,\n proxy,\n platforms: new Set([\n ...Object.keys(jsImplementations),\n ...(pluginHeader ? [platform] : []),\n ]),\n });\n return proxy;\n };\n const registerPlugin = ((_e = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _e === void 0 ? void 0 : _e.registerPlugin) || defaultRegisterPlugin;\n // Add in convertFileSrc for web, it will already be available in native context\n if (!cap.convertFileSrc) {\n cap.convertFileSrc = filePath => filePath;\n }\n cap.getPlatform = getPlatform;\n cap.handleError = handleError;\n cap.isNativePlatform = isNativePlatform;\n cap.isPluginAvailable = isPluginAvailable;\n cap.pluginMethodNoop = pluginMethodNoop;\n cap.registerPlugin = registerPlugin;\n cap.Exception = CapacitorException;\n cap.DEBUG = !!cap.DEBUG;\n cap.isLoggingEnabled = !!cap.isLoggingEnabled;\n // Deprecated props\n cap.platform = cap.getPlatform();\n cap.isNative = cap.isNativePlatform();\n return cap;\n};\nexport const initCapacitorGlobal = (win) => (win.Capacitor = createCapacitor(win));\n//# sourceMappingURL=runtime.js.map","import { legacyRegisterWebPlugin } from './legacy/legacy-web-plugin-merge';\nimport { initCapacitorGlobal } from './runtime';\nexport const Capacitor = /*#__PURE__*/ initCapacitorGlobal(typeof globalThis !== 'undefined'\n ? globalThis\n : typeof self !== 'undefined'\n ? self\n : typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined'\n ? global\n : {});\nexport const registerPlugin = Capacitor.registerPlugin;\n/**\n * @deprecated Provided for backwards compatibility for Capacitor v2 plugins.\n * Capacitor v3 plugins should import the plugin directly. This \"Plugins\"\n * export is deprecated in v3, and will be removed in v4.\n */\nexport const Plugins = Capacitor.Plugins;\n/**\n * Provided for backwards compatibility. Use the registerPlugin() API\n * instead, and provide the web plugin as the \"web\" implmenetation.\n * For example\n *\n * export const Example = registerPlugin('Example', {\n * web: () => import('./web').then(m => new m.Example())\n * })\n *\n * @deprecated Deprecated in v3, will be removed from v4.\n */\nexport const registerWebPlugin = (plugin) => legacyRegisterWebPlugin(Capacitor, plugin);\n//# sourceMappingURL=global.js.map","import { registerPlugin } from './global';\nexport const WebView = /*#__PURE__*/ registerPlugin('WebView');\n//# sourceMappingURL=core-plugins.js.map","import { Capacitor } from './global';\nimport { ExceptionCode } from './util';\n/**\n * Base class web plugins should extend.\n */\nexport class WebPlugin {\n constructor(config) {\n this.listeners = {};\n this.windowListeners = {};\n if (config) {\n // TODO: add link to upgrade guide\n console.warn(`Capacitor WebPlugin \"${config.name}\" config object was deprecated in v3 and will be removed in v4.`);\n this.config = config;\n }\n }\n addListener(eventName, listenerFunc) {\n const listeners = this.listeners[eventName];\n if (!listeners) {\n this.listeners[eventName] = [];\n }\n this.listeners[eventName].push(listenerFunc);\n // If we haven't added a window listener for this event and it requires one,\n // go ahead and add it\n const windowListener = this.windowListeners[eventName];\n if (windowListener && !windowListener.registered) {\n this.addWindowListener(windowListener);\n }\n const remove = async () => this.removeListener(eventName, listenerFunc);\n const p = Promise.resolve({ remove });\n Object.defineProperty(p, 'remove', {\n value: async () => {\n console.warn(`Using addListener() without 'await' is deprecated.`);\n await remove();\n },\n });\n return p;\n }\n async removeAllListeners() {\n this.listeners = {};\n for (const listener in this.windowListeners) {\n this.removeWindowListener(this.windowListeners[listener]);\n }\n this.windowListeners = {};\n }\n notifyListeners(eventName, data) {\n const listeners = this.listeners[eventName];\n if (listeners) {\n listeners.forEach(listener => listener(data));\n }\n }\n hasListeners(eventName) {\n return !!this.listeners[eventName].length;\n }\n registerWindowListener(windowEventName, pluginEventName) {\n this.windowListeners[pluginEventName] = {\n registered: false,\n windowEventName,\n pluginEventName,\n handler: event => {\n this.notifyListeners(pluginEventName, event);\n },\n };\n }\n unimplemented(msg = 'not implemented') {\n return new Capacitor.Exception(msg, ExceptionCode.Unimplemented);\n }\n unavailable(msg = 'not available') {\n return new Capacitor.Exception(msg, ExceptionCode.Unavailable);\n }\n async removeListener(eventName, listenerFunc) {\n const listeners = this.listeners[eventName];\n if (!listeners) {\n return;\n }\n const index = listeners.indexOf(listenerFunc);\n this.listeners[eventName].splice(index, 1);\n // If there are no more listeners for this type of event,\n // remove the window listener\n if (!this.listeners[eventName].length) {\n this.removeWindowListener(this.windowListeners[eventName]);\n }\n }\n addWindowListener(handle) {\n window.addEventListener(handle.windowEventName, handle.handler);\n handle.registered = true;\n }\n removeWindowListener(handle) {\n if (!handle) {\n return;\n }\n window.removeEventListener(handle.windowEventName, handle.handler);\n handle.registered = false;\n }\n}\n//# sourceMappingURL=web-plugin.js.map","export const legacyRegisterWebPlugin = (cap, webPlugin) => {\n var _a;\n const config = webPlugin.config;\n const Plugins = cap.Plugins;\n if (!config || !config.name) {\n // TODO: add link to upgrade guide\n throw new Error(`Capacitor WebPlugin is using the deprecated \"registerWebPlugin()\" function, but without the config. Please use \"registerPlugin()\" instead to register this web plugin.\"`);\n }\n // TODO: add link to upgrade guide\n console.warn(`Capacitor plugin \"${config.name}\" is using the deprecated \"registerWebPlugin()\" function`);\n if (!Plugins[config.name] || ((_a = config === null || config === void 0 ? void 0 : config.platforms) === null || _a === void 0 ? void 0 : _a.includes(cap.getPlatform()))) {\n // Add the web plugin into the plugins registry if there already isn't\n // an existing one. If it doesn't already exist, that means\n // there's no existing native implementation for it.\n // - OR -\n // If we already have a plugin registered (meaning it was defined in the native layer),\n // then we should only overwrite it if the corresponding web plugin activates on\n // a certain platform. For example: Geolocation uses the WebPlugin on Android but not iOS\n Plugins[config.name] = webPlugin;\n }\n};\n//# sourceMappingURL=legacy-web-plugin-merge.js.map"],"names":["CapacitorPlatforms","win","defaultPlatformMap","Map","set","name","capPlatforms","currentPlatform","platforms","addPlatform","platform","setPlatform","has","get","createCapacitorPlatforms","initPlatforms","globalThis","self","window","global","ExceptionCode","exports","CapacitorException","Error","constructor","message","code","super","this","createCapacitor","_a","_b","_c","_d","_e","capCustomPlatform","CapacitorCustomPlatform","cap","Capacitor","Plugins","getPlatform","androidBridge","webkit","messageHandlers","bridge","getPlatformId","isNativePlatform","isPluginAvailable","pluginName","plugin","registeredPlugins","getPluginHeader","PluginHeaders","find","h","registerPlugin","jsImplementations","registeredPlugin","console","warn","proxy","pluginHeader","jsImplementation","createPluginMethodWrapper","prop","remove","wrapper","args","p","async","loadPluginImplementation","then","impl","fn","bind","Unimplemented","methodHeader","methods","m","rtype","options","nativePromise","toString","callback","nativeCallback","createPluginMethod","Object","defineProperty","value","writable","configurable","addListener","removeListener","addListenerNative","eventName","call","callbackId","Promise","resolve","Proxy","_","Set","keys","convertFileSrc","filePath","handleError","err","error","pluginMethodNoop","_target","reject","Exception","DEBUG","isLoggingEnabled","isNative","initCapacitorGlobal","WebView","config","listeners","windowListeners","listenerFunc","push","windowListener","registered","addWindowListener","listener","removeWindowListener","notifyListeners","data","forEach","hasListeners","length","registerWindowListener","windowEventName","pluginEventName","handler","event","unimplemented","msg","unavailable","Unavailable","index","indexOf","splice","handle","addEventListener","removeEventListener","webPlugin","includes","legacyRegisterWebPlugin"],"mappings":";gDAAA,MAuBaA,EAJS,CAACC,GAASA,EAAID,mBAnBH,CAACC,IAC9B,MAAMC,EAAqB,IAAIC,IAC/BD,EAAmBE,IAAI,MAAO,CAAEC,KAAM,QACtC,MAAMC,EAAeL,EAAID,oBAAsB,CAC3CO,gBAAiB,CAAEF,KAAM,OACzBG,UAAWN,GAYf,OAFAI,EAAaG,YARO,CAACJ,EAAMK,KACvBJ,EAAaE,UAAUJ,IAAIC,EAAMK,IAQrCJ,EAAaK,YANQN,IACbC,EAAaE,UAAUI,IAAIP,KAC3BC,EAAaC,gBAAkBD,EAAaE,UAAUK,IAAIR,KAK3DC,GAE8CQ,CAAyBb,GAIlCc,CAAqC,oBAAfC,WAChEA,WACgB,oBAATC,KACHA,KACkB,oBAAXC,OACHA,OACkB,oBAAXC,OACHA,OACA,IAILV,EAAcT,EAAmBS,YAIjCE,EAAcX,EAAmBW,YCtC9C,IAAWS,EADcC,EAAAD,mBAAA,GACdA,EAgBRA,kBAAkBA,EAAAA,cAAgB,KATJ,cAAI,gBAQjCA,EAA2B,YAAI,cAE5B,MAAME,UAA2BC,MACpCC,YAAYC,EAASC,GACjBC,MAAMF,GACNG,KAAKH,QAAUA,EACfG,KAAKF,KAAOA,GAGb,MCxBMG,EAAmB5B,IAC5B,IAAI6B,EAAIC,EAAIC,EAAIC,EAAIC,EACpB,MAAMC,EAAoBlC,EAAImC,yBAA2B,KACnDC,EAAMpC,EAAIqC,WAAa,GACvBC,EAAWF,EAAIE,QAAUF,EAAIE,SAAW,GAIxCjC,EAAeL,EAAID,mBAMnBwC,GAAmH,QAAnGV,EAAKxB,MAAAA,OAAmD,EAASA,EAAaC,uBAAoC,IAAPuB,OAAgB,EAASA,EAAGU,cALlI,KACM,OAAtBL,EACDA,EAAkB9B,KDaH,CAACJ,IAC1B,IAAI6B,EAAIC,EACR,OAAI9B,MAAAA,OAAiC,EAASA,EAAIwC,eACvC,WAE6H,QAA9HV,EAAqE,QAA/DD,EAAK7B,MAAAA,OAAiC,EAASA,EAAIyC,cAA2B,IAAPZ,OAAgB,EAASA,EAAGa,uBAAoC,IAAPZ,OAAgB,EAASA,EAAGa,QACjK,MAGA,OCrBDC,CAAc5C,IAIlB6C,GAAwH,QAAnGf,EAAKzB,MAAAA,OAAmD,EAASA,EAAaC,uBAAoC,IAAPwB,OAAgB,EAASA,EAAGe,mBADlI,KAAwB,QAAlBN,KAchCO,GAAyH,QAAnGf,EAAK1B,MAAAA,OAAmD,EAASA,EAAaC,uBAAoC,IAAPyB,OAAgB,EAASA,EAAGe,oBAZlI,CAACC,IAC9B,MAAMC,EAASC,EAAkBrC,IAAImC,GACrC,SAAIC,MAAAA,OAAuC,EAASA,EAAOzC,UAAUI,IAAI4B,SAIrEW,EAAgBH,KASlBG,GAAuH,QAAnGlB,EAAK3B,MAAAA,OAAmD,EAASA,EAAaC,uBAAoC,IAAP0B,OAAgB,EAASA,EAAGkB,kBADlI,CAACH,IAAiB,IAAIlB,EAAI,OAAoC,QAA5BA,EAAKO,EAAIe,qBAAkC,IAAPtB,OAAgB,EAASA,EAAGuB,MAAKC,GAAKA,EAAEjD,OAAS2C,MAMhJE,EAAoB,IAAI/C,IA4HxBoD,GAAsH,QAAnGrB,EAAK5B,MAAAA,OAAmD,EAASA,EAAaC,uBAAoC,IAAP2B,OAAgB,EAASA,EAAGqB,iBA3HlI,EAACP,EAAYQ,EAAoB,MAC3D,MAAMC,EAAmBP,EAAkBrC,IAAImC,GAC/C,GAAIS,EAEA,OADAC,QAAQC,KAAK,qBAAqBX,yDAC3BS,EAAiBG,MAE5B,MAAMlD,EAAW8B,IACXqB,EAAeV,EAAgBH,GACrC,IAAIc,EACJ,MAwCMC,EAA6BC,IAC/B,IAAIC,EACJ,MAAMC,EAAU,IAAIC,KAChB,MAAMC,EA3CmBC,YACxBP,GAAoBpD,KAAY8C,EACjCM,EAEWA,EADgC,mBAAhCN,EAAkB9C,SACO8C,EAAkB9C,KACxB8C,EAAkB9C,GAErB,OAAtByB,IACJ2B,GACD,QAASN,IACTM,EAEWA,EAD6B,mBAA7BN,EAAuB,UACEA,EAAuB,MAC7BA,EAAuB,KAElDM,GA4BOQ,GAA2BC,MAAKC,IACtC,MAAMC,EA3BS,EAACD,EAAMR,KAC9B,IAAIlC,EAAIC,EACR,IAAI8B,EAcC,CAAA,GAAIW,EACL,OAA6B,QAArBzC,EAAKyC,EAAKR,UAA0B,IAAPjC,OAAgB,EAASA,EAAG2C,KAAKF,GAGtE,MAAM,IAAIlD,EAAmB,IAAI0B,mCAA4CtC,IAAYU,gBAAcuD,eAlBzF,CACd,MAAMC,EAAef,MAAAA,OAAmD,EAASA,EAAagB,QAAQxB,MAAKyB,GAAKd,IAASc,EAAEzE,OAC3H,GAAIuE,EACA,MAA2B,YAAvBA,EAAaG,MACLC,GAAY3C,EAAI4C,cAAcjC,EAAYgB,EAAKkB,WAAYF,GAG5D,CAACA,EAASG,IAAa9C,EAAI+C,eAAepC,EAAYgB,EAAKkB,WAAYF,EAASG,GAG1F,GAAIX,EACL,OAA6B,QAArB1C,EAAK0C,EAAKR,UAA0B,IAAPlC,OAAgB,EAASA,EAAG4C,KAAKF,KAc3Da,CAAmBb,EAAMR,GACpC,GAAIS,EAAI,CACJ,MAAML,EAAIK,KAAMN,GAEhB,OADAF,EAASG,MAAAA,OAA6B,EAASA,EAAEH,OAC1CG,EAGP,MAAM,IAAI9C,EAAmB,IAAI0B,KAAcgB,8BAAiCtD,IAAYU,EAAaA,cAACuD,kBAMlH,MAHa,gBAATX,IACAI,EAAEH,OAASI,SAAYJ,KAEpBG,GASX,OANAF,EAAQgB,SAAW,IAAM,GAAGlB,EAAKkB,oCACjCI,OAAOC,eAAerB,EAAS,OAAQ,CACnCsB,MAAOxB,EACPyB,UAAU,EACVC,cAAc,IAEXxB,GAELyB,EAAc5B,EAA0B,eACxC6B,EAAiB7B,EAA0B,kBAC3C8B,EAAoB,CAACC,EAAWX,KAClC,MAAMY,EAAOJ,EAAY,CAAEG,UAAAA,GAAaX,GAClClB,EAASI,UACX,MAAM2B,QAAmBD,EACzBH,EAAe,CACXE,UAAAA,EACAE,WAAAA,GACDb,IAEDf,EAAI,IAAI6B,SAAQC,GAAWH,EAAKxB,MAAK,IAAM2B,EAAQ,CAAEjC,OAAAA,QAK3D,OAJAG,EAAEH,OAASI,UACPX,QAAQC,KAAK,4DACPM,KAEHG,GAELR,EAAQ,IAAIuC,MAAM,GAAI,CACxBtF,IAAIuF,EAAGpC,GACH,OAAQA,GAEJ,IAAK,WACD,OACJ,IAAK,SACD,MAAO,KAAA,IACX,IAAK,cACD,OAAOH,EAAegC,EAAoBF,EAC9C,IAAK,iBACD,OAAOC,EACX,QACI,OAAO7B,EAA0BC,OAajD,OATAzB,EAAQS,GAAcY,EACtBV,EAAkB9C,IAAI4C,EAAY,CAC9B3C,KAAM2C,EACNY,MAAAA,EACApD,UAAW,IAAI6F,IAAI,IACZf,OAAOgB,KAAK9C,MACXK,EAAe,CAACnD,GAAY,OAGjCkD,IAmBX,OAfKvB,EAAIkE,iBACLlE,EAAIkE,eAAiBC,GAAYA,GAErCnE,EAAIG,YAAcA,EAClBH,EAAIoE,YAtIiBC,GAAQzG,EAAIyD,QAAQiD,MAAMD,GAuI/CrE,EAAIS,iBAAmBA,EACvBT,EAAIU,kBAAoBA,EACxBV,EAAIuE,iBAxIqB,CAACC,EAAS7C,EAAMhB,IAC9BiD,QAAQa,OAAO,GAAG9D,yCAAkDgB,OAwI/E3B,EAAIkB,eAAiBA,EACrBlB,EAAI0E,UAAYzF,EAChBe,EAAI2E,QAAU3E,EAAI2E,MAClB3E,EAAI4E,mBAAqB5E,EAAI4E,iBAE7B5E,EAAI3B,SAAW2B,EAAIG,cACnBH,EAAI6E,SAAW7E,EAAIS,mBACZT,GCjLEC,EDmLsB,CAACrC,GAASA,EAAIqC,UAAYT,EAAgB5B,GCnLtCkH,CAA0C,oBAAfnG,WAC5DA,WACgB,oBAATC,KACHA,KACkB,oBAAXC,OACHA,OACkB,oBAAXC,OACHA,OACA,IACLoC,EAAiBjB,EAAUiB,eAM3BhB,EAAUD,EAAUC,QChBrB,MAAC6E,EAAwB7D,EAAe,sGCI7C,MACH/B,YAAY6F,GACRzF,KAAK0F,UAAY,GACjB1F,KAAK2F,gBAAkB,GACnBF,IAEA3D,QAAQC,KAAK,wBAAwB0D,EAAOhH,uEAC5CuB,KAAKyF,OAASA,GAGtB1B,YAAYG,EAAW0B,GACD5F,KAAK0F,UAAUxB,KAE7BlE,KAAK0F,UAAUxB,GAAa,IAEhClE,KAAK0F,UAAUxB,GAAW2B,KAAKD,GAG/B,MAAME,EAAiB9F,KAAK2F,gBAAgBzB,GACxC4B,IAAmBA,EAAeC,YAClC/F,KAAKgG,kBAAkBF,GAE3B,MAAMzD,EAASI,SAAYzC,KAAKgE,eAAeE,EAAW0B,GACpDpD,EAAI6B,QAAQC,QAAQ,CAAEjC,OAAAA,IAO5B,OANAqB,OAAOC,eAAenB,EAAG,SAAU,CAC/BoB,MAAOnB,UACHX,QAAQC,KAAK,4DACPM,OAGPG,EAEXC,2BACIzC,KAAK0F,UAAY,GACjB,IAAK,MAAMO,KAAYjG,KAAK2F,gBACxB3F,KAAKkG,qBAAqBlG,KAAK2F,gBAAgBM,IAEnDjG,KAAK2F,gBAAkB,GAE3BQ,gBAAgBjC,EAAWkC,GACvB,MAAMV,EAAY1F,KAAK0F,UAAUxB,GAC7BwB,GACAA,EAAUW,SAAQJ,GAAYA,EAASG,KAG/CE,aAAapC,GACT,QAASlE,KAAK0F,UAAUxB,GAAWqC,OAEvCC,uBAAuBC,EAAiBC,GACpC1G,KAAK2F,gBAAgBe,GAAmB,CACpCX,YAAY,EACZU,gBAAAA,EACAC,gBAAAA,EACAC,QAASC,IACL5G,KAAKmG,gBAAgBO,EAAiBE,KAIlDC,cAAcC,EAAM,mBAChB,OAAO,IAAIpG,EAAUyE,UAAU2B,EAAKtH,EAAaA,cAACuD,eAEtDgE,YAAYD,EAAM,iBACd,OAAO,IAAIpG,EAAUyE,UAAU2B,EAAKtH,EAAaA,cAACwH,aAEtDvE,qBAAqByB,EAAW0B,GAC5B,MAAMF,EAAY1F,KAAK0F,UAAUxB,GACjC,IAAKwB,EACD,OAEJ,MAAMuB,EAAQvB,EAAUwB,QAAQtB,GAChC5F,KAAK0F,UAAUxB,GAAWiD,OAAOF,EAAO,GAGnCjH,KAAK0F,UAAUxB,GAAWqC,QAC3BvG,KAAKkG,qBAAqBlG,KAAK2F,gBAAgBzB,IAGvD8B,kBAAkBoB,GACd9H,OAAO+H,iBAAiBD,EAAOX,gBAAiBW,EAAOT,SACvDS,EAAOrB,YAAa,EAExBG,qBAAqBkB,GACZA,IAGL9H,OAAOgI,oBAAoBF,EAAOX,gBAAiBW,EAAOT,SAC1DS,EAAOrB,YAAa,wEF9DM1E,GG7BK,EAACZ,EAAK8G,KACzC,IAAIrH,EACJ,MAAMuF,EAAS8B,EAAU9B,OACnB9E,EAAUF,EAAIE,QACpB,IAAK8E,IAAWA,EAAOhH,KAEnB,MAAM,IAAIkB,MAAM,2KAGpBmC,QAAQC,KAAK,qBAAqB0D,EAAOhH,gEACpCkC,EAAQ8E,EAAOhH,SAAsF,QAA3EyB,EAAKuF,MAAAA,OAAuC,EAASA,EAAO7G,iBAA8B,IAAPsB,OAAgB,EAASA,EAAGsH,SAAS/G,EAAIG,kBAQvJD,EAAQ8E,EAAOhH,MAAQ8I,IHWcE,CAAwB/G,EAAWW"}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.cjs.js b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.cjs.js
new file mode 100644
index 00000000..0cb7824b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.cjs.js
@@ -0,0 +1,423 @@
+/*! Capacitor: https://capacitorjs.com/ - MIT License */
+'use strict';
+
+Object.defineProperty(exports, '__esModule', { value: true });
+
+const createCapacitorPlatforms = (win) => {
+ const defaultPlatformMap = new Map();
+ defaultPlatformMap.set('web', { name: 'web' });
+ const capPlatforms = win.CapacitorPlatforms || {
+ currentPlatform: { name: 'web' },
+ platforms: defaultPlatformMap,
+ };
+ const addPlatform = (name, platform) => {
+ capPlatforms.platforms.set(name, platform);
+ };
+ const setPlatform = (name) => {
+ if (capPlatforms.platforms.has(name)) {
+ capPlatforms.currentPlatform = capPlatforms.platforms.get(name);
+ }
+ };
+ capPlatforms.addPlatform = addPlatform;
+ capPlatforms.setPlatform = setPlatform;
+ return capPlatforms;
+};
+const initPlatforms = (win) => (win.CapacitorPlatforms = createCapacitorPlatforms(win));
+/**
+ * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead
+ */
+const CapacitorPlatforms = /*#__PURE__*/ initPlatforms((typeof globalThis !== 'undefined'
+ ? globalThis
+ : typeof self !== 'undefined'
+ ? self
+ : typeof window !== 'undefined'
+ ? window
+ : typeof global !== 'undefined'
+ ? global
+ : {}));
+/**
+ * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead
+ */
+const addPlatform = CapacitorPlatforms.addPlatform;
+/**
+ * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead
+ */
+const setPlatform = CapacitorPlatforms.setPlatform;
+
+const legacyRegisterWebPlugin = (cap, webPlugin) => {
+ var _a;
+ const config = webPlugin.config;
+ const Plugins = cap.Plugins;
+ if (!config || !config.name) {
+ // TODO: add link to upgrade guide
+ throw new Error(`Capacitor WebPlugin is using the deprecated "registerWebPlugin()" function, but without the config. Please use "registerPlugin()" instead to register this web plugin."`);
+ }
+ // TODO: add link to upgrade guide
+ console.warn(`Capacitor plugin "${config.name}" is using the deprecated "registerWebPlugin()" function`);
+ if (!Plugins[config.name] || ((_a = config === null || config === void 0 ? void 0 : config.platforms) === null || _a === void 0 ? void 0 : _a.includes(cap.getPlatform()))) {
+ // Add the web plugin into the plugins registry if there already isn't
+ // an existing one. If it doesn't already exist, that means
+ // there's no existing native implementation for it.
+ // - OR -
+ // If we already have a plugin registered (meaning it was defined in the native layer),
+ // then we should only overwrite it if the corresponding web plugin activates on
+ // a certain platform. For example: Geolocation uses the WebPlugin on Android but not iOS
+ Plugins[config.name] = webPlugin;
+ }
+};
+
+exports.ExceptionCode = void 0;
+(function (ExceptionCode) {
+ /**
+ * API is not implemented.
+ *
+ * This usually means the API can't be used because it is not implemented for
+ * the current platform.
+ */
+ ExceptionCode["Unimplemented"] = "UNIMPLEMENTED";
+ /**
+ * API is not available.
+ *
+ * This means the API can't be used right now because:
+ * - it is currently missing a prerequisite, such as network connectivity
+ * - it requires a particular platform or browser version
+ */
+ ExceptionCode["Unavailable"] = "UNAVAILABLE";
+})(exports.ExceptionCode || (exports.ExceptionCode = {}));
+class CapacitorException extends Error {
+ constructor(message, code) {
+ super(message);
+ this.message = message;
+ this.code = code;
+ }
+}
+const getPlatformId = (win) => {
+ var _a, _b;
+ if (win === null || win === void 0 ? void 0 : win.androidBridge) {
+ return 'android';
+ }
+ else if ((_b = (_a = win === null || win === void 0 ? void 0 : win.webkit) === null || _a === void 0 ? void 0 : _a.messageHandlers) === null || _b === void 0 ? void 0 : _b.bridge) {
+ return 'ios';
+ }
+ else {
+ return 'web';
+ }
+};
+
+const createCapacitor = (win) => {
+ var _a, _b, _c, _d, _e;
+ const capCustomPlatform = win.CapacitorCustomPlatform || null;
+ const cap = win.Capacitor || {};
+ const Plugins = (cap.Plugins = cap.Plugins || {});
+ /**
+ * @deprecated Use `capCustomPlatform` instead, default functions like registerPlugin will function with the new object.
+ */
+ const capPlatforms = win.CapacitorPlatforms;
+ const defaultGetPlatform = () => {
+ return capCustomPlatform !== null
+ ? capCustomPlatform.name
+ : getPlatformId(win);
+ };
+ const getPlatform = ((_a = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _a === void 0 ? void 0 : _a.getPlatform) || defaultGetPlatform;
+ const defaultIsNativePlatform = () => getPlatform() !== 'web';
+ const isNativePlatform = ((_b = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _b === void 0 ? void 0 : _b.isNativePlatform) || defaultIsNativePlatform;
+ const defaultIsPluginAvailable = (pluginName) => {
+ const plugin = registeredPlugins.get(pluginName);
+ if (plugin === null || plugin === void 0 ? void 0 : plugin.platforms.has(getPlatform())) {
+ // JS implementation available for the current platform.
+ return true;
+ }
+ if (getPluginHeader(pluginName)) {
+ // Native implementation available.
+ return true;
+ }
+ return false;
+ };
+ const isPluginAvailable = ((_c = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _c === void 0 ? void 0 : _c.isPluginAvailable) ||
+ defaultIsPluginAvailable;
+ const defaultGetPluginHeader = (pluginName) => { var _a; return (_a = cap.PluginHeaders) === null || _a === void 0 ? void 0 : _a.find(h => h.name === pluginName); };
+ const getPluginHeader = ((_d = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _d === void 0 ? void 0 : _d.getPluginHeader) || defaultGetPluginHeader;
+ const handleError = (err) => win.console.error(err);
+ const pluginMethodNoop = (_target, prop, pluginName) => {
+ return Promise.reject(`${pluginName} does not have an implementation of "${prop}".`);
+ };
+ const registeredPlugins = new Map();
+ const defaultRegisterPlugin = (pluginName, jsImplementations = {}) => {
+ const registeredPlugin = registeredPlugins.get(pluginName);
+ if (registeredPlugin) {
+ console.warn(`Capacitor plugin "${pluginName}" already registered. Cannot register plugins twice.`);
+ return registeredPlugin.proxy;
+ }
+ const platform = getPlatform();
+ const pluginHeader = getPluginHeader(pluginName);
+ let jsImplementation;
+ const loadPluginImplementation = async () => {
+ if (!jsImplementation && platform in jsImplementations) {
+ jsImplementation =
+ typeof jsImplementations[platform] === 'function'
+ ? (jsImplementation = await jsImplementations[platform]())
+ : (jsImplementation = jsImplementations[platform]);
+ }
+ else if (capCustomPlatform !== null &&
+ !jsImplementation &&
+ 'web' in jsImplementations) {
+ jsImplementation =
+ typeof jsImplementations['web'] === 'function'
+ ? (jsImplementation = await jsImplementations['web']())
+ : (jsImplementation = jsImplementations['web']);
+ }
+ return jsImplementation;
+ };
+ const createPluginMethod = (impl, prop) => {
+ var _a, _b;
+ if (pluginHeader) {
+ const methodHeader = pluginHeader === null || pluginHeader === void 0 ? void 0 : pluginHeader.methods.find(m => prop === m.name);
+ if (methodHeader) {
+ if (methodHeader.rtype === 'promise') {
+ return (options) => cap.nativePromise(pluginName, prop.toString(), options);
+ }
+ else {
+ return (options, callback) => cap.nativeCallback(pluginName, prop.toString(), options, callback);
+ }
+ }
+ else if (impl) {
+ return (_a = impl[prop]) === null || _a === void 0 ? void 0 : _a.bind(impl);
+ }
+ }
+ else if (impl) {
+ return (_b = impl[prop]) === null || _b === void 0 ? void 0 : _b.bind(impl);
+ }
+ else {
+ throw new CapacitorException(`"${pluginName}" plugin is not implemented on ${platform}`, exports.ExceptionCode.Unimplemented);
+ }
+ };
+ const createPluginMethodWrapper = (prop) => {
+ let remove;
+ const wrapper = (...args) => {
+ const p = loadPluginImplementation().then(impl => {
+ const fn = createPluginMethod(impl, prop);
+ if (fn) {
+ const p = fn(...args);
+ remove = p === null || p === void 0 ? void 0 : p.remove;
+ return p;
+ }
+ else {
+ throw new CapacitorException(`"${pluginName}.${prop}()" is not implemented on ${platform}`, exports.ExceptionCode.Unimplemented);
+ }
+ });
+ if (prop === 'addListener') {
+ p.remove = async () => remove();
+ }
+ return p;
+ };
+ // Some flair ✨
+ wrapper.toString = () => `${prop.toString()}() { [capacitor code] }`;
+ Object.defineProperty(wrapper, 'name', {
+ value: prop,
+ writable: false,
+ configurable: false,
+ });
+ return wrapper;
+ };
+ const addListener = createPluginMethodWrapper('addListener');
+ const removeListener = createPluginMethodWrapper('removeListener');
+ const addListenerNative = (eventName, callback) => {
+ const call = addListener({ eventName }, callback);
+ const remove = async () => {
+ const callbackId = await call;
+ removeListener({
+ eventName,
+ callbackId,
+ }, callback);
+ };
+ const p = new Promise(resolve => call.then(() => resolve({ remove })));
+ p.remove = async () => {
+ console.warn(`Using addListener() without 'await' is deprecated.`);
+ await remove();
+ };
+ return p;
+ };
+ const proxy = new Proxy({}, {
+ get(_, prop) {
+ switch (prop) {
+ // https://github.com/facebook/react/issues/20030
+ case '$$typeof':
+ return undefined;
+ case 'toJSON':
+ return () => ({});
+ case 'addListener':
+ return pluginHeader ? addListenerNative : addListener;
+ case 'removeListener':
+ return removeListener;
+ default:
+ return createPluginMethodWrapper(prop);
+ }
+ },
+ });
+ Plugins[pluginName] = proxy;
+ registeredPlugins.set(pluginName, {
+ name: pluginName,
+ proxy,
+ platforms: new Set([
+ ...Object.keys(jsImplementations),
+ ...(pluginHeader ? [platform] : []),
+ ]),
+ });
+ return proxy;
+ };
+ const registerPlugin = ((_e = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _e === void 0 ? void 0 : _e.registerPlugin) || defaultRegisterPlugin;
+ // Add in convertFileSrc for web, it will already be available in native context
+ if (!cap.convertFileSrc) {
+ cap.convertFileSrc = filePath => filePath;
+ }
+ cap.getPlatform = getPlatform;
+ cap.handleError = handleError;
+ cap.isNativePlatform = isNativePlatform;
+ cap.isPluginAvailable = isPluginAvailable;
+ cap.pluginMethodNoop = pluginMethodNoop;
+ cap.registerPlugin = registerPlugin;
+ cap.Exception = CapacitorException;
+ cap.DEBUG = !!cap.DEBUG;
+ cap.isLoggingEnabled = !!cap.isLoggingEnabled;
+ // Deprecated props
+ cap.platform = cap.getPlatform();
+ cap.isNative = cap.isNativePlatform();
+ return cap;
+};
+const initCapacitorGlobal = (win) => (win.Capacitor = createCapacitor(win));
+
+const Capacitor = /*#__PURE__*/ initCapacitorGlobal(typeof globalThis !== 'undefined'
+ ? globalThis
+ : typeof self !== 'undefined'
+ ? self
+ : typeof window !== 'undefined'
+ ? window
+ : typeof global !== 'undefined'
+ ? global
+ : {});
+const registerPlugin = Capacitor.registerPlugin;
+/**
+ * @deprecated Provided for backwards compatibility for Capacitor v2 plugins.
+ * Capacitor v3 plugins should import the plugin directly. This "Plugins"
+ * export is deprecated in v3, and will be removed in v4.
+ */
+const Plugins = Capacitor.Plugins;
+/**
+ * Provided for backwards compatibility. Use the registerPlugin() API
+ * instead, and provide the web plugin as the "web" implmenetation.
+ * For example
+ *
+ * export const Example = registerPlugin('Example', {
+ * web: () => import('./web').then(m => new m.Example())
+ * })
+ *
+ * @deprecated Deprecated in v3, will be removed from v4.
+ */
+const registerWebPlugin = (plugin) => legacyRegisterWebPlugin(Capacitor, plugin);
+
+/**
+ * Base class web plugins should extend.
+ */
+class WebPlugin {
+ constructor(config) {
+ this.listeners = {};
+ this.windowListeners = {};
+ if (config) {
+ // TODO: add link to upgrade guide
+ console.warn(`Capacitor WebPlugin "${config.name}" config object was deprecated in v3 and will be removed in v4.`);
+ this.config = config;
+ }
+ }
+ addListener(eventName, listenerFunc) {
+ const listeners = this.listeners[eventName];
+ if (!listeners) {
+ this.listeners[eventName] = [];
+ }
+ this.listeners[eventName].push(listenerFunc);
+ // If we haven't added a window listener for this event and it requires one,
+ // go ahead and add it
+ const windowListener = this.windowListeners[eventName];
+ if (windowListener && !windowListener.registered) {
+ this.addWindowListener(windowListener);
+ }
+ const remove = async () => this.removeListener(eventName, listenerFunc);
+ const p = Promise.resolve({ remove });
+ Object.defineProperty(p, 'remove', {
+ value: async () => {
+ console.warn(`Using addListener() without 'await' is deprecated.`);
+ await remove();
+ },
+ });
+ return p;
+ }
+ async removeAllListeners() {
+ this.listeners = {};
+ for (const listener in this.windowListeners) {
+ this.removeWindowListener(this.windowListeners[listener]);
+ }
+ this.windowListeners = {};
+ }
+ notifyListeners(eventName, data) {
+ const listeners = this.listeners[eventName];
+ if (listeners) {
+ listeners.forEach(listener => listener(data));
+ }
+ }
+ hasListeners(eventName) {
+ return !!this.listeners[eventName].length;
+ }
+ registerWindowListener(windowEventName, pluginEventName) {
+ this.windowListeners[pluginEventName] = {
+ registered: false,
+ windowEventName,
+ pluginEventName,
+ handler: event => {
+ this.notifyListeners(pluginEventName, event);
+ },
+ };
+ }
+ unimplemented(msg = 'not implemented') {
+ return new Capacitor.Exception(msg, exports.ExceptionCode.Unimplemented);
+ }
+ unavailable(msg = 'not available') {
+ return new Capacitor.Exception(msg, exports.ExceptionCode.Unavailable);
+ }
+ async removeListener(eventName, listenerFunc) {
+ const listeners = this.listeners[eventName];
+ if (!listeners) {
+ return;
+ }
+ const index = listeners.indexOf(listenerFunc);
+ this.listeners[eventName].splice(index, 1);
+ // If there are no more listeners for this type of event,
+ // remove the window listener
+ if (!this.listeners[eventName].length) {
+ this.removeWindowListener(this.windowListeners[eventName]);
+ }
+ }
+ addWindowListener(handle) {
+ window.addEventListener(handle.windowEventName, handle.handler);
+ handle.registered = true;
+ }
+ removeWindowListener(handle) {
+ if (!handle) {
+ return;
+ }
+ window.removeEventListener(handle.windowEventName, handle.handler);
+ handle.registered = false;
+ }
+}
+
+const WebView = /*#__PURE__*/ registerPlugin('WebView');
+
+exports.Capacitor = Capacitor;
+exports.CapacitorException = CapacitorException;
+exports.CapacitorPlatforms = CapacitorPlatforms;
+exports.Plugins = Plugins;
+exports.WebPlugin = WebPlugin;
+exports.WebView = WebView;
+exports.addPlatform = addPlatform;
+exports.registerPlugin = registerPlugin;
+exports.registerWebPlugin = registerWebPlugin;
+exports.setPlatform = setPlatform;
+//# sourceMappingURL=index.cjs.js.map
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.cjs.js.map b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.cjs.js.map
new file mode 100644
index 00000000..2258b545
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.cjs.js.map
@@ -0,0 +1 @@
+{"version":3,"file":"index.cjs.js","sources":["../build/platforms.js","../build/legacy/legacy-web-plugin-merge.js","../build/util.js","../build/runtime.js","../build/global.js","../build/web-plugin.js","../build/core-plugins.js"],"sourcesContent":["const createCapacitorPlatforms = (win) => {\n const defaultPlatformMap = new Map();\n defaultPlatformMap.set('web', { name: 'web' });\n const capPlatforms = win.CapacitorPlatforms || {\n currentPlatform: { name: 'web' },\n platforms: defaultPlatformMap,\n };\n const addPlatform = (name, platform) => {\n capPlatforms.platforms.set(name, platform);\n };\n const setPlatform = (name) => {\n if (capPlatforms.platforms.has(name)) {\n capPlatforms.currentPlatform = capPlatforms.platforms.get(name);\n }\n };\n capPlatforms.addPlatform = addPlatform;\n capPlatforms.setPlatform = setPlatform;\n return capPlatforms;\n};\nconst initPlatforms = (win) => (win.CapacitorPlatforms = createCapacitorPlatforms(win));\n/**\n * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead\n */\nexport const CapacitorPlatforms = /*#__PURE__*/ initPlatforms((typeof globalThis !== 'undefined'\n ? globalThis\n : typeof self !== 'undefined'\n ? self\n : typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined'\n ? global\n : {}));\n/**\n * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead\n */\nexport const addPlatform = CapacitorPlatforms.addPlatform;\n/**\n * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead\n */\nexport const setPlatform = CapacitorPlatforms.setPlatform;\n//# sourceMappingURL=platforms.js.map","export const legacyRegisterWebPlugin = (cap, webPlugin) => {\n var _a;\n const config = webPlugin.config;\n const Plugins = cap.Plugins;\n if (!config || !config.name) {\n // TODO: add link to upgrade guide\n throw new Error(`Capacitor WebPlugin is using the deprecated \"registerWebPlugin()\" function, but without the config. Please use \"registerPlugin()\" instead to register this web plugin.\"`);\n }\n // TODO: add link to upgrade guide\n console.warn(`Capacitor plugin \"${config.name}\" is using the deprecated \"registerWebPlugin()\" function`);\n if (!Plugins[config.name] || ((_a = config === null || config === void 0 ? void 0 : config.platforms) === null || _a === void 0 ? void 0 : _a.includes(cap.getPlatform()))) {\n // Add the web plugin into the plugins registry if there already isn't\n // an existing one. If it doesn't already exist, that means\n // there's no existing native implementation for it.\n // - OR -\n // If we already have a plugin registered (meaning it was defined in the native layer),\n // then we should only overwrite it if the corresponding web plugin activates on\n // a certain platform. For example: Geolocation uses the WebPlugin on Android but not iOS\n Plugins[config.name] = webPlugin;\n }\n};\n//# sourceMappingURL=legacy-web-plugin-merge.js.map","export var ExceptionCode;\n(function (ExceptionCode) {\n /**\n * API is not implemented.\n *\n * This usually means the API can't be used because it is not implemented for\n * the current platform.\n */\n ExceptionCode[\"Unimplemented\"] = \"UNIMPLEMENTED\";\n /**\n * API is not available.\n *\n * This means the API can't be used right now because:\n * - it is currently missing a prerequisite, such as network connectivity\n * - it requires a particular platform or browser version\n */\n ExceptionCode[\"Unavailable\"] = \"UNAVAILABLE\";\n})(ExceptionCode || (ExceptionCode = {}));\nexport class CapacitorException extends Error {\n constructor(message, code) {\n super(message);\n this.message = message;\n this.code = code;\n }\n}\nexport const getPlatformId = (win) => {\n var _a, _b;\n if (win === null || win === void 0 ? void 0 : win.androidBridge) {\n return 'android';\n }\n else if ((_b = (_a = win === null || win === void 0 ? void 0 : win.webkit) === null || _a === void 0 ? void 0 : _a.messageHandlers) === null || _b === void 0 ? void 0 : _b.bridge) {\n return 'ios';\n }\n else {\n return 'web';\n }\n};\n//# sourceMappingURL=util.js.map","import { CapacitorException, getPlatformId, ExceptionCode } from './util';\nexport const createCapacitor = (win) => {\n var _a, _b, _c, _d, _e;\n const capCustomPlatform = win.CapacitorCustomPlatform || null;\n const cap = win.Capacitor || {};\n const Plugins = (cap.Plugins = cap.Plugins || {});\n /**\n * @deprecated Use `capCustomPlatform` instead, default functions like registerPlugin will function with the new object.\n */\n const capPlatforms = win.CapacitorPlatforms;\n const defaultGetPlatform = () => {\n return capCustomPlatform !== null\n ? capCustomPlatform.name\n : getPlatformId(win);\n };\n const getPlatform = ((_a = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _a === void 0 ? void 0 : _a.getPlatform) || defaultGetPlatform;\n const defaultIsNativePlatform = () => getPlatform() !== 'web';\n const isNativePlatform = ((_b = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _b === void 0 ? void 0 : _b.isNativePlatform) || defaultIsNativePlatform;\n const defaultIsPluginAvailable = (pluginName) => {\n const plugin = registeredPlugins.get(pluginName);\n if (plugin === null || plugin === void 0 ? void 0 : plugin.platforms.has(getPlatform())) {\n // JS implementation available for the current platform.\n return true;\n }\n if (getPluginHeader(pluginName)) {\n // Native implementation available.\n return true;\n }\n return false;\n };\n const isPluginAvailable = ((_c = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _c === void 0 ? void 0 : _c.isPluginAvailable) ||\n defaultIsPluginAvailable;\n const defaultGetPluginHeader = (pluginName) => { var _a; return (_a = cap.PluginHeaders) === null || _a === void 0 ? void 0 : _a.find(h => h.name === pluginName); };\n const getPluginHeader = ((_d = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _d === void 0 ? void 0 : _d.getPluginHeader) || defaultGetPluginHeader;\n const handleError = (err) => win.console.error(err);\n const pluginMethodNoop = (_target, prop, pluginName) => {\n return Promise.reject(`${pluginName} does not have an implementation of \"${prop}\".`);\n };\n const registeredPlugins = new Map();\n const defaultRegisterPlugin = (pluginName, jsImplementations = {}) => {\n const registeredPlugin = registeredPlugins.get(pluginName);\n if (registeredPlugin) {\n console.warn(`Capacitor plugin \"${pluginName}\" already registered. Cannot register plugins twice.`);\n return registeredPlugin.proxy;\n }\n const platform = getPlatform();\n const pluginHeader = getPluginHeader(pluginName);\n let jsImplementation;\n const loadPluginImplementation = async () => {\n if (!jsImplementation && platform in jsImplementations) {\n jsImplementation =\n typeof jsImplementations[platform] === 'function'\n ? (jsImplementation = await jsImplementations[platform]())\n : (jsImplementation = jsImplementations[platform]);\n }\n else if (capCustomPlatform !== null &&\n !jsImplementation &&\n 'web' in jsImplementations) {\n jsImplementation =\n typeof jsImplementations['web'] === 'function'\n ? (jsImplementation = await jsImplementations['web']())\n : (jsImplementation = jsImplementations['web']);\n }\n return jsImplementation;\n };\n const createPluginMethod = (impl, prop) => {\n var _a, _b;\n if (pluginHeader) {\n const methodHeader = pluginHeader === null || pluginHeader === void 0 ? void 0 : pluginHeader.methods.find(m => prop === m.name);\n if (methodHeader) {\n if (methodHeader.rtype === 'promise') {\n return (options) => cap.nativePromise(pluginName, prop.toString(), options);\n }\n else {\n return (options, callback) => cap.nativeCallback(pluginName, prop.toString(), options, callback);\n }\n }\n else if (impl) {\n return (_a = impl[prop]) === null || _a === void 0 ? void 0 : _a.bind(impl);\n }\n }\n else if (impl) {\n return (_b = impl[prop]) === null || _b === void 0 ? void 0 : _b.bind(impl);\n }\n else {\n throw new CapacitorException(`\"${pluginName}\" plugin is not implemented on ${platform}`, ExceptionCode.Unimplemented);\n }\n };\n const createPluginMethodWrapper = (prop) => {\n let remove;\n const wrapper = (...args) => {\n const p = loadPluginImplementation().then(impl => {\n const fn = createPluginMethod(impl, prop);\n if (fn) {\n const p = fn(...args);\n remove = p === null || p === void 0 ? void 0 : p.remove;\n return p;\n }\n else {\n throw new CapacitorException(`\"${pluginName}.${prop}()\" is not implemented on ${platform}`, ExceptionCode.Unimplemented);\n }\n });\n if (prop === 'addListener') {\n p.remove = async () => remove();\n }\n return p;\n };\n // Some flair ✨\n wrapper.toString = () => `${prop.toString()}() { [capacitor code] }`;\n Object.defineProperty(wrapper, 'name', {\n value: prop,\n writable: false,\n configurable: false,\n });\n return wrapper;\n };\n const addListener = createPluginMethodWrapper('addListener');\n const removeListener = createPluginMethodWrapper('removeListener');\n const addListenerNative = (eventName, callback) => {\n const call = addListener({ eventName }, callback);\n const remove = async () => {\n const callbackId = await call;\n removeListener({\n eventName,\n callbackId,\n }, callback);\n };\n const p = new Promise(resolve => call.then(() => resolve({ remove })));\n p.remove = async () => {\n console.warn(`Using addListener() without 'await' is deprecated.`);\n await remove();\n };\n return p;\n };\n const proxy = new Proxy({}, {\n get(_, prop) {\n switch (prop) {\n // https://github.com/facebook/react/issues/20030\n case '$$typeof':\n return undefined;\n case 'toJSON':\n return () => ({});\n case 'addListener':\n return pluginHeader ? addListenerNative : addListener;\n case 'removeListener':\n return removeListener;\n default:\n return createPluginMethodWrapper(prop);\n }\n },\n });\n Plugins[pluginName] = proxy;\n registeredPlugins.set(pluginName, {\n name: pluginName,\n proxy,\n platforms: new Set([\n ...Object.keys(jsImplementations),\n ...(pluginHeader ? [platform] : []),\n ]),\n });\n return proxy;\n };\n const registerPlugin = ((_e = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _e === void 0 ? void 0 : _e.registerPlugin) || defaultRegisterPlugin;\n // Add in convertFileSrc for web, it will already be available in native context\n if (!cap.convertFileSrc) {\n cap.convertFileSrc = filePath => filePath;\n }\n cap.getPlatform = getPlatform;\n cap.handleError = handleError;\n cap.isNativePlatform = isNativePlatform;\n cap.isPluginAvailable = isPluginAvailable;\n cap.pluginMethodNoop = pluginMethodNoop;\n cap.registerPlugin = registerPlugin;\n cap.Exception = CapacitorException;\n cap.DEBUG = !!cap.DEBUG;\n cap.isLoggingEnabled = !!cap.isLoggingEnabled;\n // Deprecated props\n cap.platform = cap.getPlatform();\n cap.isNative = cap.isNativePlatform();\n return cap;\n};\nexport const initCapacitorGlobal = (win) => (win.Capacitor = createCapacitor(win));\n//# sourceMappingURL=runtime.js.map","import { legacyRegisterWebPlugin } from './legacy/legacy-web-plugin-merge';\nimport { initCapacitorGlobal } from './runtime';\nexport const Capacitor = /*#__PURE__*/ initCapacitorGlobal(typeof globalThis !== 'undefined'\n ? globalThis\n : typeof self !== 'undefined'\n ? self\n : typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined'\n ? global\n : {});\nexport const registerPlugin = Capacitor.registerPlugin;\n/**\n * @deprecated Provided for backwards compatibility for Capacitor v2 plugins.\n * Capacitor v3 plugins should import the plugin directly. This \"Plugins\"\n * export is deprecated in v3, and will be removed in v4.\n */\nexport const Plugins = Capacitor.Plugins;\n/**\n * Provided for backwards compatibility. Use the registerPlugin() API\n * instead, and provide the web plugin as the \"web\" implmenetation.\n * For example\n *\n * export const Example = registerPlugin('Example', {\n * web: () => import('./web').then(m => new m.Example())\n * })\n *\n * @deprecated Deprecated in v3, will be removed from v4.\n */\nexport const registerWebPlugin = (plugin) => legacyRegisterWebPlugin(Capacitor, plugin);\n//# sourceMappingURL=global.js.map","import { Capacitor } from './global';\nimport { ExceptionCode } from './util';\n/**\n * Base class web plugins should extend.\n */\nexport class WebPlugin {\n constructor(config) {\n this.listeners = {};\n this.windowListeners = {};\n if (config) {\n // TODO: add link to upgrade guide\n console.warn(`Capacitor WebPlugin \"${config.name}\" config object was deprecated in v3 and will be removed in v4.`);\n this.config = config;\n }\n }\n addListener(eventName, listenerFunc) {\n const listeners = this.listeners[eventName];\n if (!listeners) {\n this.listeners[eventName] = [];\n }\n this.listeners[eventName].push(listenerFunc);\n // If we haven't added a window listener for this event and it requires one,\n // go ahead and add it\n const windowListener = this.windowListeners[eventName];\n if (windowListener && !windowListener.registered) {\n this.addWindowListener(windowListener);\n }\n const remove = async () => this.removeListener(eventName, listenerFunc);\n const p = Promise.resolve({ remove });\n Object.defineProperty(p, 'remove', {\n value: async () => {\n console.warn(`Using addListener() without 'await' is deprecated.`);\n await remove();\n },\n });\n return p;\n }\n async removeAllListeners() {\n this.listeners = {};\n for (const listener in this.windowListeners) {\n this.removeWindowListener(this.windowListeners[listener]);\n }\n this.windowListeners = {};\n }\n notifyListeners(eventName, data) {\n const listeners = this.listeners[eventName];\n if (listeners) {\n listeners.forEach(listener => listener(data));\n }\n }\n hasListeners(eventName) {\n return !!this.listeners[eventName].length;\n }\n registerWindowListener(windowEventName, pluginEventName) {\n this.windowListeners[pluginEventName] = {\n registered: false,\n windowEventName,\n pluginEventName,\n handler: event => {\n this.notifyListeners(pluginEventName, event);\n },\n };\n }\n unimplemented(msg = 'not implemented') {\n return new Capacitor.Exception(msg, ExceptionCode.Unimplemented);\n }\n unavailable(msg = 'not available') {\n return new Capacitor.Exception(msg, ExceptionCode.Unavailable);\n }\n async removeListener(eventName, listenerFunc) {\n const listeners = this.listeners[eventName];\n if (!listeners) {\n return;\n }\n const index = listeners.indexOf(listenerFunc);\n this.listeners[eventName].splice(index, 1);\n // If there are no more listeners for this type of event,\n // remove the window listener\n if (!this.listeners[eventName].length) {\n this.removeWindowListener(this.windowListeners[eventName]);\n }\n }\n addWindowListener(handle) {\n window.addEventListener(handle.windowEventName, handle.handler);\n handle.registered = true;\n }\n removeWindowListener(handle) {\n if (!handle) {\n return;\n }\n window.removeEventListener(handle.windowEventName, handle.handler);\n handle.registered = false;\n }\n}\n//# sourceMappingURL=web-plugin.js.map","import { registerPlugin } from './global';\nexport const WebView = /*#__PURE__*/ registerPlugin('WebView');\n//# sourceMappingURL=core-plugins.js.map"],"names":["ExceptionCode"],"mappings":";;;;;AAAA,MAAM,wBAAwB,GAAG,CAAC,GAAG,KAAK;AAC1C,IAAI,MAAM,kBAAkB,GAAG,IAAI,GAAG,EAAE,CAAC;AACzC,IAAI,kBAAkB,CAAC,GAAG,CAAC,KAAK,EAAE,EAAE,IAAI,EAAE,KAAK,EAAE,CAAC,CAAC;AACnD,IAAI,MAAM,YAAY,GAAG,GAAG,CAAC,kBAAkB,IAAI;AACnD,QAAQ,eAAe,EAAE,EAAE,IAAI,EAAE,KAAK,EAAE;AACxC,QAAQ,SAAS,EAAE,kBAAkB;AACrC,KAAK,CAAC;AACN,IAAI,MAAM,WAAW,GAAG,CAAC,IAAI,EAAE,QAAQ,KAAK;AAC5C,QAAQ,YAAY,CAAC,SAAS,CAAC,GAAG,CAAC,IAAI,EAAE,QAAQ,CAAC,CAAC;AACnD,KAAK,CAAC;AACN,IAAI,MAAM,WAAW,GAAG,CAAC,IAAI,KAAK;AAClC,QAAQ,IAAI,YAAY,CAAC,SAAS,CAAC,GAAG,CAAC,IAAI,CAAC,EAAE;AAC9C,YAAY,YAAY,CAAC,eAAe,GAAG,YAAY,CAAC,SAAS,CAAC,GAAG,CAAC,IAAI,CAAC,CAAC;AAC5E,SAAS;AACT,KAAK,CAAC;AACN,IAAI,YAAY,CAAC,WAAW,GAAG,WAAW,CAAC;AAC3C,IAAI,YAAY,CAAC,WAAW,GAAG,WAAW,CAAC;AAC3C,IAAI,OAAO,YAAY,CAAC;AACxB,CAAC,CAAC;AACF,MAAM,aAAa,GAAG,CAAC,GAAG,MAAM,GAAG,CAAC,kBAAkB,GAAG,wBAAwB,CAAC,GAAG,CAAC,CAAC,CAAC;AACxF;AACA;AACA;AACY,MAAC,kBAAkB,iBAAiB,aAAa,EAAE,OAAO,UAAU,KAAK,WAAW;AAChG,MAAM,UAAU;AAChB,MAAM,OAAO,IAAI,KAAK,WAAW;AACjC,UAAU,IAAI;AACd,UAAU,OAAO,MAAM,KAAK,WAAW;AACvC,cAAc,MAAM;AACpB,cAAc,OAAO,MAAM,KAAK,WAAW;AAC3C,kBAAkB,MAAM;AACxB,kBAAkB,EAAE,GAAG;AACvB;AACA;AACA;AACY,MAAC,WAAW,GAAG,kBAAkB,CAAC,YAAY;AAC1D;AACA;AACA;AACY,MAAC,WAAW,GAAG,kBAAkB,CAAC;;ACvCvC,MAAM,uBAAuB,GAAG,CAAC,GAAG,EAAE,SAAS,KAAK;AAC3D,IAAI,IAAI,EAAE,CAAC;AACX,IAAI,MAAM,MAAM,GAAG,SAAS,CAAC,MAAM,CAAC;AACpC,IAAI,MAAM,OAAO,GAAG,GAAG,CAAC,OAAO,CAAC;AAChC,IAAI,IAAI,CAAC,MAAM,IAAI,CAAC,MAAM,CAAC,IAAI,EAAE;AACjC;AACA,QAAQ,MAAM,IAAI,KAAK,CAAC,CAAC,uKAAuK,CAAC,CAAC,CAAC;AACnM,KAAK;AACL;AACA,IAAI,OAAO,CAAC,IAAI,CAAC,CAAC,kBAAkB,EAAE,MAAM,CAAC,IAAI,CAAC,wDAAwD,CAAC,CAAC,CAAC;AAC7G,IAAI,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,EAAE,GAAG,MAAM,KAAK,IAAI,IAAI,MAAM,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,MAAM,CAAC,SAAS,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,WAAW,EAAE,CAAC,CAAC,EAAE;AAChL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,OAAO,CAAC,MAAM,CAAC,IAAI,CAAC,GAAG,SAAS,CAAC;AACzC,KAAK;AACL,CAAC;;ACpBUA,+BAAc;AACzB,CAAC,UAAU,aAAa,EAAE;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA,IAAI,aAAa,CAAC,eAAe,CAAC,GAAG,eAAe,CAAC;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI,aAAa,CAAC,aAAa,CAAC,GAAG,aAAa,CAAC;AACjD,CAAC,EAAEA,qBAAa,KAAKA,qBAAa,GAAG,EAAE,CAAC,CAAC,CAAC;AACnC,MAAM,kBAAkB,SAAS,KAAK,CAAC;AAC9C,IAAI,WAAW,CAAC,OAAO,EAAE,IAAI,EAAE;AAC/B,QAAQ,KAAK,CAAC,OAAO,CAAC,CAAC;AACvB,QAAQ,IAAI,CAAC,OAAO,GAAG,OAAO,CAAC;AAC/B,QAAQ,IAAI,CAAC,IAAI,GAAG,IAAI,CAAC;AACzB,KAAK;AACL,CAAC;AACM,MAAM,aAAa,GAAG,CAAC,GAAG,KAAK;AACtC,IAAI,IAAI,EAAE,EAAE,EAAE,CAAC;AACf,IAAI,IAAI,GAAG,KAAK,IAAI,IAAI,GAAG,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,GAAG,CAAC,aAAa,EAAE;AACrE,QAAQ,OAAO,SAAS,CAAC;AACzB,KAAK;AACL,SAAS,IAAI,CAAC,EAAE,GAAG,CAAC,EAAE,GAAG,GAAG,KAAK,IAAI,IAAI,GAAG,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,GAAG,CAAC,MAAM,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,MAAM,EAAE;AACxL,QAAQ,OAAO,KAAK,CAAC;AACrB,KAAK;AACL,SAAS;AACT,QAAQ,OAAO,KAAK,CAAC;AACrB,KAAK;AACL,CAAC;;ACnCM,MAAM,eAAe,GAAG,CAAC,GAAG,KAAK;AACxC,IAAI,IAAI,EAAE,EAAE,EAAE,EAAE,EAAE,EAAE,EAAE,EAAE,EAAE,CAAC;AAC3B,IAAI,MAAM,iBAAiB,GAAG,GAAG,CAAC,uBAAuB,IAAI,IAAI,CAAC;AAClE,IAAI,MAAM,GAAG,GAAG,GAAG,CAAC,SAAS,IAAI,EAAE,CAAC;AACpC,IAAI,MAAM,OAAO,IAAI,GAAG,CAAC,OAAO,GAAG,GAAG,CAAC,OAAO,IAAI,EAAE,CAAC,CAAC;AACtD;AACA;AACA;AACA,IAAI,MAAM,YAAY,GAAG,GAAG,CAAC,kBAAkB,CAAC;AAChD,IAAI,MAAM,kBAAkB,GAAG,MAAM;AACrC,QAAQ,OAAO,iBAAiB,KAAK,IAAI;AACzC,cAAc,iBAAiB,CAAC,IAAI;AACpC,cAAc,aAAa,CAAC,GAAG,CAAC,CAAC;AACjC,KAAK,CAAC;AACN,IAAI,MAAM,WAAW,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,WAAW,KAAK,kBAAkB,CAAC;AACpM,IAAI,MAAM,uBAAuB,GAAG,MAAM,WAAW,EAAE,KAAK,KAAK,CAAC;AAClE,IAAI,MAAM,gBAAgB,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,gBAAgB,KAAK,uBAAuB,CAAC;AACnN,IAAI,MAAM,wBAAwB,GAAG,CAAC,UAAU,KAAK;AACrD,QAAQ,MAAM,MAAM,GAAG,iBAAiB,CAAC,GAAG,CAAC,UAAU,CAAC,CAAC;AACzD,QAAQ,IAAI,MAAM,KAAK,IAAI,IAAI,MAAM,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,MAAM,CAAC,SAAS,CAAC,GAAG,CAAC,WAAW,EAAE,CAAC,EAAE;AACjG;AACA,YAAY,OAAO,IAAI,CAAC;AACxB,SAAS;AACT,QAAQ,IAAI,eAAe,CAAC,UAAU,CAAC,EAAE;AACzC;AACA,YAAY,OAAO,IAAI,CAAC;AACxB,SAAS;AACT,QAAQ,OAAO,KAAK,CAAC;AACrB,KAAK,CAAC;AACN,IAAI,MAAM,iBAAiB,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,iBAAiB;AACxL,QAAQ,wBAAwB,CAAC;AACjC,IAAI,MAAM,sBAAsB,GAAG,CAAC,UAAU,KAAK,EAAE,IAAI,EAAE,CAAC,CAAC,OAAO,CAAC,EAAE,GAAG,GAAG,CAAC,aAAa,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,IAAI,CAAC,CAAC,IAAI,CAAC,CAAC,IAAI,KAAK,UAAU,CAAC,CAAC,EAAE,CAAC;AACzK,IAAI,MAAM,eAAe,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,eAAe,KAAK,sBAAsB,CAAC;AAChN,IAAI,MAAM,WAAW,GAAG,CAAC,GAAG,KAAK,GAAG,CAAC,OAAO,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;AACxD,IAAI,MAAM,gBAAgB,GAAG,CAAC,OAAO,EAAE,IAAI,EAAE,UAAU,KAAK;AAC5D,QAAQ,OAAO,OAAO,CAAC,MAAM,CAAC,CAAC,EAAE,UAAU,CAAC,qCAAqC,EAAE,IAAI,CAAC,EAAE,CAAC,CAAC,CAAC;AAC7F,KAAK,CAAC;AACN,IAAI,MAAM,iBAAiB,GAAG,IAAI,GAAG,EAAE,CAAC;AACxC,IAAI,MAAM,qBAAqB,GAAG,CAAC,UAAU,EAAE,iBAAiB,GAAG,EAAE,KAAK;AAC1E,QAAQ,MAAM,gBAAgB,GAAG,iBAAiB,CAAC,GAAG,CAAC,UAAU,CAAC,CAAC;AACnE,QAAQ,IAAI,gBAAgB,EAAE;AAC9B,YAAY,OAAO,CAAC,IAAI,CAAC,CAAC,kBAAkB,EAAE,UAAU,CAAC,oDAAoD,CAAC,CAAC,CAAC;AAChH,YAAY,OAAO,gBAAgB,CAAC,KAAK,CAAC;AAC1C,SAAS;AACT,QAAQ,MAAM,QAAQ,GAAG,WAAW,EAAE,CAAC;AACvC,QAAQ,MAAM,YAAY,GAAG,eAAe,CAAC,UAAU,CAAC,CAAC;AACzD,QAAQ,IAAI,gBAAgB,CAAC;AAC7B,QAAQ,MAAM,wBAAwB,GAAG,YAAY;AACrD,YAAY,IAAI,CAAC,gBAAgB,IAAI,QAAQ,IAAI,iBAAiB,EAAE;AACpE,gBAAgB,gBAAgB;AAChC,oBAAoB,OAAO,iBAAiB,CAAC,QAAQ,CAAC,KAAK,UAAU;AACrE,2BAA2B,gBAAgB,GAAG,MAAM,iBAAiB,CAAC,QAAQ,CAAC,EAAE;AACjF,2BAA2B,gBAAgB,GAAG,iBAAiB,CAAC,QAAQ,CAAC,CAAC,CAAC;AAC3E,aAAa;AACb,iBAAiB,IAAI,iBAAiB,KAAK,IAAI;AAC/C,gBAAgB,CAAC,gBAAgB;AACjC,gBAAgB,KAAK,IAAI,iBAAiB,EAAE;AAC5C,gBAAgB,gBAAgB;AAChC,oBAAoB,OAAO,iBAAiB,CAAC,KAAK,CAAC,KAAK,UAAU;AAClE,2BAA2B,gBAAgB,GAAG,MAAM,iBAAiB,CAAC,KAAK,CAAC,EAAE;AAC9E,2BAA2B,gBAAgB,GAAG,iBAAiB,CAAC,KAAK,CAAC,CAAC,CAAC;AACxE,aAAa;AACb,YAAY,OAAO,gBAAgB,CAAC;AACpC,SAAS,CAAC;AACV,QAAQ,MAAM,kBAAkB,GAAG,CAAC,IAAI,EAAE,IAAI,KAAK;AACnD,YAAY,IAAI,EAAE,EAAE,EAAE,CAAC;AACvB,YAAY,IAAI,YAAY,EAAE;AAC9B,gBAAgB,MAAM,YAAY,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,IAAI,IAAI,KAAK,CAAC,CAAC,IAAI,CAAC,CAAC;AACjJ,gBAAgB,IAAI,YAAY,EAAE;AAClC,oBAAoB,IAAI,YAAY,CAAC,KAAK,KAAK,SAAS,EAAE;AAC1D,wBAAwB,OAAO,CAAC,OAAO,KAAK,GAAG,CAAC,aAAa,CAAC,UAAU,EAAE,IAAI,CAAC,QAAQ,EAAE,EAAE,OAAO,CAAC,CAAC;AACpG,qBAAqB;AACrB,yBAAyB;AACzB,wBAAwB,OAAO,CAAC,OAAO,EAAE,QAAQ,KAAK,GAAG,CAAC,cAAc,CAAC,UAAU,EAAE,IAAI,CAAC,QAAQ,EAAE,EAAE,OAAO,EAAE,QAAQ,CAAC,CAAC;AACzH,qBAAqB;AACrB,iBAAiB;AACjB,qBAAqB,IAAI,IAAI,EAAE;AAC/B,oBAAoB,OAAO,CAAC,EAAE,GAAG,IAAI,CAAC,IAAI,CAAC,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;AAChG,iBAAiB;AACjB,aAAa;AACb,iBAAiB,IAAI,IAAI,EAAE;AAC3B,gBAAgB,OAAO,CAAC,EAAE,GAAG,IAAI,CAAC,IAAI,CAAC,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;AAC5F,aAAa;AACb,iBAAiB;AACjB,gBAAgB,MAAM,IAAI,kBAAkB,CAAC,CAAC,CAAC,EAAE,UAAU,CAAC,+BAA+B,EAAE,QAAQ,CAAC,CAAC,EAAEA,qBAAa,CAAC,aAAa,CAAC,CAAC;AACtI,aAAa;AACb,SAAS,CAAC;AACV,QAAQ,MAAM,yBAAyB,GAAG,CAAC,IAAI,KAAK;AACpD,YAAY,IAAI,MAAM,CAAC;AACvB,YAAY,MAAM,OAAO,GAAG,CAAC,GAAG,IAAI,KAAK;AACzC,gBAAgB,MAAM,CAAC,GAAG,wBAAwB,EAAE,CAAC,IAAI,CAAC,IAAI,IAAI;AAClE,oBAAoB,MAAM,EAAE,GAAG,kBAAkB,CAAC,IAAI,EAAE,IAAI,CAAC,CAAC;AAC9D,oBAAoB,IAAI,EAAE,EAAE;AAC5B,wBAAwB,MAAM,CAAC,GAAG,EAAE,CAAC,GAAG,IAAI,CAAC,CAAC;AAC9C,wBAAwB,MAAM,GAAG,CAAC,KAAK,IAAI,IAAI,CAAC,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,CAAC,CAAC,MAAM,CAAC;AAChF,wBAAwB,OAAO,CAAC,CAAC;AACjC,qBAAqB;AACrB,yBAAyB;AACzB,wBAAwB,MAAM,IAAI,kBAAkB,CAAC,CAAC,CAAC,EAAE,UAAU,CAAC,CAAC,EAAE,IAAI,CAAC,0BAA0B,EAAE,QAAQ,CAAC,CAAC,EAAEA,qBAAa,CAAC,aAAa,CAAC,CAAC;AACjJ,qBAAqB;AACrB,iBAAiB,CAAC,CAAC;AACnB,gBAAgB,IAAI,IAAI,KAAK,aAAa,EAAE;AAC5C,oBAAoB,CAAC,CAAC,MAAM,GAAG,YAAY,MAAM,EAAE,CAAC;AACpD,iBAAiB;AACjB,gBAAgB,OAAO,CAAC,CAAC;AACzB,aAAa,CAAC;AACd;AACA,YAAY,OAAO,CAAC,QAAQ,GAAG,MAAM,CAAC,EAAE,IAAI,CAAC,QAAQ,EAAE,CAAC,uBAAuB,CAAC,CAAC;AACjF,YAAY,MAAM,CAAC,cAAc,CAAC,OAAO,EAAE,MAAM,EAAE;AACnD,gBAAgB,KAAK,EAAE,IAAI;AAC3B,gBAAgB,QAAQ,EAAE,KAAK;AAC/B,gBAAgB,YAAY,EAAE,KAAK;AACnC,aAAa,CAAC,CAAC;AACf,YAAY,OAAO,OAAO,CAAC;AAC3B,SAAS,CAAC;AACV,QAAQ,MAAM,WAAW,GAAG,yBAAyB,CAAC,aAAa,CAAC,CAAC;AACrE,QAAQ,MAAM,cAAc,GAAG,yBAAyB,CAAC,gBAAgB,CAAC,CAAC;AAC3E,QAAQ,MAAM,iBAAiB,GAAG,CAAC,SAAS,EAAE,QAAQ,KAAK;AAC3D,YAAY,MAAM,IAAI,GAAG,WAAW,CAAC,EAAE,SAAS,EAAE,EAAE,QAAQ,CAAC,CAAC;AAC9D,YAAY,MAAM,MAAM,GAAG,YAAY;AACvC,gBAAgB,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC;AAC9C,gBAAgB,cAAc,CAAC;AAC/B,oBAAoB,SAAS;AAC7B,oBAAoB,UAAU;AAC9B,iBAAiB,EAAE,QAAQ,CAAC,CAAC;AAC7B,aAAa,CAAC;AACd,YAAY,MAAM,CAAC,GAAG,IAAI,OAAO,CAAC,OAAO,IAAI,IAAI,CAAC,IAAI,CAAC,MAAM,OAAO,CAAC,EAAE,MAAM,EAAE,CAAC,CAAC,CAAC,CAAC;AACnF,YAAY,CAAC,CAAC,MAAM,GAAG,YAAY;AACnC,gBAAgB,OAAO,CAAC,IAAI,CAAC,CAAC,kDAAkD,CAAC,CAAC,CAAC;AACnF,gBAAgB,MAAM,MAAM,EAAE,CAAC;AAC/B,aAAa,CAAC;AACd,YAAY,OAAO,CAAC,CAAC;AACrB,SAAS,CAAC;AACV,QAAQ,MAAM,KAAK,GAAG,IAAI,KAAK,CAAC,EAAE,EAAE;AACpC,YAAY,GAAG,CAAC,CAAC,EAAE,IAAI,EAAE;AACzB,gBAAgB,QAAQ,IAAI;AAC5B;AACA,oBAAoB,KAAK,UAAU;AACnC,wBAAwB,OAAO,SAAS,CAAC;AACzC,oBAAoB,KAAK,QAAQ;AACjC,wBAAwB,OAAO,OAAO,EAAE,CAAC,CAAC;AAC1C,oBAAoB,KAAK,aAAa;AACtC,wBAAwB,OAAO,YAAY,GAAG,iBAAiB,GAAG,WAAW,CAAC;AAC9E,oBAAoB,KAAK,gBAAgB;AACzC,wBAAwB,OAAO,cAAc,CAAC;AAC9C,oBAAoB;AACpB,wBAAwB,OAAO,yBAAyB,CAAC,IAAI,CAAC,CAAC;AAC/D,iBAAiB;AACjB,aAAa;AACb,SAAS,CAAC,CAAC;AACX,QAAQ,OAAO,CAAC,UAAU,CAAC,GAAG,KAAK,CAAC;AACpC,QAAQ,iBAAiB,CAAC,GAAG,CAAC,UAAU,EAAE;AAC1C,YAAY,IAAI,EAAE,UAAU;AAC5B,YAAY,KAAK;AACjB,YAAY,SAAS,EAAE,IAAI,GAAG,CAAC;AAC/B,gBAAgB,GAAG,MAAM,CAAC,IAAI,CAAC,iBAAiB,CAAC;AACjD,gBAAgB,IAAI,YAAY,GAAG,CAAC,QAAQ,CAAC,GAAG,EAAE,CAAC;AACnD,aAAa,CAAC;AACd,SAAS,CAAC,CAAC;AACX,QAAQ,OAAO,KAAK,CAAC;AACrB,KAAK,CAAC;AACN,IAAI,MAAM,cAAc,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,cAAc,KAAK,qBAAqB,CAAC;AAC7M;AACA,IAAI,IAAI,CAAC,GAAG,CAAC,cAAc,EAAE;AAC7B,QAAQ,GAAG,CAAC,cAAc,GAAG,QAAQ,IAAI,QAAQ,CAAC;AAClD,KAAK;AACL,IAAI,GAAG,CAAC,WAAW,GAAG,WAAW,CAAC;AAClC,IAAI,GAAG,CAAC,WAAW,GAAG,WAAW,CAAC;AAClC,IAAI,GAAG,CAAC,gBAAgB,GAAG,gBAAgB,CAAC;AAC5C,IAAI,GAAG,CAAC,iBAAiB,GAAG,iBAAiB,CAAC;AAC9C,IAAI,GAAG,CAAC,gBAAgB,GAAG,gBAAgB,CAAC;AAC5C,IAAI,GAAG,CAAC,cAAc,GAAG,cAAc,CAAC;AACxC,IAAI,GAAG,CAAC,SAAS,GAAG,kBAAkB,CAAC;AACvC,IAAI,GAAG,CAAC,KAAK,GAAG,CAAC,CAAC,GAAG,CAAC,KAAK,CAAC;AAC5B,IAAI,GAAG,CAAC,gBAAgB,GAAG,CAAC,CAAC,GAAG,CAAC,gBAAgB,CAAC;AAClD;AACA,IAAI,GAAG,CAAC,QAAQ,GAAG,GAAG,CAAC,WAAW,EAAE,CAAC;AACrC,IAAI,GAAG,CAAC,QAAQ,GAAG,GAAG,CAAC,gBAAgB,EAAE,CAAC;AAC1C,IAAI,OAAO,GAAG,CAAC;AACf,CAAC,CAAC;AACK,MAAM,mBAAmB,GAAG,CAAC,GAAG,MAAM,GAAG,CAAC,SAAS,GAAG,eAAe,CAAC,GAAG,CAAC,CAAC;;ACnLtE,MAAC,SAAS,iBAAiB,mBAAmB,CAAC,OAAO,UAAU,KAAK,WAAW;AAC5F,MAAM,UAAU;AAChB,MAAM,OAAO,IAAI,KAAK,WAAW;AACjC,UAAU,IAAI;AACd,UAAU,OAAO,MAAM,KAAK,WAAW;AACvC,cAAc,MAAM;AACpB,cAAc,OAAO,MAAM,KAAK,WAAW;AAC3C,kBAAkB,MAAM;AACxB,kBAAkB,EAAE,EAAE;AACV,MAAC,cAAc,GAAG,SAAS,CAAC,eAAe;AACvD;AACA;AACA;AACA;AACA;AACY,MAAC,OAAO,GAAG,SAAS,CAAC,QAAQ;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACY,MAAC,iBAAiB,GAAG,CAAC,MAAM,KAAK,uBAAuB,CAAC,SAAS,EAAE,MAAM;;AC3BtF;AACA;AACA;AACO,MAAM,SAAS,CAAC;AACvB,IAAI,WAAW,CAAC,MAAM,EAAE;AACxB,QAAQ,IAAI,CAAC,SAAS,GAAG,EAAE,CAAC;AAC5B,QAAQ,IAAI,CAAC,eAAe,GAAG,EAAE,CAAC;AAClC,QAAQ,IAAI,MAAM,EAAE;AACpB;AACA,YAAY,OAAO,CAAC,IAAI,CAAC,CAAC,qBAAqB,EAAE,MAAM,CAAC,IAAI,CAAC,+DAA+D,CAAC,CAAC,CAAC;AAC/H,YAAY,IAAI,CAAC,MAAM,GAAG,MAAM,CAAC;AACjC,SAAS;AACT,KAAK;AACL,IAAI,WAAW,CAAC,SAAS,EAAE,YAAY,EAAE;AACzC,QAAQ,MAAM,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC;AACpD,QAAQ,IAAI,CAAC,SAAS,EAAE;AACxB,YAAY,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,GAAG,EAAE,CAAC;AAC3C,SAAS;AACT,QAAQ,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC,IAAI,CAAC,YAAY,CAAC,CAAC;AACrD;AACA;AACA,QAAQ,MAAM,cAAc,GAAG,IAAI,CAAC,eAAe,CAAC,SAAS,CAAC,CAAC;AAC/D,QAAQ,IAAI,cAAc,IAAI,CAAC,cAAc,CAAC,UAAU,EAAE;AAC1D,YAAY,IAAI,CAAC,iBAAiB,CAAC,cAAc,CAAC,CAAC;AACnD,SAAS;AACT,QAAQ,MAAM,MAAM,GAAG,YAAY,IAAI,CAAC,cAAc,CAAC,SAAS,EAAE,YAAY,CAAC,CAAC;AAChF,QAAQ,MAAM,CAAC,GAAG,OAAO,CAAC,OAAO,CAAC,EAAE,MAAM,EAAE,CAAC,CAAC;AAC9C,QAAQ,MAAM,CAAC,cAAc,CAAC,CAAC,EAAE,QAAQ,EAAE;AAC3C,YAAY,KAAK,EAAE,YAAY;AAC/B,gBAAgB,OAAO,CAAC,IAAI,CAAC,CAAC,kDAAkD,CAAC,CAAC,CAAC;AACnF,gBAAgB,MAAM,MAAM,EAAE,CAAC;AAC/B,aAAa;AACb,SAAS,CAAC,CAAC;AACX,QAAQ,OAAO,CAAC,CAAC;AACjB,KAAK;AACL,IAAI,MAAM,kBAAkB,GAAG;AAC/B,QAAQ,IAAI,CAAC,SAAS,GAAG,EAAE,CAAC;AAC5B,QAAQ,KAAK,MAAM,QAAQ,IAAI,IAAI,CAAC,eAAe,EAAE;AACrD,YAAY,IAAI,CAAC,oBAAoB,CAAC,IAAI,CAAC,eAAe,CAAC,QAAQ,CAAC,CAAC,CAAC;AACtE,SAAS;AACT,QAAQ,IAAI,CAAC,eAAe,GAAG,EAAE,CAAC;AAClC,KAAK;AACL,IAAI,eAAe,CAAC,SAAS,EAAE,IAAI,EAAE;AACrC,QAAQ,MAAM,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC;AACpD,QAAQ,IAAI,SAAS,EAAE;AACvB,YAAY,SAAS,CAAC,OAAO,CAAC,QAAQ,IAAI,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC;AAC1D,SAAS;AACT,KAAK;AACL,IAAI,YAAY,CAAC,SAAS,EAAE;AAC5B,QAAQ,OAAO,CAAC,CAAC,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC,MAAM,CAAC;AAClD,KAAK;AACL,IAAI,sBAAsB,CAAC,eAAe,EAAE,eAAe,EAAE;AAC7D,QAAQ,IAAI,CAAC,eAAe,CAAC,eAAe,CAAC,GAAG;AAChD,YAAY,UAAU,EAAE,KAAK;AAC7B,YAAY,eAAe;AAC3B,YAAY,eAAe;AAC3B,YAAY,OAAO,EAAE,KAAK,IAAI;AAC9B,gBAAgB,IAAI,CAAC,eAAe,CAAC,eAAe,EAAE,KAAK,CAAC,CAAC;AAC7D,aAAa;AACb,SAAS,CAAC;AACV,KAAK;AACL,IAAI,aAAa,CAAC,GAAG,GAAG,iBAAiB,EAAE;AAC3C,QAAQ,OAAO,IAAI,SAAS,CAAC,SAAS,CAAC,GAAG,EAAEA,qBAAa,CAAC,aAAa,CAAC,CAAC;AACzE,KAAK;AACL,IAAI,WAAW,CAAC,GAAG,GAAG,eAAe,EAAE;AACvC,QAAQ,OAAO,IAAI,SAAS,CAAC,SAAS,CAAC,GAAG,EAAEA,qBAAa,CAAC,WAAW,CAAC,CAAC;AACvE,KAAK;AACL,IAAI,MAAM,cAAc,CAAC,SAAS,EAAE,YAAY,EAAE;AAClD,QAAQ,MAAM,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC;AACpD,QAAQ,IAAI,CAAC,SAAS,EAAE;AACxB,YAAY,OAAO;AACnB,SAAS;AACT,QAAQ,MAAM,KAAK,GAAG,SAAS,CAAC,OAAO,CAAC,YAAY,CAAC,CAAC;AACtD,QAAQ,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC,MAAM,CAAC,KAAK,EAAE,CAAC,CAAC,CAAC;AACnD;AACA;AACA,QAAQ,IAAI,CAAC,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC,MAAM,EAAE;AAC/C,YAAY,IAAI,CAAC,oBAAoB,CAAC,IAAI,CAAC,eAAe,CAAC,SAAS,CAAC,CAAC,CAAC;AACvE,SAAS;AACT,KAAK;AACL,IAAI,iBAAiB,CAAC,MAAM,EAAE;AAC9B,QAAQ,MAAM,CAAC,gBAAgB,CAAC,MAAM,CAAC,eAAe,EAAE,MAAM,CAAC,OAAO,CAAC,CAAC;AACxE,QAAQ,MAAM,CAAC,UAAU,GAAG,IAAI,CAAC;AACjC,KAAK;AACL,IAAI,oBAAoB,CAAC,MAAM,EAAE;AACjC,QAAQ,IAAI,CAAC,MAAM,EAAE;AACrB,YAAY,OAAO;AACnB,SAAS;AACT,QAAQ,MAAM,CAAC,mBAAmB,CAAC,MAAM,CAAC,eAAe,EAAE,MAAM,CAAC,OAAO,CAAC,CAAC;AAC3E,QAAQ,MAAM,CAAC,UAAU,GAAG,KAAK,CAAC;AAClC,KAAK;AACL;;AC5FY,MAAC,OAAO,iBAAiB,cAAc,CAAC,SAAS;;;;;;;;;;;;;"}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.js b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.js
new file mode 100644
index 00000000..461b05d0
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.js
@@ -0,0 +1,410 @@
+/*! Capacitor: https://capacitorjs.com/ - MIT License */
+const createCapacitorPlatforms = (win) => {
+ const defaultPlatformMap = new Map();
+ defaultPlatformMap.set('web', { name: 'web' });
+ const capPlatforms = win.CapacitorPlatforms || {
+ currentPlatform: { name: 'web' },
+ platforms: defaultPlatformMap,
+ };
+ const addPlatform = (name, platform) => {
+ capPlatforms.platforms.set(name, platform);
+ };
+ const setPlatform = (name) => {
+ if (capPlatforms.platforms.has(name)) {
+ capPlatforms.currentPlatform = capPlatforms.platforms.get(name);
+ }
+ };
+ capPlatforms.addPlatform = addPlatform;
+ capPlatforms.setPlatform = setPlatform;
+ return capPlatforms;
+};
+const initPlatforms = (win) => (win.CapacitorPlatforms = createCapacitorPlatforms(win));
+/**
+ * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead
+ */
+const CapacitorPlatforms = /*#__PURE__*/ initPlatforms((typeof globalThis !== 'undefined'
+ ? globalThis
+ : typeof self !== 'undefined'
+ ? self
+ : typeof window !== 'undefined'
+ ? window
+ : typeof global !== 'undefined'
+ ? global
+ : {}));
+/**
+ * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead
+ */
+const addPlatform = CapacitorPlatforms.addPlatform;
+/**
+ * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead
+ */
+const setPlatform = CapacitorPlatforms.setPlatform;
+
+const legacyRegisterWebPlugin = (cap, webPlugin) => {
+ var _a;
+ const config = webPlugin.config;
+ const Plugins = cap.Plugins;
+ if (!config || !config.name) {
+ // TODO: add link to upgrade guide
+ throw new Error(`Capacitor WebPlugin is using the deprecated "registerWebPlugin()" function, but without the config. Please use "registerPlugin()" instead to register this web plugin."`);
+ }
+ // TODO: add link to upgrade guide
+ console.warn(`Capacitor plugin "${config.name}" is using the deprecated "registerWebPlugin()" function`);
+ if (!Plugins[config.name] || ((_a = config === null || config === void 0 ? void 0 : config.platforms) === null || _a === void 0 ? void 0 : _a.includes(cap.getPlatform()))) {
+ // Add the web plugin into the plugins registry if there already isn't
+ // an existing one. If it doesn't already exist, that means
+ // there's no existing native implementation for it.
+ // - OR -
+ // If we already have a plugin registered (meaning it was defined in the native layer),
+ // then we should only overwrite it if the corresponding web plugin activates on
+ // a certain platform. For example: Geolocation uses the WebPlugin on Android but not iOS
+ Plugins[config.name] = webPlugin;
+ }
+};
+
+var ExceptionCode;
+(function (ExceptionCode) {
+ /**
+ * API is not implemented.
+ *
+ * This usually means the API can't be used because it is not implemented for
+ * the current platform.
+ */
+ ExceptionCode["Unimplemented"] = "UNIMPLEMENTED";
+ /**
+ * API is not available.
+ *
+ * This means the API can't be used right now because:
+ * - it is currently missing a prerequisite, such as network connectivity
+ * - it requires a particular platform or browser version
+ */
+ ExceptionCode["Unavailable"] = "UNAVAILABLE";
+})(ExceptionCode || (ExceptionCode = {}));
+class CapacitorException extends Error {
+ constructor(message, code) {
+ super(message);
+ this.message = message;
+ this.code = code;
+ }
+}
+const getPlatformId = (win) => {
+ var _a, _b;
+ if (win === null || win === void 0 ? void 0 : win.androidBridge) {
+ return 'android';
+ }
+ else if ((_b = (_a = win === null || win === void 0 ? void 0 : win.webkit) === null || _a === void 0 ? void 0 : _a.messageHandlers) === null || _b === void 0 ? void 0 : _b.bridge) {
+ return 'ios';
+ }
+ else {
+ return 'web';
+ }
+};
+
+const createCapacitor = (win) => {
+ var _a, _b, _c, _d, _e;
+ const capCustomPlatform = win.CapacitorCustomPlatform || null;
+ const cap = win.Capacitor || {};
+ const Plugins = (cap.Plugins = cap.Plugins || {});
+ /**
+ * @deprecated Use `capCustomPlatform` instead, default functions like registerPlugin will function with the new object.
+ */
+ const capPlatforms = win.CapacitorPlatforms;
+ const defaultGetPlatform = () => {
+ return capCustomPlatform !== null
+ ? capCustomPlatform.name
+ : getPlatformId(win);
+ };
+ const getPlatform = ((_a = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _a === void 0 ? void 0 : _a.getPlatform) || defaultGetPlatform;
+ const defaultIsNativePlatform = () => getPlatform() !== 'web';
+ const isNativePlatform = ((_b = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _b === void 0 ? void 0 : _b.isNativePlatform) || defaultIsNativePlatform;
+ const defaultIsPluginAvailable = (pluginName) => {
+ const plugin = registeredPlugins.get(pluginName);
+ if (plugin === null || plugin === void 0 ? void 0 : plugin.platforms.has(getPlatform())) {
+ // JS implementation available for the current platform.
+ return true;
+ }
+ if (getPluginHeader(pluginName)) {
+ // Native implementation available.
+ return true;
+ }
+ return false;
+ };
+ const isPluginAvailable = ((_c = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _c === void 0 ? void 0 : _c.isPluginAvailable) ||
+ defaultIsPluginAvailable;
+ const defaultGetPluginHeader = (pluginName) => { var _a; return (_a = cap.PluginHeaders) === null || _a === void 0 ? void 0 : _a.find(h => h.name === pluginName); };
+ const getPluginHeader = ((_d = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _d === void 0 ? void 0 : _d.getPluginHeader) || defaultGetPluginHeader;
+ const handleError = (err) => win.console.error(err);
+ const pluginMethodNoop = (_target, prop, pluginName) => {
+ return Promise.reject(`${pluginName} does not have an implementation of "${prop}".`);
+ };
+ const registeredPlugins = new Map();
+ const defaultRegisterPlugin = (pluginName, jsImplementations = {}) => {
+ const registeredPlugin = registeredPlugins.get(pluginName);
+ if (registeredPlugin) {
+ console.warn(`Capacitor plugin "${pluginName}" already registered. Cannot register plugins twice.`);
+ return registeredPlugin.proxy;
+ }
+ const platform = getPlatform();
+ const pluginHeader = getPluginHeader(pluginName);
+ let jsImplementation;
+ const loadPluginImplementation = async () => {
+ if (!jsImplementation && platform in jsImplementations) {
+ jsImplementation =
+ typeof jsImplementations[platform] === 'function'
+ ? (jsImplementation = await jsImplementations[platform]())
+ : (jsImplementation = jsImplementations[platform]);
+ }
+ else if (capCustomPlatform !== null &&
+ !jsImplementation &&
+ 'web' in jsImplementations) {
+ jsImplementation =
+ typeof jsImplementations['web'] === 'function'
+ ? (jsImplementation = await jsImplementations['web']())
+ : (jsImplementation = jsImplementations['web']);
+ }
+ return jsImplementation;
+ };
+ const createPluginMethod = (impl, prop) => {
+ var _a, _b;
+ if (pluginHeader) {
+ const methodHeader = pluginHeader === null || pluginHeader === void 0 ? void 0 : pluginHeader.methods.find(m => prop === m.name);
+ if (methodHeader) {
+ if (methodHeader.rtype === 'promise') {
+ return (options) => cap.nativePromise(pluginName, prop.toString(), options);
+ }
+ else {
+ return (options, callback) => cap.nativeCallback(pluginName, prop.toString(), options, callback);
+ }
+ }
+ else if (impl) {
+ return (_a = impl[prop]) === null || _a === void 0 ? void 0 : _a.bind(impl);
+ }
+ }
+ else if (impl) {
+ return (_b = impl[prop]) === null || _b === void 0 ? void 0 : _b.bind(impl);
+ }
+ else {
+ throw new CapacitorException(`"${pluginName}" plugin is not implemented on ${platform}`, ExceptionCode.Unimplemented);
+ }
+ };
+ const createPluginMethodWrapper = (prop) => {
+ let remove;
+ const wrapper = (...args) => {
+ const p = loadPluginImplementation().then(impl => {
+ const fn = createPluginMethod(impl, prop);
+ if (fn) {
+ const p = fn(...args);
+ remove = p === null || p === void 0 ? void 0 : p.remove;
+ return p;
+ }
+ else {
+ throw new CapacitorException(`"${pluginName}.${prop}()" is not implemented on ${platform}`, ExceptionCode.Unimplemented);
+ }
+ });
+ if (prop === 'addListener') {
+ p.remove = async () => remove();
+ }
+ return p;
+ };
+ // Some flair ✨
+ wrapper.toString = () => `${prop.toString()}() { [capacitor code] }`;
+ Object.defineProperty(wrapper, 'name', {
+ value: prop,
+ writable: false,
+ configurable: false,
+ });
+ return wrapper;
+ };
+ const addListener = createPluginMethodWrapper('addListener');
+ const removeListener = createPluginMethodWrapper('removeListener');
+ const addListenerNative = (eventName, callback) => {
+ const call = addListener({ eventName }, callback);
+ const remove = async () => {
+ const callbackId = await call;
+ removeListener({
+ eventName,
+ callbackId,
+ }, callback);
+ };
+ const p = new Promise(resolve => call.then(() => resolve({ remove })));
+ p.remove = async () => {
+ console.warn(`Using addListener() without 'await' is deprecated.`);
+ await remove();
+ };
+ return p;
+ };
+ const proxy = new Proxy({}, {
+ get(_, prop) {
+ switch (prop) {
+ // https://github.com/facebook/react/issues/20030
+ case '$$typeof':
+ return undefined;
+ case 'toJSON':
+ return () => ({});
+ case 'addListener':
+ return pluginHeader ? addListenerNative : addListener;
+ case 'removeListener':
+ return removeListener;
+ default:
+ return createPluginMethodWrapper(prop);
+ }
+ },
+ });
+ Plugins[pluginName] = proxy;
+ registeredPlugins.set(pluginName, {
+ name: pluginName,
+ proxy,
+ platforms: new Set([
+ ...Object.keys(jsImplementations),
+ ...(pluginHeader ? [platform] : []),
+ ]),
+ });
+ return proxy;
+ };
+ const registerPlugin = ((_e = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _e === void 0 ? void 0 : _e.registerPlugin) || defaultRegisterPlugin;
+ // Add in convertFileSrc for web, it will already be available in native context
+ if (!cap.convertFileSrc) {
+ cap.convertFileSrc = filePath => filePath;
+ }
+ cap.getPlatform = getPlatform;
+ cap.handleError = handleError;
+ cap.isNativePlatform = isNativePlatform;
+ cap.isPluginAvailable = isPluginAvailable;
+ cap.pluginMethodNoop = pluginMethodNoop;
+ cap.registerPlugin = registerPlugin;
+ cap.Exception = CapacitorException;
+ cap.DEBUG = !!cap.DEBUG;
+ cap.isLoggingEnabled = !!cap.isLoggingEnabled;
+ // Deprecated props
+ cap.platform = cap.getPlatform();
+ cap.isNative = cap.isNativePlatform();
+ return cap;
+};
+const initCapacitorGlobal = (win) => (win.Capacitor = createCapacitor(win));
+
+const Capacitor = /*#__PURE__*/ initCapacitorGlobal(typeof globalThis !== 'undefined'
+ ? globalThis
+ : typeof self !== 'undefined'
+ ? self
+ : typeof window !== 'undefined'
+ ? window
+ : typeof global !== 'undefined'
+ ? global
+ : {});
+const registerPlugin = Capacitor.registerPlugin;
+/**
+ * @deprecated Provided for backwards compatibility for Capacitor v2 plugins.
+ * Capacitor v3 plugins should import the plugin directly. This "Plugins"
+ * export is deprecated in v3, and will be removed in v4.
+ */
+const Plugins = Capacitor.Plugins;
+/**
+ * Provided for backwards compatibility. Use the registerPlugin() API
+ * instead, and provide the web plugin as the "web" implmenetation.
+ * For example
+ *
+ * export const Example = registerPlugin('Example', {
+ * web: () => import('./web').then(m => new m.Example())
+ * })
+ *
+ * @deprecated Deprecated in v3, will be removed from v4.
+ */
+const registerWebPlugin = (plugin) => legacyRegisterWebPlugin(Capacitor, plugin);
+
+/**
+ * Base class web plugins should extend.
+ */
+class WebPlugin {
+ constructor(config) {
+ this.listeners = {};
+ this.windowListeners = {};
+ if (config) {
+ // TODO: add link to upgrade guide
+ console.warn(`Capacitor WebPlugin "${config.name}" config object was deprecated in v3 and will be removed in v4.`);
+ this.config = config;
+ }
+ }
+ addListener(eventName, listenerFunc) {
+ const listeners = this.listeners[eventName];
+ if (!listeners) {
+ this.listeners[eventName] = [];
+ }
+ this.listeners[eventName].push(listenerFunc);
+ // If we haven't added a window listener for this event and it requires one,
+ // go ahead and add it
+ const windowListener = this.windowListeners[eventName];
+ if (windowListener && !windowListener.registered) {
+ this.addWindowListener(windowListener);
+ }
+ const remove = async () => this.removeListener(eventName, listenerFunc);
+ const p = Promise.resolve({ remove });
+ Object.defineProperty(p, 'remove', {
+ value: async () => {
+ console.warn(`Using addListener() without 'await' is deprecated.`);
+ await remove();
+ },
+ });
+ return p;
+ }
+ async removeAllListeners() {
+ this.listeners = {};
+ for (const listener in this.windowListeners) {
+ this.removeWindowListener(this.windowListeners[listener]);
+ }
+ this.windowListeners = {};
+ }
+ notifyListeners(eventName, data) {
+ const listeners = this.listeners[eventName];
+ if (listeners) {
+ listeners.forEach(listener => listener(data));
+ }
+ }
+ hasListeners(eventName) {
+ return !!this.listeners[eventName].length;
+ }
+ registerWindowListener(windowEventName, pluginEventName) {
+ this.windowListeners[pluginEventName] = {
+ registered: false,
+ windowEventName,
+ pluginEventName,
+ handler: event => {
+ this.notifyListeners(pluginEventName, event);
+ },
+ };
+ }
+ unimplemented(msg = 'not implemented') {
+ return new Capacitor.Exception(msg, ExceptionCode.Unimplemented);
+ }
+ unavailable(msg = 'not available') {
+ return new Capacitor.Exception(msg, ExceptionCode.Unavailable);
+ }
+ async removeListener(eventName, listenerFunc) {
+ const listeners = this.listeners[eventName];
+ if (!listeners) {
+ return;
+ }
+ const index = listeners.indexOf(listenerFunc);
+ this.listeners[eventName].splice(index, 1);
+ // If there are no more listeners for this type of event,
+ // remove the window listener
+ if (!this.listeners[eventName].length) {
+ this.removeWindowListener(this.windowListeners[eventName]);
+ }
+ }
+ addWindowListener(handle) {
+ window.addEventListener(handle.windowEventName, handle.handler);
+ handle.registered = true;
+ }
+ removeWindowListener(handle) {
+ if (!handle) {
+ return;
+ }
+ window.removeEventListener(handle.windowEventName, handle.handler);
+ handle.registered = false;
+ }
+}
+
+const WebView = /*#__PURE__*/ registerPlugin('WebView');
+
+export { Capacitor, CapacitorException, CapacitorPlatforms, ExceptionCode, Plugins, WebPlugin, WebView, addPlatform, registerPlugin, registerWebPlugin, setPlatform };
+//# sourceMappingURL=index.js.map
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.js.map b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.js.map
new file mode 100644
index 00000000..6c51a8a1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/dist/index.js.map
@@ -0,0 +1 @@
+{"version":3,"file":"index.js","sources":["../build/platforms.js","../build/legacy/legacy-web-plugin-merge.js","../build/util.js","../build/runtime.js","../build/global.js","../build/web-plugin.js","../build/core-plugins.js"],"sourcesContent":["const createCapacitorPlatforms = (win) => {\n const defaultPlatformMap = new Map();\n defaultPlatformMap.set('web', { name: 'web' });\n const capPlatforms = win.CapacitorPlatforms || {\n currentPlatform: { name: 'web' },\n platforms: defaultPlatformMap,\n };\n const addPlatform = (name, platform) => {\n capPlatforms.platforms.set(name, platform);\n };\n const setPlatform = (name) => {\n if (capPlatforms.platforms.has(name)) {\n capPlatforms.currentPlatform = capPlatforms.platforms.get(name);\n }\n };\n capPlatforms.addPlatform = addPlatform;\n capPlatforms.setPlatform = setPlatform;\n return capPlatforms;\n};\nconst initPlatforms = (win) => (win.CapacitorPlatforms = createCapacitorPlatforms(win));\n/**\n * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead\n */\nexport const CapacitorPlatforms = /*#__PURE__*/ initPlatforms((typeof globalThis !== 'undefined'\n ? globalThis\n : typeof self !== 'undefined'\n ? self\n : typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined'\n ? global\n : {}));\n/**\n * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead\n */\nexport const addPlatform = CapacitorPlatforms.addPlatform;\n/**\n * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead\n */\nexport const setPlatform = CapacitorPlatforms.setPlatform;\n//# sourceMappingURL=platforms.js.map","export const legacyRegisterWebPlugin = (cap, webPlugin) => {\n var _a;\n const config = webPlugin.config;\n const Plugins = cap.Plugins;\n if (!config || !config.name) {\n // TODO: add link to upgrade guide\n throw new Error(`Capacitor WebPlugin is using the deprecated \"registerWebPlugin()\" function, but without the config. Please use \"registerPlugin()\" instead to register this web plugin.\"`);\n }\n // TODO: add link to upgrade guide\n console.warn(`Capacitor plugin \"${config.name}\" is using the deprecated \"registerWebPlugin()\" function`);\n if (!Plugins[config.name] || ((_a = config === null || config === void 0 ? void 0 : config.platforms) === null || _a === void 0 ? void 0 : _a.includes(cap.getPlatform()))) {\n // Add the web plugin into the plugins registry if there already isn't\n // an existing one. If it doesn't already exist, that means\n // there's no existing native implementation for it.\n // - OR -\n // If we already have a plugin registered (meaning it was defined in the native layer),\n // then we should only overwrite it if the corresponding web plugin activates on\n // a certain platform. For example: Geolocation uses the WebPlugin on Android but not iOS\n Plugins[config.name] = webPlugin;\n }\n};\n//# sourceMappingURL=legacy-web-plugin-merge.js.map","export var ExceptionCode;\n(function (ExceptionCode) {\n /**\n * API is not implemented.\n *\n * This usually means the API can't be used because it is not implemented for\n * the current platform.\n */\n ExceptionCode[\"Unimplemented\"] = \"UNIMPLEMENTED\";\n /**\n * API is not available.\n *\n * This means the API can't be used right now because:\n * - it is currently missing a prerequisite, such as network connectivity\n * - it requires a particular platform or browser version\n */\n ExceptionCode[\"Unavailable\"] = \"UNAVAILABLE\";\n})(ExceptionCode || (ExceptionCode = {}));\nexport class CapacitorException extends Error {\n constructor(message, code) {\n super(message);\n this.message = message;\n this.code = code;\n }\n}\nexport const getPlatformId = (win) => {\n var _a, _b;\n if (win === null || win === void 0 ? void 0 : win.androidBridge) {\n return 'android';\n }\n else if ((_b = (_a = win === null || win === void 0 ? void 0 : win.webkit) === null || _a === void 0 ? void 0 : _a.messageHandlers) === null || _b === void 0 ? void 0 : _b.bridge) {\n return 'ios';\n }\n else {\n return 'web';\n }\n};\n//# sourceMappingURL=util.js.map","import { CapacitorException, getPlatformId, ExceptionCode } from './util';\nexport const createCapacitor = (win) => {\n var _a, _b, _c, _d, _e;\n const capCustomPlatform = win.CapacitorCustomPlatform || null;\n const cap = win.Capacitor || {};\n const Plugins = (cap.Plugins = cap.Plugins || {});\n /**\n * @deprecated Use `capCustomPlatform` instead, default functions like registerPlugin will function with the new object.\n */\n const capPlatforms = win.CapacitorPlatforms;\n const defaultGetPlatform = () => {\n return capCustomPlatform !== null\n ? capCustomPlatform.name\n : getPlatformId(win);\n };\n const getPlatform = ((_a = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _a === void 0 ? void 0 : _a.getPlatform) || defaultGetPlatform;\n const defaultIsNativePlatform = () => getPlatform() !== 'web';\n const isNativePlatform = ((_b = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _b === void 0 ? void 0 : _b.isNativePlatform) || defaultIsNativePlatform;\n const defaultIsPluginAvailable = (pluginName) => {\n const plugin = registeredPlugins.get(pluginName);\n if (plugin === null || plugin === void 0 ? void 0 : plugin.platforms.has(getPlatform())) {\n // JS implementation available for the current platform.\n return true;\n }\n if (getPluginHeader(pluginName)) {\n // Native implementation available.\n return true;\n }\n return false;\n };\n const isPluginAvailable = ((_c = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _c === void 0 ? void 0 : _c.isPluginAvailable) ||\n defaultIsPluginAvailable;\n const defaultGetPluginHeader = (pluginName) => { var _a; return (_a = cap.PluginHeaders) === null || _a === void 0 ? void 0 : _a.find(h => h.name === pluginName); };\n const getPluginHeader = ((_d = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _d === void 0 ? void 0 : _d.getPluginHeader) || defaultGetPluginHeader;\n const handleError = (err) => win.console.error(err);\n const pluginMethodNoop = (_target, prop, pluginName) => {\n return Promise.reject(`${pluginName} does not have an implementation of \"${prop}\".`);\n };\n const registeredPlugins = new Map();\n const defaultRegisterPlugin = (pluginName, jsImplementations = {}) => {\n const registeredPlugin = registeredPlugins.get(pluginName);\n if (registeredPlugin) {\n console.warn(`Capacitor plugin \"${pluginName}\" already registered. Cannot register plugins twice.`);\n return registeredPlugin.proxy;\n }\n const platform = getPlatform();\n const pluginHeader = getPluginHeader(pluginName);\n let jsImplementation;\n const loadPluginImplementation = async () => {\n if (!jsImplementation && platform in jsImplementations) {\n jsImplementation =\n typeof jsImplementations[platform] === 'function'\n ? (jsImplementation = await jsImplementations[platform]())\n : (jsImplementation = jsImplementations[platform]);\n }\n else if (capCustomPlatform !== null &&\n !jsImplementation &&\n 'web' in jsImplementations) {\n jsImplementation =\n typeof jsImplementations['web'] === 'function'\n ? (jsImplementation = await jsImplementations['web']())\n : (jsImplementation = jsImplementations['web']);\n }\n return jsImplementation;\n };\n const createPluginMethod = (impl, prop) => {\n var _a, _b;\n if (pluginHeader) {\n const methodHeader = pluginHeader === null || pluginHeader === void 0 ? void 0 : pluginHeader.methods.find(m => prop === m.name);\n if (methodHeader) {\n if (methodHeader.rtype === 'promise') {\n return (options) => cap.nativePromise(pluginName, prop.toString(), options);\n }\n else {\n return (options, callback) => cap.nativeCallback(pluginName, prop.toString(), options, callback);\n }\n }\n else if (impl) {\n return (_a = impl[prop]) === null || _a === void 0 ? void 0 : _a.bind(impl);\n }\n }\n else if (impl) {\n return (_b = impl[prop]) === null || _b === void 0 ? void 0 : _b.bind(impl);\n }\n else {\n throw new CapacitorException(`\"${pluginName}\" plugin is not implemented on ${platform}`, ExceptionCode.Unimplemented);\n }\n };\n const createPluginMethodWrapper = (prop) => {\n let remove;\n const wrapper = (...args) => {\n const p = loadPluginImplementation().then(impl => {\n const fn = createPluginMethod(impl, prop);\n if (fn) {\n const p = fn(...args);\n remove = p === null || p === void 0 ? void 0 : p.remove;\n return p;\n }\n else {\n throw new CapacitorException(`\"${pluginName}.${prop}()\" is not implemented on ${platform}`, ExceptionCode.Unimplemented);\n }\n });\n if (prop === 'addListener') {\n p.remove = async () => remove();\n }\n return p;\n };\n // Some flair ✨\n wrapper.toString = () => `${prop.toString()}() { [capacitor code] }`;\n Object.defineProperty(wrapper, 'name', {\n value: prop,\n writable: false,\n configurable: false,\n });\n return wrapper;\n };\n const addListener = createPluginMethodWrapper('addListener');\n const removeListener = createPluginMethodWrapper('removeListener');\n const addListenerNative = (eventName, callback) => {\n const call = addListener({ eventName }, callback);\n const remove = async () => {\n const callbackId = await call;\n removeListener({\n eventName,\n callbackId,\n }, callback);\n };\n const p = new Promise(resolve => call.then(() => resolve({ remove })));\n p.remove = async () => {\n console.warn(`Using addListener() without 'await' is deprecated.`);\n await remove();\n };\n return p;\n };\n const proxy = new Proxy({}, {\n get(_, prop) {\n switch (prop) {\n // https://github.com/facebook/react/issues/20030\n case '$$typeof':\n return undefined;\n case 'toJSON':\n return () => ({});\n case 'addListener':\n return pluginHeader ? addListenerNative : addListener;\n case 'removeListener':\n return removeListener;\n default:\n return createPluginMethodWrapper(prop);\n }\n },\n });\n Plugins[pluginName] = proxy;\n registeredPlugins.set(pluginName, {\n name: pluginName,\n proxy,\n platforms: new Set([\n ...Object.keys(jsImplementations),\n ...(pluginHeader ? [platform] : []),\n ]),\n });\n return proxy;\n };\n const registerPlugin = ((_e = capPlatforms === null || capPlatforms === void 0 ? void 0 : capPlatforms.currentPlatform) === null || _e === void 0 ? void 0 : _e.registerPlugin) || defaultRegisterPlugin;\n // Add in convertFileSrc for web, it will already be available in native context\n if (!cap.convertFileSrc) {\n cap.convertFileSrc = filePath => filePath;\n }\n cap.getPlatform = getPlatform;\n cap.handleError = handleError;\n cap.isNativePlatform = isNativePlatform;\n cap.isPluginAvailable = isPluginAvailable;\n cap.pluginMethodNoop = pluginMethodNoop;\n cap.registerPlugin = registerPlugin;\n cap.Exception = CapacitorException;\n cap.DEBUG = !!cap.DEBUG;\n cap.isLoggingEnabled = !!cap.isLoggingEnabled;\n // Deprecated props\n cap.platform = cap.getPlatform();\n cap.isNative = cap.isNativePlatform();\n return cap;\n};\nexport const initCapacitorGlobal = (win) => (win.Capacitor = createCapacitor(win));\n//# sourceMappingURL=runtime.js.map","import { legacyRegisterWebPlugin } from './legacy/legacy-web-plugin-merge';\nimport { initCapacitorGlobal } from './runtime';\nexport const Capacitor = /*#__PURE__*/ initCapacitorGlobal(typeof globalThis !== 'undefined'\n ? globalThis\n : typeof self !== 'undefined'\n ? self\n : typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined'\n ? global\n : {});\nexport const registerPlugin = Capacitor.registerPlugin;\n/**\n * @deprecated Provided for backwards compatibility for Capacitor v2 plugins.\n * Capacitor v3 plugins should import the plugin directly. This \"Plugins\"\n * export is deprecated in v3, and will be removed in v4.\n */\nexport const Plugins = Capacitor.Plugins;\n/**\n * Provided for backwards compatibility. Use the registerPlugin() API\n * instead, and provide the web plugin as the \"web\" implmenetation.\n * For example\n *\n * export const Example = registerPlugin('Example', {\n * web: () => import('./web').then(m => new m.Example())\n * })\n *\n * @deprecated Deprecated in v3, will be removed from v4.\n */\nexport const registerWebPlugin = (plugin) => legacyRegisterWebPlugin(Capacitor, plugin);\n//# sourceMappingURL=global.js.map","import { Capacitor } from './global';\nimport { ExceptionCode } from './util';\n/**\n * Base class web plugins should extend.\n */\nexport class WebPlugin {\n constructor(config) {\n this.listeners = {};\n this.windowListeners = {};\n if (config) {\n // TODO: add link to upgrade guide\n console.warn(`Capacitor WebPlugin \"${config.name}\" config object was deprecated in v3 and will be removed in v4.`);\n this.config = config;\n }\n }\n addListener(eventName, listenerFunc) {\n const listeners = this.listeners[eventName];\n if (!listeners) {\n this.listeners[eventName] = [];\n }\n this.listeners[eventName].push(listenerFunc);\n // If we haven't added a window listener for this event and it requires one,\n // go ahead and add it\n const windowListener = this.windowListeners[eventName];\n if (windowListener && !windowListener.registered) {\n this.addWindowListener(windowListener);\n }\n const remove = async () => this.removeListener(eventName, listenerFunc);\n const p = Promise.resolve({ remove });\n Object.defineProperty(p, 'remove', {\n value: async () => {\n console.warn(`Using addListener() without 'await' is deprecated.`);\n await remove();\n },\n });\n return p;\n }\n async removeAllListeners() {\n this.listeners = {};\n for (const listener in this.windowListeners) {\n this.removeWindowListener(this.windowListeners[listener]);\n }\n this.windowListeners = {};\n }\n notifyListeners(eventName, data) {\n const listeners = this.listeners[eventName];\n if (listeners) {\n listeners.forEach(listener => listener(data));\n }\n }\n hasListeners(eventName) {\n return !!this.listeners[eventName].length;\n }\n registerWindowListener(windowEventName, pluginEventName) {\n this.windowListeners[pluginEventName] = {\n registered: false,\n windowEventName,\n pluginEventName,\n handler: event => {\n this.notifyListeners(pluginEventName, event);\n },\n };\n }\n unimplemented(msg = 'not implemented') {\n return new Capacitor.Exception(msg, ExceptionCode.Unimplemented);\n }\n unavailable(msg = 'not available') {\n return new Capacitor.Exception(msg, ExceptionCode.Unavailable);\n }\n async removeListener(eventName, listenerFunc) {\n const listeners = this.listeners[eventName];\n if (!listeners) {\n return;\n }\n const index = listeners.indexOf(listenerFunc);\n this.listeners[eventName].splice(index, 1);\n // If there are no more listeners for this type of event,\n // remove the window listener\n if (!this.listeners[eventName].length) {\n this.removeWindowListener(this.windowListeners[eventName]);\n }\n }\n addWindowListener(handle) {\n window.addEventListener(handle.windowEventName, handle.handler);\n handle.registered = true;\n }\n removeWindowListener(handle) {\n if (!handle) {\n return;\n }\n window.removeEventListener(handle.windowEventName, handle.handler);\n handle.registered = false;\n }\n}\n//# sourceMappingURL=web-plugin.js.map","import { registerPlugin } from './global';\nexport const WebView = /*#__PURE__*/ registerPlugin('WebView');\n//# sourceMappingURL=core-plugins.js.map"],"names":[],"mappings":";AAAA,MAAM,wBAAwB,GAAG,CAAC,GAAG,KAAK;AAC1C,IAAI,MAAM,kBAAkB,GAAG,IAAI,GAAG,EAAE,CAAC;AACzC,IAAI,kBAAkB,CAAC,GAAG,CAAC,KAAK,EAAE,EAAE,IAAI,EAAE,KAAK,EAAE,CAAC,CAAC;AACnD,IAAI,MAAM,YAAY,GAAG,GAAG,CAAC,kBAAkB,IAAI;AACnD,QAAQ,eAAe,EAAE,EAAE,IAAI,EAAE,KAAK,EAAE;AACxC,QAAQ,SAAS,EAAE,kBAAkB;AACrC,KAAK,CAAC;AACN,IAAI,MAAM,WAAW,GAAG,CAAC,IAAI,EAAE,QAAQ,KAAK;AAC5C,QAAQ,YAAY,CAAC,SAAS,CAAC,GAAG,CAAC,IAAI,EAAE,QAAQ,CAAC,CAAC;AACnD,KAAK,CAAC;AACN,IAAI,MAAM,WAAW,GAAG,CAAC,IAAI,KAAK;AAClC,QAAQ,IAAI,YAAY,CAAC,SAAS,CAAC,GAAG,CAAC,IAAI,CAAC,EAAE;AAC9C,YAAY,YAAY,CAAC,eAAe,GAAG,YAAY,CAAC,SAAS,CAAC,GAAG,CAAC,IAAI,CAAC,CAAC;AAC5E,SAAS;AACT,KAAK,CAAC;AACN,IAAI,YAAY,CAAC,WAAW,GAAG,WAAW,CAAC;AAC3C,IAAI,YAAY,CAAC,WAAW,GAAG,WAAW,CAAC;AAC3C,IAAI,OAAO,YAAY,CAAC;AACxB,CAAC,CAAC;AACF,MAAM,aAAa,GAAG,CAAC,GAAG,MAAM,GAAG,CAAC,kBAAkB,GAAG,wBAAwB,CAAC,GAAG,CAAC,CAAC,CAAC;AACxF;AACA;AACA;AACY,MAAC,kBAAkB,iBAAiB,aAAa,EAAE,OAAO,UAAU,KAAK,WAAW;AAChG,MAAM,UAAU;AAChB,MAAM,OAAO,IAAI,KAAK,WAAW;AACjC,UAAU,IAAI;AACd,UAAU,OAAO,MAAM,KAAK,WAAW;AACvC,cAAc,MAAM;AACpB,cAAc,OAAO,MAAM,KAAK,WAAW;AAC3C,kBAAkB,MAAM;AACxB,kBAAkB,EAAE,GAAG;AACvB;AACA;AACA;AACY,MAAC,WAAW,GAAG,kBAAkB,CAAC,YAAY;AAC1D;AACA;AACA;AACY,MAAC,WAAW,GAAG,kBAAkB,CAAC;;ACvCvC,MAAM,uBAAuB,GAAG,CAAC,GAAG,EAAE,SAAS,KAAK;AAC3D,IAAI,IAAI,EAAE,CAAC;AACX,IAAI,MAAM,MAAM,GAAG,SAAS,CAAC,MAAM,CAAC;AACpC,IAAI,MAAM,OAAO,GAAG,GAAG,CAAC,OAAO,CAAC;AAChC,IAAI,IAAI,CAAC,MAAM,IAAI,CAAC,MAAM,CAAC,IAAI,EAAE;AACjC;AACA,QAAQ,MAAM,IAAI,KAAK,CAAC,CAAC,uKAAuK,CAAC,CAAC,CAAC;AACnM,KAAK;AACL;AACA,IAAI,OAAO,CAAC,IAAI,CAAC,CAAC,kBAAkB,EAAE,MAAM,CAAC,IAAI,CAAC,wDAAwD,CAAC,CAAC,CAAC;AAC7G,IAAI,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,EAAE,GAAG,MAAM,KAAK,IAAI,IAAI,MAAM,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,MAAM,CAAC,SAAS,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,WAAW,EAAE,CAAC,CAAC,EAAE;AAChL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,OAAO,CAAC,MAAM,CAAC,IAAI,CAAC,GAAG,SAAS,CAAC;AACzC,KAAK;AACL,CAAC;;ACpBS,IAAC,cAAc;AACzB,CAAC,UAAU,aAAa,EAAE;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA,IAAI,aAAa,CAAC,eAAe,CAAC,GAAG,eAAe,CAAC;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI,aAAa,CAAC,aAAa,CAAC,GAAG,aAAa,CAAC;AACjD,CAAC,EAAE,aAAa,KAAK,aAAa,GAAG,EAAE,CAAC,CAAC,CAAC;AACnC,MAAM,kBAAkB,SAAS,KAAK,CAAC;AAC9C,IAAI,WAAW,CAAC,OAAO,EAAE,IAAI,EAAE;AAC/B,QAAQ,KAAK,CAAC,OAAO,CAAC,CAAC;AACvB,QAAQ,IAAI,CAAC,OAAO,GAAG,OAAO,CAAC;AAC/B,QAAQ,IAAI,CAAC,IAAI,GAAG,IAAI,CAAC;AACzB,KAAK;AACL,CAAC;AACM,MAAM,aAAa,GAAG,CAAC,GAAG,KAAK;AACtC,IAAI,IAAI,EAAE,EAAE,EAAE,CAAC;AACf,IAAI,IAAI,GAAG,KAAK,IAAI,IAAI,GAAG,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,GAAG,CAAC,aAAa,EAAE;AACrE,QAAQ,OAAO,SAAS,CAAC;AACzB,KAAK;AACL,SAAS,IAAI,CAAC,EAAE,GAAG,CAAC,EAAE,GAAG,GAAG,KAAK,IAAI,IAAI,GAAG,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,GAAG,CAAC,MAAM,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,MAAM,EAAE;AACxL,QAAQ,OAAO,KAAK,CAAC;AACrB,KAAK;AACL,SAAS;AACT,QAAQ,OAAO,KAAK,CAAC;AACrB,KAAK;AACL,CAAC;;ACnCM,MAAM,eAAe,GAAG,CAAC,GAAG,KAAK;AACxC,IAAI,IAAI,EAAE,EAAE,EAAE,EAAE,EAAE,EAAE,EAAE,EAAE,EAAE,CAAC;AAC3B,IAAI,MAAM,iBAAiB,GAAG,GAAG,CAAC,uBAAuB,IAAI,IAAI,CAAC;AAClE,IAAI,MAAM,GAAG,GAAG,GAAG,CAAC,SAAS,IAAI,EAAE,CAAC;AACpC,IAAI,MAAM,OAAO,IAAI,GAAG,CAAC,OAAO,GAAG,GAAG,CAAC,OAAO,IAAI,EAAE,CAAC,CAAC;AACtD;AACA;AACA;AACA,IAAI,MAAM,YAAY,GAAG,GAAG,CAAC,kBAAkB,CAAC;AAChD,IAAI,MAAM,kBAAkB,GAAG,MAAM;AACrC,QAAQ,OAAO,iBAAiB,KAAK,IAAI;AACzC,cAAc,iBAAiB,CAAC,IAAI;AACpC,cAAc,aAAa,CAAC,GAAG,CAAC,CAAC;AACjC,KAAK,CAAC;AACN,IAAI,MAAM,WAAW,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,WAAW,KAAK,kBAAkB,CAAC;AACpM,IAAI,MAAM,uBAAuB,GAAG,MAAM,WAAW,EAAE,KAAK,KAAK,CAAC;AAClE,IAAI,MAAM,gBAAgB,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,gBAAgB,KAAK,uBAAuB,CAAC;AACnN,IAAI,MAAM,wBAAwB,GAAG,CAAC,UAAU,KAAK;AACrD,QAAQ,MAAM,MAAM,GAAG,iBAAiB,CAAC,GAAG,CAAC,UAAU,CAAC,CAAC;AACzD,QAAQ,IAAI,MAAM,KAAK,IAAI,IAAI,MAAM,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,MAAM,CAAC,SAAS,CAAC,GAAG,CAAC,WAAW,EAAE,CAAC,EAAE;AACjG;AACA,YAAY,OAAO,IAAI,CAAC;AACxB,SAAS;AACT,QAAQ,IAAI,eAAe,CAAC,UAAU,CAAC,EAAE;AACzC;AACA,YAAY,OAAO,IAAI,CAAC;AACxB,SAAS;AACT,QAAQ,OAAO,KAAK,CAAC;AACrB,KAAK,CAAC;AACN,IAAI,MAAM,iBAAiB,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,iBAAiB;AACxL,QAAQ,wBAAwB,CAAC;AACjC,IAAI,MAAM,sBAAsB,GAAG,CAAC,UAAU,KAAK,EAAE,IAAI,EAAE,CAAC,CAAC,OAAO,CAAC,EAAE,GAAG,GAAG,CAAC,aAAa,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,IAAI,CAAC,CAAC,IAAI,CAAC,CAAC,IAAI,KAAK,UAAU,CAAC,CAAC,EAAE,CAAC;AACzK,IAAI,MAAM,eAAe,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,eAAe,KAAK,sBAAsB,CAAC;AAChN,IAAI,MAAM,WAAW,GAAG,CAAC,GAAG,KAAK,GAAG,CAAC,OAAO,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;AACxD,IAAI,MAAM,gBAAgB,GAAG,CAAC,OAAO,EAAE,IAAI,EAAE,UAAU,KAAK;AAC5D,QAAQ,OAAO,OAAO,CAAC,MAAM,CAAC,CAAC,EAAE,UAAU,CAAC,qCAAqC,EAAE,IAAI,CAAC,EAAE,CAAC,CAAC,CAAC;AAC7F,KAAK,CAAC;AACN,IAAI,MAAM,iBAAiB,GAAG,IAAI,GAAG,EAAE,CAAC;AACxC,IAAI,MAAM,qBAAqB,GAAG,CAAC,UAAU,EAAE,iBAAiB,GAAG,EAAE,KAAK;AAC1E,QAAQ,MAAM,gBAAgB,GAAG,iBAAiB,CAAC,GAAG,CAAC,UAAU,CAAC,CAAC;AACnE,QAAQ,IAAI,gBAAgB,EAAE;AAC9B,YAAY,OAAO,CAAC,IAAI,CAAC,CAAC,kBAAkB,EAAE,UAAU,CAAC,oDAAoD,CAAC,CAAC,CAAC;AAChH,YAAY,OAAO,gBAAgB,CAAC,KAAK,CAAC;AAC1C,SAAS;AACT,QAAQ,MAAM,QAAQ,GAAG,WAAW,EAAE,CAAC;AACvC,QAAQ,MAAM,YAAY,GAAG,eAAe,CAAC,UAAU,CAAC,CAAC;AACzD,QAAQ,IAAI,gBAAgB,CAAC;AAC7B,QAAQ,MAAM,wBAAwB,GAAG,YAAY;AACrD,YAAY,IAAI,CAAC,gBAAgB,IAAI,QAAQ,IAAI,iBAAiB,EAAE;AACpE,gBAAgB,gBAAgB;AAChC,oBAAoB,OAAO,iBAAiB,CAAC,QAAQ,CAAC,KAAK,UAAU;AACrE,2BAA2B,gBAAgB,GAAG,MAAM,iBAAiB,CAAC,QAAQ,CAAC,EAAE;AACjF,2BAA2B,gBAAgB,GAAG,iBAAiB,CAAC,QAAQ,CAAC,CAAC,CAAC;AAC3E,aAAa;AACb,iBAAiB,IAAI,iBAAiB,KAAK,IAAI;AAC/C,gBAAgB,CAAC,gBAAgB;AACjC,gBAAgB,KAAK,IAAI,iBAAiB,EAAE;AAC5C,gBAAgB,gBAAgB;AAChC,oBAAoB,OAAO,iBAAiB,CAAC,KAAK,CAAC,KAAK,UAAU;AAClE,2BAA2B,gBAAgB,GAAG,MAAM,iBAAiB,CAAC,KAAK,CAAC,EAAE;AAC9E,2BAA2B,gBAAgB,GAAG,iBAAiB,CAAC,KAAK,CAAC,CAAC,CAAC;AACxE,aAAa;AACb,YAAY,OAAO,gBAAgB,CAAC;AACpC,SAAS,CAAC;AACV,QAAQ,MAAM,kBAAkB,GAAG,CAAC,IAAI,EAAE,IAAI,KAAK;AACnD,YAAY,IAAI,EAAE,EAAE,EAAE,CAAC;AACvB,YAAY,IAAI,YAAY,EAAE;AAC9B,gBAAgB,MAAM,YAAY,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,IAAI,IAAI,KAAK,CAAC,CAAC,IAAI,CAAC,CAAC;AACjJ,gBAAgB,IAAI,YAAY,EAAE;AAClC,oBAAoB,IAAI,YAAY,CAAC,KAAK,KAAK,SAAS,EAAE;AAC1D,wBAAwB,OAAO,CAAC,OAAO,KAAK,GAAG,CAAC,aAAa,CAAC,UAAU,EAAE,IAAI,CAAC,QAAQ,EAAE,EAAE,OAAO,CAAC,CAAC;AACpG,qBAAqB;AACrB,yBAAyB;AACzB,wBAAwB,OAAO,CAAC,OAAO,EAAE,QAAQ,KAAK,GAAG,CAAC,cAAc,CAAC,UAAU,EAAE,IAAI,CAAC,QAAQ,EAAE,EAAE,OAAO,EAAE,QAAQ,CAAC,CAAC;AACzH,qBAAqB;AACrB,iBAAiB;AACjB,qBAAqB,IAAI,IAAI,EAAE;AAC/B,oBAAoB,OAAO,CAAC,EAAE,GAAG,IAAI,CAAC,IAAI,CAAC,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;AAChG,iBAAiB;AACjB,aAAa;AACb,iBAAiB,IAAI,IAAI,EAAE;AAC3B,gBAAgB,OAAO,CAAC,EAAE,GAAG,IAAI,CAAC,IAAI,CAAC,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;AAC5F,aAAa;AACb,iBAAiB;AACjB,gBAAgB,MAAM,IAAI,kBAAkB,CAAC,CAAC,CAAC,EAAE,UAAU,CAAC,+BAA+B,EAAE,QAAQ,CAAC,CAAC,EAAE,aAAa,CAAC,aAAa,CAAC,CAAC;AACtI,aAAa;AACb,SAAS,CAAC;AACV,QAAQ,MAAM,yBAAyB,GAAG,CAAC,IAAI,KAAK;AACpD,YAAY,IAAI,MAAM,CAAC;AACvB,YAAY,MAAM,OAAO,GAAG,CAAC,GAAG,IAAI,KAAK;AACzC,gBAAgB,MAAM,CAAC,GAAG,wBAAwB,EAAE,CAAC,IAAI,CAAC,IAAI,IAAI;AAClE,oBAAoB,MAAM,EAAE,GAAG,kBAAkB,CAAC,IAAI,EAAE,IAAI,CAAC,CAAC;AAC9D,oBAAoB,IAAI,EAAE,EAAE;AAC5B,wBAAwB,MAAM,CAAC,GAAG,EAAE,CAAC,GAAG,IAAI,CAAC,CAAC;AAC9C,wBAAwB,MAAM,GAAG,CAAC,KAAK,IAAI,IAAI,CAAC,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,CAAC,CAAC,MAAM,CAAC;AAChF,wBAAwB,OAAO,CAAC,CAAC;AACjC,qBAAqB;AACrB,yBAAyB;AACzB,wBAAwB,MAAM,IAAI,kBAAkB,CAAC,CAAC,CAAC,EAAE,UAAU,CAAC,CAAC,EAAE,IAAI,CAAC,0BAA0B,EAAE,QAAQ,CAAC,CAAC,EAAE,aAAa,CAAC,aAAa,CAAC,CAAC;AACjJ,qBAAqB;AACrB,iBAAiB,CAAC,CAAC;AACnB,gBAAgB,IAAI,IAAI,KAAK,aAAa,EAAE;AAC5C,oBAAoB,CAAC,CAAC,MAAM,GAAG,YAAY,MAAM,EAAE,CAAC;AACpD,iBAAiB;AACjB,gBAAgB,OAAO,CAAC,CAAC;AACzB,aAAa,CAAC;AACd;AACA,YAAY,OAAO,CAAC,QAAQ,GAAG,MAAM,CAAC,EAAE,IAAI,CAAC,QAAQ,EAAE,CAAC,uBAAuB,CAAC,CAAC;AACjF,YAAY,MAAM,CAAC,cAAc,CAAC,OAAO,EAAE,MAAM,EAAE;AACnD,gBAAgB,KAAK,EAAE,IAAI;AAC3B,gBAAgB,QAAQ,EAAE,KAAK;AAC/B,gBAAgB,YAAY,EAAE,KAAK;AACnC,aAAa,CAAC,CAAC;AACf,YAAY,OAAO,OAAO,CAAC;AAC3B,SAAS,CAAC;AACV,QAAQ,MAAM,WAAW,GAAG,yBAAyB,CAAC,aAAa,CAAC,CAAC;AACrE,QAAQ,MAAM,cAAc,GAAG,yBAAyB,CAAC,gBAAgB,CAAC,CAAC;AAC3E,QAAQ,MAAM,iBAAiB,GAAG,CAAC,SAAS,EAAE,QAAQ,KAAK;AAC3D,YAAY,MAAM,IAAI,GAAG,WAAW,CAAC,EAAE,SAAS,EAAE,EAAE,QAAQ,CAAC,CAAC;AAC9D,YAAY,MAAM,MAAM,GAAG,YAAY;AACvC,gBAAgB,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC;AAC9C,gBAAgB,cAAc,CAAC;AAC/B,oBAAoB,SAAS;AAC7B,oBAAoB,UAAU;AAC9B,iBAAiB,EAAE,QAAQ,CAAC,CAAC;AAC7B,aAAa,CAAC;AACd,YAAY,MAAM,CAAC,GAAG,IAAI,OAAO,CAAC,OAAO,IAAI,IAAI,CAAC,IAAI,CAAC,MAAM,OAAO,CAAC,EAAE,MAAM,EAAE,CAAC,CAAC,CAAC,CAAC;AACnF,YAAY,CAAC,CAAC,MAAM,GAAG,YAAY;AACnC,gBAAgB,OAAO,CAAC,IAAI,CAAC,CAAC,kDAAkD,CAAC,CAAC,CAAC;AACnF,gBAAgB,MAAM,MAAM,EAAE,CAAC;AAC/B,aAAa,CAAC;AACd,YAAY,OAAO,CAAC,CAAC;AACrB,SAAS,CAAC;AACV,QAAQ,MAAM,KAAK,GAAG,IAAI,KAAK,CAAC,EAAE,EAAE;AACpC,YAAY,GAAG,CAAC,CAAC,EAAE,IAAI,EAAE;AACzB,gBAAgB,QAAQ,IAAI;AAC5B;AACA,oBAAoB,KAAK,UAAU;AACnC,wBAAwB,OAAO,SAAS,CAAC;AACzC,oBAAoB,KAAK,QAAQ;AACjC,wBAAwB,OAAO,OAAO,EAAE,CAAC,CAAC;AAC1C,oBAAoB,KAAK,aAAa;AACtC,wBAAwB,OAAO,YAAY,GAAG,iBAAiB,GAAG,WAAW,CAAC;AAC9E,oBAAoB,KAAK,gBAAgB;AACzC,wBAAwB,OAAO,cAAc,CAAC;AAC9C,oBAAoB;AACpB,wBAAwB,OAAO,yBAAyB,CAAC,IAAI,CAAC,CAAC;AAC/D,iBAAiB;AACjB,aAAa;AACb,SAAS,CAAC,CAAC;AACX,QAAQ,OAAO,CAAC,UAAU,CAAC,GAAG,KAAK,CAAC;AACpC,QAAQ,iBAAiB,CAAC,GAAG,CAAC,UAAU,EAAE;AAC1C,YAAY,IAAI,EAAE,UAAU;AAC5B,YAAY,KAAK;AACjB,YAAY,SAAS,EAAE,IAAI,GAAG,CAAC;AAC/B,gBAAgB,GAAG,MAAM,CAAC,IAAI,CAAC,iBAAiB,CAAC;AACjD,gBAAgB,IAAI,YAAY,GAAG,CAAC,QAAQ,CAAC,GAAG,EAAE,CAAC;AACnD,aAAa,CAAC;AACd,SAAS,CAAC,CAAC;AACX,QAAQ,OAAO,KAAK,CAAC;AACrB,KAAK,CAAC;AACN,IAAI,MAAM,cAAc,GAAG,CAAC,CAAC,EAAE,GAAG,YAAY,KAAK,IAAI,IAAI,YAAY,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,YAAY,CAAC,eAAe,MAAM,IAAI,IAAI,EAAE,KAAK,KAAK,CAAC,GAAG,KAAK,CAAC,GAAG,EAAE,CAAC,cAAc,KAAK,qBAAqB,CAAC;AAC7M;AACA,IAAI,IAAI,CAAC,GAAG,CAAC,cAAc,EAAE;AAC7B,QAAQ,GAAG,CAAC,cAAc,GAAG,QAAQ,IAAI,QAAQ,CAAC;AAClD,KAAK;AACL,IAAI,GAAG,CAAC,WAAW,GAAG,WAAW,CAAC;AAClC,IAAI,GAAG,CAAC,WAAW,GAAG,WAAW,CAAC;AAClC,IAAI,GAAG,CAAC,gBAAgB,GAAG,gBAAgB,CAAC;AAC5C,IAAI,GAAG,CAAC,iBAAiB,GAAG,iBAAiB,CAAC;AAC9C,IAAI,GAAG,CAAC,gBAAgB,GAAG,gBAAgB,CAAC;AAC5C,IAAI,GAAG,CAAC,cAAc,GAAG,cAAc,CAAC;AACxC,IAAI,GAAG,CAAC,SAAS,GAAG,kBAAkB,CAAC;AACvC,IAAI,GAAG,CAAC,KAAK,GAAG,CAAC,CAAC,GAAG,CAAC,KAAK,CAAC;AAC5B,IAAI,GAAG,CAAC,gBAAgB,GAAG,CAAC,CAAC,GAAG,CAAC,gBAAgB,CAAC;AAClD;AACA,IAAI,GAAG,CAAC,QAAQ,GAAG,GAAG,CAAC,WAAW,EAAE,CAAC;AACrC,IAAI,GAAG,CAAC,QAAQ,GAAG,GAAG,CAAC,gBAAgB,EAAE,CAAC;AAC1C,IAAI,OAAO,GAAG,CAAC;AACf,CAAC,CAAC;AACK,MAAM,mBAAmB,GAAG,CAAC,GAAG,MAAM,GAAG,CAAC,SAAS,GAAG,eAAe,CAAC,GAAG,CAAC,CAAC;;ACnLtE,MAAC,SAAS,iBAAiB,mBAAmB,CAAC,OAAO,UAAU,KAAK,WAAW;AAC5F,MAAM,UAAU;AAChB,MAAM,OAAO,IAAI,KAAK,WAAW;AACjC,UAAU,IAAI;AACd,UAAU,OAAO,MAAM,KAAK,WAAW;AACvC,cAAc,MAAM;AACpB,cAAc,OAAO,MAAM,KAAK,WAAW;AAC3C,kBAAkB,MAAM;AACxB,kBAAkB,EAAE,EAAE;AACV,MAAC,cAAc,GAAG,SAAS,CAAC,eAAe;AACvD;AACA;AACA;AACA;AACA;AACY,MAAC,OAAO,GAAG,SAAS,CAAC,QAAQ;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACY,MAAC,iBAAiB,GAAG,CAAC,MAAM,KAAK,uBAAuB,CAAC,SAAS,EAAE,MAAM;;AC3BtF;AACA;AACA;AACO,MAAM,SAAS,CAAC;AACvB,IAAI,WAAW,CAAC,MAAM,EAAE;AACxB,QAAQ,IAAI,CAAC,SAAS,GAAG,EAAE,CAAC;AAC5B,QAAQ,IAAI,CAAC,eAAe,GAAG,EAAE,CAAC;AAClC,QAAQ,IAAI,MAAM,EAAE;AACpB;AACA,YAAY,OAAO,CAAC,IAAI,CAAC,CAAC,qBAAqB,EAAE,MAAM,CAAC,IAAI,CAAC,+DAA+D,CAAC,CAAC,CAAC;AAC/H,YAAY,IAAI,CAAC,MAAM,GAAG,MAAM,CAAC;AACjC,SAAS;AACT,KAAK;AACL,IAAI,WAAW,CAAC,SAAS,EAAE,YAAY,EAAE;AACzC,QAAQ,MAAM,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC;AACpD,QAAQ,IAAI,CAAC,SAAS,EAAE;AACxB,YAAY,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,GAAG,EAAE,CAAC;AAC3C,SAAS;AACT,QAAQ,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC,IAAI,CAAC,YAAY,CAAC,CAAC;AACrD;AACA;AACA,QAAQ,MAAM,cAAc,GAAG,IAAI,CAAC,eAAe,CAAC,SAAS,CAAC,CAAC;AAC/D,QAAQ,IAAI,cAAc,IAAI,CAAC,cAAc,CAAC,UAAU,EAAE;AAC1D,YAAY,IAAI,CAAC,iBAAiB,CAAC,cAAc,CAAC,CAAC;AACnD,SAAS;AACT,QAAQ,MAAM,MAAM,GAAG,YAAY,IAAI,CAAC,cAAc,CAAC,SAAS,EAAE,YAAY,CAAC,CAAC;AAChF,QAAQ,MAAM,CAAC,GAAG,OAAO,CAAC,OAAO,CAAC,EAAE,MAAM,EAAE,CAAC,CAAC;AAC9C,QAAQ,MAAM,CAAC,cAAc,CAAC,CAAC,EAAE,QAAQ,EAAE;AAC3C,YAAY,KAAK,EAAE,YAAY;AAC/B,gBAAgB,OAAO,CAAC,IAAI,CAAC,CAAC,kDAAkD,CAAC,CAAC,CAAC;AACnF,gBAAgB,MAAM,MAAM,EAAE,CAAC;AAC/B,aAAa;AACb,SAAS,CAAC,CAAC;AACX,QAAQ,OAAO,CAAC,CAAC;AACjB,KAAK;AACL,IAAI,MAAM,kBAAkB,GAAG;AAC/B,QAAQ,IAAI,CAAC,SAAS,GAAG,EAAE,CAAC;AAC5B,QAAQ,KAAK,MAAM,QAAQ,IAAI,IAAI,CAAC,eAAe,EAAE;AACrD,YAAY,IAAI,CAAC,oBAAoB,CAAC,IAAI,CAAC,eAAe,CAAC,QAAQ,CAAC,CAAC,CAAC;AACtE,SAAS;AACT,QAAQ,IAAI,CAAC,eAAe,GAAG,EAAE,CAAC;AAClC,KAAK;AACL,IAAI,eAAe,CAAC,SAAS,EAAE,IAAI,EAAE;AACrC,QAAQ,MAAM,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC;AACpD,QAAQ,IAAI,SAAS,EAAE;AACvB,YAAY,SAAS,CAAC,OAAO,CAAC,QAAQ,IAAI,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC;AAC1D,SAAS;AACT,KAAK;AACL,IAAI,YAAY,CAAC,SAAS,EAAE;AAC5B,QAAQ,OAAO,CAAC,CAAC,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC,MAAM,CAAC;AAClD,KAAK;AACL,IAAI,sBAAsB,CAAC,eAAe,EAAE,eAAe,EAAE;AAC7D,QAAQ,IAAI,CAAC,eAAe,CAAC,eAAe,CAAC,GAAG;AAChD,YAAY,UAAU,EAAE,KAAK;AAC7B,YAAY,eAAe;AAC3B,YAAY,eAAe;AAC3B,YAAY,OAAO,EAAE,KAAK,IAAI;AAC9B,gBAAgB,IAAI,CAAC,eAAe,CAAC,eAAe,EAAE,KAAK,CAAC,CAAC;AAC7D,aAAa;AACb,SAAS,CAAC;AACV,KAAK;AACL,IAAI,aAAa,CAAC,GAAG,GAAG,iBAAiB,EAAE;AAC3C,QAAQ,OAAO,IAAI,SAAS,CAAC,SAAS,CAAC,GAAG,EAAE,aAAa,CAAC,aAAa,CAAC,CAAC;AACzE,KAAK;AACL,IAAI,WAAW,CAAC,GAAG,GAAG,eAAe,EAAE;AACvC,QAAQ,OAAO,IAAI,SAAS,CAAC,SAAS,CAAC,GAAG,EAAE,aAAa,CAAC,WAAW,CAAC,CAAC;AACvE,KAAK;AACL,IAAI,MAAM,cAAc,CAAC,SAAS,EAAE,YAAY,EAAE;AAClD,QAAQ,MAAM,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC;AACpD,QAAQ,IAAI,CAAC,SAAS,EAAE;AACxB,YAAY,OAAO;AACnB,SAAS;AACT,QAAQ,MAAM,KAAK,GAAG,SAAS,CAAC,OAAO,CAAC,YAAY,CAAC,CAAC;AACtD,QAAQ,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC,MAAM,CAAC,KAAK,EAAE,CAAC,CAAC,CAAC;AACnD;AACA;AACA,QAAQ,IAAI,CAAC,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,CAAC,MAAM,EAAE;AAC/C,YAAY,IAAI,CAAC,oBAAoB,CAAC,IAAI,CAAC,eAAe,CAAC,SAAS,CAAC,CAAC,CAAC;AACvE,SAAS;AACT,KAAK;AACL,IAAI,iBAAiB,CAAC,MAAM,EAAE;AAC9B,QAAQ,MAAM,CAAC,gBAAgB,CAAC,MAAM,CAAC,eAAe,EAAE,MAAM,CAAC,OAAO,CAAC,CAAC;AACxE,QAAQ,MAAM,CAAC,UAAU,GAAG,IAAI,CAAC;AACjC,KAAK;AACL,IAAI,oBAAoB,CAAC,MAAM,EAAE;AACjC,QAAQ,IAAI,CAAC,MAAM,EAAE;AACrB,YAAY,OAAO;AACnB,SAAS;AACT,QAAQ,MAAM,CAAC,mBAAmB,CAAC,MAAM,CAAC,eAAe,EAAE,MAAM,CAAC,OAAO,CAAC,CAAC;AAC3E,QAAQ,MAAM,CAAC,UAAU,GAAG,KAAK,CAAC;AAClC,KAAK;AACL;;AC5FY,MAAC,OAAO,iBAAiB,cAAc,CAAC,SAAS;;;;"}
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/package.json b/temporary_modules/trezor-connect/node_modules/@capacitor/core/package.json
new file mode 100644
index 00000000..719ee368
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/package.json
@@ -0,0 +1,55 @@
+{
+ "name": "@capacitor/core",
+ "version": "3.5.0",
+ "description": "Capacitor: Cross-platform apps with JavaScript and the web",
+ "homepage": "https://capacitorjs.com",
+ "author": "Ionic Team (https://ionic.io)",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ionic-team/capacitor.git"
+ },
+ "bugs": {
+ "url": "https://github.com/ionic-team/capacitor/issues"
+ },
+ "files": [
+ "dist/",
+ "types/",
+ "cordova.js"
+ ],
+ "main": "dist/index.cjs.js",
+ "module": "dist/index.js",
+ "types": "types/index.d.ts",
+ "unpkg": "dist/capacitor.js",
+ "scripts": {
+ "build": "npm run clean && npm run transpile && npm run rollup",
+ "build:nativebridge": "tsc native-bridge.ts --target es2017 --moduleResolution node --outDir build && rollup --config rollup.bridge.config.js",
+ "clean": "rimraf dist",
+ "prepublishOnly": "npm run build",
+ "rollup": "rollup --config rollup.config.js",
+ "transpile": "tsc",
+ "test": "jest",
+ "test.watch": "jest --watchAll",
+ "test.treeshaking": "node src/tests/build-treeshaking.js"
+ },
+ "dependencies": {
+ "tslib": "^2.1.0"
+ },
+ "devDependencies": {
+ "@rollup/plugin-node-resolve": "^10.0.0",
+ "@rollup/plugin-replace": "^2.4.2",
+ "@types/jest": "^26.0.4",
+ "jest": "^26.1.0",
+ "rimraf": "^3.0.2",
+ "rollup": "^2.21.0",
+ "rollup-plugin-terser": "^7.0.2",
+ "typescript": "^4.0.5"
+ },
+ "jest": {
+ "preset": "ts-jest"
+ },
+ "publishConfig": {
+ "access": "public"
+ },
+ "gitHead": "f03e1a67140c8af25288456f9e99dd6234b50f25"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/core-plugins.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/core-plugins.d.ts
new file mode 100644
index 00000000..f566cbe9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/core-plugins.d.ts
@@ -0,0 +1,10 @@
+import type { Plugin } from './definitions';
+export interface WebViewPlugin extends Plugin {
+ setServerBasePath(options: WebViewPath): Promise;
+ getServerBasePath(): Promise;
+ persistServerBasePath(): Promise;
+}
+export interface WebViewPath {
+ path: string;
+}
+export declare const WebView: WebViewPlugin;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/definitions-internal.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/definitions-internal.d.ts
new file mode 100644
index 00000000..2eb7d8b7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/definitions-internal.d.ts
@@ -0,0 +1,159 @@
+import type { CapacitorGlobal, PluginCallback, PluginResultData, PluginResultError } from './definitions';
+import type { CapacitorPlatformsInstance } from './platforms';
+export interface PluginHeaderMethod {
+ readonly name: string;
+ readonly rtype?: 'promise' | 'callback';
+}
+export interface PluginHeader {
+ readonly name: string;
+ readonly methods: readonly PluginHeaderMethod[];
+}
+/**
+ * Has all instance properties that are available and used
+ * by the native layer. The "Capacitor" interface it extends
+ * is the public one.
+ */
+export interface CapacitorInstance extends CapacitorGlobal {
+ /**
+ * Internal registry for all plugins assigned to the Capacitor global.
+ * Legacy Capacitor referenced this property directly, but as of v3
+ * it should be an internal API. Still exporting on the Capacitor
+ * type, but with the deprecated JSDoc tag.
+ */
+ Plugins: {
+ [pluginName: string]: {
+ [prop: string]: any;
+ };
+ };
+ PluginHeaders?: readonly PluginHeader[];
+ /**
+ * Gets the WebView server urls set by the native web view. Defaults
+ * to "" if not running from a native platform.
+ */
+ getServerUrl: () => string;
+ /**
+ * Low-level API to send data to the native layer.
+ * Prefer using `nativeCallback()` or `nativePromise()` instead.
+ * Returns the Callback Id.
+ */
+ toNative?: (pluginName: string, methodName: string, options: any, storedCallback?: StoredCallback) => string;
+ /**
+ * Sends data over the bridge to the native layer.
+ * Returns the Callback Id.
+ */
+ nativeCallback: (pluginName: string, methodName: string, options?: O, callback?: PluginCallback) => string;
+ /**
+ * Sends data over the bridge to the native layer and
+ * resolves the promise when it receives the data from
+ * the native implementation.
+ */
+ nativePromise: (pluginName: string, methodName: string, options?: O) => Promise;
+ /**
+ * Low-level API used by the native layers to send
+ * data back to the webview runtime.
+ */
+ fromNative?: (result: PluginResult) => void;
+ /**
+ * Low-level API for backwards compatibility.
+ */
+ createEvent?: (eventName: string, eventData?: any) => Event;
+ /**
+ * Low-level API triggered from native implementations.
+ */
+ triggerEvent?: (eventName: string, target: string, eventData?: any) => boolean;
+ handleError: (err: Error) => void;
+ handleWindowError: (msg: string | Event, url: string, lineNo: number, columnNo: number, err: Error) => void;
+ /**
+ * Low-level API used by the native bridge to log messages.
+ */
+ logJs: (message: string, level: 'error' | 'warn' | 'info' | 'log') => void;
+ logToNative: (data: MessageCallData) => void;
+ logFromNative: (results: PluginResult) => void;
+ /**
+ * Low-level API used by the native bridge.
+ */
+ withPlugin?: (pluginName: string, fn: (...args: any[]) => any) => void;
+}
+export interface MessageCallData {
+ type?: 'message';
+ callbackId: string;
+ pluginId: string;
+ methodName: string;
+ options: any;
+}
+export interface ErrorCallData {
+ type: 'js.error';
+ error: {
+ message: string;
+ url: string;
+ line: number;
+ col: number;
+ errorObject: string;
+ };
+}
+export declare type CallData = MessageCallData | ErrorCallData;
+/**
+ * A resulting call back from the native layer.
+ */
+export interface PluginResult {
+ callbackId?: string;
+ methodName?: string;
+ data: PluginResultData;
+ success: boolean;
+ error?: PluginResultError;
+ pluginId?: string;
+ save?: boolean;
+}
+/**
+ * Callback data kept on the client
+ * to be called after native response
+ */
+export interface StoredCallback {
+ callback?: PluginCallback;
+ resolve?: (...args: any[]) => any;
+ reject?: (...args: any[]) => any;
+}
+export interface CapacitorCustomPlatformInstance {
+ name: string;
+ plugins: {
+ [pluginName: string]: any;
+ };
+}
+export interface WindowCapacitor {
+ Capacitor?: CapacitorInstance;
+ /**
+ * @deprecated Use `CapacitorCustomPlatform` instead
+ */
+ CapacitorPlatforms?: CapacitorPlatformsInstance;
+ CapacitorCustomPlatform?: CapacitorCustomPlatformInstance;
+ Ionic?: {
+ WebView?: {
+ getServerBasePath?: any;
+ setServerBasePath?: any;
+ persistServerBasePath?: any;
+ convertFileSrc?: any;
+ };
+ };
+ WEBVIEW_SERVER_URL?: string;
+ androidBridge?: {
+ postMessage(data: string): void;
+ };
+ webkit?: {
+ messageHandlers?: {
+ bridge: {
+ postMessage(data: any): void;
+ };
+ };
+ };
+ console?: Console;
+ cordova?: {
+ fireDocumentEvent?: (eventName: string, eventData: any) => void;
+ };
+ dispatchEvent?: any;
+ document?: any;
+ navigator?: {
+ app?: {
+ exitApp?: () => void;
+ };
+ };
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/definitions.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/definitions.d.ts
new file mode 100644
index 00000000..f98a5364
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/definitions.d.ts
@@ -0,0 +1,96 @@
+import type { PluginRegistry } from './legacy/legacy-definitions';
+import type { CapacitorException } from './util';
+export interface CapacitorGlobal {
+ /**
+ * The Exception class used when generating plugin Exceptions
+ * from bridge calls.
+ */
+ Exception: typeof CapacitorException;
+ /**
+ * Utility function to convert a file path into a usable src depending
+ * on the native WebView implementation value and environment.
+ */
+ convertFileSrc: (filePath: string) => string;
+ /**
+ * Gets the name of the platform, such as `android`, `ios`, or `web`.
+ */
+ getPlatform: () => string;
+ /**
+ * Boolean if the platform is native or not. `android` and `ios`
+ * would return `true`, otherwise `false`.
+ */
+ isNativePlatform: () => boolean;
+ /**
+ * Used to check if a platform is registered and available.
+ */
+ isPluginAvailable: (name: string) => boolean;
+ registerPlugin: RegisterPlugin;
+ /**
+ * Add a listener for a plugin event.
+ */
+ addListener?: (pluginName: string, eventName: string, callback: PluginCallback) => PluginListenerHandle;
+ /**
+ * Remove a listener to a plugin event.
+ */
+ removeListener?: (pluginName: string, callbackId: string, eventName: string, callback: PluginCallback) => void;
+ DEBUG?: boolean;
+ isLoggingEnabled?: boolean;
+ /**
+ * @deprecated Plugins should be imported instead. Deprecated in
+ * v3 and Capacitor.Plugins property definition will not be exported in v4.
+ */
+ Plugins: PluginRegistry;
+ /**
+ * Called when a plugin method is not available. Defaults to console
+ * logging a warning. Provided for backwards compatibility.
+ * @deprecated Deprecated in v3, will be removed from v4
+ */
+ pluginMethodNoop: (target: any, key: PropertyKey, pluginName: string) => Promise;
+ /**
+ * @deprecated Use `isNativePlatform()` instead
+ */
+ isNative?: boolean;
+ /**
+ * @deprecated Use `getPlatform()` instead
+ */
+ platform?: string;
+}
+/**
+ * Register plugin implementations with Capacitor.
+ *
+ * This function will create and register an instance that contains the
+ * implementations of the plugin.
+ *
+ * Each plugin has multiple implementations, one per platform. Each
+ * implementation must adhere to a common interface to ensure client code
+ * behaves consistently across each platform.
+ *
+ * @param pluginName The unique CamelCase name of this plugin.
+ * @param implementations The map of plugin implementations.
+ */
+export declare type RegisterPlugin = (pluginName: string, implementations?: Readonly) => T;
+/**
+ * A map of plugin implementations.
+ *
+ * Each key should be the lowercased platform name as recognized by Capacitor,
+ * e.g. 'android', 'ios', and 'web'. Each value must be an instance of a plugin
+ * implementation for the respective platform.
+ */
+export declare type PluginImplementations = {
+ [platform: string]: (() => Promise) | any;
+};
+export interface Plugin {
+ addListener(eventName: string, listenerFunc: (...args: any[]) => any): Promise;
+ removeAllListeners(): Promise;
+}
+export declare type PermissionState = 'prompt' | 'prompt-with-rationale' | 'granted' | 'denied';
+export interface PluginListenerHandle {
+ remove: () => Promise;
+}
+export interface PluginResultData {
+ [key: string]: any;
+}
+export interface PluginResultError {
+ message: string;
+}
+export declare type PluginCallback = (data: PluginResultData, error?: PluginResultError) => void;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/global.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/global.d.ts
new file mode 100644
index 00000000..405b4421
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/global.d.ts
@@ -0,0 +1,21 @@
+import type { WebPlugin } from './web-plugin';
+export declare const Capacitor: import("./definitions").CapacitorGlobal;
+export declare const registerPlugin: import("./definitions").RegisterPlugin;
+/**
+ * @deprecated Provided for backwards compatibility for Capacitor v2 plugins.
+ * Capacitor v3 plugins should import the plugin directly. This "Plugins"
+ * export is deprecated in v3, and will be removed in v4.
+ */
+export declare const Plugins: import(".").PluginRegistry;
+/**
+ * Provided for backwards compatibility. Use the registerPlugin() API
+ * instead, and provide the web plugin as the "web" implmenetation.
+ * For example
+ *
+ * export const Example = registerPlugin('Example', {
+ * web: () => import('./web').then(m => new m.Example())
+ * })
+ *
+ * @deprecated Deprecated in v3, will be removed from v4.
+ */
+export declare const registerWebPlugin: (plugin: WebPlugin) => void;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/index.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/index.d.ts
new file mode 100644
index 00000000..4248977d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/index.d.ts
@@ -0,0 +1,9 @@
+export type { CapacitorGlobal, PermissionState, Plugin, PluginCallback, PluginImplementations, PluginListenerHandle, PluginResultData, PluginResultError, } from './definitions';
+export { CapacitorPlatforms, addPlatform, setPlatform } from './platforms';
+export { Capacitor, registerPlugin } from './global';
+export { WebPlugin, WebPluginConfig, ListenerCallback } from './web-plugin';
+export { WebView } from './core-plugins';
+export type { WebViewPath, WebViewPlugin } from './core-plugins';
+export { CapacitorException, ExceptionCode } from './util';
+export { Plugins, registerWebPlugin } from './global';
+export type { CallbackID, CancellableCallback, ISODateString, PluginConfig, PluginRegistry, } from './legacy/legacy-definitions';
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/legacy/legacy-definitions.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/legacy/legacy-definitions.d.ts
new file mode 100644
index 00000000..c63152ef
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/legacy/legacy-definitions.d.ts
@@ -0,0 +1,37 @@
+/**
+ * @deprecated
+ */
+export interface PluginRegistry {
+ [pluginName: string]: {
+ [prop: string]: any;
+ };
+}
+/**
+ * @deprecated
+ */
+export interface PluginConfig {
+ id: string;
+ name: string;
+}
+/**
+ * @deprecated
+ */
+export declare type ISODateString = string;
+/**
+ * @deprecated
+ */
+export declare type CallbackID = string;
+/**
+ * CancellableCallback is a simple wrapper that a method will
+ * return to make it easy to cancel any repeated callback the method
+ * might have set up. For example: a geolocation watch.
+ * @deprecated
+ */
+export interface CancellableCallback {
+ /**
+ * The cancel function for this method
+ *
+ * @deprecated
+ */
+ cancel: (...args: any[]) => any;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/legacy/legacy-web-plugin-merge.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/legacy/legacy-web-plugin-merge.d.ts
new file mode 100644
index 00000000..c49ca118
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/legacy/legacy-web-plugin-merge.d.ts
@@ -0,0 +1,3 @@
+import type { CapacitorGlobal } from '../definitions';
+import type { WebPlugin } from '../web-plugin';
+export declare const legacyRegisterWebPlugin: (cap: CapacitorGlobal, webPlugin: WebPlugin) => void;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/platforms.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/platforms.d.ts
new file mode 100644
index 00000000..4e119894
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/platforms.d.ts
@@ -0,0 +1,28 @@
+import type { PluginImplementations } from './definitions';
+import type { PluginHeader } from './definitions-internal';
+export interface CapacitorPlatform {
+ name: string;
+ getPlatform?(): string;
+ isPluginAvailable?(pluginName: string): boolean;
+ getPluginHeader?(pluginName: string): PluginHeader | undefined;
+ registerPlugin?(pluginName: string, jsImplementations: PluginImplementations): any;
+ isNativePlatform?(): boolean;
+}
+export interface CapacitorPlatformsInstance {
+ currentPlatform: CapacitorPlatform;
+ platforms: Map;
+ addPlatform(name: string, platform: CapacitorPlatform): void;
+ setPlatform(name: string): void;
+}
+/**
+ * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead
+ */
+export declare const CapacitorPlatforms: CapacitorPlatformsInstance;
+/**
+ * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead
+ */
+export declare const addPlatform: (name: string, platform: CapacitorPlatform) => void;
+/**
+ * @deprecated Set `CapacitorCustomPlatform` on the window object prior to runtime executing in the web app instead
+ */
+export declare const setPlatform: (name: string) => void;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/runtime.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/runtime.d.ts
new file mode 100644
index 00000000..969ee487
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/runtime.d.ts
@@ -0,0 +1,9 @@
+import type { CapacitorGlobal } from './definitions';
+import type { CapacitorInstance, WindowCapacitor } from './definitions-internal';
+export interface RegisteredPlugin {
+ readonly name: string;
+ readonly proxy: any;
+ readonly platforms: ReadonlySet;
+}
+export declare const createCapacitor: (win: WindowCapacitor) => CapacitorInstance;
+export declare const initCapacitorGlobal: (win: any) => CapacitorGlobal;
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/util.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/util.d.ts
new file mode 100644
index 00000000..8813851b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/util.d.ts
@@ -0,0 +1,24 @@
+import type { WindowCapacitor } from './definitions-internal';
+export declare enum ExceptionCode {
+ /**
+ * API is not implemented.
+ *
+ * This usually means the API can't be used because it is not implemented for
+ * the current platform.
+ */
+ Unimplemented = "UNIMPLEMENTED",
+ /**
+ * API is not available.
+ *
+ * This means the API can't be used right now because:
+ * - it is currently missing a prerequisite, such as network connectivity
+ * - it requires a particular platform or browser version
+ */
+ Unavailable = "UNAVAILABLE"
+}
+export declare class CapacitorException extends Error {
+ readonly message: string;
+ readonly code?: ExceptionCode;
+ constructor(message: string, code?: ExceptionCode);
+}
+export declare const getPlatformId: (win: WindowCapacitor) => 'android' | 'ios' | 'web';
diff --git a/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/web-plugin.d.ts b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/web-plugin.d.ts
new file mode 100644
index 00000000..21d043f5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@capacitor/core/types/web-plugin.d.ts
@@ -0,0 +1,48 @@
+import type { PluginListenerHandle, Plugin } from './definitions';
+import type { CapacitorException } from './util';
+/**
+ * Base class web plugins should extend.
+ */
+export declare class WebPlugin implements Plugin {
+ /**
+ * @deprecated WebPluginConfig deprecated in v3 and will be removed in v4.
+ */
+ config?: WebPluginConfig;
+ protected listeners: {
+ [eventName: string]: ListenerCallback[];
+ };
+ protected windowListeners: {
+ [eventName: string]: WindowListenerHandle;
+ };
+ constructor(config?: WebPluginConfig);
+ addListener(eventName: string, listenerFunc: ListenerCallback): Promise & PluginListenerHandle;
+ removeAllListeners(): Promise;
+ protected notifyListeners(eventName: string, data: any): void;
+ protected hasListeners(eventName: string): boolean;
+ protected registerWindowListener(windowEventName: string, pluginEventName: string): void;
+ protected unimplemented(msg?: string): CapacitorException;
+ protected unavailable(msg?: string): CapacitorException;
+ private removeListener;
+ private addWindowListener;
+ private removeWindowListener;
+}
+export declare type ListenerCallback = (err: any, ...args: any[]) => void;
+export interface WindowListenerHandle {
+ registered: boolean;
+ windowEventName: string;
+ pluginEventName: string;
+ handler: (event: any) => void;
+}
+/**
+ * @deprecated Deprecated in v3, removing in v4.
+ */
+export interface WebPluginConfig {
+ /**
+ * @deprecated Deprecated in v3, removing in v4.
+ */
+ readonly name: string;
+ /**
+ * @deprecated Deprecated in v3, removing in v4.
+ */
+ platforms?: string[];
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/CHANGELOG.md
new file mode 100644
index 00000000..fb3c722d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/CHANGELOG.md
@@ -0,0 +1,118 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+## [2.2.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/cli-framework-output@2.2.2...@ionic/cli-framework-output@2.2.3) (2022-03-04)
+
+
+### Bug Fixes
+
+* correct time unit ([#4796](https://github.com/ionic-team/ionic-cli/issues/4796)) ([8f79cf2](https://github.com/ionic-team/ionic-cli/commit/8f79cf2069ff0b59a076ae9112fcef2dd84f8dc2))
+
+
+
+
+
+## [2.2.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/cli-framework-output@2.2.1...@ionic/cli-framework-output@2.2.2) (2020-09-29)
+
+
+### Bug Fixes
+
+* add signal-exit dependency in correct place ([178e5e5](https://github.com/ionic-team/ionic-cli/commit/178e5e51cdc3593e3d096a5197e1dc0e17292bbd))
+
+
+
+
+
+## [2.2.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/cli-framework-output@2.2.0...@ionic/cli-framework-output@2.2.1) (2020-09-24)
+
+**Note:** Version bump only for package @ionic/cli-framework-output
+
+
+
+
+
+# [2.2.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/cli-framework-output@2.1.0...@ionic/cli-framework-output@2.2.0) (2020-09-02)
+
+
+### Bug Fixes
+
+* **formatter:** do not strip newlines when not titleizing ([3e38cd8](https://github.com/ionic-team/ionic-cli/commit/3e38cd891d0b914e03ea06d57cbb6ab067d43ac2))
+
+
+### Features
+
+* **output:** write method shortcut ([ca89ee9](https://github.com/ionic-team/ionic-cli/commit/ca89ee92a99a52bd4abd8a1cb97ba3087ec8c4e0))
+
+
+
+
+
+# [2.1.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/cli-framework-output@2.0.2...@ionic/cli-framework-output@2.1.0) (2020-08-29)
+
+
+### Features
+
+* **logger:** add createDefaultLogger helper ([6961c33](https://github.com/ionic-team/ionic-cli/commit/6961c3377e88498d86eb0a39e5aef3f776fb3fd3))
+* **logger:** add tags option for tagged formatter ([6957104](https://github.com/ionic-team/ionic-cli/commit/695710462178f109d10504e6d9d8b0870eb0541c))
+
+
+
+
+
+## [2.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/cli-framework-output@2.0.1...@ionic/cli-framework-output@2.0.2) (2020-08-28)
+
+**Note:** Version bump only for package @ionic/cli-framework-output
+
+
+
+
+
+## [2.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/cli-framework-output@2.0.0...@ionic/cli-framework-output@2.0.1) (2020-08-27)
+
+
+### Bug Fixes
+
+* strip newlines when redrawing ([d13085f](https://github.com/ionic-team/ionic-cli/commit/d13085f8bdf372cd761f30ba97d9551721a26396))
+
+
+
+
+
+# [2.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/cli-framework-output@1.1.0...@ionic/cli-framework-output@2.0.0) (2020-08-27)
+
+
+### Bug Fixes
+
+* **output:** newlines in stream output strategy ([4f9a7c9](https://github.com/ionic-team/ionic-cli/commit/4f9a7c988a0a63b21bf2a80eef065155c78545d0))
+* **output:** stream is optional ([df3e949](https://github.com/ionic-team/ionic-cli/commit/df3e949ebb092c92b84717a83bd662e283463e37))
+
+
+### Code Refactoring
+
+* **output:** replace log-update ([a90005c](https://github.com/ionic-team/ionic-cli/commit/a90005cd048a68252456da8409dedacaab54b505))
+
+
+### BREAKING CHANGES
+
+* **output:** `LogUpdateOutputStrategy` removed in favor of `TTYOutputStrategy`
+
+
+
+
+
+# [1.1.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/cli-framework-output@1.0.1...@ionic/cli-framework-output@1.1.0) (2020-08-26)
+
+
+### Features
+
+* **output:** show elapsed time for tasks ([e4525f7](https://github.com/ionic-team/ionic-cli/commit/e4525f79b549b66e25e6c01297ccc77cc6c85250))
+
+
+
+
+
+## 1.0.1 (2020-08-25)
+
+**Note:** Version bump only for package @ionic/cli-framework-output
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/LICENSE b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/LICENSE
new file mode 100644
index 00000000..62cadf75
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2019 Drifty Co
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/README.md b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/README.md
new file mode 100644
index 00000000..178c1517
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/README.md
@@ -0,0 +1 @@
+# @ionic/cli-framework-output
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/colors.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/colors.d.ts
new file mode 100644
index 00000000..eb33b066
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/colors.d.ts
@@ -0,0 +1,33 @@
+import { LoggerLevel } from './logger';
+export declare type ColorFunction = (...text: string[]) => string;
+export declare type LoggerColors = {
+ [L in LoggerLevel]: ColorFunction;
+};
+export interface Colors {
+ /**
+ * Used to mark text as important. Comparable to HTML's .
+ */
+ strong: ColorFunction;
+ /**
+ * Used to mark text as less important.
+ */
+ weak: ColorFunction;
+ /**
+ * Used to mark text as input such as commands, inputs, options, etc.
+ */
+ input: ColorFunction;
+ /**
+ * Used to mark text as successful.
+ */
+ success: ColorFunction;
+ /**
+ * Used to mark text as failed.
+ */
+ failure: ColorFunction;
+ /**
+ * Used to mark text as ancillary or supportive.
+ */
+ ancillary: ColorFunction;
+ log: LoggerColors;
+}
+export declare const NO_COLORS: Colors;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/colors.js b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/colors.js
new file mode 100644
index 00000000..60be071d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/colors.js
@@ -0,0 +1,18 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.NO_COLORS = void 0;
+const utils_1 = require("./utils");
+exports.NO_COLORS = Object.freeze({
+ strong: utils_1.identity,
+ weak: utils_1.identity,
+ input: utils_1.identity,
+ success: utils_1.identity,
+ failure: utils_1.identity,
+ ancillary: utils_1.identity,
+ log: Object.freeze({
+ DEBUG: utils_1.identity,
+ INFO: utils_1.identity,
+ WARN: utils_1.identity,
+ ERROR: utils_1.identity,
+ }),
+});
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/index.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/index.d.ts
new file mode 100644
index 00000000..78cc2e49
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/index.d.ts
@@ -0,0 +1,24 @@
+import { TTY_WIDTH, indent, sliceAnsi, stringWidth, stripAnsi, wordWrap } from '@ionic/utils-terminal';
+import { Logger, CreateTaggedFormatterOptions } from './logger';
+import { OutputStrategy } from './output';
+export { TTY_WIDTH, indent, sliceAnsi, stringWidth, stripAnsi, wordWrap };
+export * from './colors';
+export * from './logger';
+export * from './output';
+export * from './tasks';
+export interface CreateDefaultLoggerOptions {
+ /**
+ * Specify a custom output strategy to use for the logger.
+ *
+ * By default, the logger uses a output strategy with process.stdout and no colors.
+ */
+ output?: OutputStrategy;
+ /**
+ * Specify custom logger formatter options.
+ */
+ formatterOptions?: CreateTaggedFormatterOptions;
+}
+/**
+ * Creates a logger instance with good defaults.
+ */
+export declare function createDefaultLogger({ output, formatterOptions }?: CreateDefaultLoggerOptions): Logger;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/index.js b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/index.js
new file mode 100644
index 00000000..90ce03c1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/index.js
@@ -0,0 +1,29 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.createDefaultLogger = exports.wordWrap = exports.stripAnsi = exports.stringWidth = exports.sliceAnsi = exports.indent = exports.TTY_WIDTH = void 0;
+const tslib_1 = require("tslib");
+const utils_terminal_1 = require("@ionic/utils-terminal");
+Object.defineProperty(exports, "TTY_WIDTH", { enumerable: true, get: function () { return utils_terminal_1.TTY_WIDTH; } });
+Object.defineProperty(exports, "indent", { enumerable: true, get: function () { return utils_terminal_1.indent; } });
+Object.defineProperty(exports, "sliceAnsi", { enumerable: true, get: function () { return utils_terminal_1.sliceAnsi; } });
+Object.defineProperty(exports, "stringWidth", { enumerable: true, get: function () { return utils_terminal_1.stringWidth; } });
+Object.defineProperty(exports, "stripAnsi", { enumerable: true, get: function () { return utils_terminal_1.stripAnsi; } });
+Object.defineProperty(exports, "wordWrap", { enumerable: true, get: function () { return utils_terminal_1.wordWrap; } });
+const colors_1 = require("./colors");
+const logger_1 = require("./logger");
+const output_1 = require("./output");
+tslib_1.__exportStar(require("./colors"), exports);
+tslib_1.__exportStar(require("./logger"), exports);
+tslib_1.__exportStar(require("./output"), exports);
+tslib_1.__exportStar(require("./tasks"), exports);
+/**
+ * Creates a logger instance with good defaults.
+ */
+function createDefaultLogger({ output = new output_1.StreamOutputStrategy({ colors: colors_1.NO_COLORS, stream: process.stdout }), formatterOptions } = {}) {
+ const { weak } = output.colors;
+ const prefix = process.argv.includes('--log-timestamps') ? () => `${weak('[' + new Date().toISOString() + ']')}` : '';
+ const formatter = logger_1.createTaggedFormatter({ colors: output.colors, prefix, titleize: true, wrap: true, ...formatterOptions });
+ const handlers = new Set([new logger_1.StreamHandler({ stream: output.stream, formatter })]);
+ return new logger_1.Logger({ handlers });
+}
+exports.createDefaultLogger = createDefaultLogger;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/logger.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/logger.d.ts
new file mode 100644
index 00000000..4d2aebf2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/logger.d.ts
@@ -0,0 +1,105 @@
+///
+import { WordWrapOptions } from '@ionic/utils-terminal';
+import { ColorFunction, Colors } from './colors';
+export interface LogRecord {
+ msg: string;
+ logger: Logger;
+ level?: LoggerLevelWeight;
+ format?: boolean;
+}
+export declare type LoggerLevel = 'DEBUG' | 'INFO' | 'WARN' | 'ERROR';
+export declare type LoggerLevelWeight = number;
+export declare type LoggerFormatter = (record: LogRecord) => string;
+export declare const LOGGER_LEVELS: {
+ readonly [L in LoggerLevel]: LoggerLevelWeight;
+};
+export declare const LOGGER_LEVEL_NAMES: ReadonlyMap;
+export declare function getLoggerLevelName(level?: LoggerLevelWeight): LoggerLevel | undefined;
+export declare function getLoggerLevelColor(colors: Colors, level?: LoggerLevelWeight): ColorFunction | undefined;
+export interface LoggerHandler {
+ formatter?: LoggerFormatter;
+ clone(): LoggerHandler;
+ handle(record: LogRecord): void;
+}
+export interface StreamHandlerOptions {
+ readonly stream: NodeJS.WritableStream;
+ readonly filter?: (record: LogRecord) => boolean;
+ readonly formatter?: LoggerFormatter;
+}
+export declare class StreamHandler implements LoggerHandler {
+ readonly stream: NodeJS.WritableStream;
+ readonly filter?: (record: LogRecord) => boolean;
+ formatter?: LoggerFormatter;
+ constructor({ stream, filter, formatter }: StreamHandlerOptions);
+ clone(opts?: Partial): StreamHandler;
+ handle(record: LogRecord): void;
+}
+export declare const DEFAULT_LOGGER_HANDLERS: ReadonlySet;
+export interface LoggerOptions {
+ readonly handlers?: Set;
+ readonly level?: LoggerLevelWeight;
+}
+export declare class Logger {
+ handlers: Set;
+ level: LoggerLevelWeight;
+ constructor({ level, handlers }?: LoggerOptions);
+ static cloneHandlers(handlers: ReadonlySet): Set;
+ /**
+ * Clone this logger, optionally overriding logger options.
+ *
+ * @param opts Logger options to override from this logger.
+ */
+ clone(opts?: Partial): Logger;
+ /**
+ * Log a message as-is.
+ *
+ * @param msg The string to log.
+ */
+ msg(msg: string): void;
+ /**
+ * Log a message using the `debug` logger level.
+ *
+ * @param msg The string to log.
+ */
+ debug(msg: string): void;
+ /**
+ * Log a message using the `info` logger level.
+ *
+ * @param msg The string to log.
+ */
+ info(msg: string): void;
+ /**
+ * Log a message using the `warn` logger level.
+ *
+ * @param msg The string to log.
+ */
+ warn(msg: string): void;
+ /**
+ * Log a message using the `error` logger level.
+ *
+ * @param msg The string to log.
+ */
+ error(msg: string): void;
+ createRecord(msg: string, level?: LoggerLevelWeight, format?: boolean): LogRecord;
+ /**
+ * Log newlines using a logger output found via `level`.
+ *
+ * @param num The number of newlines to log.
+ * @param level The logger level. If omitted, the default output is used.
+ */
+ nl(num?: number, level?: LoggerLevelWeight): void;
+ /**
+ * Log a record using a logger output found via `level`.
+ */
+ log(record: LogRecord): void;
+ createWriteStream(level?: LoggerLevelWeight, format?: boolean): NodeJS.WritableStream;
+}
+export interface CreateTaggedFormatterOptions {
+ prefix?: string | (() => string);
+ titleize?: boolean;
+ wrap?: boolean | WordWrapOptions;
+ colors?: Colors;
+ tags?: ReadonlyMap;
+}
+export declare function createTaggedFormatter({ colors, prefix, tags, titleize, wrap }?: CreateTaggedFormatterOptions): LoggerFormatter;
+export declare function createPrefixedFormatter(prefix: string | (() => string)): LoggerFormatter;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/logger.js b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/logger.js
new file mode 100644
index 00000000..872615db
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/logger.js
@@ -0,0 +1,202 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.createPrefixedFormatter = exports.createTaggedFormatter = exports.Logger = exports.DEFAULT_LOGGER_HANDLERS = exports.StreamHandler = exports.getLoggerLevelColor = exports.getLoggerLevelName = exports.LOGGER_LEVEL_NAMES = exports.LOGGER_LEVELS = void 0;
+const utils_terminal_1 = require("@ionic/utils-terminal");
+const stream_1 = require("stream");
+const util = require("util");
+const colors_1 = require("./colors");
+const utils_1 = require("./utils");
+exports.LOGGER_LEVELS = Object.freeze({
+ DEBUG: 10,
+ INFO: 20,
+ WARN: 30,
+ ERROR: 40,
+});
+exports.LOGGER_LEVEL_NAMES = new Map([
+ [exports.LOGGER_LEVELS.DEBUG, 'DEBUG'],
+ [exports.LOGGER_LEVELS.INFO, 'INFO'],
+ [exports.LOGGER_LEVELS.WARN, 'WARN'],
+ [exports.LOGGER_LEVELS.ERROR, 'ERROR'],
+]);
+function getLoggerLevelName(level) {
+ if (level) {
+ const levelName = exports.LOGGER_LEVEL_NAMES.get(level);
+ if (levelName) {
+ return levelName;
+ }
+ }
+}
+exports.getLoggerLevelName = getLoggerLevelName;
+function getLoggerLevelColor(colors, level) {
+ const levelName = getLoggerLevelName(level);
+ if (levelName) {
+ return colors.log[levelName];
+ }
+}
+exports.getLoggerLevelColor = getLoggerLevelColor;
+class StreamHandler {
+ constructor({ stream, filter, formatter }) {
+ this.stream = stream;
+ this.filter = filter;
+ this.formatter = formatter;
+ }
+ clone(opts) {
+ const { stream, filter, formatter } = this;
+ return new StreamHandler({ stream, filter, formatter, ...opts });
+ }
+ handle(record) {
+ if (this.filter && !this.filter(record)) {
+ return;
+ }
+ const msg = this.formatter && record.format !== false ? this.formatter(record) : record.msg;
+ this.stream.write(utils_1.enforceLF(msg));
+ }
+}
+exports.StreamHandler = StreamHandler;
+const stdoutLogRecordFilter = (record) => !record.level || record.level === exports.LOGGER_LEVELS.INFO;
+const stderrLogRecordFilter = (record) => !!record.level && record.level !== exports.LOGGER_LEVELS.INFO;
+exports.DEFAULT_LOGGER_HANDLERS = new Set([
+ new StreamHandler({ stream: process.stdout, filter: stdoutLogRecordFilter }),
+ new StreamHandler({ stream: process.stderr, filter: stderrLogRecordFilter }),
+]);
+class Logger {
+ constructor({ level = exports.LOGGER_LEVELS.INFO, handlers } = {}) {
+ this.level = level;
+ this.handlers = handlers ? handlers : Logger.cloneHandlers(exports.DEFAULT_LOGGER_HANDLERS);
+ }
+ static cloneHandlers(handlers) {
+ return new Set([...handlers].map(handler => handler.clone()));
+ }
+ /**
+ * Clone this logger, optionally overriding logger options.
+ *
+ * @param opts Logger options to override from this logger.
+ */
+ clone(opts = {}) {
+ const { level, handlers } = this;
+ return new Logger({ level, handlers: Logger.cloneHandlers(handlers), ...opts });
+ }
+ /**
+ * Log a message as-is.
+ *
+ * @param msg The string to log.
+ */
+ msg(msg) {
+ this.log(this.createRecord(msg));
+ }
+ /**
+ * Log a message using the `debug` logger level.
+ *
+ * @param msg The string to log.
+ */
+ debug(msg) {
+ this.log(this.createRecord(msg, exports.LOGGER_LEVELS.DEBUG));
+ }
+ /**
+ * Log a message using the `info` logger level.
+ *
+ * @param msg The string to log.
+ */
+ info(msg) {
+ this.log(this.createRecord(msg, exports.LOGGER_LEVELS.INFO));
+ }
+ /**
+ * Log a message using the `warn` logger level.
+ *
+ * @param msg The string to log.
+ */
+ warn(msg) {
+ this.log(this.createRecord(msg, exports.LOGGER_LEVELS.WARN));
+ }
+ /**
+ * Log a message using the `error` logger level.
+ *
+ * @param msg The string to log.
+ */
+ error(msg) {
+ this.log(this.createRecord(msg, exports.LOGGER_LEVELS.ERROR));
+ }
+ createRecord(msg, level, format) {
+ return {
+ // If the logger is used to quickly print something, let's pretty-print
+ // it into a string.
+ msg: util.format(msg),
+ level,
+ logger: this,
+ format,
+ };
+ }
+ /**
+ * Log newlines using a logger output found via `level`.
+ *
+ * @param num The number of newlines to log.
+ * @param level The logger level. If omitted, the default output is used.
+ */
+ nl(num = 1, level) {
+ this.log({ ...this.createRecord('\n'.repeat(num), level), format: false });
+ }
+ /**
+ * Log a record using a logger output found via `level`.
+ */
+ log(record) {
+ if (typeof record.level === 'number' && this.level > record.level) {
+ return;
+ }
+ for (const handler of this.handlers) {
+ handler.handle(record);
+ }
+ }
+ createWriteStream(level, format) {
+ const self = this;
+ return new class extends stream_1.Writable {
+ _write(chunk, encoding, callback) {
+ self.log(self.createRecord(chunk.toString(), level, format));
+ callback();
+ }
+ }();
+ }
+}
+exports.Logger = Logger;
+function createTaggedFormatter({ colors = colors_1.NO_COLORS, prefix = '', tags, titleize, wrap } = {}) {
+ const { strong, weak } = colors;
+ const getLevelTag = (level) => {
+ if (!level) {
+ return '';
+ }
+ if (tags) {
+ const tag = tags.get(level);
+ return tag ? tag : '';
+ }
+ const levelName = getLoggerLevelName(level);
+ if (!levelName) {
+ return '';
+ }
+ const levelColor = getLoggerLevelColor(colors, level);
+ return `${weak('[')}\x1b[40m${strong(levelColor ? levelColor(levelName) : levelName)}\x1b[49m${weak(']')}`;
+ };
+ return ({ msg, level, format }) => {
+ if (format === false) {
+ return msg;
+ }
+ const [firstLine, ...lines] = msg.split('\n');
+ const levelColor = getLoggerLevelColor(colors, level);
+ const tag = (typeof prefix === 'function' ? prefix() : prefix) + getLevelTag(level);
+ const title = titleize && lines.length > 0 ? `${strong(levelColor ? levelColor(firstLine) : firstLine)}\n` : firstLine;
+ const indentation = tag ? utils_terminal_1.stringWidth(tag) + 1 : 0;
+ const pulledLines = titleize ? utils_1.dropWhile(lines, l => l === '') : lines;
+ return ((tag ? `${tag} ` : '') +
+ (wrap
+ ? utils_terminal_1.wordWrap([title, ...pulledLines].join('\n'), { indentation, ...(typeof wrap === 'object' ? wrap : {}) })
+ : [title, ...pulledLines.map(l => l ? ' '.repeat(indentation) + l : '')].join('\n')));
+ };
+}
+exports.createTaggedFormatter = createTaggedFormatter;
+function createPrefixedFormatter(prefix) {
+ return ({ msg, format }) => {
+ if (format === false) {
+ return msg;
+ }
+ return `${typeof prefix === 'function' ? prefix() : prefix} ${msg}`;
+ };
+}
+exports.createPrefixedFormatter = createPrefixedFormatter;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/output.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/output.d.ts
new file mode 100644
index 00000000..92261f62
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/output.d.ts
@@ -0,0 +1,40 @@
+///
+import { Colors } from './colors';
+import { TaskChain } from './tasks';
+export interface OutputStrategy {
+ readonly stream: NodeJS.WritableStream;
+ readonly colors: Colors;
+ write(msg: string): boolean;
+ createTaskChain(): TaskChain;
+}
+export interface StreamOutputStrategyOptions {
+ readonly stream?: NodeJS.WritableStream;
+ readonly colors?: Colors;
+}
+export declare class StreamOutputStrategy implements OutputStrategy {
+ readonly stream: NodeJS.WritableStream;
+ readonly colors: Colors;
+ constructor({ stream, colors }: StreamOutputStrategyOptions);
+ write(msg: string): boolean;
+ createTaskChain(): TaskChain;
+}
+export interface TTYOutputStrategyOptions extends StreamOutputStrategyOptions {
+ readonly stream?: NodeJS.WriteStream;
+}
+export declare class TTYOutputStrategy extends StreamOutputStrategy implements OutputStrategy {
+ readonly stream: NodeJS.WriteStream;
+ protected readonly redrawer: TTYOutputRedrawer;
+ constructor({ stream, colors }?: TTYOutputStrategyOptions);
+ createTaskChain(): TaskChain;
+}
+export interface TTYOutputRedrawerOptions {
+ readonly stream?: NodeJS.WriteStream;
+}
+export declare class TTYOutputRedrawer {
+ readonly stream: NodeJS.WriteStream;
+ constructor({ stream }: TTYOutputRedrawerOptions);
+ get width(): number;
+ redraw(msg: string): void;
+ clear(): void;
+ end(): void;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/output.js b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/output.js
new file mode 100644
index 00000000..b304186a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/output.js
@@ -0,0 +1,86 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.TTYOutputRedrawer = exports.TTYOutputStrategy = exports.StreamOutputStrategy = void 0;
+const utils_terminal_1 = require("@ionic/utils-terminal");
+const colors_1 = require("./colors");
+const tasks_1 = require("./tasks");
+const utils_1 = require("./utils");
+class StreamOutputStrategy {
+ constructor({ stream = process.stdout, colors = colors_1.NO_COLORS }) {
+ this.stream = stream;
+ this.colors = colors;
+ }
+ write(msg) {
+ return this.stream.write(msg);
+ }
+ createTaskChain() {
+ const { failure, success, weak } = this.colors;
+ const chain = new tasks_1.TaskChain();
+ chain.on('next', task => {
+ task.on('end', result => {
+ if (result.success) {
+ this.write(`${success(tasks_1.ICON_SUCCESS)} ${task.msg} ${weak(`in ${utils_1.formatHrTime(result.elapsedTime)}`)}\n`);
+ }
+ else {
+ this.write(`${failure(tasks_1.ICON_FAILURE)} ${task.msg} ${failure(weak('- failed!'))}\n`);
+ }
+ });
+ });
+ return chain;
+ }
+}
+exports.StreamOutputStrategy = StreamOutputStrategy;
+class TTYOutputStrategy extends StreamOutputStrategy {
+ constructor({ stream = process.stdout, colors = colors_1.NO_COLORS } = {}) {
+ super({ stream, colors });
+ this.stream = stream;
+ this.redrawer = new TTYOutputRedrawer({ stream });
+ }
+ createTaskChain() {
+ const { failure, strong, success, weak } = this.colors;
+ const chain = new tasks_1.TaskChain({ taskOptions: { tickInterval: 50 } });
+ chain.on('next', task => {
+ task.on('end', result => {
+ if (result.success) {
+ this.write(`${success(tasks_1.ICON_SUCCESS)} ${task.msg} ${weak(`in ${utils_1.formatHrTime(result.elapsedTime)}`)}\n`);
+ }
+ else {
+ this.write(`${failure(tasks_1.ICON_FAILURE)} ${task.msg} ${failure(weak('- failed!'))}\n`);
+ }
+ });
+ const spinner = new tasks_1.Spinner();
+ task.on('tick', () => {
+ const progress = task.progressRatio ? (task.progressRatio * 100).toFixed(2) : '';
+ const frame = spinner.frame();
+ this.redrawer.redraw(`${strong(frame)} ${task.msg}${progress ? ' (' + strong(String(progress) + '%') + ')' : ''} `);
+ });
+ task.on('clear', () => {
+ this.redrawer.clear();
+ });
+ });
+ chain.on('end', () => {
+ this.redrawer.end();
+ });
+ return chain;
+ }
+}
+exports.TTYOutputStrategy = TTYOutputStrategy;
+class TTYOutputRedrawer {
+ constructor({ stream = process.stdout }) {
+ this.stream = stream;
+ }
+ get width() {
+ return this.stream.columns || 80;
+ }
+ redraw(msg) {
+ utils_terminal_1.Cursor.hide();
+ this.stream.write(utils_terminal_1.EscapeCode.eraseLines(1) + msg.replace(/[\r\n]+$/, ''));
+ }
+ clear() {
+ this.stream.write(utils_terminal_1.EscapeCode.eraseLines(1));
+ }
+ end() {
+ utils_terminal_1.Cursor.show();
+ }
+}
+exports.TTYOutputRedrawer = TTYOutputRedrawer;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/tasks.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/tasks.d.ts
new file mode 100644
index 00000000..b37c19e5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/tasks.d.ts
@@ -0,0 +1,78 @@
+///
+import { EventEmitter } from 'events';
+export declare const ICON_SUCCESS: string;
+export declare const ICON_FAILURE: string;
+export declare class Spinner {
+ frames: string[];
+ i: number;
+ constructor(frames?: string[]);
+ frame(): string;
+}
+export interface TaskOptions {
+ readonly msg?: string;
+ readonly tickInterval?: number;
+}
+export interface TaskResult {
+ /**
+ * Elapsed time from process.hrtime()
+ */
+ elapsedTime: [number, number];
+ /**
+ * Whether the task succeeded or not
+ */
+ success: boolean;
+}
+export interface Task extends EventEmitter {
+ on(name: 'success', handler: () => void): this;
+ on(name: 'failure', handler: () => void): this;
+ on(name: 'clear', handler: () => void): this;
+ on(name: 'tick', handler: () => void): this;
+ on(name: 'end', handler: (result: TaskResult) => void): this;
+ emit(name: 'success'): boolean;
+ emit(name: 'failure'): boolean;
+ emit(name: 'clear'): boolean;
+ emit(name: 'tick'): boolean;
+ emit(name: 'end', result: TaskResult): boolean;
+}
+export declare class Task extends EventEmitter {
+ tickInterval?: number;
+ intervalId?: NodeJS.Timer;
+ running: boolean;
+ progressRatio?: number;
+ protected _msg: string;
+ protected _startTime?: [number, number];
+ protected _success: boolean;
+ constructor({ msg, tickInterval }?: TaskOptions);
+ get msg(): string;
+ set msg(msg: string);
+ start(): this;
+ tick(): this;
+ progress(prog: number, total: number): this;
+ clear(): this;
+ end(): this;
+ succeed(): this;
+ fail(): this;
+}
+export interface TaskChain extends EventEmitter {
+ on(name: 'end', handler: (lastTask?: Task) => void): this;
+ on(name: 'failure', handler: (failedTask?: Task) => void): this;
+ on(name: 'next', handler: (task: Task) => void): this;
+ emit(name: 'end', lastTask?: Task): boolean;
+ emit(name: 'failure', failedTask?: Task): boolean;
+ emit(name: 'next', task: Task): boolean;
+}
+export interface TaskChainOptions {
+ readonly taskOptions?: Partial;
+}
+export declare class TaskChain extends EventEmitter {
+ protected current?: Task;
+ protected readonly tasks: Task[];
+ protected readonly taskOptions: Partial;
+ constructor({ taskOptions }?: TaskChainOptions);
+ next(msg: string): Task;
+ createTask(options: TaskOptions): Task;
+ nextTask(task: Task): Task;
+ end(): this;
+ fail(): this;
+ cleanup(): this;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/tasks.js b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/tasks.js
new file mode 100644
index 00000000..21f323e4
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/tasks.js
@@ -0,0 +1,141 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.TaskChain = exports.Task = exports.Spinner = exports.ICON_FAILURE = exports.ICON_SUCCESS = void 0;
+const events_1 = require("events");
+const isWindows = process.platform === 'win32';
+exports.ICON_SUCCESS = isWindows ? '√' : '✔';
+exports.ICON_FAILURE = isWindows ? '×' : '✖';
+const SPINNER_FRAMES = isWindows ?
+ ['-', '\\', '|', '/'] :
+ ['⠋', '⠙', '⠹', '⠸', '⠼', '⠴', '⠦', '⠧', '⠇', '⠏'];
+class Spinner {
+ constructor(frames = SPINNER_FRAMES) {
+ this.frames = frames;
+ this.i = 0;
+ }
+ frame() {
+ return this.frames[this.i = ++this.i % this.frames.length];
+ }
+}
+exports.Spinner = Spinner;
+class Task extends events_1.EventEmitter {
+ constructor({ msg = '', tickInterval } = {}) {
+ super();
+ this.running = false;
+ this._msg = '';
+ this._success = false;
+ this.msg = msg;
+ this.tickInterval = tickInterval;
+ }
+ get msg() {
+ return this._msg;
+ }
+ set msg(msg) {
+ this._msg = msg;
+ this.tick();
+ }
+ start() {
+ if (!this.running && this.tickInterval) {
+ this.intervalId = setInterval(() => { this.tick(); }, this.tickInterval);
+ }
+ this.running = true;
+ this._startTime = process.hrtime();
+ return this;
+ }
+ tick() {
+ this.emit('tick');
+ return this;
+ }
+ progress(prog, total) {
+ this.progressRatio = prog / total;
+ this.tick();
+ return this;
+ }
+ clear() {
+ if (this.intervalId) {
+ clearInterval(this.intervalId);
+ this.intervalId = undefined;
+ }
+ this.emit('clear');
+ return this;
+ }
+ end() {
+ this.running = false;
+ this.tick();
+ this.clear();
+ this.emit('end', {
+ elapsedTime: process.hrtime(this._startTime),
+ success: this._success,
+ });
+ return this;
+ }
+ succeed() {
+ if (this.running) {
+ this._success = true;
+ this.end();
+ this.emit('success');
+ }
+ return this;
+ }
+ fail() {
+ if (this.running) {
+ this._success = false;
+ this.end();
+ this.emit('failure');
+ }
+ return this;
+ }
+}
+exports.Task = Task;
+class TaskChain extends events_1.EventEmitter {
+ constructor({ taskOptions = {} } = {}) {
+ super();
+ this.tasks = [];
+ this.taskOptions = taskOptions;
+ }
+ next(msg) {
+ return this.nextTask(this.createTask({ msg, ...this.taskOptions }));
+ }
+ createTask(options) {
+ return new Task(options);
+ }
+ nextTask(task) {
+ if (this.current) {
+ this.current.succeed();
+ }
+ this.tasks.push(task);
+ this.current = task;
+ task.start();
+ this.emit('next', task);
+ return task;
+ }
+ end() {
+ const task = this.current;
+ if (task) {
+ task.succeed();
+ }
+ this.current = undefined;
+ this.emit('end', task);
+ return this;
+ }
+ fail() {
+ const task = this.current;
+ if (task) {
+ task.fail();
+ }
+ this.emit('failure', task);
+ return this;
+ }
+ cleanup() {
+ for (const task of this.tasks) {
+ if (task.running) {
+ task.fail();
+ }
+ else {
+ task.clear();
+ }
+ }
+ return this;
+ }
+}
+exports.TaskChain = TaskChain;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/utils.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/utils.d.ts
new file mode 100644
index 00000000..9aa60dfd
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/utils.d.ts
@@ -0,0 +1,4 @@
+export declare function identity(v: T): T;
+export declare function enforceLF(str: string): string;
+export declare function dropWhile(array: readonly T[], predicate?: (item: T) => boolean): T[];
+export declare function formatHrTime(hrtime: [number, number]): string;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/utils.js b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/utils.js
new file mode 100644
index 00000000..7cf77aa9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/dist/utils.js
@@ -0,0 +1,39 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.formatHrTime = exports.dropWhile = exports.enforceLF = exports.identity = void 0;
+function identity(v) {
+ return v;
+}
+exports.identity = identity;
+function enforceLF(str) {
+ return str.match(/[\r\n]$/) ? str : str + '\n';
+}
+exports.enforceLF = enforceLF;
+function dropWhile(array, predicate = v => !!v) {
+ let done = false;
+ return array.filter(item => {
+ if (done) {
+ return true;
+ }
+ if (predicate(item)) {
+ return false;
+ }
+ else {
+ done = true;
+ return true;
+ }
+ });
+}
+exports.dropWhile = dropWhile;
+const TIME_UNITS = ['s', 'ms', 'μs'];
+function formatHrTime(hrtime) {
+ let time = hrtime[0] + hrtime[1] / 1e9;
+ let index = 0;
+ for (; index < TIME_UNITS.length - 1; index++, time *= 1000) {
+ if (time >= 1) {
+ break;
+ }
+ }
+ return time.toFixed(2) + TIME_UNITS[index];
+}
+exports.formatHrTime = formatHrTime;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/package.json b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/package.json
new file mode 100644
index 00000000..7d057452
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/cli-framework-output/package.json
@@ -0,0 +1,46 @@
+{
+ "name": "@ionic/cli-framework-output",
+ "version": "2.2.3",
+ "description": "The log/tasks/spinners portion of Ionic CLI Framework",
+ "homepage": "https://ionicframework.com/",
+ "author": "Ionic Team (https://ionicframework.com)",
+ "main": "./dist/index.js",
+ "types": "./dist/index.d.ts",
+ "engines": {
+ "node": ">=10.3.0"
+ },
+ "files": [
+ "dist/",
+ "LICENSE",
+ "README.md"
+ ],
+ "scripts": {
+ "clean": "rimraf dist",
+ "lint": "true",
+ "build": "npm run clean && tsc",
+ "watch": "tsc -w --preserveWatchOutput",
+ "test": "jest --maxWorkers=4",
+ "prepublishOnly": "npm run build"
+ },
+ "license": "MIT",
+ "dependencies": {
+ "@ionic/utils-terminal": "2.3.1",
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "devDependencies": {
+ "@ionic/utils-stream": "3.1.5",
+ "@types/debug": "^4.1.1",
+ "@types/inquirer": "0.0.43",
+ "@types/jest": "^26.0.10",
+ "@types/node": "~10.17.13",
+ "@types/slice-ansi": "^4.0.0",
+ "@types/wrap-ansi": "^3.0.0",
+ "jest": "^26.4.2",
+ "jest-cli": "^26.0.1",
+ "lint-staged": "^10.0.2",
+ "ts-jest": "~26.3.0",
+ "typescript": "~4.0.2"
+ },
+ "gitHead": "441df17dbec23611801945278c0c98ca58ca7d06"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/CHANGELOG.md
new file mode 100644
index 00000000..d0abd7de
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/CHANGELOG.md
@@ -0,0 +1,177 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+## [2.1.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@2.1.4...@ionic/utils-array@2.1.5) (2020-08-28)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+## [2.1.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@2.1.3...@ionic/utils-array@2.1.4) (2020-08-25)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+## [2.1.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@2.1.2...@ionic/utils-array@2.1.3) (2020-05-12)
+
+
+### Bug Fixes
+
+* pin tslib to avoid "Cannot set property pathExists" error ([689e1f0](https://github.com/ionic-team/ionic-cli/commit/689e1f038b907356ef855a067a76d4822e7072a8))
+
+
+
+
+
+## [2.1.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@2.1.1...@ionic/utils-array@2.1.2) (2020-05-06)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+## [2.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@2.1.0...@ionic/utils-array@2.1.1) (2020-03-03)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+# 2.1.0 (2020-02-11)
+
+
+### Features
+
+* **start:** add new list starter option ([#4315](https://github.com/ionic-team/ionic-cli/issues/4315)) ([1df44c1](https://github.com/ionic-team/ionic-cli/commit/1df44c1591f37b89f2b672857740edd6cb2aea67))
+
+
+
+
+
+## [2.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@2.0.1...@ionic/utils-array@2.0.2) (2020-02-10)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+## [2.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@2.0.0...@ionic/utils-array@2.0.1) (2020-02-03)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+# [2.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@1.2.2...@ionic/utils-array@2.0.0) (2020-01-25)
+
+
+### chore
+
+* require Node 10 ([5a47874](https://github.com/ionic-team/ionic-cli/commit/5a478746c074207b6dc96aa8771f04a606deb1ef))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 10.3.0 is required.
+
+
+
+
+
+## [1.2.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@1.2.1...@ionic/utils-array@1.2.2) (2019-12-05)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+## [1.2.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@1.2.0...@ionic/utils-array@1.2.1) (2019-09-18)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+# [1.2.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@1.1.1...@ionic/utils-array@1.2.0) (2019-08-28)
+
+
+### Features
+
+* **replace:** add replace item in array by index function ([011ddf7](https://github.com/ionic-team/ionic-cli/commit/011ddf7))
+* **splice:** add non-mutating splice function ([758d287](https://github.com/ionic-team/ionic-cli/commit/758d287))
+
+
+
+
+
+## [1.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@1.1.0...@ionic/utils-array@1.1.1) (2019-08-23)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+# [1.1.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@1.0.2...@ionic/utils-array@1.1.0) (2019-08-14)
+
+
+### Features
+
+* add new `move` function ([ba8da3b](https://github.com/ionic-team/ionic-cli/commit/ba8da3b))
+
+
+
+
+
+## [1.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@1.0.1...@ionic/utils-array@1.0.2) (2019-08-07)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+## [1.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@1.0.0...@ionic/utils-array@1.0.1) (2019-06-05)
+
+**Note:** Version bump only for package @ionic/utils-array
+
+
+
+
+
+# [1.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-array@0.0.1...@ionic/utils-array@1.0.0) (2019-05-29)
+
+
+### chore
+
+* require Node 8 ([5670e68](https://github.com/ionic-team/ionic-cli/commit/5670e68))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 8.9.4 is required.
+
+
+
+
+
+
+## 0.0.1 (2019-02-27)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-array
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/LICENSE b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/LICENSE
new file mode 100644
index 00000000..7c5808ce
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2017 Drifty Co
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/README.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/README.md
new file mode 100644
index 00000000..f43b97c1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/README.md
@@ -0,0 +1 @@
+# @ionic/utils-array
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/dist/index.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/dist/index.d.ts
new file mode 100644
index 00000000..0f7388e2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/dist/index.d.ts
@@ -0,0 +1,39 @@
+export declare function conform(t?: T | T[]): T[];
+export declare function concurrentFilter(array: T[], callback: (currentValue: T) => Promise): Promise;
+export declare function filter(array: T[], callback: (currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function filter(array: readonly T[], callback: (currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function map(array: T[], callback: (currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function map(array: T[], callback: (currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function map(array: readonly T[], callback: (currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function map(array: readonly T[], callback: (currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function reduce(array: T[], callback: (accumulator: T, currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function reduce(array: T[], callback: (accumulator: T, currentValue: T, currentIndex: number, array: readonly T[]) => Promise, initialValue: T): Promise;
+export declare function reduce(array: T[], callback: (accumulator: R, currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function reduce(array: T[], callback: (accumulator: U, currentValue: T, currentIndex: number, array: readonly T[]) => Promise, initialValue: U): Promise;
+export declare function reduce(array: readonly T[], callback: (accumulator: T, currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function reduce(array: readonly T[], callback: (accumulator: T, currentValue: T, currentIndex: number, array: readonly T[]) => Promise, initialValue: T): Promise;
+export declare function reduce(array: readonly T[], callback: (accumulator: R, currentValue: T, currentIndex: number, array: readonly T[]) => Promise): Promise;
+export declare function reduce(array: readonly T[], callback: (accumulator: U, currentValue: T, currentIndex: number, array: readonly T[]) => Promise, initialValue: U): Promise;
+/**
+ * Splice an array.
+ *
+ * This function will return a new array with the standard splice behavior
+ * applied. Unlike the standard array splice, the array of removed items is not
+ * returned.
+ */
+export declare function splice(array: readonly T[], start: number, deleteCount?: number, ...items: T[]): T[];
+/**
+ * Move an item in an array by index.
+ *
+ * This function will return a new array with the item in the `fromIndex`
+ * position moved to the `toIndex` position. If `fromIndex` or `toIndex` are
+ * out of bounds, the array items remain unmoved.
+ */
+export declare function move(array: readonly T[], fromIndex: number, toIndex: number): T[];
+/**
+ * Replace an item in an array by index.
+ *
+ * This function will return a new array with the item in the `index` position
+ * replaced with `item`. If `index` is out of bounds, the item is not replaced.
+ */
+export declare function replace(array: readonly T[], index: number, item: T): T[];
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/dist/index.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/dist/index.js
new file mode 100644
index 00000000..b4cfaa7d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/dist/index.js
@@ -0,0 +1,97 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.replace = exports.move = exports.splice = exports.reduce = exports.map = exports.filter = exports.concurrentFilter = exports.conform = void 0;
+function conform(t) {
+ if (typeof t === 'undefined') {
+ return [];
+ }
+ if (!Array.isArray(t)) {
+ return [t];
+ }
+ return t;
+}
+exports.conform = conform;
+async function concurrentFilter(array, callback) {
+ const mapper = async (v) => [v, await callback(v)];
+ const mapped = await Promise.all(array.map(mapper));
+ return mapped
+ .filter(([, f]) => f)
+ .map(([v]) => v);
+}
+exports.concurrentFilter = concurrentFilter;
+async function filter(array, callback) {
+ const initial = [];
+ return reduce(array, async (acc, v, i, arr) => {
+ if (await callback(v, i, arr)) {
+ acc.push(v);
+ }
+ return acc;
+ }, initial);
+}
+exports.filter = filter;
+async function map(array, callback) {
+ const initial = [];
+ return reduce(array, async (acc, v, i, arr) => {
+ acc.push(await callback(v, i, arr));
+ return acc;
+ }, initial);
+}
+exports.map = map;
+async function reduce(array, callback, initialValue) {
+ const hadInitialValue = typeof initialValue === 'undefined';
+ const startingIndex = hadInitialValue ? 1 : 0;
+ if (typeof initialValue === 'undefined') {
+ if (array.length === 0) {
+ throw new TypeError('Reduce of empty array with no initial value');
+ }
+ initialValue = array[0];
+ }
+ let value = initialValue;
+ for (let i = startingIndex; i < array.length; i++) {
+ const v = await callback(value, array[i], i, array);
+ value = v;
+ }
+ return value;
+}
+exports.reduce = reduce;
+/**
+ * Splice an array.
+ *
+ * This function will return a new array with the standard splice behavior
+ * applied. Unlike the standard array splice, the array of removed items is not
+ * returned.
+ */
+function splice(array, start, deleteCount = array.length - start, ...items) {
+ const result = [...array];
+ result.splice(start, deleteCount, ...items);
+ return result;
+}
+exports.splice = splice;
+/**
+ * Move an item in an array by index.
+ *
+ * This function will return a new array with the item in the `fromIndex`
+ * position moved to the `toIndex` position. If `fromIndex` or `toIndex` are
+ * out of bounds, the array items remain unmoved.
+ */
+function move(array, fromIndex, toIndex) {
+ const element = array[fromIndex];
+ if (fromIndex < 0 || toIndex < 0 || fromIndex >= array.length || toIndex >= array.length) {
+ return [...array];
+ }
+ return splice(splice(array, fromIndex, 1), toIndex, 0, element);
+}
+exports.move = move;
+/**
+ * Replace an item in an array by index.
+ *
+ * This function will return a new array with the item in the `index` position
+ * replaced with `item`. If `index` is out of bounds, the item is not replaced.
+ */
+function replace(array, index, item) {
+ if (index < 0 || index > array.length) {
+ return [...array];
+ }
+ return splice(array, index, 1, item);
+}
+exports.replace = replace;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/package.json b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/package.json
new file mode 100644
index 00000000..9d2897e1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-array/package.json
@@ -0,0 +1,49 @@
+{
+ "name": "@ionic/utils-array",
+ "version": "2.1.5",
+ "description": "Array utils",
+ "main": "dist/index.js",
+ "types": "dist/index.d.ts",
+ "homepage": "https://ionicframework.com/",
+ "author": "Ionic Team (https://ionic.io)",
+ "license": "MIT",
+ "engines": {
+ "node": ">=10.3.0"
+ },
+ "files": [
+ "dist/",
+ "LICENSE",
+ "README.md"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/ionic-team/ionic-cli.git"
+ },
+ "bugs": {
+ "url": "https://github.com/ionic-team/ionic-cli/issues"
+ },
+ "scripts": {
+ "clean": "rimraf dist",
+ "lint": "true",
+ "build": "npm run clean && tsc",
+ "watch": "tsc -w --preserveWatchOutput",
+ "test": "jest --maxWorkers=4",
+ "prepublishOnly": "npm run build"
+ },
+ "dependencies": {
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "devDependencies": {
+ "@types/debug": "^4.1.1",
+ "@types/jest": "^26.0.10",
+ "@types/node": "~10.17.13",
+ "jest": "^26.4.2",
+ "jest-cli": "^26.0.1",
+ "lint-staged": "^10.0.2",
+ "rimraf": "^3.0.0",
+ "ts-jest": "~26.3.0",
+ "typescript": "~4.0.2"
+ },
+ "gitHead": "f85e6db0eba47c8d97181b52d69c687c100f93fb"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/CHANGELOG.md
new file mode 100644
index 00000000..13f44ad4
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/CHANGELOG.md
@@ -0,0 +1,302 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+## [3.1.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@3.1.4...@ionic/utils-fs@3.1.5) (2020-08-28)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [3.1.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@3.1.3...@ionic/utils-fs@3.1.4) (2020-08-25)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [3.1.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@3.1.2...@ionic/utils-fs@3.1.3) (2020-05-12)
+
+
+### Bug Fixes
+
+* pin tslib to avoid "Cannot set property pathExists" error ([689e1f0](https://github.com/ionic-team/ionic-cli/commit/689e1f038b907356ef855a067a76d4822e7072a8))
+
+
+
+
+
+## [3.1.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@3.1.1...@ionic/utils-fs@3.1.2) (2020-05-06)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [3.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@3.1.0...@ionic/utils-fs@3.1.1) (2020-03-03)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+# 3.1.0 (2020-02-11)
+
+
+### Features
+
+* **start:** add new list starter option ([#4315](https://github.com/ionic-team/ionic-cli/issues/4315)) ([1df44c1](https://github.com/ionic-team/ionic-cli/commit/1df44c1591f37b89f2b672857740edd6cb2aea67))
+
+
+
+
+
+## [3.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@3.0.1...@ionic/utils-fs@3.0.2) (2020-02-10)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [3.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@3.0.0...@ionic/utils-fs@3.0.1) (2020-02-03)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+# [3.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.9...@ionic/utils-fs@3.0.0) (2020-01-25)
+
+
+### chore
+
+* require Node 10 ([5a47874](https://github.com/ionic-team/ionic-cli/commit/5a478746c074207b6dc96aa8771f04a606deb1ef))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 10.3.0 is required.
+
+
+
+
+
+## [2.0.9](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.8...@ionic/utils-fs@2.0.9) (2019-12-05)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [2.0.8](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.7...@ionic/utils-fs@2.0.8) (2019-10-14)
+
+
+### Bug Fixes
+
+* **fileToString:** handle ENOTDIR errors ([fab07d8](https://github.com/ionic-team/ionic-cli/commit/fab07d8c6e3d6756d633ada4c81165d11c70eb8f))
+
+
+
+
+
+## [2.0.7](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.6...@ionic/utils-fs@2.0.7) (2019-09-18)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [2.0.6](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.5...@ionic/utils-fs@2.0.6) (2019-08-23)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [2.0.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.4...@ionic/utils-fs@2.0.5) (2019-08-14)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [2.0.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.3...@ionic/utils-fs@2.0.4) (2019-08-07)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [2.0.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.2...@ionic/utils-fs@2.0.3) (2019-06-28)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [2.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.1...@ionic/utils-fs@2.0.2) (2019-06-10)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+## [2.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@2.0.0...@ionic/utils-fs@2.0.1) (2019-06-05)
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+
+
+
+# [2.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@1.2.0...@ionic/utils-fs@2.0.0) (2019-05-29)
+
+
+### chore
+
+* require Node 8 ([5670e68](https://github.com/ionic-team/ionic-cli/commit/5670e68))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 8.9.4 is required.
+
+
+
+
+
+
+# [1.2.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@1.1.1...@ionic/utils-fs@1.2.0) (2019-03-06)
+
+
+### Features
+
+* **fs:** add `isExecutableFile` utility ([53d9626](https://github.com/ionic-team/ionic-cli/commit/53d9626))
+* **fs:** add `pathReadable`, `pathWritable`, and `pathExecutable` ([5412791](https://github.com/ionic-team/ionic-cli/commit/5412791))
+
+
+
+
+
+## [1.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@1.1.0...@ionic/utils-fs@1.1.1) (2019-02-27)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+# [1.1.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@1.0.0...@ionic/utils-fs@1.1.0) (2019-02-15)
+
+
+### Bug Fixes
+
+* **walk:** stat symlinks themselves while walking ([92f2cee](https://github.com/ionic-team/ionic-cli/commit/92f2cee))
+
+
+### Features
+
+* **fs:** `onError` option for `readdirp` and `getFileTree` ([90bcfcd](https://github.com/ionic-team/ionic-cli/commit/90bcfcd))
+* **fs:** `onFileNode` and `onDirectoryNode` options for `getFileTree` ([1858e96](https://github.com/ionic-team/ionic-cli/commit/1858e96))
+* **fs:** add `getFileTree` for creating file tree object structures ([c14b46b](https://github.com/ionic-team/ionic-cli/commit/c14b46b))
+
+
+
+
+
+# [1.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@0.0.7...@ionic/utils-fs@1.0.0) (2019-01-08)
+
+
+### Bug Fixes
+
+* rimraf is a full dependency ([962ad94](https://github.com/ionic-team/ionic-cli/commit/962ad94))
+
+
+### Features
+
+* switch to fs-extra ([c17d8d8](https://github.com/ionic-team/ionic-cli/commit/c17d8d8))
+
+
+### BREAKING CHANGES
+
+* `readDir`, `readDirp`, `readDirSafe` were renamed to be
+consistent with fs and fs-extra. `readJsonFile` and `writeJsonFile` have
+been renamed to `readJson` and `writeJson` and use the fs-extra version
+directly. `isDir` was removed (use stat). `copyFile` and `copyDirectory`
+were removed (use `copy`). `removeDirectory` was removed (use `remove`).
+
+
+
+
+
+## [0.0.7](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@0.0.6...@ionic/utils-fs@0.0.7) (2019-01-07)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+## [0.0.6](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@0.0.5...@ionic/utils-fs@0.0.6) (2018-12-19)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+## [0.0.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@0.0.4...@ionic/utils-fs@0.0.5) (2018-11-20)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+## [0.0.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@0.0.3...@ionic/utils-fs@0.0.4) (2018-10-31)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+## [0.0.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@0.0.2...@ionic/utils-fs@0.0.3) (2018-10-05)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+## [0.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-fs@0.0.1...@ionic/utils-fs@0.0.2) (2018-10-03)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+
+## 0.0.1 (2018-09-05)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-fs
+
+# Change Log
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/LICENSE b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/LICENSE
new file mode 100644
index 00000000..7c5808ce
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2017 Drifty Co
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/README.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/README.md
new file mode 100644
index 00000000..8370453e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/README.md
@@ -0,0 +1 @@
+# @ionic/utils-fs
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/index.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/index.d.ts
new file mode 100644
index 00000000..8dc73e29
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/index.d.ts
@@ -0,0 +1,146 @@
+///
+import * as fs from 'fs-extra';
+import * as stream from 'stream';
+export * from 'fs-extra';
+export { stat as statSafe, readdir as readdirSafe } from './safe';
+export interface ReaddirPOptions {
+ /**
+ * Filter out items from the walk process from the final result.
+ *
+ * @return `true` to keep, otherwise the item is filtered out
+ */
+ readonly filter?: (item: WalkerItem) => boolean;
+ /**
+ * Called whenever an error occurs during the walk process.
+ *
+ * If excluded, the function will throw an error when first encountered.
+ */
+ readonly onError?: (err: Error) => void;
+ readonly walkerOptions?: WalkerOptions;
+}
+export declare function readdirp(dir: string, { filter, onError, walkerOptions }?: ReaddirPOptions): Promise;
+export declare const enum FileType {
+ FILE = "file",
+ DIRECTORY = "directory"
+}
+export interface RegularFileNode {
+ path: string;
+ type: FileType.FILE;
+ parent: FileNode;
+}
+export interface DirectoryNode {
+ path: string;
+ type: FileType.DIRECTORY;
+ parent?: FileNode;
+ children: FileNode[];
+}
+export declare type FileNode = RegularFileNode | DirectoryNode;
+export interface GetFileTreeOptions {
+ /**
+ * Called whenever an error occurs during the walk process.
+ *
+ * If excluded, the function will throw an error when first encountered.
+ */
+ readonly onError?: (err: Error) => void;
+ /**
+ * Called whenever a file node is added to the tree.
+ *
+ * File nodes can be supplemented by returning a new object from this
+ * function.
+ */
+ readonly onFileNode?: (node: RegularFileNode) => RegularFileNode & RE;
+ /**
+ * Called whenever a directory node is added to the tree.
+ *
+ * Directory nodes can be supplemented by returning a new object from this
+ * function.
+ */
+ readonly onDirectoryNode?: (node: DirectoryNode) => DirectoryNode & DE;
+ readonly walkerOptions?: WalkerOptions;
+}
+/**
+ * Compile and return a file tree structure.
+ *
+ * This function walks a directory structure recursively, building a nested
+ * object structure in memory that represents it. When finished, the root
+ * directory node is returned.
+ *
+ * @param dir The root directory from which to compile the file tree
+ */
+export declare function getFileTree(dir: string, { onError, onFileNode, onDirectoryNode, walkerOptions }?: GetFileTreeOptions): Promise;
+export declare function fileToString(filePath: string): Promise;
+export declare function getFileChecksum(filePath: string): Promise;
+/**
+ * Return true and cached checksums for a file by its path.
+ *
+ * Cached checksums are stored as `.md5` files next to the original file. If
+ * the cache file is missing, the cached checksum is undefined.
+ *
+ * @param p The file path
+ * @return Promise<[true checksum, cached checksum or undefined if cache file missing]>
+ */
+export declare function getFileChecksums(p: string): Promise<[string, string | undefined]>;
+/**
+ * Store a cache file containing the source file's md5 checksum hash.
+ *
+ * @param p The file path
+ * @param checksum The checksum. If excluded, the checksum is computed
+ */
+export declare function cacheFileChecksum(p: string, checksum?: string): Promise;
+export declare function writeStreamToFile(stream: NodeJS.ReadableStream, destination: string): Promise;
+export declare function pathAccessible(filePath: string, mode: number): Promise;
+export declare function pathExists(filePath: string): Promise;
+export declare function pathReadable(filePath: string): Promise;
+export declare function pathWritable(filePath: string): Promise;
+export declare function pathExecutable(filePath: string): Promise;
+export declare function isExecutableFile(filePath: string): Promise;
+/**
+ * Find the base directory based on the path given and a marker file to look for.
+ */
+export declare function findBaseDirectory(dir: string, file: string): Promise;
+/**
+ * Generate a random file path within the computer's temporary directory.
+ *
+ * @param prefix Optionally provide a filename prefix.
+ */
+export declare function tmpfilepath(prefix?: string): string;
+/**
+ * Given an absolute system path, compile an array of paths working backwards
+ * one directory at a time, always ending in the root directory.
+ *
+ * For example, `'/some/dir'` => `['/some/dir', '/some', '/']`
+ *
+ * @param filePath Absolute system base path.
+ */
+export declare function compilePaths(filePath: string): string[];
+export interface WalkerItem {
+ path: string;
+ stats: fs.Stats;
+}
+export interface WalkerOptions {
+ /**
+ * Filter out file paths during walk.
+ *
+ * As the file tree is walked, this function can be used to exclude files and
+ * directories from the final result.
+ *
+ * It can also be used to tune performance. If a subdirectory is excluded, it
+ * is not walked.
+ *
+ * @param p The file path.
+ * @return `true` to include file path, otherwise it is excluded
+ */
+ readonly pathFilter?: (p: string) => boolean;
+}
+export interface Walker extends stream.Readable {
+ on(event: 'data', callback: (item: WalkerItem) => void): this;
+ on(event: string, callback: (...args: any[]) => any): this;
+}
+export declare class Walker extends stream.Readable {
+ readonly p: string;
+ readonly options: WalkerOptions;
+ readonly paths: string[];
+ constructor(p: string, options?: WalkerOptions);
+ _read(): void;
+}
+export declare function walk(p: string, options?: WalkerOptions): Walker;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/index.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/index.js
new file mode 100644
index 00000000..4da8417d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/index.js
@@ -0,0 +1,286 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.walk = exports.Walker = exports.compilePaths = exports.tmpfilepath = exports.findBaseDirectory = exports.isExecutableFile = exports.pathExecutable = exports.pathWritable = exports.pathReadable = exports.pathExists = exports.pathAccessible = exports.writeStreamToFile = exports.cacheFileChecksum = exports.getFileChecksums = exports.getFileChecksum = exports.fileToString = exports.getFileTree = exports.readdirp = exports.readdirSafe = exports.statSafe = void 0;
+const tslib_1 = require("tslib");
+const fs = require("fs-extra");
+const os = require("os");
+const path = require("path");
+const stream = require("stream");
+const safe = require("./safe");
+tslib_1.__exportStar(require("fs-extra"), exports);
+var safe_1 = require("./safe");
+Object.defineProperty(exports, "statSafe", { enumerable: true, get: function () { return safe_1.stat; } });
+Object.defineProperty(exports, "readdirSafe", { enumerable: true, get: function () { return safe_1.readdir; } });
+async function readdirp(dir, { filter, onError, walkerOptions } = {}) {
+ return new Promise((resolve, reject) => {
+ const items = [];
+ let rs = walk(dir, walkerOptions);
+ if (filter) {
+ rs = rs.pipe(new stream.Transform({
+ objectMode: true,
+ transform(obj, enc, cb) {
+ if (!filter || filter(obj)) {
+ this.push(obj);
+ }
+ cb();
+ },
+ }));
+ }
+ rs
+ .on('error', (err) => onError ? onError(err) : reject(err))
+ .on('data', (item) => items.push(item.path))
+ .on('end', () => resolve(items));
+ });
+}
+exports.readdirp = readdirp;
+/**
+ * Compile and return a file tree structure.
+ *
+ * This function walks a directory structure recursively, building a nested
+ * object structure in memory that represents it. When finished, the root
+ * directory node is returned.
+ *
+ * @param dir The root directory from which to compile the file tree
+ */
+async function getFileTree(dir, { onError, onFileNode = n => n, onDirectoryNode = n => n, walkerOptions } = {}) {
+ const fileMap = new Map([]);
+ const getOrCreateParent = (item) => {
+ const parentPath = path.dirname(item.path);
+ const parent = fileMap.get(parentPath);
+ if (parent && parent.type === "directory" /* DIRECTORY */) {
+ return parent;
+ }
+ return onDirectoryNode({ path: parentPath, type: "directory" /* DIRECTORY */, children: [] });
+ };
+ const createFileNode = (item, parent) => {
+ const node = { path: item.path, parent };
+ return item.stats.isDirectory() ?
+ onDirectoryNode({ ...node, type: "directory" /* DIRECTORY */, children: [] }) :
+ onFileNode({ ...node, type: "file" /* FILE */ });
+ };
+ return new Promise((resolve, reject) => {
+ dir = path.resolve(dir);
+ const rs = walk(dir, walkerOptions);
+ rs
+ .on('error', err => onError ? onError(err) : reject(err))
+ .on('data', item => {
+ const parent = getOrCreateParent(item);
+ const node = createFileNode(item, parent);
+ parent.children.push(node);
+ fileMap.set(item.path, node);
+ fileMap.set(parent.path, parent);
+ })
+ .on('end', () => {
+ const root = fileMap.get(dir);
+ if (!root) {
+ return reject(new Error('No root node found after walking directory structure.'));
+ }
+ delete root.parent;
+ resolve(root);
+ });
+ });
+}
+exports.getFileTree = getFileTree;
+async function fileToString(filePath) {
+ try {
+ return await fs.readFile(filePath, { encoding: 'utf8' });
+ }
+ catch (e) {
+ if (e.code === 'ENOENT' || e.code === 'ENOTDIR') {
+ return '';
+ }
+ throw e;
+ }
+}
+exports.fileToString = fileToString;
+async function getFileChecksum(filePath) {
+ const crypto = await Promise.resolve().then(() => require('crypto'));
+ return new Promise((resolve, reject) => {
+ const hash = crypto.createHash('md5');
+ const input = fs.createReadStream(filePath);
+ input.on('error', (err) => {
+ reject(err);
+ });
+ hash.once('readable', () => {
+ const fullChecksum = hash.read().toString('hex');
+ resolve(fullChecksum);
+ });
+ input.pipe(hash);
+ });
+}
+exports.getFileChecksum = getFileChecksum;
+/**
+ * Return true and cached checksums for a file by its path.
+ *
+ * Cached checksums are stored as `.md5` files next to the original file. If
+ * the cache file is missing, the cached checksum is undefined.
+ *
+ * @param p The file path
+ * @return Promise<[true checksum, cached checksum or undefined if cache file missing]>
+ */
+async function getFileChecksums(p) {
+ return Promise.all([
+ getFileChecksum(p),
+ (async () => {
+ try {
+ const md5 = await fs.readFile(`${p}.md5`, { encoding: 'utf8' });
+ return md5.trim();
+ }
+ catch (e) {
+ if (e.code !== 'ENOENT') {
+ throw e;
+ }
+ }
+ })(),
+ ]);
+}
+exports.getFileChecksums = getFileChecksums;
+/**
+ * Store a cache file containing the source file's md5 checksum hash.
+ *
+ * @param p The file path
+ * @param checksum The checksum. If excluded, the checksum is computed
+ */
+async function cacheFileChecksum(p, checksum) {
+ const md5 = await getFileChecksum(p);
+ await fs.writeFile(`${p}.md5`, md5, { encoding: 'utf8' });
+}
+exports.cacheFileChecksum = cacheFileChecksum;
+function writeStreamToFile(stream, destination) {
+ return new Promise((resolve, reject) => {
+ const dest = fs.createWriteStream(destination);
+ stream.pipe(dest);
+ dest.on('error', reject);
+ dest.on('finish', resolve);
+ });
+}
+exports.writeStreamToFile = writeStreamToFile;
+async function pathAccessible(filePath, mode) {
+ try {
+ await fs.access(filePath, mode);
+ }
+ catch (e) {
+ return false;
+ }
+ return true;
+}
+exports.pathAccessible = pathAccessible;
+async function pathExists(filePath) {
+ return pathAccessible(filePath, fs.constants.F_OK);
+}
+exports.pathExists = pathExists;
+async function pathReadable(filePath) {
+ return pathAccessible(filePath, fs.constants.R_OK);
+}
+exports.pathReadable = pathReadable;
+async function pathWritable(filePath) {
+ return pathAccessible(filePath, fs.constants.W_OK);
+}
+exports.pathWritable = pathWritable;
+async function pathExecutable(filePath) {
+ return pathAccessible(filePath, fs.constants.X_OK);
+}
+exports.pathExecutable = pathExecutable;
+async function isExecutableFile(filePath) {
+ const [stats, executable] = await (Promise.all([
+ safe.stat(filePath),
+ pathExecutable(filePath),
+ ]));
+ return !!stats && (stats.isFile() || stats.isSymbolicLink()) && executable;
+}
+exports.isExecutableFile = isExecutableFile;
+/**
+ * Find the base directory based on the path given and a marker file to look for.
+ */
+async function findBaseDirectory(dir, file) {
+ if (!dir || !file) {
+ return;
+ }
+ for (const d of compilePaths(dir)) {
+ const results = await safe.readdir(d);
+ if (results.includes(file)) {
+ return d;
+ }
+ }
+}
+exports.findBaseDirectory = findBaseDirectory;
+/**
+ * Generate a random file path within the computer's temporary directory.
+ *
+ * @param prefix Optionally provide a filename prefix.
+ */
+function tmpfilepath(prefix) {
+ const rn = Math.random().toString(16).substring(2, 8);
+ const p = path.resolve(os.tmpdir(), prefix ? `${prefix}-${rn}` : rn);
+ return p;
+}
+exports.tmpfilepath = tmpfilepath;
+/**
+ * Given an absolute system path, compile an array of paths working backwards
+ * one directory at a time, always ending in the root directory.
+ *
+ * For example, `'/some/dir'` => `['/some/dir', '/some', '/']`
+ *
+ * @param filePath Absolute system base path.
+ */
+function compilePaths(filePath) {
+ filePath = path.normalize(filePath);
+ if (!path.isAbsolute(filePath)) {
+ throw new Error(`${filePath} is not an absolute path`);
+ }
+ const parsed = path.parse(filePath);
+ if (filePath === parsed.root) {
+ return [filePath];
+ }
+ return filePath
+ .slice(parsed.root.length)
+ .split(path.sep)
+ .map((segment, i, array) => parsed.root + path.join(...array.slice(0, array.length - i)))
+ .concat(parsed.root);
+}
+exports.compilePaths = compilePaths;
+class Walker extends stream.Readable {
+ constructor(p, options = {}) {
+ super({ objectMode: true });
+ this.p = p;
+ this.options = options;
+ this.paths = [this.p];
+ }
+ _read() {
+ const p = this.paths.shift();
+ const { pathFilter } = this.options;
+ if (!p) {
+ this.push(null);
+ return;
+ }
+ fs.lstat(p, (err, stats) => {
+ if (err) {
+ this.emit('error', err);
+ return;
+ }
+ const item = { path: p, stats };
+ if (stats.isDirectory()) {
+ fs.readdir(p, (err, contents) => {
+ if (err) {
+ this.emit('error', err);
+ return;
+ }
+ let paths = contents.map(file => path.join(p, file));
+ if (pathFilter) {
+ paths = paths.filter(p => pathFilter(p.substring(this.p.length + 1)));
+ }
+ this.paths.push(...paths);
+ this.push(item);
+ });
+ }
+ else {
+ this.push(item);
+ }
+ });
+ }
+}
+exports.Walker = Walker;
+function walk(p, options = {}) {
+ return new Walker(p, options);
+}
+exports.walk = walk;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/safe.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/safe.d.ts
new file mode 100644
index 00000000..e891d2e0
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/safe.d.ts
@@ -0,0 +1,4 @@
+///
+import * as fs from 'fs-extra';
+export declare function stat(p: string): Promise;
+export declare function readdir(dir: string): Promise;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/safe.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/safe.js
new file mode 100644
index 00000000..79befb89
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/dist/safe.js
@@ -0,0 +1,22 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.readdir = exports.stat = void 0;
+const fs = require("fs-extra");
+async function stat(p) {
+ try {
+ return await fs.stat(p);
+ }
+ catch (e) {
+ // ignore
+ }
+}
+exports.stat = stat;
+async function readdir(dir) {
+ try {
+ return await fs.readdir(dir);
+ }
+ catch (e) {
+ return [];
+ }
+}
+exports.readdir = readdir;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/package.json b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/package.json
new file mode 100644
index 00000000..44689eaa
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-fs/package.json
@@ -0,0 +1,51 @@
+{
+ "name": "@ionic/utils-fs",
+ "version": "3.1.5",
+ "description": "Filesystem utils for Node",
+ "main": "dist/index.js",
+ "types": "dist/index.d.ts",
+ "homepage": "https://ionicframework.com/",
+ "author": "Ionic Team (https://ionic.io)",
+ "license": "MIT",
+ "engines": {
+ "node": ">=10.3.0"
+ },
+ "files": [
+ "dist/",
+ "LICENSE",
+ "README.md"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/ionic-team/ionic-cli.git"
+ },
+ "bugs": {
+ "url": "https://github.com/ionic-team/ionic-cli/issues"
+ },
+ "scripts": {
+ "clean": "rimraf dist",
+ "lint": "true",
+ "build": "npm run clean && tsc",
+ "watch": "tsc -w --preserveWatchOutput",
+ "test": "jest --maxWorkers=4",
+ "prepublishOnly": "npm run build"
+ },
+ "dependencies": {
+ "debug": "^4.0.0",
+ "fs-extra": "^9.0.0",
+ "tslib": "^2.0.1"
+ },
+ "devDependencies": {
+ "@types/debug": "^4.1.1",
+ "@types/fs-extra": "^8.0.0",
+ "@types/jest": "^26.0.10",
+ "@types/node": "~10.17.13",
+ "jest": "^26.4.2",
+ "jest-cli": "^26.0.1",
+ "lint-staged": "^10.0.2",
+ "rimraf": "^3.0.0",
+ "ts-jest": "~26.3.0",
+ "typescript": "~4.0.2"
+ },
+ "gitHead": "f85e6db0eba47c8d97181b52d69c687c100f93fb"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/CHANGELOG.md
new file mode 100644
index 00000000..17497525
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/CHANGELOG.md
@@ -0,0 +1,162 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+## [2.1.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@2.1.4...@ionic/utils-object@2.1.5) (2020-08-28)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+## [2.1.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@2.1.3...@ionic/utils-object@2.1.4) (2020-08-25)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+## [2.1.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@2.1.2...@ionic/utils-object@2.1.3) (2020-05-12)
+
+
+### Bug Fixes
+
+* pin tslib to avoid "Cannot set property pathExists" error ([689e1f0](https://github.com/ionic-team/ionic-cli/commit/689e1f038b907356ef855a067a76d4822e7072a8))
+
+
+
+
+
+## [2.1.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@2.1.1...@ionic/utils-object@2.1.2) (2020-05-06)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+## [2.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@2.1.0...@ionic/utils-object@2.1.1) (2020-03-03)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+# 2.1.0 (2020-02-11)
+
+
+### Features
+
+* **start:** add new list starter option ([#4315](https://github.com/ionic-team/ionic-cli/issues/4315)) ([1df44c1](https://github.com/ionic-team/ionic-cli/commit/1df44c1591f37b89f2b672857740edd6cb2aea67))
+
+
+
+
+
+## [2.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@2.0.1...@ionic/utils-object@2.0.2) (2020-02-10)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+## [2.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@2.0.0...@ionic/utils-object@2.0.1) (2020-02-03)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+# [2.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@1.0.6...@ionic/utils-object@2.0.0) (2020-01-25)
+
+
+### chore
+
+* require Node 10 ([5a47874](https://github.com/ionic-team/ionic-cli/commit/5a478746c074207b6dc96aa8771f04a606deb1ef))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 10.3.0 is required.
+
+
+
+
+
+## [1.0.6](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@1.0.5...@ionic/utils-object@1.0.6) (2019-12-05)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+## [1.0.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@1.0.4...@ionic/utils-object@1.0.5) (2019-09-18)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+## [1.0.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@1.0.3...@ionic/utils-object@1.0.4) (2019-08-23)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+## [1.0.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@1.0.2...@ionic/utils-object@1.0.3) (2019-08-14)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+## [1.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@1.0.1...@ionic/utils-object@1.0.2) (2019-08-07)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+## [1.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@1.0.0...@ionic/utils-object@1.0.1) (2019-06-05)
+
+**Note:** Version bump only for package @ionic/utils-object
+
+
+
+
+
+# [1.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-object@0.0.1...@ionic/utils-object@1.0.0) (2019-05-29)
+
+
+### chore
+
+* require Node 8 ([5670e68](https://github.com/ionic-team/ionic-cli/commit/5670e68))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 8.9.4 is required.
+
+
+
+
+
+
+## 0.0.1 (2019-02-27)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-object
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/LICENSE b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/LICENSE
new file mode 100644
index 00000000..7c5808ce
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2017 Drifty Co
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/README.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/README.md
new file mode 100644
index 00000000..08999f96
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/README.md
@@ -0,0 +1 @@
+# @ionic/utils-object
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/dist/index.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/dist/index.d.ts
new file mode 100644
index 00000000..cd1d061a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/dist/index.d.ts
@@ -0,0 +1,10 @@
+export declare function createCaseInsensitiveObject(): {
+ [key: string]: T;
+};
+export declare const CaseInsensitiveProxyHandler: ProxyHandler;
+export declare type AliasedMapKey = string | symbol;
+export declare class AliasedMap extends Map {
+ getAliases(): Map;
+ resolveAlias(key: AliasedMapKey | K): V | undefined;
+ keysWithoutAliases(): K[];
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/dist/index.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/dist/index.js
new file mode 100644
index 00000000..62ccb67f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/dist/index.js
@@ -0,0 +1,49 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.AliasedMap = exports.CaseInsensitiveProxyHandler = exports.createCaseInsensitiveObject = void 0;
+function createCaseInsensitiveObject() {
+ return new Proxy({}, exports.CaseInsensitiveProxyHandler);
+}
+exports.createCaseInsensitiveObject = createCaseInsensitiveObject;
+exports.CaseInsensitiveProxyHandler = {
+ has: (obj, prop) => {
+ return conformPropertyKey(prop) in obj;
+ },
+ get: (obj, prop) => {
+ return obj[conformPropertyKey(prop)];
+ },
+ set: (obj, prop, value) => {
+ obj[conformPropertyKey(prop)] = value;
+ return true;
+ },
+ deleteProperty: (obj, prop) => {
+ return delete obj[conformPropertyKey(prop)];
+ },
+};
+const conformPropertyKey = (prop) => typeof prop === 'string' ? prop.toLowerCase() : prop;
+class AliasedMap extends Map {
+ getAliases() {
+ const aliasmap = new Map();
+ // TODO: waiting for https://github.com/Microsoft/TypeScript/issues/18562
+ const aliases = [...this.entries()].filter(([, v]) => typeof v === 'string' || typeof v === 'symbol');
+ aliases.forEach(([alias, cmd]) => {
+ const cmdaliases = aliasmap.get(cmd) || [];
+ cmdaliases.push(alias);
+ aliasmap.set(cmd, cmdaliases);
+ });
+ return aliasmap;
+ }
+ resolveAlias(key) {
+ const r = this.get(key);
+ if (typeof r !== 'string' && typeof r !== 'symbol') {
+ return r;
+ }
+ return this.resolveAlias(r);
+ }
+ keysWithoutAliases() {
+ return [...this.entries()]
+ .filter((entry) => typeof entry[1] !== 'string' && typeof entry[1] !== 'symbol')
+ .map(([k, v]) => k);
+ }
+}
+exports.AliasedMap = AliasedMap;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/package.json b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/package.json
new file mode 100644
index 00000000..54c993e0
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-object/package.json
@@ -0,0 +1,49 @@
+{
+ "name": "@ionic/utils-object",
+ "version": "2.1.5",
+ "description": "Object utils",
+ "main": "dist/index.js",
+ "types": "dist/index.d.ts",
+ "homepage": "https://ionicframework.com/",
+ "author": "Ionic Team (https://ionic.io)",
+ "license": "MIT",
+ "engines": {
+ "node": ">=10.3.0"
+ },
+ "files": [
+ "dist/",
+ "LICENSE",
+ "README.md"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/ionic-team/ionic-cli.git"
+ },
+ "bugs": {
+ "url": "https://github.com/ionic-team/ionic-cli/issues"
+ },
+ "scripts": {
+ "clean": "rimraf dist",
+ "lint": "true",
+ "build": "npm run clean && tsc",
+ "watch": "tsc -w --preserveWatchOutput",
+ "test": "jest --maxWorkers=4",
+ "prepublishOnly": "npm run build"
+ },
+ "dependencies": {
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "devDependencies": {
+ "@types/debug": "^4.1.1",
+ "@types/jest": "^26.0.10",
+ "@types/node": "~10.17.13",
+ "jest": "^26.4.2",
+ "jest-cli": "^26.0.1",
+ "lint-staged": "^10.0.2",
+ "rimraf": "^3.0.0",
+ "ts-jest": "~26.3.0",
+ "typescript": "~4.0.2"
+ },
+ "gitHead": "f85e6db0eba47c8d97181b52d69c687c100f93fb"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/CHANGELOG.md
new file mode 100644
index 00000000..6290db0c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/CHANGELOG.md
@@ -0,0 +1,229 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+## [2.1.8](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.1.7...@ionic/utils-process@2.1.8) (2020-09-29)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [2.1.7](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.1.6...@ionic/utils-process@2.1.7) (2020-09-24)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [2.1.6](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.1.5...@ionic/utils-process@2.1.6) (2020-08-28)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [2.1.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.1.4...@ionic/utils-process@2.1.5) (2020-08-27)
+
+
+### Bug Fixes
+
+* **onExit:** switch to signal-exit implementation ([95521e2](https://github.com/ionic-team/ionic-cli/commit/95521e2d4d47795020dc20b53bd4ce99e87e4f73))
+
+
+
+
+
+## [2.1.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.1.3...@ionic/utils-process@2.1.4) (2020-08-25)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [2.1.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.1.2...@ionic/utils-process@2.1.3) (2020-05-12)
+
+
+### Bug Fixes
+
+* pin tslib to avoid "Cannot set property pathExists" error ([689e1f0](https://github.com/ionic-team/ionic-cli/commit/689e1f038b907356ef855a067a76d4822e7072a8))
+
+
+
+
+
+## [2.1.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.1.1...@ionic/utils-process@2.1.2) (2020-05-06)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [2.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.1.0...@ionic/utils-process@2.1.1) (2020-03-03)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+# 2.1.0 (2020-02-11)
+
+
+### Features
+
+* **start:** add new list starter option ([#4315](https://github.com/ionic-team/ionic-cli/issues/4315)) ([1df44c1](https://github.com/ionic-team/ionic-cli/commit/1df44c1591f37b89f2b672857740edd6cb2aea67))
+
+
+
+
+
+## [2.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.0.1...@ionic/utils-process@2.0.2) (2020-02-10)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [2.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@2.0.0...@ionic/utils-process@2.0.1) (2020-02-03)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+# [2.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.9...@ionic/utils-process@2.0.0) (2020-01-25)
+
+
+### chore
+
+* require Node 10 ([5a47874](https://github.com/ionic-team/ionic-cli/commit/5a478746c074207b6dc96aa8771f04a606deb1ef))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 10.3.0 is required.
+
+
+
+
+
+## [1.0.9](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.8...@ionic/utils-process@1.0.9) (2020-01-13)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [1.0.8](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.7...@ionic/utils-process@1.0.8) (2019-12-10)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [1.0.7](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.6...@ionic/utils-process@1.0.7) (2019-12-05)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [1.0.6](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.5...@ionic/utils-process@1.0.6) (2019-11-21)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [1.0.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.4...@ionic/utils-process@1.0.5) (2019-09-18)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [1.0.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.3...@ionic/utils-process@1.0.4) (2019-08-23)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [1.0.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.2...@ionic/utils-process@1.0.3) (2019-08-14)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [1.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.1...@ionic/utils-process@1.0.2) (2019-08-07)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+## [1.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@1.0.0...@ionic/utils-process@1.0.1) (2019-06-05)
+
+**Note:** Version bump only for package @ionic/utils-process
+
+
+
+
+
+# [1.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@0.1.0...@ionic/utils-process@1.0.0) (2019-05-29)
+
+
+### Bug Fixes
+
+* **process:** re-raise captured signals ([d82bfde](https://github.com/ionic-team/ionic-cli/commit/d82bfde))
+
+
+### chore
+
+* require Node 8 ([5670e68](https://github.com/ionic-team/ionic-cli/commit/5670e68))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 8.9.4 is required.
+
+
+
+
+
+
+# [0.1.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-process@0.0.1...@ionic/utils-process@0.1.0) (2019-03-06)
+
+
+### Features
+
+* **process:** add `getPathParts` to split path into parts ([7dfbbc2](https://github.com/ionic-team/ionic-cli/commit/7dfbbc2))
+
+
+
+
+
+## 0.0.1 (2019-02-27)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-process
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/LICENSE b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/LICENSE
new file mode 100644
index 00000000..7c5808ce
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2017 Drifty Co
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/README.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/README.md
new file mode 100644
index 00000000..b4f5a776
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/README.md
@@ -0,0 +1 @@
+# @ionic/utils-process
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/dist/index.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/dist/index.d.ts
new file mode 100644
index 00000000..41e2e189
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/dist/index.d.ts
@@ -0,0 +1,63 @@
+///
+export declare const ERROR_TIMEOUT_REACHED: Error;
+export declare function killProcessTree(pid: number, signal?: string | number): Promise;
+/**
+ * Creates an alternative implementation of `process.env` object.
+ *
+ * On a Windows shell, `process.env` is a magic object that offers
+ * case-insensitive environment variable access. On other platforms, case
+ * sensitivity matters. This method creates an empty "`process.env`" object
+ * type that works for all platforms.
+ */
+export declare function createProcessEnv(...sources: {
+ [key: string]: string | undefined;
+}[]): NodeJS.ProcessEnv;
+/**
+ * Split a PATH string into path parts.
+ */
+export declare function getPathParts(envpath?: string): string[];
+/**
+ * Resolves when the given amount of milliseconds has passed.
+ */
+export declare function sleep(ms: number): Promise;
+/**
+ * Resolves when a given predicate is true or a timeout is reached.
+ *
+ * Configure `interval` to set how often the `predicate` is called.
+ *
+ * By default, `timeout` is Infinity. If given a value (in ms), and that
+ * timeout value is reached, this function will reject with
+ * the `ERROR_TIMEOUT_REACHED` error.
+ */
+export declare function sleepUntil(predicate: () => boolean, { interval, timeout }: {
+ interval?: number;
+ timeout?: number;
+}): Promise;
+/**
+ * Never resolves and keeps Node running.
+ */
+export declare function sleepForever(): Promise;
+/**
+ * Register a synchronous function to be called once the process exits.
+ */
+export declare function onExit(fn: () => void): void;
+export declare type ExitFn = () => Promise;
+/**
+ * Register an asynchronous function to be called when the process wants to
+ * exit.
+ *
+ * A handler will be registered for the 'SIGINT', 'SIGTERM', 'SIGHUP',
+ * 'SIGBREAK' signals. If any of the signal events is emitted, `fn` will be
+ * called exactly once, awaited upon, and then the process will exit once all
+ * registered functions are resolved.
+ */
+export declare function onBeforeExit(fn: ExitFn): void;
+/**
+ * Remove a function that was registered with `onBeforeExit`.
+ */
+export declare function offBeforeExit(fn: ExitFn): void;
+/**
+ * Asynchronous `process.exit()`, for running functions registered with
+ * `onBeforeExit`.
+ */
+export declare function processExit(exitCode?: number): Promise;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/dist/index.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/dist/index.js
new file mode 100644
index 00000000..f7ef96b2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/dist/index.js
@@ -0,0 +1,158 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.processExit = exports.offBeforeExit = exports.onBeforeExit = exports.onExit = exports.sleepForever = exports.sleepUntil = exports.sleep = exports.getPathParts = exports.createProcessEnv = exports.killProcessTree = exports.ERROR_TIMEOUT_REACHED = void 0;
+const utils_object_1 = require("@ionic/utils-object");
+const utils_terminal_1 = require("@ionic/utils-terminal");
+const Debug = require("debug");
+const pathlib = require("path");
+const onSignalExit = require("signal-exit");
+const kill = require("tree-kill");
+const debug = Debug('ionic:utils-process');
+exports.ERROR_TIMEOUT_REACHED = new Error('TIMEOUT_REACHED');
+function killProcessTree(pid, signal = 'SIGTERM') {
+ return new Promise((resolve, reject) => {
+ kill(pid, signal, err => {
+ if (err) {
+ debug('error while killing process tree for %d: %O', pid, err);
+ return reject(err);
+ }
+ resolve();
+ });
+ });
+}
+exports.killProcessTree = killProcessTree;
+/**
+ * Creates an alternative implementation of `process.env` object.
+ *
+ * On a Windows shell, `process.env` is a magic object that offers
+ * case-insensitive environment variable access. On other platforms, case
+ * sensitivity matters. This method creates an empty "`process.env`" object
+ * type that works for all platforms.
+ */
+function createProcessEnv(...sources) {
+ return Object.assign(utils_terminal_1.TERMINAL_INFO.windows ? utils_object_1.createCaseInsensitiveObject() : {}, ...sources);
+}
+exports.createProcessEnv = createProcessEnv;
+/**
+ * Split a PATH string into path parts.
+ */
+function getPathParts(envpath = process.env.PATH || '') {
+ return envpath.split(pathlib.delimiter);
+}
+exports.getPathParts = getPathParts;
+/**
+ * Resolves when the given amount of milliseconds has passed.
+ */
+async function sleep(ms) {
+ return new Promise(resolve => {
+ setTimeout(resolve, ms);
+ });
+}
+exports.sleep = sleep;
+/**
+ * Resolves when a given predicate is true or a timeout is reached.
+ *
+ * Configure `interval` to set how often the `predicate` is called.
+ *
+ * By default, `timeout` is Infinity. If given a value (in ms), and that
+ * timeout value is reached, this function will reject with
+ * the `ERROR_TIMEOUT_REACHED` error.
+ */
+async function sleepUntil(predicate, { interval = 30, timeout = Infinity }) {
+ let ms = 0;
+ while (!predicate()) {
+ await sleep(interval);
+ ms += interval;
+ if (ms > timeout) {
+ throw exports.ERROR_TIMEOUT_REACHED;
+ }
+ }
+}
+exports.sleepUntil = sleepUntil;
+/**
+ * Never resolves and keeps Node running.
+ */
+async function sleepForever() {
+ return new Promise(() => {
+ setInterval(() => { }, 1000);
+ });
+}
+exports.sleepForever = sleepForever;
+/**
+ * Register a synchronous function to be called once the process exits.
+ */
+function onExit(fn) {
+ onSignalExit(() => {
+ debug('onExit: process.exit/normal shutdown');
+ fn();
+ });
+}
+exports.onExit = onExit;
+const exitFns = new Set();
+/**
+ * Register an asynchronous function to be called when the process wants to
+ * exit.
+ *
+ * A handler will be registered for the 'SIGINT', 'SIGTERM', 'SIGHUP',
+ * 'SIGBREAK' signals. If any of the signal events is emitted, `fn` will be
+ * called exactly once, awaited upon, and then the process will exit once all
+ * registered functions are resolved.
+ */
+function onBeforeExit(fn) {
+ exitFns.add(fn);
+}
+exports.onBeforeExit = onBeforeExit;
+/**
+ * Remove a function that was registered with `onBeforeExit`.
+ */
+function offBeforeExit(fn) {
+ exitFns.delete(fn);
+}
+exports.offBeforeExit = offBeforeExit;
+const once = (fn) => {
+ let called = false;
+ return async () => {
+ if (!called) {
+ await fn();
+ called = true;
+ }
+ };
+};
+const beforeExitHandlerWrapper = (signal) => once(async () => {
+ debug('onBeforeExit handler: %O received', signal);
+ debug('onBeforeExit handler: running %O functions', exitFns.size);
+ await Promise.all([...exitFns.values()].map(async (fn) => {
+ try {
+ await fn();
+ }
+ catch (e) {
+ debug('onBeforeExit handler: error from function: %O', e);
+ }
+ }));
+ if (signal !== 'process.exit') {
+ debug('onBeforeExit handler: killing self (exit code %O, signal %O)', process.exitCode ? process.exitCode : 0, signal);
+ process.removeListener(signal, BEFORE_EXIT_SIGNAL_LISTENERS[signal]);
+ process.kill(process.pid, signal);
+ }
+});
+const BEFORE_EXIT_SIGNAL_LISTENERS = {
+ SIGINT: beforeExitHandlerWrapper('SIGINT'),
+ SIGTERM: beforeExitHandlerWrapper('SIGTERM'),
+ SIGHUP: beforeExitHandlerWrapper('SIGHUP'),
+ SIGBREAK: beforeExitHandlerWrapper('SIGBREAK'),
+};
+for (const [signal, fn] of Object.entries(BEFORE_EXIT_SIGNAL_LISTENERS)) {
+ process.on(signal, fn);
+}
+const processExitHandler = beforeExitHandlerWrapper('process.exit');
+/**
+ * Asynchronous `process.exit()`, for running functions registered with
+ * `onBeforeExit`.
+ */
+async function processExit(exitCode = 0) {
+ process.exitCode = exitCode;
+ await processExitHandler();
+ debug('processExit: exiting (exit code: %O)', process.exitCode);
+ process.exit();
+}
+exports.processExit = processExit;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/package.json b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/package.json
new file mode 100644
index 00000000..86ff0d97
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-process/package.json
@@ -0,0 +1,54 @@
+{
+ "name": "@ionic/utils-process",
+ "version": "2.1.8",
+ "description": "Process utils for NodeJS",
+ "main": "dist/index.js",
+ "types": "dist/index.d.ts",
+ "homepage": "https://ionicframework.com/",
+ "author": "Ionic Team (https://ionic.io)",
+ "license": "MIT",
+ "engines": {
+ "node": ">=10.3.0"
+ },
+ "files": [
+ "dist/",
+ "LICENSE",
+ "README.md"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/ionic-team/ionic-cli.git"
+ },
+ "bugs": {
+ "url": "https://github.com/ionic-team/ionic-cli/issues"
+ },
+ "scripts": {
+ "clean": "rimraf dist",
+ "lint": "true",
+ "build": "npm run clean && tsc",
+ "watch": "tsc -w --preserveWatchOutput",
+ "test": "jest --maxWorkers=4",
+ "prepublishOnly": "npm run build"
+ },
+ "dependencies": {
+ "@ionic/utils-object": "2.1.5",
+ "@ionic/utils-terminal": "2.3.1",
+ "debug": "^4.0.0",
+ "signal-exit": "^3.0.3",
+ "tree-kill": "^1.2.2",
+ "tslib": "^2.0.1"
+ },
+ "devDependencies": {
+ "@types/debug": "^4.1.1",
+ "@types/jest": "^26.0.10",
+ "@types/node": "~10.17.13",
+ "@types/signal-exit": "^3.0.0",
+ "jest": "^26.4.2",
+ "jest-cli": "^26.0.1",
+ "lint-staged": "^10.0.2",
+ "rimraf": "^3.0.0",
+ "ts-jest": "~26.3.0",
+ "typescript": "~4.0.2"
+ },
+ "gitHead": "85097593e45837e1a0bdef8f3e20a5f44f6cd1e6"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/CHANGELOG.md
new file mode 100644
index 00000000..e1579657
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/CHANGELOG.md
@@ -0,0 +1,179 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+## [3.1.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@3.1.4...@ionic/utils-stream@3.1.5) (2020-08-28)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+## [3.1.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@3.1.3...@ionic/utils-stream@3.1.4) (2020-08-25)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+## [3.1.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@3.1.2...@ionic/utils-stream@3.1.3) (2020-05-12)
+
+
+### Bug Fixes
+
+* pin tslib to avoid "Cannot set property pathExists" error ([689e1f0](https://github.com/ionic-team/ionic-cli/commit/689e1f038b907356ef855a067a76d4822e7072a8))
+
+
+
+
+
+## [3.1.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@3.1.1...@ionic/utils-stream@3.1.2) (2020-05-06)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+## [3.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@3.1.0...@ionic/utils-stream@3.1.1) (2020-03-03)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+# 3.1.0 (2020-02-11)
+
+
+### Features
+
+* **start:** add new list starter option ([#4315](https://github.com/ionic-team/ionic-cli/issues/4315)) ([1df44c1](https://github.com/ionic-team/ionic-cli/commit/1df44c1591f37b89f2b672857740edd6cb2aea67))
+
+
+
+
+
+## [3.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@3.0.1...@ionic/utils-stream@3.0.2) (2020-02-10)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+## [3.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@3.0.0...@ionic/utils-stream@3.0.1) (2020-02-03)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+# [3.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@2.0.5...@ionic/utils-stream@3.0.0) (2020-01-25)
+
+
+### chore
+
+* require Node 10 ([5a47874](https://github.com/ionic-team/ionic-cli/commit/5a478746c074207b6dc96aa8771f04a606deb1ef))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 10.3.0 is required.
+
+
+
+
+
+## [2.0.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@2.0.4...@ionic/utils-stream@2.0.5) (2019-12-05)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+## [2.0.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@2.0.3...@ionic/utils-stream@2.0.4) (2019-09-18)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+## [2.0.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@2.0.2...@ionic/utils-stream@2.0.3) (2019-08-23)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+## [2.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@2.0.1...@ionic/utils-stream@2.0.2) (2019-08-14)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+## [2.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@2.0.0...@ionic/utils-stream@2.0.1) (2019-08-07)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+# [2.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@1.0.1...@ionic/utils-stream@2.0.0) (2019-06-10)
+
+
+### Code Refactoring
+
+* remove combineStreams ([93f4ff2](https://github.com/ionic-team/ionic-cli/commit/93f4ff2))
+
+
+### BREAKING CHANGES
+
+* `combineStreams` has been removed. Use
+`stream-combiner2` directly.
+
+
+
+
+
+## [1.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@1.0.0...@ionic/utils-stream@1.0.1) (2019-06-05)
+
+**Note:** Version bump only for package @ionic/utils-stream
+
+
+
+
+
+# [1.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-stream@0.0.1...@ionic/utils-stream@1.0.0) (2019-05-29)
+
+
+### chore
+
+* require Node 8 ([5670e68](https://github.com/ionic-team/ionic-cli/commit/5670e68))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 8.9.4 is required.
+
+
+
+
+
+
+## 0.0.1 (2019-02-27)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-stream
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/LICENSE b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/LICENSE
new file mode 100644
index 00000000..7c5808ce
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2017 Drifty Co
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/README.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/README.md
new file mode 100644
index 00000000..fce2c8f9
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/README.md
@@ -0,0 +1 @@
+# @ionic/utils-stream
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/dist/index.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/dist/index.d.ts
new file mode 100644
index 00000000..d257a7f2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/dist/index.d.ts
@@ -0,0 +1,38 @@
+///
+import { Readable, ReadableOptions, Writable, WritableOptions } from 'stream';
+export declare class NullStream extends Writable {
+ _write(chunk: any, encoding: string, callback: () => void): void;
+}
+export interface ReadableStreamBufferOptions extends ReadableOptions {
+ chunkSize?: number;
+ allocSize?: number;
+ growSize?: number;
+}
+export declare class ReadableStreamBuffer extends Readable {
+ protected buffer: Buffer;
+ protected _size: number;
+ protected _stopped: boolean;
+ protected chunkSize: number;
+ protected growSize: number;
+ constructor(opts?: ReadableStreamBufferOptions);
+ get size(): number;
+ get stopped(): boolean;
+ _read(): void;
+ feed(data: Buffer | string, encoding?: string): void;
+ stop(): void;
+ protected _send(): void;
+}
+export interface WritableStreamBufferOptions extends WritableOptions {
+ allocSize?: number;
+ growSize?: number;
+}
+export declare class WritableStreamBuffer extends Writable {
+ protected buffer: Buffer;
+ protected _size: number;
+ protected growSize: number;
+ constructor(opts?: WritableStreamBufferOptions);
+ get size(): number;
+ _write(chunk: any, encoding: string, callback: () => void): void;
+ consume(bytes?: number): Buffer;
+}
+export declare function growBufferForAppendedData(buf: Buffer, actualsize: number, appendsize: number): Buffer;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/dist/index.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/dist/index.js
new file mode 100644
index 00000000..295b7d34
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/dist/index.js
@@ -0,0 +1,108 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.growBufferForAppendedData = exports.WritableStreamBuffer = exports.ReadableStreamBuffer = exports.NullStream = void 0;
+const stream_1 = require("stream");
+const DEFAULT_CHUNK_SIZE = 4;
+const DEFAULT_ALLOC_SIZE = 32;
+const DEFAULT_GROW_SIZE = 16;
+class NullStream extends stream_1.Writable {
+ _write(chunk, encoding, callback) {
+ callback();
+ }
+}
+exports.NullStream = NullStream;
+class ReadableStreamBuffer extends stream_1.Readable {
+ constructor(opts) {
+ super(opts);
+ this._size = 0;
+ this._stopped = false;
+ this.buffer = Buffer.alloc(opts && opts.allocSize ? opts.allocSize : DEFAULT_ALLOC_SIZE);
+ this.chunkSize = opts && opts.chunkSize ? opts.chunkSize : DEFAULT_CHUNK_SIZE;
+ this.growSize = opts && opts.growSize ? opts.growSize : DEFAULT_GROW_SIZE;
+ }
+ get size() {
+ return this._size;
+ }
+ get stopped() {
+ return this._stopped;
+ }
+ _read() {
+ this._send();
+ }
+ feed(data, encoding = 'utf8') {
+ if (this._stopped) {
+ throw new Error('ReadableStreamBuffer is stopped. Can no longer feed.');
+ }
+ const datasize = typeof data === 'string' ? Buffer.byteLength(data) : data.length;
+ this.buffer = growBufferForAppendedData(this.buffer, this._size, Math.ceil(datasize / this.growSize) * this.growSize);
+ if (typeof data === 'string') {
+ this.buffer.write(data, this._size, datasize, encoding);
+ }
+ else {
+ this.buffer.copy(data, this._size, 0);
+ }
+ this._size += datasize;
+ }
+ stop() {
+ if (this._stopped) {
+ return;
+ }
+ this._stopped = true;
+ if (this._size === 0) {
+ this.push(null);
+ }
+ }
+ _send() {
+ const chunkSize = Math.min(this.chunkSize, this._size);
+ let done = false;
+ if (chunkSize > 0) {
+ const chunk = Buffer.alloc(chunkSize);
+ this.buffer.copy(chunk, 0, 0, chunkSize);
+ done = !this.push(chunk);
+ this.buffer.copy(this.buffer, 0, chunkSize, this._size);
+ this._size -= chunkSize;
+ }
+ if (this._size === 0 && this._stopped) {
+ this.push(null);
+ }
+ if (!done) {
+ setTimeout(() => this._send(), 1);
+ }
+ }
+}
+exports.ReadableStreamBuffer = ReadableStreamBuffer;
+class WritableStreamBuffer extends stream_1.Writable {
+ constructor(opts) {
+ super(opts);
+ this._size = 0;
+ this.buffer = Buffer.alloc(opts && opts.allocSize ? opts.allocSize : DEFAULT_ALLOC_SIZE);
+ this.growSize = opts && opts.growSize ? opts.growSize : DEFAULT_GROW_SIZE;
+ }
+ get size() {
+ return this._size;
+ }
+ _write(chunk, encoding, callback) {
+ this.buffer = growBufferForAppendedData(this.buffer, this._size, Math.ceil(chunk.length / this.growSize) * this.growSize);
+ chunk.copy(this.buffer, this._size, 0);
+ this._size += chunk.length;
+ callback();
+ }
+ consume(bytes) {
+ bytes = typeof bytes === 'number' ? bytes : this._size;
+ const data = Buffer.alloc(bytes);
+ this.buffer.copy(data, 0, 0, data.length);
+ this.buffer.copy(this.buffer, 0, data.length);
+ this._size -= data.length;
+ return data;
+ }
+}
+exports.WritableStreamBuffer = WritableStreamBuffer;
+function growBufferForAppendedData(buf, actualsize, appendsize) {
+ if ((buf.length - actualsize) >= appendsize) {
+ return buf;
+ }
+ const newbuffer = Buffer.alloc(buf.length + appendsize);
+ buf.copy(newbuffer, 0, 0, actualsize);
+ return newbuffer;
+}
+exports.growBufferForAppendedData = growBufferForAppendedData;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/package.json b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/package.json
new file mode 100644
index 00000000..307f02fe
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-stream/package.json
@@ -0,0 +1,50 @@
+{
+ "name": "@ionic/utils-stream",
+ "version": "3.1.5",
+ "description": "Stream utils for NodeJS",
+ "main": "dist/index.js",
+ "types": "dist/index.d.ts",
+ "homepage": "https://ionicframework.com/",
+ "author": "Ionic Team (https://ionic.io)",
+ "license": "MIT",
+ "engines": {
+ "node": ">=10.3.0"
+ },
+ "files": [
+ "dist/",
+ "LICENSE",
+ "README.md"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/ionic-team/ionic-cli.git"
+ },
+ "bugs": {
+ "url": "https://github.com/ionic-team/ionic-cli/issues"
+ },
+ "scripts": {
+ "clean": "rimraf dist",
+ "lint": "true",
+ "build": "npm run clean && tsc",
+ "watch": "tsc -w --preserveWatchOutput",
+ "test": "jest --maxWorkers=4",
+ "prepublishOnly": "npm run build"
+ },
+ "dependencies": {
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "devDependencies": {
+ "@types/debug": "^4.1.1",
+ "@types/jest": "^26.0.10",
+ "@types/node": "~10.17.13",
+ "jest": "^26.4.2",
+ "jest-cli": "^26.0.1",
+ "lint-staged": "^10.0.2",
+ "rimraf": "^3.0.0",
+ "stream-combiner2": "^1.1.1",
+ "ts-jest": "~26.3.0",
+ "typescript": "~4.0.2"
+ },
+ "gitHead": "f85e6db0eba47c8d97181b52d69c687c100f93fb"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/CHANGELOG.md
new file mode 100644
index 00000000..f0aeeb30
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/CHANGELOG.md
@@ -0,0 +1,277 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+## [2.1.9](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.1.8...@ionic/utils-subprocess@2.1.9) (2022-03-04)
+
+
+### Bug Fixes
+
+* bump cross-spawn version to avoid windows problem ([#4784](https://github.com/ionic-team/ionic-cli/issues/4784)) ([2c88a71](https://github.com/ionic-team/ionic-cli/commit/2c88a7180e87497a27a97ca979c612d6663cbb2a))
+
+
+
+
+
+## [2.1.8](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.1.7...@ionic/utils-subprocess@2.1.8) (2020-09-29)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [2.1.7](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.1.6...@ionic/utils-subprocess@2.1.7) (2020-09-24)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [2.1.6](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.1.5...@ionic/utils-subprocess@2.1.6) (2020-08-28)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [2.1.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.1.4...@ionic/utils-subprocess@2.1.5) (2020-08-27)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [2.1.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.1.3...@ionic/utils-subprocess@2.1.4) (2020-08-25)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [2.1.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.1.2...@ionic/utils-subprocess@2.1.3) (2020-05-12)
+
+
+### Bug Fixes
+
+* pin tslib to avoid "Cannot set property pathExists" error ([689e1f0](https://github.com/ionic-team/ionic-cli/commit/689e1f038b907356ef855a067a76d4822e7072a8))
+
+
+
+
+
+## [2.1.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.1.1...@ionic/utils-subprocess@2.1.2) (2020-05-06)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [2.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.1.0...@ionic/utils-subprocess@2.1.1) (2020-03-03)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+# 2.1.0 (2020-02-11)
+
+
+### Features
+
+* **start:** add new list starter option ([#4315](https://github.com/ionic-team/ionic-cli/issues/4315)) ([1df44c1](https://github.com/ionic-team/ionic-cli/commit/1df44c1591f37b89f2b672857740edd6cb2aea67))
+
+
+
+
+
+## [2.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.0.1...@ionic/utils-subprocess@2.0.2) (2020-02-10)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [2.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@2.0.0...@ionic/utils-subprocess@2.0.1) (2020-02-03)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+# [2.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.13...@ionic/utils-subprocess@2.0.0) (2020-01-25)
+
+
+### chore
+
+* require Node 10 ([5a47874](https://github.com/ionic-team/ionic-cli/commit/5a478746c074207b6dc96aa8771f04a606deb1ef))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 10.3.0 is required.
+
+
+
+
+
+## [1.0.13](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.12...@ionic/utils-subprocess@1.0.13) (2020-01-13)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.12](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.11...@ionic/utils-subprocess@1.0.12) (2019-12-10)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.11](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.10...@ionic/utils-subprocess@1.0.11) (2019-12-05)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.10](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.9...@ionic/utils-subprocess@1.0.10) (2019-11-21)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.9](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.8...@ionic/utils-subprocess@1.0.9) (2019-10-14)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.8](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.7...@ionic/utils-subprocess@1.0.8) (2019-09-18)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.7](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.6...@ionic/utils-subprocess@1.0.7) (2019-08-28)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.6](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.5...@ionic/utils-subprocess@1.0.6) (2019-08-23)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.4...@ionic/utils-subprocess@1.0.5) (2019-08-14)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.3...@ionic/utils-subprocess@1.0.4) (2019-08-07)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.2...@ionic/utils-subprocess@1.0.3) (2019-06-28)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.1...@ionic/utils-subprocess@1.0.2) (2019-06-10)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+## [1.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@1.0.0...@ionic/utils-subprocess@1.0.1) (2019-06-05)
+
+**Note:** Version bump only for package @ionic/utils-subprocess
+
+
+
+
+
+# [1.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@0.1.0...@ionic/utils-subprocess@1.0.0) (2019-05-29)
+
+
+### Bug Fixes
+
+* **subprocess:** check all executable extensions on windows ([#3949](https://github.com/ionic-team/ionic-cli/issues/3949)) ([e1cf74e](https://github.com/ionic-team/ionic-cli/commit/e1cf74e))
+
+
+### chore
+
+* require Node 8 ([5670e68](https://github.com/ionic-team/ionic-cli/commit/5670e68))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 8.9.4 is required.
+
+
+
+
+
+
+# [0.1.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-subprocess@0.0.1...@ionic/utils-subprocess@0.1.0) (2019-03-06)
+
+
+### Bug Fixes
+
+* **subprocess:** allow symlinks for commands found by `which` ([ce5bf80](https://github.com/ionic-team/ionic-cli/commit/ce5bf80))
+* **subprocess:** check if command found by `which` is executable ([638cf61](https://github.com/ionic-team/ionic-cli/commit/638cf61))
+
+
+### Features
+
+* **subprocess:** add `convertPATH` utility ([eb14e8d](https://github.com/ionic-team/ionic-cli/commit/eb14e8d))
+* **subprocess:** add `findExecutables` (like `which`, but for all) ([95acb53](https://github.com/ionic-team/ionic-cli/commit/95acb53))
+* **subprocess:** options for `bashify()` ([465fafc](https://github.com/ionic-team/ionic-cli/commit/465fafc))
+
+
+
+
+
+## 0.0.1 (2019-02-27)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-subprocess
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/LICENSE b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/LICENSE
new file mode 100644
index 00000000..7c5808ce
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2017 Drifty Co
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/README.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/README.md
new file mode 100644
index 00000000..b4f5a776
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/README.md
@@ -0,0 +1 @@
+# @ionic/utils-process
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/dist/index.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/dist/index.d.ts
new file mode 100644
index 00000000..97a2f631
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/dist/index.d.ts
@@ -0,0 +1,102 @@
+///
+import { ChildProcess, ForkOptions, SpawnOptions } from 'child_process';
+export declare const ERROR_COMMAND_NOT_FOUND = "ERR_SUBPROCESS_COMMAND_NOT_FOUND";
+export declare const ERROR_NON_ZERO_EXIT = "ERR_SUBPROCESS_NON_ZERO_EXIT";
+export declare const ERROR_SIGNAL_EXIT = "ERR_SUBPROCESS_SIGNAL_EXIT";
+export declare const TILDE_PATH_REGEX: RegExp;
+export declare function expandTildePath(p: string): string;
+/**
+ * Prepare the PATH environment variable for use with subprocesses.
+ *
+ * If a raw tilde is found in PATH, e.g. `~/.bin`, it is expanded. The raw
+ * tilde works in Bash, but not in Node's `child_process` outside of a shell.
+ *
+ * This is a utility method. You do not need to use it with `Subprocess`.
+ *
+ * @param path Defaults to `process.env.PATH`
+ */
+export declare function convertPATH(path?: string): string;
+export declare class SubprocessError extends Error {
+ readonly name = "SubprocessError";
+ message: string;
+ stack: string;
+ code?: typeof ERROR_COMMAND_NOT_FOUND | typeof ERROR_NON_ZERO_EXIT | typeof ERROR_SIGNAL_EXIT;
+ error?: Error;
+ output?: string;
+ signal?: string;
+ exitCode?: number;
+ constructor(message: string);
+}
+export interface SubprocessOptions extends SpawnOptions {
+}
+export interface SubprocessBashifyOptions {
+ /**
+ * Mask file path to first argument.
+ *
+ * The first argument to subprocesses is the program name or path, e.g.
+ * `/path/to/bin/my-program`. If `true`, `bashify()` will return the program
+ * name without a file path, e.g. `my-program`.
+ *
+ * The default is `true`.
+ */
+ maskArgv0?: boolean;
+ /**
+ * Mask file path to second argument.
+ *
+ * In some subprocesses, the second argument is a script file to run, e.g.
+ * `node ./scripts/post-install`. If `true`, `bashify()` will return the
+ * script name without a file path, e.g. `node post-install`.
+ *
+ * The default is `false`.
+ */
+ maskArgv1?: boolean;
+ /**
+ * Remove the first argument from output.
+ *
+ * Useful to make a command such as `node ./scripts/post-install` appear as
+ * simply `post-install`.
+ *
+ * The default is `false`.
+ */
+ shiftArgv0?: boolean;
+}
+export declare class Subprocess {
+ name: string;
+ args: readonly string[];
+ protected readonly path?: string;
+ protected _options: SpawnOptions;
+ constructor(name: string, args: readonly string[], options?: SubprocessOptions);
+ get options(): Readonly;
+ output(): Promise;
+ combinedOutput(): Promise;
+ run(): Promise & {
+ p: ChildProcess;
+ };
+ spawn(): ChildProcess;
+ bashify({ maskArgv0, maskArgv1, shiftArgv0 }?: SubprocessBashifyOptions): string;
+ bashifyArg(arg: string): string;
+ maskArg(arg: string): string;
+}
+export declare function spawn(command: string, args?: readonly string[], options?: SpawnOptions): ChildProcess;
+export declare function fork(modulePath: string, args?: readonly string[], options?: ForkOptions & Pick): ChildProcess;
+export interface WhichOptions {
+ PATH?: string;
+ PATHEXT?: string;
+}
+/**
+ * Find the first instance of a program in PATH.
+ *
+ * If `program` contains a path separator, this function will merely return it.
+ *
+ * @param program A command name, such as `ionic`
+ */
+export declare function which(program: string, { PATH, PATHEXT }?: WhichOptions): Promise;
+/**
+ * Find all instances of a program in PATH.
+ *
+ * If `program` contains a path separator, this function will merely return it
+ * inside an array.
+ *
+ * @param program A command name, such as `ionic`
+ */
+export declare function findExecutables(program: string, { PATH, PATHEXT }?: WhichOptions): Promise;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/dist/index.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/dist/index.js
new file mode 100644
index 00000000..0f8a4e43
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/dist/index.js
@@ -0,0 +1,227 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.findExecutables = exports.which = exports.fork = exports.spawn = exports.Subprocess = exports.SubprocessError = exports.convertPATH = exports.expandTildePath = exports.TILDE_PATH_REGEX = exports.ERROR_SIGNAL_EXIT = exports.ERROR_NON_ZERO_EXIT = exports.ERROR_COMMAND_NOT_FOUND = void 0;
+const utils_array_1 = require("@ionic/utils-array");
+const utils_fs_1 = require("@ionic/utils-fs");
+const utils_process_1 = require("@ionic/utils-process");
+const utils_stream_1 = require("@ionic/utils-stream");
+const utils_terminal_1 = require("@ionic/utils-terminal");
+const child_process_1 = require("child_process");
+const crossSpawn = require("cross-spawn");
+const os = require("os");
+const pathlib = require("path");
+exports.ERROR_COMMAND_NOT_FOUND = 'ERR_SUBPROCESS_COMMAND_NOT_FOUND';
+exports.ERROR_NON_ZERO_EXIT = 'ERR_SUBPROCESS_NON_ZERO_EXIT';
+exports.ERROR_SIGNAL_EXIT = 'ERR_SUBPROCESS_SIGNAL_EXIT';
+exports.TILDE_PATH_REGEX = /^~($|\/|\\)/;
+function expandTildePath(p) {
+ const h = os.homedir();
+ return p.replace(exports.TILDE_PATH_REGEX, `${h}$1`);
+}
+exports.expandTildePath = expandTildePath;
+/**
+ * Prepare the PATH environment variable for use with subprocesses.
+ *
+ * If a raw tilde is found in PATH, e.g. `~/.bin`, it is expanded. The raw
+ * tilde works in Bash, but not in Node's `child_process` outside of a shell.
+ *
+ * This is a utility method. You do not need to use it with `Subprocess`.
+ *
+ * @param path Defaults to `process.env.PATH`
+ */
+function convertPATH(path = process.env.PATH || '') {
+ return path.split(pathlib.delimiter).map(expandTildePath).join(pathlib.delimiter);
+}
+exports.convertPATH = convertPATH;
+class SubprocessError extends Error {
+ constructor(message) {
+ super(message);
+ this.name = 'SubprocessError';
+ this.message = message;
+ this.stack = (new Error()).stack || '';
+ }
+}
+exports.SubprocessError = SubprocessError;
+class Subprocess {
+ constructor(name, args, options = {}) {
+ this.name = name;
+ this.args = args;
+ const masked = this.maskArg(name);
+ if (masked !== name) {
+ this.name = masked;
+ this.path = name;
+ }
+ this._options = options;
+ }
+ get options() {
+ const opts = this._options;
+ if (!opts.env) {
+ opts.env = process.env;
+ }
+ const env = utils_process_1.createProcessEnv(opts.env || {}, {
+ PATH: convertPATH(typeof opts.env.PATH === 'string' ? opts.env.PATH : process.env.PATH),
+ });
+ return { ...opts, env };
+ }
+ async output() {
+ this._options.stdio = 'pipe';
+ const promise = this.run();
+ const stdoutBuf = new utils_stream_1.WritableStreamBuffer();
+ const stderrBuf = new utils_stream_1.WritableStreamBuffer();
+ const combinedBuf = new utils_stream_1.WritableStreamBuffer();
+ promise.p.stdout.pipe(stdoutBuf);
+ promise.p.stdout.pipe(combinedBuf);
+ promise.p.stderr.pipe(stderrBuf);
+ promise.p.stderr.pipe(combinedBuf);
+ try {
+ await promise;
+ }
+ catch (e) {
+ stdoutBuf.end();
+ stderrBuf.end();
+ e.output = combinedBuf.consume().toString();
+ throw e;
+ }
+ stderrBuf.end();
+ combinedBuf.end();
+ return stdoutBuf.consume().toString();
+ }
+ async combinedOutput() {
+ this._options.stdio = 'pipe';
+ const promise = this.run();
+ const buf = new utils_stream_1.WritableStreamBuffer();
+ promise.p.stdout.pipe(buf);
+ promise.p.stderr.pipe(buf);
+ try {
+ await promise;
+ }
+ catch (e) {
+ e.output = buf.consume().toString();
+ throw e;
+ }
+ return buf.consume().toString();
+ }
+ run() {
+ const p = this.spawn();
+ const promise = new Promise((resolve, reject) => {
+ p.on('error', (error) => {
+ let err;
+ if (error.code === 'ENOENT') {
+ err = new SubprocessError('Command not found.');
+ err.code = exports.ERROR_COMMAND_NOT_FOUND;
+ }
+ else {
+ err = new SubprocessError('Command error.');
+ }
+ err.error = error;
+ reject(err);
+ });
+ p.on('close', (code, signal) => {
+ let err;
+ if (code === 0) {
+ return resolve();
+ }
+ if (signal) {
+ err = new SubprocessError('Signal exit from subprocess.');
+ err.code = exports.ERROR_SIGNAL_EXIT;
+ err.signal = signal;
+ }
+ else {
+ err = new SubprocessError('Non-zero exit from subprocess.');
+ err.code = exports.ERROR_NON_ZERO_EXIT;
+ err.exitCode = code;
+ }
+ reject(err);
+ });
+ });
+ Object.defineProperties(promise, {
+ p: { value: p },
+ });
+ return promise;
+ }
+ spawn() {
+ return spawn(this.path ? this.path : this.name, this.args, this.options);
+ }
+ bashify({ maskArgv0 = true, maskArgv1 = false, shiftArgv0 = false } = {}) {
+ const args = [this.path ? this.path : this.name, ...this.args];
+ if (shiftArgv0) {
+ args.shift();
+ }
+ if (args[0] && maskArgv0) {
+ args[0] = this.maskArg(args[0]);
+ }
+ if (args[1] && maskArgv1) {
+ args[1] = this.maskArg(args[1]);
+ }
+ return args.length > 0
+ ? args.map(arg => this.bashifyArg(arg)).join(' ')
+ : '';
+ }
+ bashifyArg(arg) {
+ return arg.includes(' ') ? `"${arg.replace(/\"/g, '\\"')}"` : arg;
+ }
+ maskArg(arg) {
+ const i = arg.lastIndexOf(pathlib.sep);
+ return i >= 0 ? arg.substring(i + 1) : arg;
+ }
+}
+exports.Subprocess = Subprocess;
+function spawn(command, args = [], options) {
+ return crossSpawn(command, [...args], options);
+}
+exports.spawn = spawn;
+function fork(modulePath, args = [], options = {}) {
+ return child_process_1.fork(modulePath, [...args], options);
+}
+exports.fork = fork;
+const DEFAULT_PATHEXT = utils_terminal_1.TERMINAL_INFO.windows ? '.COM;.EXE;.BAT;.CMD' : undefined;
+/**
+ * Find the first instance of a program in PATH.
+ *
+ * If `program` contains a path separator, this function will merely return it.
+ *
+ * @param program A command name, such as `ionic`
+ */
+async function which(program, { PATH = process.env.PATH, PATHEXT = process.env.PATHEXT || DEFAULT_PATHEXT } = {}) {
+ if (program.includes(pathlib.sep)) {
+ return program;
+ }
+ const results = await _findExecutables(program, { PATH });
+ if (!results.length) {
+ const err = new Error(`${program} cannot be found within PATH`);
+ err.code = 'ENOENT';
+ throw err;
+ }
+ return results[0];
+}
+exports.which = which;
+/**
+ * Find all instances of a program in PATH.
+ *
+ * If `program` contains a path separator, this function will merely return it
+ * inside an array.
+ *
+ * @param program A command name, such as `ionic`
+ */
+async function findExecutables(program, { PATH = process.env.PATH, PATHEXT = process.env.PATHEXT || DEFAULT_PATHEXT } = {}) {
+ if (program.includes(pathlib.sep)) {
+ return [program];
+ }
+ return _findExecutables(program, { PATH });
+}
+exports.findExecutables = findExecutables;
+async function _findExecutables(program, { PATH = process.env.PATH, PATHEXT = process.env.PATHEXT || DEFAULT_PATHEXT } = {}) {
+ const pathParts = utils_process_1.getPathParts(PATH);
+ let programNames;
+ // if windows, cycle through all possible executable extensions
+ // ex: node.exe, npm.cmd, etc.
+ if (utils_terminal_1.TERMINAL_INFO.windows) {
+ const exts = utils_process_1.getPathParts(PATHEXT).map(ext => ext.toLowerCase());
+ // don't append extensions if one has already been provided
+ programNames = exts.includes(pathlib.extname(program).toLowerCase()) ? [program] : exts.map(ext => program + ext);
+ }
+ else {
+ programNames = [program];
+ }
+ return [].concat(...await utils_array_1.map(programNames, async (programName) => utils_array_1.concurrentFilter(pathParts.map(p => pathlib.join(p, programName)), async (p) => utils_fs_1.isExecutableFile(p))));
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/package.json b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/package.json
new file mode 100644
index 00000000..bd88c89b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-subprocess/package.json
@@ -0,0 +1,56 @@
+{
+ "name": "@ionic/utils-subprocess",
+ "version": "2.1.9",
+ "description": "Subprocess utils for NodeJS",
+ "main": "dist/index.js",
+ "types": "dist/index.d.ts",
+ "homepage": "https://ionicframework.com/",
+ "author": "Ionic Team (https://ionic.io)",
+ "license": "MIT",
+ "engines": {
+ "node": ">=10.3.0"
+ },
+ "files": [
+ "dist/",
+ "LICENSE",
+ "README.md"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/ionic-team/ionic-cli.git"
+ },
+ "bugs": {
+ "url": "https://github.com/ionic-team/ionic-cli/issues"
+ },
+ "scripts": {
+ "clean": "rimraf dist",
+ "lint": "true",
+ "build": "npm run clean && tsc",
+ "watch": "tsc -w --preserveWatchOutput",
+ "test": "jest --maxWorkers=4",
+ "prepublishOnly": "npm run build"
+ },
+ "dependencies": {
+ "@ionic/utils-array": "2.1.5",
+ "@ionic/utils-fs": "3.1.5",
+ "@ionic/utils-process": "2.1.8",
+ "@ionic/utils-stream": "3.1.5",
+ "@ionic/utils-terminal": "2.3.1",
+ "cross-spawn": "^7.0.3",
+ "debug": "^4.0.0",
+ "tslib": "^2.0.1"
+ },
+ "devDependencies": {
+ "@types/cross-spawn": "^6.0.0",
+ "@types/debug": "^4.1.1",
+ "@types/jest": "^26.0.10",
+ "@types/node": "~10.17.13",
+ "jest": "^26.4.2",
+ "jest-cli": "^26.0.1",
+ "lint-staged": "^10.0.2",
+ "rimraf": "^3.0.0",
+ "ts-jest": "~26.3.0",
+ "typescript": "~4.0.2"
+ },
+ "gitHead": "441df17dbec23611801945278c0c98ca58ca7d06"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/CHANGELOG.md
new file mode 100644
index 00000000..82e4416c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/CHANGELOG.md
@@ -0,0 +1,228 @@
+# Change Log
+
+All notable changes to this project will be documented in this file.
+See [Conventional Commits](https://conventionalcommits.org) for commit guidelines.
+
+## [2.3.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.3.0...@ionic/utils-terminal@2.3.1) (2020-09-29)
+
+
+### Bug Fixes
+
+* add signal-exit dependency in correct place ([178e5e5](https://github.com/ionic-team/ionic-cli/commit/178e5e51cdc3593e3d096a5197e1dc0e17292bbd))
+
+
+
+
+
+# [2.3.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.2.1...@ionic/utils-terminal@2.3.0) (2020-09-24)
+
+
+### Features
+
+* **format:** add more formatting utilities ([d30f099](https://github.com/ionic-team/ionic-cli/commit/d30f099f50df18816fb1d3064c434f1b318518a2))
+* **format:** terminal prose formatting utils ([8912348](https://github.com/ionic-team/ionic-cli/commit/8912348ca348ae6192ddfff1af88f9c9443d205d))
+
+
+
+
+
+## [2.2.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.2.0...@ionic/utils-terminal@2.2.1) (2020-08-28)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+# [2.2.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.1.4...@ionic/utils-terminal@2.2.0) (2020-08-27)
+
+
+### Features
+
+* add some ansi escape codes + cursor wrapper ([edbdb57](https://github.com/ionic-team/ionic-cli/commit/edbdb572bfe2fb5710eff7e49a483c86601ba425))
+
+
+
+
+
+## [2.1.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.1.3...@ionic/utils-terminal@2.1.4) (2020-08-25)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+## [2.1.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.1.2...@ionic/utils-terminal@2.1.3) (2020-05-12)
+
+
+### Bug Fixes
+
+* pin tslib to avoid "Cannot set property pathExists" error ([689e1f0](https://github.com/ionic-team/ionic-cli/commit/689e1f038b907356ef855a067a76d4822e7072a8))
+
+
+
+
+
+## [2.1.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.1.1...@ionic/utils-terminal@2.1.2) (2020-05-06)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+## [2.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.1.0...@ionic/utils-terminal@2.1.1) (2020-03-03)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+# 2.1.0 (2020-02-11)
+
+
+### Features
+
+* **start:** add new list starter option ([#4315](https://github.com/ionic-team/ionic-cli/issues/4315)) ([1df44c1](https://github.com/ionic-team/ionic-cli/commit/1df44c1591f37b89f2b672857740edd6cb2aea67))
+
+
+
+
+
+## [2.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.0.1...@ionic/utils-terminal@2.0.2) (2020-02-10)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+## [2.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@2.0.0...@ionic/utils-terminal@2.0.1) (2020-02-03)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+# [2.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@1.1.2...@ionic/utils-terminal@2.0.0) (2020-01-25)
+
+
+### chore
+
+* require Node 10 ([5a47874](https://github.com/ionic-team/ionic-cli/commit/5a478746c074207b6dc96aa8771f04a606deb1ef))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 10.3.0 is required.
+
+
+
+
+
+## [1.1.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@1.1.1...@ionic/utils-terminal@1.1.2) (2019-12-10)
+
+
+### Bug Fixes
+
+* **windows:** do not check TERM for windows detection ([ac4b417](https://github.com/ionic-team/ionic-cli/commit/ac4b417385c0c7859674e2ba59e495e9abc5bce4))
+
+
+
+
+
+## [1.1.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@1.1.0...@ionic/utils-terminal@1.1.1) (2019-12-05)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+# [1.1.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@1.0.5...@ionic/utils-terminal@1.1.0) (2019-11-21)
+
+
+### Bug Fixes
+
+* **shell:** use shell from NodeJS if available ([53d0afa](https://github.com/ionic-team/ionic-cli/commit/53d0afaea8966f7742220896a98da570c706fb63))
+
+
+### Features
+
+* **ci:** support GitHub Actions detection ([5646c8e](https://github.com/ionic-team/ionic-cli/commit/5646c8e083862dbf976cd6cdecabe209c0ad8cfd))
+
+
+
+
+
+## [1.0.5](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@1.0.4...@ionic/utils-terminal@1.0.5) (2019-09-18)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+## [1.0.4](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@1.0.3...@ionic/utils-terminal@1.0.4) (2019-08-23)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+## [1.0.3](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@1.0.2...@ionic/utils-terminal@1.0.3) (2019-08-14)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+## [1.0.2](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@1.0.1...@ionic/utils-terminal@1.0.2) (2019-08-07)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+## [1.0.1](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@1.0.0...@ionic/utils-terminal@1.0.1) (2019-06-05)
+
+**Note:** Version bump only for package @ionic/utils-terminal
+
+
+
+
+
+# [1.0.0](https://github.com/ionic-team/ionic-cli/compare/@ionic/utils-terminal@0.0.1...@ionic/utils-terminal@1.0.0) (2019-05-29)
+
+
+### chore
+
+* require Node 8 ([5670e68](https://github.com/ionic-team/ionic-cli/commit/5670e68))
+
+
+### Features
+
+* include path to shell in terminal info ([79480b9](https://github.com/ionic-team/ionic-cli/commit/79480b9))
+
+
+### BREAKING CHANGES
+
+* A minimum of Node.js 8.9.4 is required.
+
+
+
+
+
+
+## 0.0.1 (2019-02-27)
+
+
+
+
+**Note:** Version bump only for package @ionic/utils-terminal
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/LICENSE b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/LICENSE
new file mode 100644
index 00000000..7c5808ce
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2017 Drifty Co
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/README.md b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/README.md
new file mode 100644
index 00000000..735a564e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/README.md
@@ -0,0 +1 @@
+# @ionic/utils-terminal
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/ansi.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/ansi.d.ts
new file mode 100644
index 00000000..6cacec43
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/ansi.d.ts
@@ -0,0 +1,19 @@
+/**
+ * ANSI escape codes (WIP)
+ *
+ * @see https://en.wikipedia.org/wiki/ANSI_escape_code
+ */
+export declare class EscapeCode {
+ static readonly cursorLeft: () => string;
+ static readonly cursorUp: (count?: number) => string;
+ static readonly cursorDown: (count?: number) => string;
+ static readonly cursorForward: (count?: number) => string;
+ static readonly cursorBackward: (count?: number) => string;
+ static readonly cursorHide: () => string;
+ static readonly cursorShow: () => string;
+ static readonly eraseLine: () => string;
+ static readonly eraseLines: (count: number) => string;
+ static readonly eraseUp: () => string;
+ static readonly eraseDown: () => string;
+ static readonly eraseScreen: () => string;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/ansi.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/ansi.js
new file mode 100644
index 00000000..3f5ca573
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/ansi.js
@@ -0,0 +1,33 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.EscapeCode = void 0;
+const ESC = '\u001B[';
+/**
+ * ANSI escape codes (WIP)
+ *
+ * @see https://en.wikipedia.org/wiki/ANSI_escape_code
+ */
+class EscapeCode {
+}
+exports.EscapeCode = EscapeCode;
+EscapeCode.cursorLeft = () => `${ESC}G`;
+EscapeCode.cursorUp = (count = 1) => `${ESC}${count}A`;
+EscapeCode.cursorDown = (count = 1) => `${ESC}${count}B`;
+EscapeCode.cursorForward = (count = 1) => `${ESC}${count}C`;
+EscapeCode.cursorBackward = (count = 1) => `${ESC}${count}D`;
+EscapeCode.cursorHide = () => `${ESC}?25l`;
+EscapeCode.cursorShow = () => `${ESC}?25h`;
+EscapeCode.eraseLine = () => `${ESC}2K`;
+EscapeCode.eraseLines = (count) => {
+ let seq = '';
+ for (let i = 0; i < count; i++) {
+ seq += EscapeCode.eraseLine();
+ if (i < count - 1) {
+ seq += EscapeCode.cursorUp();
+ }
+ }
+ return `${seq}${EscapeCode.cursorLeft()}`;
+};
+EscapeCode.eraseUp = () => `${ESC}1J`;
+EscapeCode.eraseDown = () => `${ESC}J`;
+EscapeCode.eraseScreen = () => `${ESC}2J`;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/cursor.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/cursor.d.ts
new file mode 100644
index 00000000..1ca8e6a6
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/cursor.d.ts
@@ -0,0 +1,9 @@
+///
+export declare class Cursor {
+ static stream: NodeJS.WriteStream;
+ private static _isVisible;
+ private static _listenerAttached;
+ static show(): void;
+ static hide(): void;
+ static toggle(): void;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/cursor.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/cursor.js
new file mode 100644
index 00000000..b7a3b53c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/cursor.js
@@ -0,0 +1,37 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.Cursor = void 0;
+const onExit = require("signal-exit");
+const ansi_1 = require("./ansi");
+class Cursor {
+ static show() {
+ if (Cursor.stream.isTTY) {
+ Cursor._isVisible = true;
+ Cursor.stream.write(ansi_1.EscapeCode.cursorShow());
+ }
+ }
+ static hide() {
+ if (Cursor.stream.isTTY) {
+ if (!Cursor._listenerAttached) {
+ onExit(() => {
+ Cursor.show();
+ });
+ Cursor._listenerAttached = true;
+ }
+ Cursor._isVisible = false;
+ Cursor.stream.write(ansi_1.EscapeCode.cursorHide());
+ }
+ }
+ static toggle() {
+ if (Cursor._isVisible) {
+ Cursor.hide();
+ }
+ else {
+ Cursor.show();
+ }
+ }
+}
+exports.Cursor = Cursor;
+Cursor.stream = process.stderr;
+Cursor._isVisible = true;
+Cursor._listenerAttached = false;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/format.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/format.d.ts
new file mode 100644
index 00000000..61d4cee7
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/format.d.ts
@@ -0,0 +1,35 @@
+import sliceAnsi = require('slice-ansi');
+import stringWidth = require('string-width');
+import stripAnsi = require('strip-ansi');
+export { sliceAnsi, stringWidth, stripAnsi };
+export declare const TTY_WIDTH: number;
+export declare function indent(n?: number): string;
+export interface WordWrapOptions {
+ width?: number;
+ indentation?: number;
+ append?: string;
+}
+export declare function wordWrap(msg: string, { width, indentation, append }: WordWrapOptions): string;
+export declare function prettyPath(p: string): string;
+export declare function expandPath(p: string): string;
+export declare function generateFillSpaceStringList(list: string[], optimalLength?: number, fillCharacter?: string): string[];
+export interface ColumnarOptions {
+ hsep?: string;
+ vsep?: string;
+ headers?: string[];
+}
+/**
+ * Basic CLI table generator with support for ANSI colors.
+ *
+ * @param rows 2-dimensional matrix containing cells. An array of columns,
+ * which are arrays of cells.
+ * @param options.vsep The vertical separator character, default is
+ * `chalk.dim('|')`. Supply an empty string to hide
+ * the separator altogether.
+ * @param options.hsep The horizontal separator character, default is
+ * `chalk.dim('-')`. This is used under the headers,
+ * if supplied. Supply an empty string to hide the
+ * separator altogether.
+ * @param options.headers An array of header cells.
+ */
+export declare function columnar(rows: string[][], { hsep, vsep, headers }: ColumnarOptions): string;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/format.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/format.js
new file mode 100644
index 00000000..6e1d2c4a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/format.js
@@ -0,0 +1,122 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.columnar = exports.generateFillSpaceStringList = exports.expandPath = exports.prettyPath = exports.wordWrap = exports.indent = exports.TTY_WIDTH = exports.stripAnsi = exports.stringWidth = exports.sliceAnsi = void 0;
+const os = require("os");
+const path = require("path");
+const sliceAnsi = require("slice-ansi");
+exports.sliceAnsi = sliceAnsi;
+const stringWidth = require("string-width");
+exports.stringWidth = stringWidth;
+const stripAnsi = require("strip-ansi");
+exports.stripAnsi = stripAnsi;
+const wrapAnsi = require("wrap-ansi");
+const untildify = require("untildify");
+const MIN_TTY_WIDTH = 80;
+const MAX_TTY_WIDTH = 120;
+exports.TTY_WIDTH = process.stdout.columns ? Math.max(MIN_TTY_WIDTH, Math.min(process.stdout.columns, MAX_TTY_WIDTH)) : Infinity;
+function indent(n = 4) {
+ return ' '.repeat(n);
+}
+exports.indent = indent;
+function wordWrap(msg, { width = exports.TTY_WIDTH, indentation = 0, append = '' }) {
+ return wrapAnsi(msg, width - indentation - append.length, { trim: true }).split('\n').join(`${append}\n${indent(indentation)}`);
+}
+exports.wordWrap = wordWrap;
+function prettyPath(p) {
+ p = expandPath(p);
+ const cwd = process.cwd();
+ const d = path.dirname(p);
+ const h = os.homedir();
+ const distanceFromCwd = Math.abs(d.split(path.sep).length - cwd.split(path.sep).length);
+ if (cwd === d) {
+ return '.' + path.sep + path.basename(p);
+ }
+ else if (d.startsWith(cwd)) {
+ return '.' + path.sep + p.substring(cwd.length + 1);
+ }
+ else if (distanceFromCwd <= 2) {
+ const rel = path.relative(cwd, p);
+ return rel ? rel : '.';
+ }
+ else if (p === h) {
+ return '~';
+ }
+ else if (p.indexOf(h) === 0) {
+ return '~' + path.sep + p.substring(h.length + 1);
+ }
+ return p;
+}
+exports.prettyPath = prettyPath;
+function expandPath(p) {
+ return path.resolve(untildify(p));
+}
+exports.expandPath = expandPath;
+function generateFillSpaceStringList(list, optimalLength = 1, fillCharacter = ' ') {
+ if (optimalLength < 2) {
+ optimalLength = 2;
+ }
+ const longestItem = Math.max(...list.map(item => stringWidth(item)));
+ const fullLength = longestItem > optimalLength ? longestItem + 1 : optimalLength;
+ const fullLengthString = fillCharacter.repeat(fullLength);
+ return list.map(item => sliceAnsi(fullLengthString, 0, fullLength - stringWidth(item)));
+}
+exports.generateFillSpaceStringList = generateFillSpaceStringList;
+/**
+ * Basic CLI table generator with support for ANSI colors.
+ *
+ * @param rows 2-dimensional matrix containing cells. An array of columns,
+ * which are arrays of cells.
+ * @param options.vsep The vertical separator character, default is
+ * `chalk.dim('|')`. Supply an empty string to hide
+ * the separator altogether.
+ * @param options.hsep The horizontal separator character, default is
+ * `chalk.dim('-')`. This is used under the headers,
+ * if supplied. Supply an empty string to hide the
+ * separator altogether.
+ * @param options.headers An array of header cells.
+ */
+function columnar(rows, { hsep = '-', vsep = '|', headers }) {
+ const includeHeaders = headers ? true : false;
+ if (!rows[0]) {
+ return '';
+ }
+ const columnCount = headers ? headers.length : rows[0].length;
+ const columns = headers ?
+ headers.map(header => [header]) :
+ rows[0].map(() => []);
+ for (const row of rows) {
+ let highestLineCount = 0;
+ const splitRows = row.map(cell => {
+ const lines = cell.split('\n');
+ highestLineCount = Math.max(highestLineCount, lines.length);
+ return lines;
+ });
+ for (const rowIndex in row) {
+ if (columns[rowIndex]) {
+ columns[rowIndex].push(...splitRows[rowIndex], ...Array(highestLineCount - splitRows[rowIndex].length).fill(''));
+ }
+ }
+ }
+ const paddedColumns = columns.map((col, columnIndex) => {
+ if (columnIndex < columnCount - 1) {
+ const spaceCol = generateFillSpaceStringList(col);
+ return col.map((cell, cellIndex) => `${cell}${spaceCol[cellIndex]}${vsep === '' ? '' : `${vsep} `}`);
+ }
+ else {
+ return col;
+ }
+ });
+ let longestRowLength = 0;
+ const singleColumn = paddedColumns.reduce((a, b) => {
+ return a.map((_, i) => {
+ const r = a[i] + b[i];
+ longestRowLength = Math.max(longestRowLength, stringWidth(r));
+ return r;
+ });
+ });
+ if (includeHeaders && hsep !== '') {
+ singleColumn.splice(1, 0, hsep.repeat(longestRowLength));
+ }
+ return singleColumn.join('\n');
+}
+exports.columnar = columnar;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/index.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/index.d.ts
new file mode 100644
index 00000000..f3632e2e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/index.d.ts
@@ -0,0 +1,4 @@
+export * from './ansi';
+export * from './cursor';
+export * from './format';
+export * from './info';
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/index.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/index.js
new file mode 100644
index 00000000..94a3118c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/index.js
@@ -0,0 +1,7 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+const tslib_1 = require("tslib");
+tslib_1.__exportStar(require("./ansi"), exports);
+tslib_1.__exportStar(require("./cursor"), exports);
+tslib_1.__exportStar(require("./format"), exports);
+tslib_1.__exportStar(require("./info"), exports);
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/info.d.ts b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/info.d.ts
new file mode 100644
index 00000000..614bc035
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/info.d.ts
@@ -0,0 +1,26 @@
+/**
+ * These environment variables work for: GitHub Actions, Travis CI, CircleCI,
+ * Gitlab CI, AppVeyor, CodeShip, Jenkins, TeamCity, Bitbucket Pipelines, AWS
+ * CodeBuild
+ */
+export declare const CI_ENVIRONMENT_VARIABLES: readonly string[];
+export declare const CI_ENVIRONMENT_VARIABLES_DETECTED: string[];
+export interface TerminalInfo {
+ /**
+ * Whether this is in CI or not.
+ */
+ readonly ci: boolean;
+ /**
+ * Path to the user's shell program.
+ */
+ readonly shell: string;
+ /**
+ * Whether the terminal is an interactive TTY or not.
+ */
+ readonly tty: boolean;
+ /**
+ * Whether this is a Windows shell or not.
+ */
+ readonly windows: boolean;
+}
+export declare const TERMINAL_INFO: TerminalInfo;
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/info.js b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/info.js
new file mode 100644
index 00000000..94b3b708
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/dist/info.js
@@ -0,0 +1,39 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.TERMINAL_INFO = exports.CI_ENVIRONMENT_VARIABLES_DETECTED = exports.CI_ENVIRONMENT_VARIABLES = void 0;
+const Debug = require("debug");
+const os = require("os");
+const debug = Debug('ionic:utils-terminal:info');
+/**
+ * These environment variables work for: GitHub Actions, Travis CI, CircleCI,
+ * Gitlab CI, AppVeyor, CodeShip, Jenkins, TeamCity, Bitbucket Pipelines, AWS
+ * CodeBuild
+ */
+exports.CI_ENVIRONMENT_VARIABLES = ['CI', 'BUILD_ID', 'BUILD_NUMBER', 'BITBUCKET_COMMIT', 'CODEBUILD_BUILD_ARN', 'GITHUB_ACTIONS'];
+exports.CI_ENVIRONMENT_VARIABLES_DETECTED = exports.CI_ENVIRONMENT_VARIABLES.filter(v => !!process.env[v]);
+function getShell() {
+ const { shell } = os.userInfo();
+ if (shell) {
+ return shell;
+ }
+ if (process.env.SHELL) {
+ return process.env.SHELL;
+ }
+ if (process.platform === 'darwin') {
+ return '/bin/bash';
+ }
+ if (process.platform === 'win32') {
+ return process.env.COMSPEC ? process.env.COMSPEC : 'cmd.exe';
+ }
+ return '/bin/sh';
+}
+if (exports.CI_ENVIRONMENT_VARIABLES_DETECTED.length > 0) {
+ debug(`Environment variables for CI detected: ${exports.CI_ENVIRONMENT_VARIABLES_DETECTED.join(', ')}`);
+}
+exports.TERMINAL_INFO = Object.freeze({
+ ci: exports.CI_ENVIRONMENT_VARIABLES_DETECTED.length > 0,
+ shell: getShell(),
+ tty: Boolean(process.stdin.isTTY && process.stdout.isTTY && process.stderr.isTTY),
+ windows: process.platform === 'win32' || !!(process.env.OSTYPE && /^(msys|cygwin)$/.test(process.env.OSTYPE) ||
+ process.env.MSYSTEM && /^MINGW(32|64)$/.test(process.env.MSYSTEM)),
+});
diff --git a/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/package.json b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/package.json
new file mode 100644
index 00000000..1ae22877
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/@ionic/utils-terminal/package.json
@@ -0,0 +1,56 @@
+{
+ "name": "@ionic/utils-terminal",
+ "version": "2.3.1",
+ "description": "Terminal utils for NodeJS",
+ "main": "dist/index.js",
+ "types": "dist/index.d.ts",
+ "homepage": "https://ionicframework.com/",
+ "author": "Ionic Team (https://ionic.io)",
+ "license": "MIT",
+ "engines": {
+ "node": ">=10.3.0"
+ },
+ "files": [
+ "dist/",
+ "LICENSE",
+ "README.md"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/ionic-team/ionic-cli.git"
+ },
+ "bugs": {
+ "url": "https://github.com/ionic-team/ionic-cli/issues"
+ },
+ "scripts": {
+ "clean": "rimraf dist",
+ "lint": "true",
+ "build": "npm run clean && tsc",
+ "watch": "tsc -w --preserveWatchOutput",
+ "test": "jest --maxWorkers=4",
+ "prepublishOnly": "npm run build"
+ },
+ "dependencies": {
+ "debug": "^4.0.0",
+ "signal-exit": "^3.0.3",
+ "slice-ansi": "^4.0.0",
+ "string-width": "^4.1.0",
+ "strip-ansi": "^6.0.0",
+ "tslib": "^2.0.1",
+ "untildify": "^4.0.0",
+ "wrap-ansi": "^7.0.0"
+ },
+ "devDependencies": {
+ "@types/debug": "^4.1.1",
+ "@types/jest": "^26.0.10",
+ "@types/node": "~10.17.13",
+ "@types/signal-exit": "^3.0.0",
+ "jest": "^26.4.2",
+ "jest-cli": "^26.0.1",
+ "lint-staged": "^10.0.2",
+ "rimraf": "^3.0.0",
+ "ts-jest": "~26.3.0",
+ "typescript": "~4.0.2"
+ },
+ "gitHead": "85097593e45837e1a0bdef8f3e20a5f44f6cd1e6"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-regex/index.d.ts b/temporary_modules/trezor-connect/node_modules/ansi-regex/index.d.ts
new file mode 100644
index 00000000..2dbf6af2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-regex/index.d.ts
@@ -0,0 +1,37 @@
+declare namespace ansiRegex {
+ interface Options {
+ /**
+ Match only the first ANSI escape.
+
+ @default false
+ */
+ onlyFirst: boolean;
+ }
+}
+
+/**
+Regular expression for matching ANSI escape codes.
+
+@example
+```
+import ansiRegex = require('ansi-regex');
+
+ansiRegex().test('\u001B[4mcake\u001B[0m');
+//=> true
+
+ansiRegex().test('cake');
+//=> false
+
+'\u001B[4mcake\u001B[0m'.match(ansiRegex());
+//=> ['\u001B[4m', '\u001B[0m']
+
+'\u001B[4mcake\u001B[0m'.match(ansiRegex({onlyFirst: true}));
+//=> ['\u001B[4m']
+
+'\u001B]8;;https://github.com\u0007click\u001B]8;;\u0007'.match(ansiRegex());
+//=> ['\u001B]8;;https://github.com\u0007', '\u001B]8;;\u0007']
+```
+*/
+declare function ansiRegex(options?: ansiRegex.Options): RegExp;
+
+export = ansiRegex;
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-regex/index.js b/temporary_modules/trezor-connect/node_modules/ansi-regex/index.js
new file mode 100644
index 00000000..616ff837
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-regex/index.js
@@ -0,0 +1,10 @@
+'use strict';
+
+module.exports = ({onlyFirst = false} = {}) => {
+ const pattern = [
+ '[\\u001B\\u009B][[\\]()#;?]*(?:(?:(?:(?:;[-a-zA-Z\\d\\/#&.:=?%@~_]+)*|[a-zA-Z\\d]+(?:;[-a-zA-Z\\d\\/#&.:=?%@~_]*)*)?\\u0007)',
+ '(?:(?:\\d{1,4}(?:;\\d{0,4})*)?[\\dA-PR-TZcf-ntqry=><~]))'
+ ].join('|');
+
+ return new RegExp(pattern, onlyFirst ? undefined : 'g');
+};
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-regex/license b/temporary_modules/trezor-connect/node_modules/ansi-regex/license
new file mode 100644
index 00000000..e7af2f77
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-regex/license
@@ -0,0 +1,9 @@
+MIT License
+
+Copyright (c) Sindre Sorhus (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-regex/package.json b/temporary_modules/trezor-connect/node_modules/ansi-regex/package.json
new file mode 100644
index 00000000..017f5311
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-regex/package.json
@@ -0,0 +1,55 @@
+{
+ "name": "ansi-regex",
+ "version": "5.0.1",
+ "description": "Regular expression for matching ANSI escape codes",
+ "license": "MIT",
+ "repository": "chalk/ansi-regex",
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "sindresorhus.com"
+ },
+ "engines": {
+ "node": ">=8"
+ },
+ "scripts": {
+ "test": "xo && ava && tsd",
+ "view-supported": "node fixtures/view-codes.js"
+ },
+ "files": [
+ "index.js",
+ "index.d.ts"
+ ],
+ "keywords": [
+ "ansi",
+ "styles",
+ "color",
+ "colour",
+ "colors",
+ "terminal",
+ "console",
+ "cli",
+ "string",
+ "tty",
+ "escape",
+ "formatting",
+ "rgb",
+ "256",
+ "shell",
+ "xterm",
+ "command-line",
+ "text",
+ "regex",
+ "regexp",
+ "re",
+ "match",
+ "test",
+ "find",
+ "pattern"
+ ],
+ "devDependencies": {
+ "ava": "^2.4.0",
+ "tsd": "^0.9.0",
+ "xo": "^0.25.3"
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-regex/readme.md b/temporary_modules/trezor-connect/node_modules/ansi-regex/readme.md
new file mode 100644
index 00000000..4d848bc3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-regex/readme.md
@@ -0,0 +1,78 @@
+# ansi-regex
+
+> Regular expression for matching [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code)
+
+
+## Install
+
+```
+$ npm install ansi-regex
+```
+
+
+## Usage
+
+```js
+const ansiRegex = require('ansi-regex');
+
+ansiRegex().test('\u001B[4mcake\u001B[0m');
+//=> true
+
+ansiRegex().test('cake');
+//=> false
+
+'\u001B[4mcake\u001B[0m'.match(ansiRegex());
+//=> ['\u001B[4m', '\u001B[0m']
+
+'\u001B[4mcake\u001B[0m'.match(ansiRegex({onlyFirst: true}));
+//=> ['\u001B[4m']
+
+'\u001B]8;;https://github.com\u0007click\u001B]8;;\u0007'.match(ansiRegex());
+//=> ['\u001B]8;;https://github.com\u0007', '\u001B]8;;\u0007']
+```
+
+
+## API
+
+### ansiRegex(options?)
+
+Returns a regex for matching ANSI escape codes.
+
+#### options
+
+Type: `object`
+
+##### onlyFirst
+
+Type: `boolean`
+Default: `false` *(Matches any ANSI escape codes in a string)*
+
+Match only the first ANSI escape.
+
+
+## FAQ
+
+### Why do you test for codes not in the ECMA 48 standard?
+
+Some of the codes we run as a test are codes that we acquired finding various lists of non-standard or manufacturer specific codes. We test for both standard and non-standard codes, as most of them follow the same or similar format and can be safely matched in strings without the risk of removing actual string content. There are a few non-standard control codes that do not follow the traditional format (i.e. they end in numbers) thus forcing us to exclude them from the test because we cannot reliably match them.
+
+On the historical side, those ECMA standards were established in the early 90's whereas the VT100, for example, was designed in the mid/late 70's. At that point in time, control codes were still pretty ungoverned and engineers used them for a multitude of things, namely to activate hardware ports that may have been proprietary. Somewhere else you see a similar 'anarchy' of codes is in the x86 architecture for processors; there are a ton of "interrupts" that can mean different things on certain brands of processors, most of which have been phased out.
+
+
+## Maintainers
+
+- [Sindre Sorhus](https://github.com/sindresorhus)
+- [Josh Junon](https://github.com/qix-)
+
+
+---
+
+
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-styles/index.d.ts b/temporary_modules/trezor-connect/node_modules/ansi-styles/index.d.ts
new file mode 100644
index 00000000..44a907e5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-styles/index.d.ts
@@ -0,0 +1,345 @@
+declare type CSSColor =
+ | 'aliceblue'
+ | 'antiquewhite'
+ | 'aqua'
+ | 'aquamarine'
+ | 'azure'
+ | 'beige'
+ | 'bisque'
+ | 'black'
+ | 'blanchedalmond'
+ | 'blue'
+ | 'blueviolet'
+ | 'brown'
+ | 'burlywood'
+ | 'cadetblue'
+ | 'chartreuse'
+ | 'chocolate'
+ | 'coral'
+ | 'cornflowerblue'
+ | 'cornsilk'
+ | 'crimson'
+ | 'cyan'
+ | 'darkblue'
+ | 'darkcyan'
+ | 'darkgoldenrod'
+ | 'darkgray'
+ | 'darkgreen'
+ | 'darkgrey'
+ | 'darkkhaki'
+ | 'darkmagenta'
+ | 'darkolivegreen'
+ | 'darkorange'
+ | 'darkorchid'
+ | 'darkred'
+ | 'darksalmon'
+ | 'darkseagreen'
+ | 'darkslateblue'
+ | 'darkslategray'
+ | 'darkslategrey'
+ | 'darkturquoise'
+ | 'darkviolet'
+ | 'deeppink'
+ | 'deepskyblue'
+ | 'dimgray'
+ | 'dimgrey'
+ | 'dodgerblue'
+ | 'firebrick'
+ | 'floralwhite'
+ | 'forestgreen'
+ | 'fuchsia'
+ | 'gainsboro'
+ | 'ghostwhite'
+ | 'gold'
+ | 'goldenrod'
+ | 'gray'
+ | 'green'
+ | 'greenyellow'
+ | 'grey'
+ | 'honeydew'
+ | 'hotpink'
+ | 'indianred'
+ | 'indigo'
+ | 'ivory'
+ | 'khaki'
+ | 'lavender'
+ | 'lavenderblush'
+ | 'lawngreen'
+ | 'lemonchiffon'
+ | 'lightblue'
+ | 'lightcoral'
+ | 'lightcyan'
+ | 'lightgoldenrodyellow'
+ | 'lightgray'
+ | 'lightgreen'
+ | 'lightgrey'
+ | 'lightpink'
+ | 'lightsalmon'
+ | 'lightseagreen'
+ | 'lightskyblue'
+ | 'lightslategray'
+ | 'lightslategrey'
+ | 'lightsteelblue'
+ | 'lightyellow'
+ | 'lime'
+ | 'limegreen'
+ | 'linen'
+ | 'magenta'
+ | 'maroon'
+ | 'mediumaquamarine'
+ | 'mediumblue'
+ | 'mediumorchid'
+ | 'mediumpurple'
+ | 'mediumseagreen'
+ | 'mediumslateblue'
+ | 'mediumspringgreen'
+ | 'mediumturquoise'
+ | 'mediumvioletred'
+ | 'midnightblue'
+ | 'mintcream'
+ | 'mistyrose'
+ | 'moccasin'
+ | 'navajowhite'
+ | 'navy'
+ | 'oldlace'
+ | 'olive'
+ | 'olivedrab'
+ | 'orange'
+ | 'orangered'
+ | 'orchid'
+ | 'palegoldenrod'
+ | 'palegreen'
+ | 'paleturquoise'
+ | 'palevioletred'
+ | 'papayawhip'
+ | 'peachpuff'
+ | 'peru'
+ | 'pink'
+ | 'plum'
+ | 'powderblue'
+ | 'purple'
+ | 'rebeccapurple'
+ | 'red'
+ | 'rosybrown'
+ | 'royalblue'
+ | 'saddlebrown'
+ | 'salmon'
+ | 'sandybrown'
+ | 'seagreen'
+ | 'seashell'
+ | 'sienna'
+ | 'silver'
+ | 'skyblue'
+ | 'slateblue'
+ | 'slategray'
+ | 'slategrey'
+ | 'snow'
+ | 'springgreen'
+ | 'steelblue'
+ | 'tan'
+ | 'teal'
+ | 'thistle'
+ | 'tomato'
+ | 'turquoise'
+ | 'violet'
+ | 'wheat'
+ | 'white'
+ | 'whitesmoke'
+ | 'yellow'
+ | 'yellowgreen';
+
+declare namespace ansiStyles {
+ interface ColorConvert {
+ /**
+ The RGB color space.
+
+ @param red - (`0`-`255`)
+ @param green - (`0`-`255`)
+ @param blue - (`0`-`255`)
+ */
+ rgb(red: number, green: number, blue: number): string;
+
+ /**
+ The RGB HEX color space.
+
+ @param hex - A hexadecimal string containing RGB data.
+ */
+ hex(hex: string): string;
+
+ /**
+ @param keyword - A CSS color name.
+ */
+ keyword(keyword: CSSColor): string;
+
+ /**
+ The HSL color space.
+
+ @param hue - (`0`-`360`)
+ @param saturation - (`0`-`100`)
+ @param lightness - (`0`-`100`)
+ */
+ hsl(hue: number, saturation: number, lightness: number): string;
+
+ /**
+ The HSV color space.
+
+ @param hue - (`0`-`360`)
+ @param saturation - (`0`-`100`)
+ @param value - (`0`-`100`)
+ */
+ hsv(hue: number, saturation: number, value: number): string;
+
+ /**
+ The HSV color space.
+
+ @param hue - (`0`-`360`)
+ @param whiteness - (`0`-`100`)
+ @param blackness - (`0`-`100`)
+ */
+ hwb(hue: number, whiteness: number, blackness: number): string;
+
+ /**
+ Use a [4-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#3/4-bit) to set text color.
+ */
+ ansi(ansi: number): string;
+
+ /**
+ Use an [8-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#8-bit) to set text color.
+ */
+ ansi256(ansi: number): string;
+ }
+
+ interface CSPair {
+ /**
+ The ANSI terminal control sequence for starting this style.
+ */
+ readonly open: string;
+
+ /**
+ The ANSI terminal control sequence for ending this style.
+ */
+ readonly close: string;
+ }
+
+ interface ColorBase {
+ readonly ansi: ColorConvert;
+ readonly ansi256: ColorConvert;
+ readonly ansi16m: ColorConvert;
+
+ /**
+ The ANSI terminal control sequence for ending this color.
+ */
+ readonly close: string;
+ }
+
+ interface Modifier {
+ /**
+ Resets the current color chain.
+ */
+ readonly reset: CSPair;
+
+ /**
+ Make text bold.
+ */
+ readonly bold: CSPair;
+
+ /**
+ Emitting only a small amount of light.
+ */
+ readonly dim: CSPair;
+
+ /**
+ Make text italic. (Not widely supported)
+ */
+ readonly italic: CSPair;
+
+ /**
+ Make text underline. (Not widely supported)
+ */
+ readonly underline: CSPair;
+
+ /**
+ Inverse background and foreground colors.
+ */
+ readonly inverse: CSPair;
+
+ /**
+ Prints the text, but makes it invisible.
+ */
+ readonly hidden: CSPair;
+
+ /**
+ Puts a horizontal line through the center of the text. (Not widely supported)
+ */
+ readonly strikethrough: CSPair;
+ }
+
+ interface ForegroundColor {
+ readonly black: CSPair;
+ readonly red: CSPair;
+ readonly green: CSPair;
+ readonly yellow: CSPair;
+ readonly blue: CSPair;
+ readonly cyan: CSPair;
+ readonly magenta: CSPair;
+ readonly white: CSPair;
+
+ /**
+ Alias for `blackBright`.
+ */
+ readonly gray: CSPair;
+
+ /**
+ Alias for `blackBright`.
+ */
+ readonly grey: CSPair;
+
+ readonly blackBright: CSPair;
+ readonly redBright: CSPair;
+ readonly greenBright: CSPair;
+ readonly yellowBright: CSPair;
+ readonly blueBright: CSPair;
+ readonly cyanBright: CSPair;
+ readonly magentaBright: CSPair;
+ readonly whiteBright: CSPair;
+ }
+
+ interface BackgroundColor {
+ readonly bgBlack: CSPair;
+ readonly bgRed: CSPair;
+ readonly bgGreen: CSPair;
+ readonly bgYellow: CSPair;
+ readonly bgBlue: CSPair;
+ readonly bgCyan: CSPair;
+ readonly bgMagenta: CSPair;
+ readonly bgWhite: CSPair;
+
+ /**
+ Alias for `bgBlackBright`.
+ */
+ readonly bgGray: CSPair;
+
+ /**
+ Alias for `bgBlackBright`.
+ */
+ readonly bgGrey: CSPair;
+
+ readonly bgBlackBright: CSPair;
+ readonly bgRedBright: CSPair;
+ readonly bgGreenBright: CSPair;
+ readonly bgYellowBright: CSPair;
+ readonly bgBlueBright: CSPair;
+ readonly bgCyanBright: CSPair;
+ readonly bgMagentaBright: CSPair;
+ readonly bgWhiteBright: CSPair;
+ }
+}
+
+declare const ansiStyles: {
+ readonly modifier: ansiStyles.Modifier;
+ readonly color: ansiStyles.ForegroundColor & ansiStyles.ColorBase;
+ readonly bgColor: ansiStyles.BackgroundColor & ansiStyles.ColorBase;
+ readonly codes: ReadonlyMap;
+} & ansiStyles.BackgroundColor & ansiStyles.ForegroundColor & ansiStyles.Modifier;
+
+export = ansiStyles;
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-styles/index.js b/temporary_modules/trezor-connect/node_modules/ansi-styles/index.js
new file mode 100644
index 00000000..5d82581a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-styles/index.js
@@ -0,0 +1,163 @@
+'use strict';
+
+const wrapAnsi16 = (fn, offset) => (...args) => {
+ const code = fn(...args);
+ return `\u001B[${code + offset}m`;
+};
+
+const wrapAnsi256 = (fn, offset) => (...args) => {
+ const code = fn(...args);
+ return `\u001B[${38 + offset};5;${code}m`;
+};
+
+const wrapAnsi16m = (fn, offset) => (...args) => {
+ const rgb = fn(...args);
+ return `\u001B[${38 + offset};2;${rgb[0]};${rgb[1]};${rgb[2]}m`;
+};
+
+const ansi2ansi = n => n;
+const rgb2rgb = (r, g, b) => [r, g, b];
+
+const setLazyProperty = (object, property, get) => {
+ Object.defineProperty(object, property, {
+ get: () => {
+ const value = get();
+
+ Object.defineProperty(object, property, {
+ value,
+ enumerable: true,
+ configurable: true
+ });
+
+ return value;
+ },
+ enumerable: true,
+ configurable: true
+ });
+};
+
+/** @type {typeof import('color-convert')} */
+let colorConvert;
+const makeDynamicStyles = (wrap, targetSpace, identity, isBackground) => {
+ if (colorConvert === undefined) {
+ colorConvert = require('color-convert');
+ }
+
+ const offset = isBackground ? 10 : 0;
+ const styles = {};
+
+ for (const [sourceSpace, suite] of Object.entries(colorConvert)) {
+ const name = sourceSpace === 'ansi16' ? 'ansi' : sourceSpace;
+ if (sourceSpace === targetSpace) {
+ styles[name] = wrap(identity, offset);
+ } else if (typeof suite === 'object') {
+ styles[name] = wrap(suite[targetSpace], offset);
+ }
+ }
+
+ return styles;
+};
+
+function assembleStyles() {
+ const codes = new Map();
+ const styles = {
+ modifier: {
+ reset: [0, 0],
+ // 21 isn't widely supported and 22 does the same thing
+ bold: [1, 22],
+ dim: [2, 22],
+ italic: [3, 23],
+ underline: [4, 24],
+ inverse: [7, 27],
+ hidden: [8, 28],
+ strikethrough: [9, 29]
+ },
+ color: {
+ black: [30, 39],
+ red: [31, 39],
+ green: [32, 39],
+ yellow: [33, 39],
+ blue: [34, 39],
+ magenta: [35, 39],
+ cyan: [36, 39],
+ white: [37, 39],
+
+ // Bright color
+ blackBright: [90, 39],
+ redBright: [91, 39],
+ greenBright: [92, 39],
+ yellowBright: [93, 39],
+ blueBright: [94, 39],
+ magentaBright: [95, 39],
+ cyanBright: [96, 39],
+ whiteBright: [97, 39]
+ },
+ bgColor: {
+ bgBlack: [40, 49],
+ bgRed: [41, 49],
+ bgGreen: [42, 49],
+ bgYellow: [43, 49],
+ bgBlue: [44, 49],
+ bgMagenta: [45, 49],
+ bgCyan: [46, 49],
+ bgWhite: [47, 49],
+
+ // Bright color
+ bgBlackBright: [100, 49],
+ bgRedBright: [101, 49],
+ bgGreenBright: [102, 49],
+ bgYellowBright: [103, 49],
+ bgBlueBright: [104, 49],
+ bgMagentaBright: [105, 49],
+ bgCyanBright: [106, 49],
+ bgWhiteBright: [107, 49]
+ }
+ };
+
+ // Alias bright black as gray (and grey)
+ styles.color.gray = styles.color.blackBright;
+ styles.bgColor.bgGray = styles.bgColor.bgBlackBright;
+ styles.color.grey = styles.color.blackBright;
+ styles.bgColor.bgGrey = styles.bgColor.bgBlackBright;
+
+ for (const [groupName, group] of Object.entries(styles)) {
+ for (const [styleName, style] of Object.entries(group)) {
+ styles[styleName] = {
+ open: `\u001B[${style[0]}m`,
+ close: `\u001B[${style[1]}m`
+ };
+
+ group[styleName] = styles[styleName];
+
+ codes.set(style[0], style[1]);
+ }
+
+ Object.defineProperty(styles, groupName, {
+ value: group,
+ enumerable: false
+ });
+ }
+
+ Object.defineProperty(styles, 'codes', {
+ value: codes,
+ enumerable: false
+ });
+
+ styles.color.close = '\u001B[39m';
+ styles.bgColor.close = '\u001B[49m';
+
+ setLazyProperty(styles.color, 'ansi', () => makeDynamicStyles(wrapAnsi16, 'ansi16', ansi2ansi, false));
+ setLazyProperty(styles.color, 'ansi256', () => makeDynamicStyles(wrapAnsi256, 'ansi256', ansi2ansi, false));
+ setLazyProperty(styles.color, 'ansi16m', () => makeDynamicStyles(wrapAnsi16m, 'rgb', rgb2rgb, false));
+ setLazyProperty(styles.bgColor, 'ansi', () => makeDynamicStyles(wrapAnsi16, 'ansi16', ansi2ansi, true));
+ setLazyProperty(styles.bgColor, 'ansi256', () => makeDynamicStyles(wrapAnsi256, 'ansi256', ansi2ansi, true));
+ setLazyProperty(styles.bgColor, 'ansi16m', () => makeDynamicStyles(wrapAnsi16m, 'rgb', rgb2rgb, true));
+
+ return styles;
+}
+
+// Make the export immutable
+Object.defineProperty(module, 'exports', {
+ enumerable: true,
+ get: assembleStyles
+});
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-styles/license b/temporary_modules/trezor-connect/node_modules/ansi-styles/license
new file mode 100644
index 00000000..e7af2f77
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-styles/license
@@ -0,0 +1,9 @@
+MIT License
+
+Copyright (c) Sindre Sorhus (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-styles/package.json b/temporary_modules/trezor-connect/node_modules/ansi-styles/package.json
new file mode 100644
index 00000000..75393284
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-styles/package.json
@@ -0,0 +1,56 @@
+{
+ "name": "ansi-styles",
+ "version": "4.3.0",
+ "description": "ANSI escape codes for styling strings in the terminal",
+ "license": "MIT",
+ "repository": "chalk/ansi-styles",
+ "funding": "https://github.com/chalk/ansi-styles?sponsor=1",
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "sindresorhus.com"
+ },
+ "engines": {
+ "node": ">=8"
+ },
+ "scripts": {
+ "test": "xo && ava && tsd",
+ "screenshot": "svg-term --command='node screenshot' --out=screenshot.svg --padding=3 --width=55 --height=3 --at=1000 --no-cursor"
+ },
+ "files": [
+ "index.js",
+ "index.d.ts"
+ ],
+ "keywords": [
+ "ansi",
+ "styles",
+ "color",
+ "colour",
+ "colors",
+ "terminal",
+ "console",
+ "cli",
+ "string",
+ "tty",
+ "escape",
+ "formatting",
+ "rgb",
+ "256",
+ "shell",
+ "xterm",
+ "log",
+ "logging",
+ "command-line",
+ "text"
+ ],
+ "dependencies": {
+ "color-convert": "^2.0.1"
+ },
+ "devDependencies": {
+ "@types/color-convert": "^1.9.0",
+ "ava": "^2.3.0",
+ "svg-term-cli": "^2.1.1",
+ "tsd": "^0.11.0",
+ "xo": "^0.25.3"
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/ansi-styles/readme.md b/temporary_modules/trezor-connect/node_modules/ansi-styles/readme.md
new file mode 100644
index 00000000..24883de8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/ansi-styles/readme.md
@@ -0,0 +1,152 @@
+# ansi-styles [](https://travis-ci.org/chalk/ansi-styles)
+
+> [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code#Colors_and_Styles) for styling strings in the terminal
+
+You probably want the higher-level [chalk](https://github.com/chalk/chalk) module for styling your strings.
+
+
+
+## Install
+
+```
+$ npm install ansi-styles
+```
+
+## Usage
+
+```js
+const style = require('ansi-styles');
+
+console.log(`${style.green.open}Hello world!${style.green.close}`);
+
+
+// Color conversion between 16/256/truecolor
+// NOTE: If conversion goes to 16 colors or 256 colors, the original color
+// may be degraded to fit that color palette. This means terminals
+// that do not support 16 million colors will best-match the
+// original color.
+console.log(style.bgColor.ansi.hsl(120, 80, 72) + 'Hello world!' + style.bgColor.close);
+console.log(style.color.ansi256.rgb(199, 20, 250) + 'Hello world!' + style.color.close);
+console.log(style.color.ansi16m.hex('#abcdef') + 'Hello world!' + style.color.close);
+```
+
+## API
+
+Each style has an `open` and `close` property.
+
+## Styles
+
+### Modifiers
+
+- `reset`
+- `bold`
+- `dim`
+- `italic` *(Not widely supported)*
+- `underline`
+- `inverse`
+- `hidden`
+- `strikethrough` *(Not widely supported)*
+
+### Colors
+
+- `black`
+- `red`
+- `green`
+- `yellow`
+- `blue`
+- `magenta`
+- `cyan`
+- `white`
+- `blackBright` (alias: `gray`, `grey`)
+- `redBright`
+- `greenBright`
+- `yellowBright`
+- `blueBright`
+- `magentaBright`
+- `cyanBright`
+- `whiteBright`
+
+### Background colors
+
+- `bgBlack`
+- `bgRed`
+- `bgGreen`
+- `bgYellow`
+- `bgBlue`
+- `bgMagenta`
+- `bgCyan`
+- `bgWhite`
+- `bgBlackBright` (alias: `bgGray`, `bgGrey`)
+- `bgRedBright`
+- `bgGreenBright`
+- `bgYellowBright`
+- `bgBlueBright`
+- `bgMagentaBright`
+- `bgCyanBright`
+- `bgWhiteBright`
+
+## Advanced usage
+
+By default, you get a map of styles, but the styles are also available as groups. They are non-enumerable so they don't show up unless you access them explicitly. This makes it easier to expose only a subset in a higher-level module.
+
+- `style.modifier`
+- `style.color`
+- `style.bgColor`
+
+###### Example
+
+```js
+console.log(style.color.green.open);
+```
+
+Raw escape codes (i.e. without the CSI escape prefix `\u001B[` and render mode postfix `m`) are available under `style.codes`, which returns a `Map` with the open codes as keys and close codes as values.
+
+###### Example
+
+```js
+console.log(style.codes.get(36));
+//=> 39
+```
+
+## [256 / 16 million (TrueColor) support](https://gist.github.com/XVilka/8346728)
+
+`ansi-styles` uses the [`color-convert`](https://github.com/Qix-/color-convert) package to allow for converting between various colors and ANSI escapes, with support for 256 and 16 million colors.
+
+The following color spaces from `color-convert` are supported:
+
+- `rgb`
+- `hex`
+- `keyword`
+- `hsl`
+- `hsv`
+- `hwb`
+- `ansi`
+- `ansi256`
+
+To use these, call the associated conversion function with the intended output, for example:
+
+```js
+style.color.ansi.rgb(100, 200, 15); // RGB to 16 color ansi foreground code
+style.bgColor.ansi.rgb(100, 200, 15); // RGB to 16 color ansi background code
+
+style.color.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code
+style.bgColor.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code
+
+style.color.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color foreground code
+style.bgColor.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color background code
+```
+
+## Related
+
+- [ansi-escapes](https://github.com/sindresorhus/ansi-escapes) - ANSI escape codes for manipulating the terminal
+
+## Maintainers
+
+- [Sindre Sorhus](https://github.com/sindresorhus)
+- [Josh Junon](https://github.com/qix-)
+
+## For enterprise
+
+Available as part of the Tidelift Subscription.
+
+The maintainers of `ansi-styles` and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-ansi-styles?utm_source=npm-ansi-styles&utm_medium=referral&utm_campaign=enterprise&utm_term=repo)
diff --git a/temporary_modules/trezor-connect/node_modules/astral-regex/index.d.ts b/temporary_modules/trezor-connect/node_modules/astral-regex/index.d.ts
new file mode 100644
index 00000000..e81ac315
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/astral-regex/index.d.ts
@@ -0,0 +1,28 @@
+declare namespace astralRegex {
+ interface Options {
+ /**
+ Only match an exact string. Useful with `RegExp#test()` to check if a string is a astral symbol. Default: `false` _(Matches any astral symbols in a string)_
+ */
+ readonly exact?: boolean;
+ }
+}
+
+/**
+Regular expression for matching [astral symbols](https://everything2.com/title/astral+plane).
+
+@returns A `RegExp` for matching astral symbols.
+
+@example
+```
+import astralRegex = require('astral-regex');
+
+astralRegex({exact: true}).test('🦄');
+//=> true
+
+'foo 🦄 💩 bar'.match(astralRegex());
+//=> ['🦄', '💩']
+```
+*/
+declare function astralRegex(options?: astralRegex.Options): RegExp;
+
+export = astralRegex;
diff --git a/temporary_modules/trezor-connect/node_modules/astral-regex/index.js b/temporary_modules/trezor-connect/node_modules/astral-regex/index.js
new file mode 100644
index 00000000..651177d4
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/astral-regex/index.js
@@ -0,0 +1,6 @@
+'use strict';
+const regex = '[\uD800-\uDBFF][\uDC00-\uDFFF]';
+
+const astralRegex = options => options && options.exact ? new RegExp(`^${regex}$`) : new RegExp(regex, 'g');
+
+module.exports = astralRegex;
diff --git a/temporary_modules/trezor-connect/node_modules/astral-regex/license b/temporary_modules/trezor-connect/node_modules/astral-regex/license
new file mode 100644
index 00000000..db6bc32c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/astral-regex/license
@@ -0,0 +1,9 @@
+MIT License
+
+Copyright (c) Kevin Mårtensson (github.com/kevva)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/astral-regex/package.json b/temporary_modules/trezor-connect/node_modules/astral-regex/package.json
new file mode 100644
index 00000000..d1ceea7f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/astral-regex/package.json
@@ -0,0 +1,33 @@
+{
+ "name": "astral-regex",
+ "version": "2.0.0",
+ "description": "Regular expression for matching astral symbols",
+ "license": "MIT",
+ "repository": "kevva/astral-regex",
+ "author": {
+ "name": "Kevin Mårtensson",
+ "email": "kevinmartensson@gmail.com",
+ "url": "github.com/kevva"
+ },
+ "engines": {
+ "node": ">=8"
+ },
+ "scripts": {
+ "test": "xo && ava && tsd"
+ },
+ "files": [
+ "index.js",
+ "index.d.ts"
+ ],
+ "keywords": [
+ "astral",
+ "emoji",
+ "regex",
+ "surrogate"
+ ],
+ "devDependencies": {
+ "ava": "^1.4.1",
+ "tsd": "^0.7.2",
+ "xo": "^0.24.0"
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/astral-regex/readme.md b/temporary_modules/trezor-connect/node_modules/astral-regex/readme.md
new file mode 100644
index 00000000..89d6659a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/astral-regex/readme.md
@@ -0,0 +1,46 @@
+# astral-regex [](https://travis-ci.org/kevva/astral-regex)
+
+> Regular expression for matching [astral symbols](https://everything2.com/title/astral+plane)
+
+
+## Install
+
+```
+$ npm install astral-regex
+```
+
+
+## Usage
+
+```js
+const astralRegex = require('astral-regex');
+
+astralRegex({exact: true}).test('🦄');
+//=> true
+
+'foo 🦄 💩 bar'.match(astralRegex());
+//=> ['🦄', '💩']
+```
+
+
+## API
+
+### astralRegex([options])
+
+Returns a `RegExp` for matching astral symbols.
+
+#### options
+
+Type: `Object`
+
+##### exact
+
+Type: `boolean`
+Default: `false` *(Matches any astral symbols in a string)*
+
+Only match an exact string. Useful with `RegExp#test()` to check if a string is a astral symbol.
+
+
+## License
+
+MIT © [Kevin Mårtensson](https://github.com/kevva)
diff --git a/temporary_modules/trezor-connect/node_modules/at-least-node/LICENSE b/temporary_modules/trezor-connect/node_modules/at-least-node/LICENSE
new file mode 100644
index 00000000..5e29ccc5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/at-least-node/LICENSE
@@ -0,0 +1,6 @@
+The ISC License
+Copyright (c) 2020 Ryan Zimmerman
+
+Permission to use, copy, modify, and/or distribute this software for any purpose with or without fee is hereby granted, provided that the above copyright notice and this permission notice appear in all copies.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/at-least-node/README.md b/temporary_modules/trezor-connect/node_modules/at-least-node/README.md
new file mode 100644
index 00000000..fd6e5146
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/at-least-node/README.md
@@ -0,0 +1,25 @@
+# at-least-node
+
+
+
+
+
+Sometimes you need to check if you're on _at least_ a given Node.js version, but you don't want to pull in the whole [`semver`](https://www.npmjs.com/package/semver) kitchen sink. That's what `at-least-node` is for.
+
+| Package | Size |
+| --------------- | ------- |
+| `at-least-node` | 2.6 kB |
+| `semver` | 75.5 kB |
+
+```js
+const atLeastNode = require('at-least-node')
+atLeastNode('10.12.0')
+// -> true on Node 10.12.0+, false on anything below that
+```
+
+When passing in a version string:
+
+- You cannot include a leading `v` (i.e. `v10.12.0`)
+- You cannot omit sections (i.e. `10.12`)
+- You cannot use pre-releases (i.e. `1.0.0-beta`)
+- There is no input validation, if you make a mistake, the resulting behavior is undefined
diff --git a/temporary_modules/trezor-connect/node_modules/at-least-node/index.js b/temporary_modules/trezor-connect/node_modules/at-least-node/index.js
new file mode 100644
index 00000000..974a2fa8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/at-least-node/index.js
@@ -0,0 +1,5 @@
+module.exports = r => {
+ const n = process.versions.node.split('.').map(x => parseInt(x, 10))
+ r = r.split('.').map(x => parseInt(x, 10))
+ return n[0] > r[0] || (n[0] === r[0] && (n[1] > r[1] || (n[1] === r[1] && n[2] >= r[2])))
+}
diff --git a/temporary_modules/trezor-connect/node_modules/at-least-node/package.json b/temporary_modules/trezor-connect/node_modules/at-least-node/package.json
new file mode 100644
index 00000000..2c13641f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/at-least-node/package.json
@@ -0,0 +1,32 @@
+{
+ "name": "at-least-node",
+ "version": "1.0.0",
+ "description": "Lightweight Node.js version sniffing/comparison",
+ "keywords": [
+ "semver",
+ "feature"
+ ],
+ "homepage": "https://github.com/RyanZim/at-least-node#readme",
+ "bugs": {
+ "url": "https://github.com/RyanZim/at-least-node/issues"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/RyanZim/at-least-node.git"
+ },
+ "license": "ISC",
+ "author": "Ryan Zimmerman ",
+ "main": "index.js",
+ "files": [],
+ "scripts": {
+ "test": "ava"
+ },
+ "devDependencies": {
+ "ava": "^3.1.0",
+ "rewire": "^4.0.1",
+ "semver": "^7.1.2"
+ },
+ "engines": {
+ "node": ">= 4.0.0"
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/base64-js/LICENSE b/temporary_modules/trezor-connect/node_modules/base64-js/LICENSE
new file mode 100644
index 00000000..6d52b8ac
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/base64-js/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Jameson Little
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/base64-js/README.md b/temporary_modules/trezor-connect/node_modules/base64-js/README.md
new file mode 100644
index 00000000..b42a48f4
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/base64-js/README.md
@@ -0,0 +1,34 @@
+base64-js
+=========
+
+`base64-js` does basic base64 encoding/decoding in pure JS.
+
+[](http://travis-ci.org/beatgammit/base64-js)
+
+Many browsers already have base64 encoding/decoding functionality, but it is for text data, not all-purpose binary data.
+
+Sometimes encoding/decoding binary data in the browser is useful, and that is what this module does.
+
+## install
+
+With [npm](https://npmjs.org) do:
+
+`npm install base64-js` and `var base64js = require('base64-js')`
+
+For use in web browsers do:
+
+``
+
+[Get supported base64-js with the Tidelift Subscription](https://tidelift.com/subscription/pkg/npm-base64-js?utm_source=npm-base64-js&utm_medium=referral&utm_campaign=readme)
+
+## methods
+
+`base64js` has three exposed functions, `byteLength`, `toByteArray` and `fromByteArray`, which both take a single argument.
+
+* `byteLength` - Takes a base64 string and returns length of byte array
+* `toByteArray` - Takes a base64 string and returns a byte array
+* `fromByteArray` - Takes a byte array and returns a base64 string
+
+## license
+
+MIT
diff --git a/temporary_modules/trezor-connect/node_modules/base64-js/base64js.min.js b/temporary_modules/trezor-connect/node_modules/base64-js/base64js.min.js
new file mode 100644
index 00000000..908ac83f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/base64-js/base64js.min.js
@@ -0,0 +1 @@
+(function(a){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=a();else if("function"==typeof define&&define.amd)define([],a);else{var b;b="undefined"==typeof window?"undefined"==typeof global?"undefined"==typeof self?this:self:global:window,b.base64js=a()}})(function(){return function(){function b(d,e,g){function a(j,i){if(!e[j]){if(!d[j]){var f="function"==typeof require&&require;if(!i&&f)return f(j,!0);if(h)return h(j,!0);var c=new Error("Cannot find module '"+j+"'");throw c.code="MODULE_NOT_FOUND",c}var k=e[j]={exports:{}};d[j][0].call(k.exports,function(b){var c=d[j][1][b];return a(c||b)},k,k.exports,b,d,e,g)}return e[j].exports}for(var h="function"==typeof require&&require,c=0;c>16,j[k++]=255&b>>8,j[k++]=255&b;return 2===h&&(b=l[a.charCodeAt(c)]<<2|l[a.charCodeAt(c+1)]>>4,j[k++]=255&b),1===h&&(b=l[a.charCodeAt(c)]<<10|l[a.charCodeAt(c+1)]<<4|l[a.charCodeAt(c+2)]>>2,j[k++]=255&b>>8,j[k++]=255&b),j}function g(a){return k[63&a>>18]+k[63&a>>12]+k[63&a>>6]+k[63&a]}function h(a,b,c){for(var d,e=[],f=b;fj?j:g+f));return 1===d?(b=a[c-1],e.push(k[b>>2]+k[63&b<<4]+"==")):2===d&&(b=(a[c-2]<<8)+a[c-1],e.push(k[b>>10]+k[63&b>>4]+k[63&b<<2]+"=")),e.join("")}c.byteLength=function(a){var b=d(a),c=b[0],e=b[1];return 3*(c+e)/4-e},c.toByteArray=f,c.fromByteArray=j;for(var k=[],l=[],m="undefined"==typeof Uint8Array?Array:Uint8Array,n="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/",o=0,p=n.length;o 0) {
+ throw new Error('Invalid string. Length must be a multiple of 4')
+ }
+
+ // Trim off extra bytes after placeholder bytes are found
+ // See: https://github.com/beatgammit/base64-js/issues/42
+ var validLen = b64.indexOf('=')
+ if (validLen === -1) validLen = len
+
+ var placeHoldersLen = validLen === len
+ ? 0
+ : 4 - (validLen % 4)
+
+ return [validLen, placeHoldersLen]
+}
+
+// base64 is 4/3 + up to two characters of the original data
+function byteLength (b64) {
+ var lens = getLens(b64)
+ var validLen = lens[0]
+ var placeHoldersLen = lens[1]
+ return ((validLen + placeHoldersLen) * 3 / 4) - placeHoldersLen
+}
+
+function _byteLength (b64, validLen, placeHoldersLen) {
+ return ((validLen + placeHoldersLen) * 3 / 4) - placeHoldersLen
+}
+
+function toByteArray (b64) {
+ var tmp
+ var lens = getLens(b64)
+ var validLen = lens[0]
+ var placeHoldersLen = lens[1]
+
+ var arr = new Arr(_byteLength(b64, validLen, placeHoldersLen))
+
+ var curByte = 0
+
+ // if there are placeholders, only get up to the last complete 4 chars
+ var len = placeHoldersLen > 0
+ ? validLen - 4
+ : validLen
+
+ var i
+ for (i = 0; i < len; i += 4) {
+ tmp =
+ (revLookup[b64.charCodeAt(i)] << 18) |
+ (revLookup[b64.charCodeAt(i + 1)] << 12) |
+ (revLookup[b64.charCodeAt(i + 2)] << 6) |
+ revLookup[b64.charCodeAt(i + 3)]
+ arr[curByte++] = (tmp >> 16) & 0xFF
+ arr[curByte++] = (tmp >> 8) & 0xFF
+ arr[curByte++] = tmp & 0xFF
+ }
+
+ if (placeHoldersLen === 2) {
+ tmp =
+ (revLookup[b64.charCodeAt(i)] << 2) |
+ (revLookup[b64.charCodeAt(i + 1)] >> 4)
+ arr[curByte++] = tmp & 0xFF
+ }
+
+ if (placeHoldersLen === 1) {
+ tmp =
+ (revLookup[b64.charCodeAt(i)] << 10) |
+ (revLookup[b64.charCodeAt(i + 1)] << 4) |
+ (revLookup[b64.charCodeAt(i + 2)] >> 2)
+ arr[curByte++] = (tmp >> 8) & 0xFF
+ arr[curByte++] = tmp & 0xFF
+ }
+
+ return arr
+}
+
+function tripletToBase64 (num) {
+ return lookup[num >> 18 & 0x3F] +
+ lookup[num >> 12 & 0x3F] +
+ lookup[num >> 6 & 0x3F] +
+ lookup[num & 0x3F]
+}
+
+function encodeChunk (uint8, start, end) {
+ var tmp
+ var output = []
+ for (var i = start; i < end; i += 3) {
+ tmp =
+ ((uint8[i] << 16) & 0xFF0000) +
+ ((uint8[i + 1] << 8) & 0xFF00) +
+ (uint8[i + 2] & 0xFF)
+ output.push(tripletToBase64(tmp))
+ }
+ return output.join('')
+}
+
+function fromByteArray (uint8) {
+ var tmp
+ var len = uint8.length
+ var extraBytes = len % 3 // if we have 1 byte left, pad 2 bytes
+ var parts = []
+ var maxChunkLength = 16383 // must be multiple of 3
+
+ // go through the array every three bytes, we'll deal with trailing stuff later
+ for (var i = 0, len2 = len - extraBytes; i < len2; i += maxChunkLength) {
+ parts.push(encodeChunk(uint8, i, (i + maxChunkLength) > len2 ? len2 : (i + maxChunkLength)))
+ }
+
+ // pad the end with zeros, but make sure to not forget the extra bytes
+ if (extraBytes === 1) {
+ tmp = uint8[len - 1]
+ parts.push(
+ lookup[tmp >> 2] +
+ lookup[(tmp << 4) & 0x3F] +
+ '=='
+ )
+ } else if (extraBytes === 2) {
+ tmp = (uint8[len - 2] << 8) + uint8[len - 1]
+ parts.push(
+ lookup[tmp >> 10] +
+ lookup[(tmp >> 4) & 0x3F] +
+ lookup[(tmp << 2) & 0x3F] +
+ '='
+ )
+ }
+
+ return parts.join('')
+}
diff --git a/temporary_modules/trezor-connect/node_modules/base64-js/package.json b/temporary_modules/trezor-connect/node_modules/base64-js/package.json
new file mode 100644
index 00000000..c3972e39
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/base64-js/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "base64-js",
+ "description": "Base64 encoding/decoding in pure JS",
+ "version": "1.5.1",
+ "author": "T. Jameson Little ",
+ "typings": "index.d.ts",
+ "bugs": {
+ "url": "https://github.com/beatgammit/base64-js/issues"
+ },
+ "devDependencies": {
+ "babel-minify": "^0.5.1",
+ "benchmark": "^2.1.4",
+ "browserify": "^16.3.0",
+ "standard": "*",
+ "tape": "4.x"
+ },
+ "homepage": "https://github.com/beatgammit/base64-js",
+ "keywords": [
+ "base64"
+ ],
+ "license": "MIT",
+ "main": "index.js",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/beatgammit/base64-js.git"
+ },
+ "scripts": {
+ "build": "browserify -s base64js -r ./ | minify > base64js.min.js",
+ "lint": "standard",
+ "test": "npm run lint && npm run unit",
+ "unit": "tape test/*.js"
+ },
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/feross"
+ },
+ {
+ "type": "patreon",
+ "url": "https://www.patreon.com/feross"
+ },
+ {
+ "type": "consulting",
+ "url": "https://feross.org/support"
+ }
+ ]
+}
diff --git a/temporary_modules/trezor-connect/node_modules/big-integer/BigInteger.d.ts b/temporary_modules/trezor-connect/node_modules/big-integer/BigInteger.d.ts
new file mode 100644
index 00000000..168ba5f4
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/big-integer/BigInteger.d.ts
@@ -0,0 +1,2393 @@
+/**
+ * Type definitions for BigInteger.js
+ * Definitions by: Tommy Frazier
+ */
+export = bigInt;
+export as namespace bigInt;
+
+declare var bigInt: bigInt.BigIntegerStatic;
+
+declare namespace bigInt {
+ type BigNumber = number | bigint | string | BigInteger;
+
+ interface BigIntegerStatic {
+ /**
+ * Equivalent to bigInt(0).
+ */
+ (): BigInteger;
+
+ /**
+ * Parse a Javascript number into a bigInt.
+ */
+ (number: number): BigInteger;
+
+ /**
+ * Parse a Javascript native bigint into a bigInt.
+ */
+ (number: bigint): BigInteger;
+
+ /**
+ * Parse a string into a bigInt.
+ * Default base is 10.
+ * Default alphabet is "0123456789abcdefghijklmnopqrstuvwxyz".
+ * caseSensitive defaults to false.
+ */
+ (string: string, base?: BigNumber, alphabet?: string, caseSensitive?: boolean): BigInteger;
+
+ /**
+ * no-op.
+ */
+ (bigInt: BigInteger): BigInteger;
+
+ /**
+ * Constructs a bigInt from an array of digits in specified base.
+ * The optional isNegative flag will make the number negative.
+ */
+ fromArray: (digits: BigNumber[], base?: BigNumber, isNegative?: boolean) => BigInteger;
+
+ /**
+ * Finds the greatest common denominator of a and b.
+ */
+ gcd: (a: BigNumber, b: BigNumber) => BigInteger;
+
+
+ /**
+ * Returns true if x is a BigInteger, false otherwise.
+ */
+ isInstance: (x: any) => x is BigInteger;
+
+ /**
+ * Finds the least common multiple of a and b.
+ */
+ lcm: (a: BigNumber, b: BigNumber) => BigInteger;
+
+ /**
+ * Returns the largest of a and b.
+ */
+ max: (a: BigNumber, b: BigNumber) => BigInteger;
+
+ /**
+ * Returns the smallest of a and b.
+ */
+ min: (a: BigNumber, b: BigNumber) => BigInteger;
+
+ /**
+ * Equivalent to bigInt(-1).
+ */
+ minusOne: BigInteger;
+
+ /**
+ * Equivalent to bigInt(1).
+ */
+ one: BigInteger;
+
+ /**
+ * Returns a random number between min and max.
+ */
+ randBetween: (min: BigNumber, max: BigNumber, rng?: () => number) => BigInteger;
+
+ /**
+ * Equivalent to bigInt(0).
+ */
+ zero: BigInteger;
+ }
+
+ interface BigInteger {
+ /**
+ * Returns the absolute value of a bigInt.
+ */
+ abs(): BigInteger;
+
+ /**
+ * Performs addition.
+ */
+ add(number: BigNumber): BigInteger;
+
+ /**
+ * Performs the bitwise AND operation.
+ */
+ and(number: BigNumber): BigInteger;
+
+ /**
+ * Returns the number of digits required to represent a bigInt in binary.
+ */
+ bitLength(): BigInteger;
+
+ /**
+ * Performs a comparison between two numbers. If the numbers are equal, it returns 0.
+ * If the first number is greater, it returns 1. If the first number is lesser, it returns -1.
+ */
+ compare(number: BigNumber): number;
+
+ /**
+ * Performs a comparison between the absolute value of two numbers.
+ */
+ compareAbs(number: BigNumber): number;
+
+ /**
+ * Alias for the compare method.
+ */
+ compareTo(number: BigNumber): number;
+
+ /**
+ * Performs integer division, disregarding the remainder.
+ */
+ divide(number: BigNumber): BigInteger;
+
+ /**
+ * Performs division and returns an object with two properties: quotient and remainder.
+ * The sign of the remainder will match the sign of the dividend.
+ */
+ divmod(number: BigNumber): { quotient: BigInteger, remainder: BigInteger };
+
+ /**
+ * Alias for the equals method.
+ */
+ eq(number: BigNumber): boolean;
+
+ /**
+ * Checks if two numbers are equal.
+ */
+ equals(number: BigNumber): boolean;
+
+ /**
+ * Alias for the greaterOrEquals method.
+ */
+ geq(number: BigNumber): boolean;
+
+ /**
+ * Checks if the first number is greater than the second.
+ */
+ greater(number: BigNumber): boolean;
+
+ /**
+ * Checks if the first number is greater than or equal to the second.
+ */
+ greaterOrEquals(number: BigNumber): boolean;
+
+ /**
+ * Alias for the greater method.
+ */
+ gt(number: BigNumber): boolean;
+
+ /**
+ * Returns true if the first number is divisible by the second number, false otherwise.
+ */
+ isDivisibleBy(number: BigNumber): boolean;
+
+ /**
+ * Returns true if the number is even, false otherwise.
+ */
+ isEven(): boolean;
+
+ /**
+ * Returns true if the number is negative, false otherwise.
+ * Returns false for 0 and true for -0.
+ */
+ isNegative(): boolean;
+
+ /**
+ * Returns true if the number is odd, false otherwise.
+ */
+ isOdd(): boolean;
+
+ /**
+ * Return true if the number is positive, false otherwise.
+ * Returns true for 0 and false for -0.
+ */
+ isPositive(): boolean;
+
+ /**
+ * Returns true if the number is prime, false otherwise.
+ */
+ isPrime(strict?: boolean): boolean;
+
+ /**
+ * Returns true if the number is very likely to be prime, false otherwise.
+ */
+ isProbablePrime(iterations?: number, rng?: () => number): boolean;
+
+ /**
+ * Returns true if the number is 1 or -1, false otherwise.
+ */
+ isUnit(): boolean;
+
+ /**
+ * Return true if the number is 0 or -0, false otherwise.
+ */
+ isZero(): boolean;
+
+ /**
+ * Alias for the lesserOrEquals method.
+ */
+ leq(number: BigNumber): boolean;
+
+ /**
+ * Checks if the first number is lesser than the second.
+ */
+ lesser(number: BigNumber): boolean;
+
+ /**
+ * Checks if the first number is less than or equal to the second.
+ */
+ lesserOrEquals(number: BigNumber): boolean;
+
+ /**
+ * Alias for the lesser method.
+ */
+ lt(number: BigNumber): boolean;
+
+ /**
+ * Alias for the subtract method.
+ */
+ minus(number: BigNumber): BigInteger;
+
+ /**
+ * Performs division and returns the remainder, disregarding the quotient.
+ * The sign of the remainder will match the sign of the dividend.
+ */
+ mod(number: BigNumber): BigInteger;
+
+ /**
+ * Finds the multiplicative inverse of the number modulo mod.
+ */
+ modInv(number: BigNumber): BigInteger;
+
+ /**
+ * Takes the number to the power exp modulo mod.
+ */
+ modPow(exp: BigNumber, mod: BigNumber): BigInteger;
+
+ /**
+ * Performs multiplication.
+ */
+ multiply(number: BigNumber): BigInteger;
+
+ /**
+ * Reverses the sign of the number.
+ */
+ negate(): BigInteger;
+
+ /**
+ * Alias for the notEquals method.
+ */
+ neq(number: BigNumber): boolean;
+
+ /**
+ * Adds one to the number.
+ */
+ next(): BigInteger;
+
+ /**
+ * Performs the bitwise NOT operation.
+ */
+ not(): BigInteger;
+
+ /**
+ * Checks if two numbers are not equal.
+ */
+ notEquals(number: BigNumber): boolean;
+
+ /**
+ * Performs the bitwise OR operation.
+ */
+ or(number: BigNumber): BigInteger;
+
+ /**
+ * Alias for the divide method.
+ */
+ over(number: BigNumber): BigInteger;
+
+ /**
+ * Alias for the add method.
+ */
+ plus(number: BigNumber): BigInteger;
+
+ /**
+ * Performs exponentiation. If the exponent is less than 0, pow returns 0.
+ * bigInt.zero.pow(0) returns 1.
+ */
+ pow(number: BigNumber): BigInteger;
+
+ /**
+ * Subtracts one from the number.
+ */
+ prev(): BigInteger;
+
+ /**
+ * Alias for the mod method.
+ */
+ remainder(number: BigNumber): BigInteger;
+
+ /**
+ * Shifts the number left by n places in its binary representation.
+ * If a negative number is provided, it will shift right.
+ *
+ * Throws an error if number is outside of the range [-9007199254740992, 9007199254740992].
+ */
+ shiftLeft(number: BigNumber): BigInteger;
+
+ /**
+ * Shifts the number right by n places in its binary representation.
+ * If a negative number is provided, it will shift left.
+ *
+ * Throws an error if number is outside of the range [-9007199254740992, 9007199254740992].
+ */
+ shiftRight(number: BigNumber): BigInteger;
+
+ /**
+ * Squares the number.
+ */
+ square(): BigInteger;
+
+ /**
+ * Performs subtraction.
+ */
+ subtract(number: BigNumber): BigInteger;
+
+ /**
+ * Alias for the multiply method.
+ */
+ times(number: BigNumber): BigInteger;
+
+ /**
+ *
+ * Converts a bigInt to an object representing it as an array of integers module the given radix.
+ */
+ toArray(radix: number): BaseArray;
+
+ /**
+ * Converts a bigInt into a native Javascript number. Loses precision for numbers outside the range.
+ */
+ toJSNumber(): number;
+
+ /**
+ * Converts a bigInt to a string.
+ */
+ toString(radix?: number, alphabet?: string): string;
+
+ /**
+ * Converts a bigInt to a string. This method is called behind the scenes in JSON.stringify.
+ */
+ toJSON(): string;
+
+ /**
+ * Converts a bigInt to a native Javascript number. This override allows you to use native
+ * arithmetic operators without explicit conversion.
+ */
+ valueOf(): number;
+
+ /**
+ * Performs the bitwise XOR operation.
+ */
+ xor(number: BigNumber): BigInteger;
+ }
+
+ // Array constant accessors
+ interface BigIntegerStatic {
+ '-999': BigInteger;
+ '-998': BigInteger;
+ '-997': BigInteger;
+ '-996': BigInteger;
+ '-995': BigInteger;
+ '-994': BigInteger;
+ '-993': BigInteger;
+ '-992': BigInteger;
+ '-991': BigInteger;
+ '-990': BigInteger;
+ '-989': BigInteger;
+ '-988': BigInteger;
+ '-987': BigInteger;
+ '-986': BigInteger;
+ '-985': BigInteger;
+ '-984': BigInteger;
+ '-983': BigInteger;
+ '-982': BigInteger;
+ '-981': BigInteger;
+ '-980': BigInteger;
+ '-979': BigInteger;
+ '-978': BigInteger;
+ '-977': BigInteger;
+ '-976': BigInteger;
+ '-975': BigInteger;
+ '-974': BigInteger;
+ '-973': BigInteger;
+ '-972': BigInteger;
+ '-971': BigInteger;
+ '-970': BigInteger;
+ '-969': BigInteger;
+ '-968': BigInteger;
+ '-967': BigInteger;
+ '-966': BigInteger;
+ '-965': BigInteger;
+ '-964': BigInteger;
+ '-963': BigInteger;
+ '-962': BigInteger;
+ '-961': BigInteger;
+ '-960': BigInteger;
+ '-959': BigInteger;
+ '-958': BigInteger;
+ '-957': BigInteger;
+ '-956': BigInteger;
+ '-955': BigInteger;
+ '-954': BigInteger;
+ '-953': BigInteger;
+ '-952': BigInteger;
+ '-951': BigInteger;
+ '-950': BigInteger;
+ '-949': BigInteger;
+ '-948': BigInteger;
+ '-947': BigInteger;
+ '-946': BigInteger;
+ '-945': BigInteger;
+ '-944': BigInteger;
+ '-943': BigInteger;
+ '-942': BigInteger;
+ '-941': BigInteger;
+ '-940': BigInteger;
+ '-939': BigInteger;
+ '-938': BigInteger;
+ '-937': BigInteger;
+ '-936': BigInteger;
+ '-935': BigInteger;
+ '-934': BigInteger;
+ '-933': BigInteger;
+ '-932': BigInteger;
+ '-931': BigInteger;
+ '-930': BigInteger;
+ '-929': BigInteger;
+ '-928': BigInteger;
+ '-927': BigInteger;
+ '-926': BigInteger;
+ '-925': BigInteger;
+ '-924': BigInteger;
+ '-923': BigInteger;
+ '-922': BigInteger;
+ '-921': BigInteger;
+ '-920': BigInteger;
+ '-919': BigInteger;
+ '-918': BigInteger;
+ '-917': BigInteger;
+ '-916': BigInteger;
+ '-915': BigInteger;
+ '-914': BigInteger;
+ '-913': BigInteger;
+ '-912': BigInteger;
+ '-911': BigInteger;
+ '-910': BigInteger;
+ '-909': BigInteger;
+ '-908': BigInteger;
+ '-907': BigInteger;
+ '-906': BigInteger;
+ '-905': BigInteger;
+ '-904': BigInteger;
+ '-903': BigInteger;
+ '-902': BigInteger;
+ '-901': BigInteger;
+ '-900': BigInteger;
+ '-899': BigInteger;
+ '-898': BigInteger;
+ '-897': BigInteger;
+ '-896': BigInteger;
+ '-895': BigInteger;
+ '-894': BigInteger;
+ '-893': BigInteger;
+ '-892': BigInteger;
+ '-891': BigInteger;
+ '-890': BigInteger;
+ '-889': BigInteger;
+ '-888': BigInteger;
+ '-887': BigInteger;
+ '-886': BigInteger;
+ '-885': BigInteger;
+ '-884': BigInteger;
+ '-883': BigInteger;
+ '-882': BigInteger;
+ '-881': BigInteger;
+ '-880': BigInteger;
+ '-879': BigInteger;
+ '-878': BigInteger;
+ '-877': BigInteger;
+ '-876': BigInteger;
+ '-875': BigInteger;
+ '-874': BigInteger;
+ '-873': BigInteger;
+ '-872': BigInteger;
+ '-871': BigInteger;
+ '-870': BigInteger;
+ '-869': BigInteger;
+ '-868': BigInteger;
+ '-867': BigInteger;
+ '-866': BigInteger;
+ '-865': BigInteger;
+ '-864': BigInteger;
+ '-863': BigInteger;
+ '-862': BigInteger;
+ '-861': BigInteger;
+ '-860': BigInteger;
+ '-859': BigInteger;
+ '-858': BigInteger;
+ '-857': BigInteger;
+ '-856': BigInteger;
+ '-855': BigInteger;
+ '-854': BigInteger;
+ '-853': BigInteger;
+ '-852': BigInteger;
+ '-851': BigInteger;
+ '-850': BigInteger;
+ '-849': BigInteger;
+ '-848': BigInteger;
+ '-847': BigInteger;
+ '-846': BigInteger;
+ '-845': BigInteger;
+ '-844': BigInteger;
+ '-843': BigInteger;
+ '-842': BigInteger;
+ '-841': BigInteger;
+ '-840': BigInteger;
+ '-839': BigInteger;
+ '-838': BigInteger;
+ '-837': BigInteger;
+ '-836': BigInteger;
+ '-835': BigInteger;
+ '-834': BigInteger;
+ '-833': BigInteger;
+ '-832': BigInteger;
+ '-831': BigInteger;
+ '-830': BigInteger;
+ '-829': BigInteger;
+ '-828': BigInteger;
+ '-827': BigInteger;
+ '-826': BigInteger;
+ '-825': BigInteger;
+ '-824': BigInteger;
+ '-823': BigInteger;
+ '-822': BigInteger;
+ '-821': BigInteger;
+ '-820': BigInteger;
+ '-819': BigInteger;
+ '-818': BigInteger;
+ '-817': BigInteger;
+ '-816': BigInteger;
+ '-815': BigInteger;
+ '-814': BigInteger;
+ '-813': BigInteger;
+ '-812': BigInteger;
+ '-811': BigInteger;
+ '-810': BigInteger;
+ '-809': BigInteger;
+ '-808': BigInteger;
+ '-807': BigInteger;
+ '-806': BigInteger;
+ '-805': BigInteger;
+ '-804': BigInteger;
+ '-803': BigInteger;
+ '-802': BigInteger;
+ '-801': BigInteger;
+ '-800': BigInteger;
+ '-799': BigInteger;
+ '-798': BigInteger;
+ '-797': BigInteger;
+ '-796': BigInteger;
+ '-795': BigInteger;
+ '-794': BigInteger;
+ '-793': BigInteger;
+ '-792': BigInteger;
+ '-791': BigInteger;
+ '-790': BigInteger;
+ '-789': BigInteger;
+ '-788': BigInteger;
+ '-787': BigInteger;
+ '-786': BigInteger;
+ '-785': BigInteger;
+ '-784': BigInteger;
+ '-783': BigInteger;
+ '-782': BigInteger;
+ '-781': BigInteger;
+ '-780': BigInteger;
+ '-779': BigInteger;
+ '-778': BigInteger;
+ '-777': BigInteger;
+ '-776': BigInteger;
+ '-775': BigInteger;
+ '-774': BigInteger;
+ '-773': BigInteger;
+ '-772': BigInteger;
+ '-771': BigInteger;
+ '-770': BigInteger;
+ '-769': BigInteger;
+ '-768': BigInteger;
+ '-767': BigInteger;
+ '-766': BigInteger;
+ '-765': BigInteger;
+ '-764': BigInteger;
+ '-763': BigInteger;
+ '-762': BigInteger;
+ '-761': BigInteger;
+ '-760': BigInteger;
+ '-759': BigInteger;
+ '-758': BigInteger;
+ '-757': BigInteger;
+ '-756': BigInteger;
+ '-755': BigInteger;
+ '-754': BigInteger;
+ '-753': BigInteger;
+ '-752': BigInteger;
+ '-751': BigInteger;
+ '-750': BigInteger;
+ '-749': BigInteger;
+ '-748': BigInteger;
+ '-747': BigInteger;
+ '-746': BigInteger;
+ '-745': BigInteger;
+ '-744': BigInteger;
+ '-743': BigInteger;
+ '-742': BigInteger;
+ '-741': BigInteger;
+ '-740': BigInteger;
+ '-739': BigInteger;
+ '-738': BigInteger;
+ '-737': BigInteger;
+ '-736': BigInteger;
+ '-735': BigInteger;
+ '-734': BigInteger;
+ '-733': BigInteger;
+ '-732': BigInteger;
+ '-731': BigInteger;
+ '-730': BigInteger;
+ '-729': BigInteger;
+ '-728': BigInteger;
+ '-727': BigInteger;
+ '-726': BigInteger;
+ '-725': BigInteger;
+ '-724': BigInteger;
+ '-723': BigInteger;
+ '-722': BigInteger;
+ '-721': BigInteger;
+ '-720': BigInteger;
+ '-719': BigInteger;
+ '-718': BigInteger;
+ '-717': BigInteger;
+ '-716': BigInteger;
+ '-715': BigInteger;
+ '-714': BigInteger;
+ '-713': BigInteger;
+ '-712': BigInteger;
+ '-711': BigInteger;
+ '-710': BigInteger;
+ '-709': BigInteger;
+ '-708': BigInteger;
+ '-707': BigInteger;
+ '-706': BigInteger;
+ '-705': BigInteger;
+ '-704': BigInteger;
+ '-703': BigInteger;
+ '-702': BigInteger;
+ '-701': BigInteger;
+ '-700': BigInteger;
+ '-699': BigInteger;
+ '-698': BigInteger;
+ '-697': BigInteger;
+ '-696': BigInteger;
+ '-695': BigInteger;
+ '-694': BigInteger;
+ '-693': BigInteger;
+ '-692': BigInteger;
+ '-691': BigInteger;
+ '-690': BigInteger;
+ '-689': BigInteger;
+ '-688': BigInteger;
+ '-687': BigInteger;
+ '-686': BigInteger;
+ '-685': BigInteger;
+ '-684': BigInteger;
+ '-683': BigInteger;
+ '-682': BigInteger;
+ '-681': BigInteger;
+ '-680': BigInteger;
+ '-679': BigInteger;
+ '-678': BigInteger;
+ '-677': BigInteger;
+ '-676': BigInteger;
+ '-675': BigInteger;
+ '-674': BigInteger;
+ '-673': BigInteger;
+ '-672': BigInteger;
+ '-671': BigInteger;
+ '-670': BigInteger;
+ '-669': BigInteger;
+ '-668': BigInteger;
+ '-667': BigInteger;
+ '-666': BigInteger;
+ '-665': BigInteger;
+ '-664': BigInteger;
+ '-663': BigInteger;
+ '-662': BigInteger;
+ '-661': BigInteger;
+ '-660': BigInteger;
+ '-659': BigInteger;
+ '-658': BigInteger;
+ '-657': BigInteger;
+ '-656': BigInteger;
+ '-655': BigInteger;
+ '-654': BigInteger;
+ '-653': BigInteger;
+ '-652': BigInteger;
+ '-651': BigInteger;
+ '-650': BigInteger;
+ '-649': BigInteger;
+ '-648': BigInteger;
+ '-647': BigInteger;
+ '-646': BigInteger;
+ '-645': BigInteger;
+ '-644': BigInteger;
+ '-643': BigInteger;
+ '-642': BigInteger;
+ '-641': BigInteger;
+ '-640': BigInteger;
+ '-639': BigInteger;
+ '-638': BigInteger;
+ '-637': BigInteger;
+ '-636': BigInteger;
+ '-635': BigInteger;
+ '-634': BigInteger;
+ '-633': BigInteger;
+ '-632': BigInteger;
+ '-631': BigInteger;
+ '-630': BigInteger;
+ '-629': BigInteger;
+ '-628': BigInteger;
+ '-627': BigInteger;
+ '-626': BigInteger;
+ '-625': BigInteger;
+ '-624': BigInteger;
+ '-623': BigInteger;
+ '-622': BigInteger;
+ '-621': BigInteger;
+ '-620': BigInteger;
+ '-619': BigInteger;
+ '-618': BigInteger;
+ '-617': BigInteger;
+ '-616': BigInteger;
+ '-615': BigInteger;
+ '-614': BigInteger;
+ '-613': BigInteger;
+ '-612': BigInteger;
+ '-611': BigInteger;
+ '-610': BigInteger;
+ '-609': BigInteger;
+ '-608': BigInteger;
+ '-607': BigInteger;
+ '-606': BigInteger;
+ '-605': BigInteger;
+ '-604': BigInteger;
+ '-603': BigInteger;
+ '-602': BigInteger;
+ '-601': BigInteger;
+ '-600': BigInteger;
+ '-599': BigInteger;
+ '-598': BigInteger;
+ '-597': BigInteger;
+ '-596': BigInteger;
+ '-595': BigInteger;
+ '-594': BigInteger;
+ '-593': BigInteger;
+ '-592': BigInteger;
+ '-591': BigInteger;
+ '-590': BigInteger;
+ '-589': BigInteger;
+ '-588': BigInteger;
+ '-587': BigInteger;
+ '-586': BigInteger;
+ '-585': BigInteger;
+ '-584': BigInteger;
+ '-583': BigInteger;
+ '-582': BigInteger;
+ '-581': BigInteger;
+ '-580': BigInteger;
+ '-579': BigInteger;
+ '-578': BigInteger;
+ '-577': BigInteger;
+ '-576': BigInteger;
+ '-575': BigInteger;
+ '-574': BigInteger;
+ '-573': BigInteger;
+ '-572': BigInteger;
+ '-571': BigInteger;
+ '-570': BigInteger;
+ '-569': BigInteger;
+ '-568': BigInteger;
+ '-567': BigInteger;
+ '-566': BigInteger;
+ '-565': BigInteger;
+ '-564': BigInteger;
+ '-563': BigInteger;
+ '-562': BigInteger;
+ '-561': BigInteger;
+ '-560': BigInteger;
+ '-559': BigInteger;
+ '-558': BigInteger;
+ '-557': BigInteger;
+ '-556': BigInteger;
+ '-555': BigInteger;
+ '-554': BigInteger;
+ '-553': BigInteger;
+ '-552': BigInteger;
+ '-551': BigInteger;
+ '-550': BigInteger;
+ '-549': BigInteger;
+ '-548': BigInteger;
+ '-547': BigInteger;
+ '-546': BigInteger;
+ '-545': BigInteger;
+ '-544': BigInteger;
+ '-543': BigInteger;
+ '-542': BigInteger;
+ '-541': BigInteger;
+ '-540': BigInteger;
+ '-539': BigInteger;
+ '-538': BigInteger;
+ '-537': BigInteger;
+ '-536': BigInteger;
+ '-535': BigInteger;
+ '-534': BigInteger;
+ '-533': BigInteger;
+ '-532': BigInteger;
+ '-531': BigInteger;
+ '-530': BigInteger;
+ '-529': BigInteger;
+ '-528': BigInteger;
+ '-527': BigInteger;
+ '-526': BigInteger;
+ '-525': BigInteger;
+ '-524': BigInteger;
+ '-523': BigInteger;
+ '-522': BigInteger;
+ '-521': BigInteger;
+ '-520': BigInteger;
+ '-519': BigInteger;
+ '-518': BigInteger;
+ '-517': BigInteger;
+ '-516': BigInteger;
+ '-515': BigInteger;
+ '-514': BigInteger;
+ '-513': BigInteger;
+ '-512': BigInteger;
+ '-511': BigInteger;
+ '-510': BigInteger;
+ '-509': BigInteger;
+ '-508': BigInteger;
+ '-507': BigInteger;
+ '-506': BigInteger;
+ '-505': BigInteger;
+ '-504': BigInteger;
+ '-503': BigInteger;
+ '-502': BigInteger;
+ '-501': BigInteger;
+ '-500': BigInteger;
+ '-499': BigInteger;
+ '-498': BigInteger;
+ '-497': BigInteger;
+ '-496': BigInteger;
+ '-495': BigInteger;
+ '-494': BigInteger;
+ '-493': BigInteger;
+ '-492': BigInteger;
+ '-491': BigInteger;
+ '-490': BigInteger;
+ '-489': BigInteger;
+ '-488': BigInteger;
+ '-487': BigInteger;
+ '-486': BigInteger;
+ '-485': BigInteger;
+ '-484': BigInteger;
+ '-483': BigInteger;
+ '-482': BigInteger;
+ '-481': BigInteger;
+ '-480': BigInteger;
+ '-479': BigInteger;
+ '-478': BigInteger;
+ '-477': BigInteger;
+ '-476': BigInteger;
+ '-475': BigInteger;
+ '-474': BigInteger;
+ '-473': BigInteger;
+ '-472': BigInteger;
+ '-471': BigInteger;
+ '-470': BigInteger;
+ '-469': BigInteger;
+ '-468': BigInteger;
+ '-467': BigInteger;
+ '-466': BigInteger;
+ '-465': BigInteger;
+ '-464': BigInteger;
+ '-463': BigInteger;
+ '-462': BigInteger;
+ '-461': BigInteger;
+ '-460': BigInteger;
+ '-459': BigInteger;
+ '-458': BigInteger;
+ '-457': BigInteger;
+ '-456': BigInteger;
+ '-455': BigInteger;
+ '-454': BigInteger;
+ '-453': BigInteger;
+ '-452': BigInteger;
+ '-451': BigInteger;
+ '-450': BigInteger;
+ '-449': BigInteger;
+ '-448': BigInteger;
+ '-447': BigInteger;
+ '-446': BigInteger;
+ '-445': BigInteger;
+ '-444': BigInteger;
+ '-443': BigInteger;
+ '-442': BigInteger;
+ '-441': BigInteger;
+ '-440': BigInteger;
+ '-439': BigInteger;
+ '-438': BigInteger;
+ '-437': BigInteger;
+ '-436': BigInteger;
+ '-435': BigInteger;
+ '-434': BigInteger;
+ '-433': BigInteger;
+ '-432': BigInteger;
+ '-431': BigInteger;
+ '-430': BigInteger;
+ '-429': BigInteger;
+ '-428': BigInteger;
+ '-427': BigInteger;
+ '-426': BigInteger;
+ '-425': BigInteger;
+ '-424': BigInteger;
+ '-423': BigInteger;
+ '-422': BigInteger;
+ '-421': BigInteger;
+ '-420': BigInteger;
+ '-419': BigInteger;
+ '-418': BigInteger;
+ '-417': BigInteger;
+ '-416': BigInteger;
+ '-415': BigInteger;
+ '-414': BigInteger;
+ '-413': BigInteger;
+ '-412': BigInteger;
+ '-411': BigInteger;
+ '-410': BigInteger;
+ '-409': BigInteger;
+ '-408': BigInteger;
+ '-407': BigInteger;
+ '-406': BigInteger;
+ '-405': BigInteger;
+ '-404': BigInteger;
+ '-403': BigInteger;
+ '-402': BigInteger;
+ '-401': BigInteger;
+ '-400': BigInteger;
+ '-399': BigInteger;
+ '-398': BigInteger;
+ '-397': BigInteger;
+ '-396': BigInteger;
+ '-395': BigInteger;
+ '-394': BigInteger;
+ '-393': BigInteger;
+ '-392': BigInteger;
+ '-391': BigInteger;
+ '-390': BigInteger;
+ '-389': BigInteger;
+ '-388': BigInteger;
+ '-387': BigInteger;
+ '-386': BigInteger;
+ '-385': BigInteger;
+ '-384': BigInteger;
+ '-383': BigInteger;
+ '-382': BigInteger;
+ '-381': BigInteger;
+ '-380': BigInteger;
+ '-379': BigInteger;
+ '-378': BigInteger;
+ '-377': BigInteger;
+ '-376': BigInteger;
+ '-375': BigInteger;
+ '-374': BigInteger;
+ '-373': BigInteger;
+ '-372': BigInteger;
+ '-371': BigInteger;
+ '-370': BigInteger;
+ '-369': BigInteger;
+ '-368': BigInteger;
+ '-367': BigInteger;
+ '-366': BigInteger;
+ '-365': BigInteger;
+ '-364': BigInteger;
+ '-363': BigInteger;
+ '-362': BigInteger;
+ '-361': BigInteger;
+ '-360': BigInteger;
+ '-359': BigInteger;
+ '-358': BigInteger;
+ '-357': BigInteger;
+ '-356': BigInteger;
+ '-355': BigInteger;
+ '-354': BigInteger;
+ '-353': BigInteger;
+ '-352': BigInteger;
+ '-351': BigInteger;
+ '-350': BigInteger;
+ '-349': BigInteger;
+ '-348': BigInteger;
+ '-347': BigInteger;
+ '-346': BigInteger;
+ '-345': BigInteger;
+ '-344': BigInteger;
+ '-343': BigInteger;
+ '-342': BigInteger;
+ '-341': BigInteger;
+ '-340': BigInteger;
+ '-339': BigInteger;
+ '-338': BigInteger;
+ '-337': BigInteger;
+ '-336': BigInteger;
+ '-335': BigInteger;
+ '-334': BigInteger;
+ '-333': BigInteger;
+ '-332': BigInteger;
+ '-331': BigInteger;
+ '-330': BigInteger;
+ '-329': BigInteger;
+ '-328': BigInteger;
+ '-327': BigInteger;
+ '-326': BigInteger;
+ '-325': BigInteger;
+ '-324': BigInteger;
+ '-323': BigInteger;
+ '-322': BigInteger;
+ '-321': BigInteger;
+ '-320': BigInteger;
+ '-319': BigInteger;
+ '-318': BigInteger;
+ '-317': BigInteger;
+ '-316': BigInteger;
+ '-315': BigInteger;
+ '-314': BigInteger;
+ '-313': BigInteger;
+ '-312': BigInteger;
+ '-311': BigInteger;
+ '-310': BigInteger;
+ '-309': BigInteger;
+ '-308': BigInteger;
+ '-307': BigInteger;
+ '-306': BigInteger;
+ '-305': BigInteger;
+ '-304': BigInteger;
+ '-303': BigInteger;
+ '-302': BigInteger;
+ '-301': BigInteger;
+ '-300': BigInteger;
+ '-299': BigInteger;
+ '-298': BigInteger;
+ '-297': BigInteger;
+ '-296': BigInteger;
+ '-295': BigInteger;
+ '-294': BigInteger;
+ '-293': BigInteger;
+ '-292': BigInteger;
+ '-291': BigInteger;
+ '-290': BigInteger;
+ '-289': BigInteger;
+ '-288': BigInteger;
+ '-287': BigInteger;
+ '-286': BigInteger;
+ '-285': BigInteger;
+ '-284': BigInteger;
+ '-283': BigInteger;
+ '-282': BigInteger;
+ '-281': BigInteger;
+ '-280': BigInteger;
+ '-279': BigInteger;
+ '-278': BigInteger;
+ '-277': BigInteger;
+ '-276': BigInteger;
+ '-275': BigInteger;
+ '-274': BigInteger;
+ '-273': BigInteger;
+ '-272': BigInteger;
+ '-271': BigInteger;
+ '-270': BigInteger;
+ '-269': BigInteger;
+ '-268': BigInteger;
+ '-267': BigInteger;
+ '-266': BigInteger;
+ '-265': BigInteger;
+ '-264': BigInteger;
+ '-263': BigInteger;
+ '-262': BigInteger;
+ '-261': BigInteger;
+ '-260': BigInteger;
+ '-259': BigInteger;
+ '-258': BigInteger;
+ '-257': BigInteger;
+ '-256': BigInteger;
+ '-255': BigInteger;
+ '-254': BigInteger;
+ '-253': BigInteger;
+ '-252': BigInteger;
+ '-251': BigInteger;
+ '-250': BigInteger;
+ '-249': BigInteger;
+ '-248': BigInteger;
+ '-247': BigInteger;
+ '-246': BigInteger;
+ '-245': BigInteger;
+ '-244': BigInteger;
+ '-243': BigInteger;
+ '-242': BigInteger;
+ '-241': BigInteger;
+ '-240': BigInteger;
+ '-239': BigInteger;
+ '-238': BigInteger;
+ '-237': BigInteger;
+ '-236': BigInteger;
+ '-235': BigInteger;
+ '-234': BigInteger;
+ '-233': BigInteger;
+ '-232': BigInteger;
+ '-231': BigInteger;
+ '-230': BigInteger;
+ '-229': BigInteger;
+ '-228': BigInteger;
+ '-227': BigInteger;
+ '-226': BigInteger;
+ '-225': BigInteger;
+ '-224': BigInteger;
+ '-223': BigInteger;
+ '-222': BigInteger;
+ '-221': BigInteger;
+ '-220': BigInteger;
+ '-219': BigInteger;
+ '-218': BigInteger;
+ '-217': BigInteger;
+ '-216': BigInteger;
+ '-215': BigInteger;
+ '-214': BigInteger;
+ '-213': BigInteger;
+ '-212': BigInteger;
+ '-211': BigInteger;
+ '-210': BigInteger;
+ '-209': BigInteger;
+ '-208': BigInteger;
+ '-207': BigInteger;
+ '-206': BigInteger;
+ '-205': BigInteger;
+ '-204': BigInteger;
+ '-203': BigInteger;
+ '-202': BigInteger;
+ '-201': BigInteger;
+ '-200': BigInteger;
+ '-199': BigInteger;
+ '-198': BigInteger;
+ '-197': BigInteger;
+ '-196': BigInteger;
+ '-195': BigInteger;
+ '-194': BigInteger;
+ '-193': BigInteger;
+ '-192': BigInteger;
+ '-191': BigInteger;
+ '-190': BigInteger;
+ '-189': BigInteger;
+ '-188': BigInteger;
+ '-187': BigInteger;
+ '-186': BigInteger;
+ '-185': BigInteger;
+ '-184': BigInteger;
+ '-183': BigInteger;
+ '-182': BigInteger;
+ '-181': BigInteger;
+ '-180': BigInteger;
+ '-179': BigInteger;
+ '-178': BigInteger;
+ '-177': BigInteger;
+ '-176': BigInteger;
+ '-175': BigInteger;
+ '-174': BigInteger;
+ '-173': BigInteger;
+ '-172': BigInteger;
+ '-171': BigInteger;
+ '-170': BigInteger;
+ '-169': BigInteger;
+ '-168': BigInteger;
+ '-167': BigInteger;
+ '-166': BigInteger;
+ '-165': BigInteger;
+ '-164': BigInteger;
+ '-163': BigInteger;
+ '-162': BigInteger;
+ '-161': BigInteger;
+ '-160': BigInteger;
+ '-159': BigInteger;
+ '-158': BigInteger;
+ '-157': BigInteger;
+ '-156': BigInteger;
+ '-155': BigInteger;
+ '-154': BigInteger;
+ '-153': BigInteger;
+ '-152': BigInteger;
+ '-151': BigInteger;
+ '-150': BigInteger;
+ '-149': BigInteger;
+ '-148': BigInteger;
+ '-147': BigInteger;
+ '-146': BigInteger;
+ '-145': BigInteger;
+ '-144': BigInteger;
+ '-143': BigInteger;
+ '-142': BigInteger;
+ '-141': BigInteger;
+ '-140': BigInteger;
+ '-139': BigInteger;
+ '-138': BigInteger;
+ '-137': BigInteger;
+ '-136': BigInteger;
+ '-135': BigInteger;
+ '-134': BigInteger;
+ '-133': BigInteger;
+ '-132': BigInteger;
+ '-131': BigInteger;
+ '-130': BigInteger;
+ '-129': BigInteger;
+ '-128': BigInteger;
+ '-127': BigInteger;
+ '-126': BigInteger;
+ '-125': BigInteger;
+ '-124': BigInteger;
+ '-123': BigInteger;
+ '-122': BigInteger;
+ '-121': BigInteger;
+ '-120': BigInteger;
+ '-119': BigInteger;
+ '-118': BigInteger;
+ '-117': BigInteger;
+ '-116': BigInteger;
+ '-115': BigInteger;
+ '-114': BigInteger;
+ '-113': BigInteger;
+ '-112': BigInteger;
+ '-111': BigInteger;
+ '-110': BigInteger;
+ '-109': BigInteger;
+ '-108': BigInteger;
+ '-107': BigInteger;
+ '-106': BigInteger;
+ '-105': BigInteger;
+ '-104': BigInteger;
+ '-103': BigInteger;
+ '-102': BigInteger;
+ '-101': BigInteger;
+ '-100': BigInteger;
+ '-99': BigInteger;
+ '-98': BigInteger;
+ '-97': BigInteger;
+ '-96': BigInteger;
+ '-95': BigInteger;
+ '-94': BigInteger;
+ '-93': BigInteger;
+ '-92': BigInteger;
+ '-91': BigInteger;
+ '-90': BigInteger;
+ '-89': BigInteger;
+ '-88': BigInteger;
+ '-87': BigInteger;
+ '-86': BigInteger;
+ '-85': BigInteger;
+ '-84': BigInteger;
+ '-83': BigInteger;
+ '-82': BigInteger;
+ '-81': BigInteger;
+ '-80': BigInteger;
+ '-79': BigInteger;
+ '-78': BigInteger;
+ '-77': BigInteger;
+ '-76': BigInteger;
+ '-75': BigInteger;
+ '-74': BigInteger;
+ '-73': BigInteger;
+ '-72': BigInteger;
+ '-71': BigInteger;
+ '-70': BigInteger;
+ '-69': BigInteger;
+ '-68': BigInteger;
+ '-67': BigInteger;
+ '-66': BigInteger;
+ '-65': BigInteger;
+ '-64': BigInteger;
+ '-63': BigInteger;
+ '-62': BigInteger;
+ '-61': BigInteger;
+ '-60': BigInteger;
+ '-59': BigInteger;
+ '-58': BigInteger;
+ '-57': BigInteger;
+ '-56': BigInteger;
+ '-55': BigInteger;
+ '-54': BigInteger;
+ '-53': BigInteger;
+ '-52': BigInteger;
+ '-51': BigInteger;
+ '-50': BigInteger;
+ '-49': BigInteger;
+ '-48': BigInteger;
+ '-47': BigInteger;
+ '-46': BigInteger;
+ '-45': BigInteger;
+ '-44': BigInteger;
+ '-43': BigInteger;
+ '-42': BigInteger;
+ '-41': BigInteger;
+ '-40': BigInteger;
+ '-39': BigInteger;
+ '-38': BigInteger;
+ '-37': BigInteger;
+ '-36': BigInteger;
+ '-35': BigInteger;
+ '-34': BigInteger;
+ '-33': BigInteger;
+ '-32': BigInteger;
+ '-31': BigInteger;
+ '-30': BigInteger;
+ '-29': BigInteger;
+ '-28': BigInteger;
+ '-27': BigInteger;
+ '-26': BigInteger;
+ '-25': BigInteger;
+ '-24': BigInteger;
+ '-23': BigInteger;
+ '-22': BigInteger;
+ '-21': BigInteger;
+ '-20': BigInteger;
+ '-19': BigInteger;
+ '-18': BigInteger;
+ '-17': BigInteger;
+ '-16': BigInteger;
+ '-15': BigInteger;
+ '-14': BigInteger;
+ '-13': BigInteger;
+ '-12': BigInteger;
+ '-11': BigInteger;
+ '-10': BigInteger;
+ '-9': BigInteger;
+ '-8': BigInteger;
+ '-7': BigInteger;
+ '-6': BigInteger;
+ '-5': BigInteger;
+ '-4': BigInteger;
+ '-3': BigInteger;
+ '-2': BigInteger;
+ '-1': BigInteger;
+ '0': BigInteger;
+ '1': BigInteger;
+ '2': BigInteger;
+ '3': BigInteger;
+ '4': BigInteger;
+ '5': BigInteger;
+ '6': BigInteger;
+ '7': BigInteger;
+ '8': BigInteger;
+ '9': BigInteger;
+ '10': BigInteger;
+ '11': BigInteger;
+ '12': BigInteger;
+ '13': BigInteger;
+ '14': BigInteger;
+ '15': BigInteger;
+ '16': BigInteger;
+ '17': BigInteger;
+ '18': BigInteger;
+ '19': BigInteger;
+ '20': BigInteger;
+ '21': BigInteger;
+ '22': BigInteger;
+ '23': BigInteger;
+ '24': BigInteger;
+ '25': BigInteger;
+ '26': BigInteger;
+ '27': BigInteger;
+ '28': BigInteger;
+ '29': BigInteger;
+ '30': BigInteger;
+ '31': BigInteger;
+ '32': BigInteger;
+ '33': BigInteger;
+ '34': BigInteger;
+ '35': BigInteger;
+ '36': BigInteger;
+ '37': BigInteger;
+ '38': BigInteger;
+ '39': BigInteger;
+ '40': BigInteger;
+ '41': BigInteger;
+ '42': BigInteger;
+ '43': BigInteger;
+ '44': BigInteger;
+ '45': BigInteger;
+ '46': BigInteger;
+ '47': BigInteger;
+ '48': BigInteger;
+ '49': BigInteger;
+ '50': BigInteger;
+ '51': BigInteger;
+ '52': BigInteger;
+ '53': BigInteger;
+ '54': BigInteger;
+ '55': BigInteger;
+ '56': BigInteger;
+ '57': BigInteger;
+ '58': BigInteger;
+ '59': BigInteger;
+ '60': BigInteger;
+ '61': BigInteger;
+ '62': BigInteger;
+ '63': BigInteger;
+ '64': BigInteger;
+ '65': BigInteger;
+ '66': BigInteger;
+ '67': BigInteger;
+ '68': BigInteger;
+ '69': BigInteger;
+ '70': BigInteger;
+ '71': BigInteger;
+ '72': BigInteger;
+ '73': BigInteger;
+ '74': BigInteger;
+ '75': BigInteger;
+ '76': BigInteger;
+ '77': BigInteger;
+ '78': BigInteger;
+ '79': BigInteger;
+ '80': BigInteger;
+ '81': BigInteger;
+ '82': BigInteger;
+ '83': BigInteger;
+ '84': BigInteger;
+ '85': BigInteger;
+ '86': BigInteger;
+ '87': BigInteger;
+ '88': BigInteger;
+ '89': BigInteger;
+ '90': BigInteger;
+ '91': BigInteger;
+ '92': BigInteger;
+ '93': BigInteger;
+ '94': BigInteger;
+ '95': BigInteger;
+ '96': BigInteger;
+ '97': BigInteger;
+ '98': BigInteger;
+ '99': BigInteger;
+ '100': BigInteger;
+ '101': BigInteger;
+ '102': BigInteger;
+ '103': BigInteger;
+ '104': BigInteger;
+ '105': BigInteger;
+ '106': BigInteger;
+ '107': BigInteger;
+ '108': BigInteger;
+ '109': BigInteger;
+ '110': BigInteger;
+ '111': BigInteger;
+ '112': BigInteger;
+ '113': BigInteger;
+ '114': BigInteger;
+ '115': BigInteger;
+ '116': BigInteger;
+ '117': BigInteger;
+ '118': BigInteger;
+ '119': BigInteger;
+ '120': BigInteger;
+ '121': BigInteger;
+ '122': BigInteger;
+ '123': BigInteger;
+ '124': BigInteger;
+ '125': BigInteger;
+ '126': BigInteger;
+ '127': BigInteger;
+ '128': BigInteger;
+ '129': BigInteger;
+ '130': BigInteger;
+ '131': BigInteger;
+ '132': BigInteger;
+ '133': BigInteger;
+ '134': BigInteger;
+ '135': BigInteger;
+ '136': BigInteger;
+ '137': BigInteger;
+ '138': BigInteger;
+ '139': BigInteger;
+ '140': BigInteger;
+ '141': BigInteger;
+ '142': BigInteger;
+ '143': BigInteger;
+ '144': BigInteger;
+ '145': BigInteger;
+ '146': BigInteger;
+ '147': BigInteger;
+ '148': BigInteger;
+ '149': BigInteger;
+ '150': BigInteger;
+ '151': BigInteger;
+ '152': BigInteger;
+ '153': BigInteger;
+ '154': BigInteger;
+ '155': BigInteger;
+ '156': BigInteger;
+ '157': BigInteger;
+ '158': BigInteger;
+ '159': BigInteger;
+ '160': BigInteger;
+ '161': BigInteger;
+ '162': BigInteger;
+ '163': BigInteger;
+ '164': BigInteger;
+ '165': BigInteger;
+ '166': BigInteger;
+ '167': BigInteger;
+ '168': BigInteger;
+ '169': BigInteger;
+ '170': BigInteger;
+ '171': BigInteger;
+ '172': BigInteger;
+ '173': BigInteger;
+ '174': BigInteger;
+ '175': BigInteger;
+ '176': BigInteger;
+ '177': BigInteger;
+ '178': BigInteger;
+ '179': BigInteger;
+ '180': BigInteger;
+ '181': BigInteger;
+ '182': BigInteger;
+ '183': BigInteger;
+ '184': BigInteger;
+ '185': BigInteger;
+ '186': BigInteger;
+ '187': BigInteger;
+ '188': BigInteger;
+ '189': BigInteger;
+ '190': BigInteger;
+ '191': BigInteger;
+ '192': BigInteger;
+ '193': BigInteger;
+ '194': BigInteger;
+ '195': BigInteger;
+ '196': BigInteger;
+ '197': BigInteger;
+ '198': BigInteger;
+ '199': BigInteger;
+ '200': BigInteger;
+ '201': BigInteger;
+ '202': BigInteger;
+ '203': BigInteger;
+ '204': BigInteger;
+ '205': BigInteger;
+ '206': BigInteger;
+ '207': BigInteger;
+ '208': BigInteger;
+ '209': BigInteger;
+ '210': BigInteger;
+ '211': BigInteger;
+ '212': BigInteger;
+ '213': BigInteger;
+ '214': BigInteger;
+ '215': BigInteger;
+ '216': BigInteger;
+ '217': BigInteger;
+ '218': BigInteger;
+ '219': BigInteger;
+ '220': BigInteger;
+ '221': BigInteger;
+ '222': BigInteger;
+ '223': BigInteger;
+ '224': BigInteger;
+ '225': BigInteger;
+ '226': BigInteger;
+ '227': BigInteger;
+ '228': BigInteger;
+ '229': BigInteger;
+ '230': BigInteger;
+ '231': BigInteger;
+ '232': BigInteger;
+ '233': BigInteger;
+ '234': BigInteger;
+ '235': BigInteger;
+ '236': BigInteger;
+ '237': BigInteger;
+ '238': BigInteger;
+ '239': BigInteger;
+ '240': BigInteger;
+ '241': BigInteger;
+ '242': BigInteger;
+ '243': BigInteger;
+ '244': BigInteger;
+ '245': BigInteger;
+ '246': BigInteger;
+ '247': BigInteger;
+ '248': BigInteger;
+ '249': BigInteger;
+ '250': BigInteger;
+ '251': BigInteger;
+ '252': BigInteger;
+ '253': BigInteger;
+ '254': BigInteger;
+ '255': BigInteger;
+ '256': BigInteger;
+ '257': BigInteger;
+ '258': BigInteger;
+ '259': BigInteger;
+ '260': BigInteger;
+ '261': BigInteger;
+ '262': BigInteger;
+ '263': BigInteger;
+ '264': BigInteger;
+ '265': BigInteger;
+ '266': BigInteger;
+ '267': BigInteger;
+ '268': BigInteger;
+ '269': BigInteger;
+ '270': BigInteger;
+ '271': BigInteger;
+ '272': BigInteger;
+ '273': BigInteger;
+ '274': BigInteger;
+ '275': BigInteger;
+ '276': BigInteger;
+ '277': BigInteger;
+ '278': BigInteger;
+ '279': BigInteger;
+ '280': BigInteger;
+ '281': BigInteger;
+ '282': BigInteger;
+ '283': BigInteger;
+ '284': BigInteger;
+ '285': BigInteger;
+ '286': BigInteger;
+ '287': BigInteger;
+ '288': BigInteger;
+ '289': BigInteger;
+ '290': BigInteger;
+ '291': BigInteger;
+ '292': BigInteger;
+ '293': BigInteger;
+ '294': BigInteger;
+ '295': BigInteger;
+ '296': BigInteger;
+ '297': BigInteger;
+ '298': BigInteger;
+ '299': BigInteger;
+ '300': BigInteger;
+ '301': BigInteger;
+ '302': BigInteger;
+ '303': BigInteger;
+ '304': BigInteger;
+ '305': BigInteger;
+ '306': BigInteger;
+ '307': BigInteger;
+ '308': BigInteger;
+ '309': BigInteger;
+ '310': BigInteger;
+ '311': BigInteger;
+ '312': BigInteger;
+ '313': BigInteger;
+ '314': BigInteger;
+ '315': BigInteger;
+ '316': BigInteger;
+ '317': BigInteger;
+ '318': BigInteger;
+ '319': BigInteger;
+ '320': BigInteger;
+ '321': BigInteger;
+ '322': BigInteger;
+ '323': BigInteger;
+ '324': BigInteger;
+ '325': BigInteger;
+ '326': BigInteger;
+ '327': BigInteger;
+ '328': BigInteger;
+ '329': BigInteger;
+ '330': BigInteger;
+ '331': BigInteger;
+ '332': BigInteger;
+ '333': BigInteger;
+ '334': BigInteger;
+ '335': BigInteger;
+ '336': BigInteger;
+ '337': BigInteger;
+ '338': BigInteger;
+ '339': BigInteger;
+ '340': BigInteger;
+ '341': BigInteger;
+ '342': BigInteger;
+ '343': BigInteger;
+ '344': BigInteger;
+ '345': BigInteger;
+ '346': BigInteger;
+ '347': BigInteger;
+ '348': BigInteger;
+ '349': BigInteger;
+ '350': BigInteger;
+ '351': BigInteger;
+ '352': BigInteger;
+ '353': BigInteger;
+ '354': BigInteger;
+ '355': BigInteger;
+ '356': BigInteger;
+ '357': BigInteger;
+ '358': BigInteger;
+ '359': BigInteger;
+ '360': BigInteger;
+ '361': BigInteger;
+ '362': BigInteger;
+ '363': BigInteger;
+ '364': BigInteger;
+ '365': BigInteger;
+ '366': BigInteger;
+ '367': BigInteger;
+ '368': BigInteger;
+ '369': BigInteger;
+ '370': BigInteger;
+ '371': BigInteger;
+ '372': BigInteger;
+ '373': BigInteger;
+ '374': BigInteger;
+ '375': BigInteger;
+ '376': BigInteger;
+ '377': BigInteger;
+ '378': BigInteger;
+ '379': BigInteger;
+ '380': BigInteger;
+ '381': BigInteger;
+ '382': BigInteger;
+ '383': BigInteger;
+ '384': BigInteger;
+ '385': BigInteger;
+ '386': BigInteger;
+ '387': BigInteger;
+ '388': BigInteger;
+ '389': BigInteger;
+ '390': BigInteger;
+ '391': BigInteger;
+ '392': BigInteger;
+ '393': BigInteger;
+ '394': BigInteger;
+ '395': BigInteger;
+ '396': BigInteger;
+ '397': BigInteger;
+ '398': BigInteger;
+ '399': BigInteger;
+ '400': BigInteger;
+ '401': BigInteger;
+ '402': BigInteger;
+ '403': BigInteger;
+ '404': BigInteger;
+ '405': BigInteger;
+ '406': BigInteger;
+ '407': BigInteger;
+ '408': BigInteger;
+ '409': BigInteger;
+ '410': BigInteger;
+ '411': BigInteger;
+ '412': BigInteger;
+ '413': BigInteger;
+ '414': BigInteger;
+ '415': BigInteger;
+ '416': BigInteger;
+ '417': BigInteger;
+ '418': BigInteger;
+ '419': BigInteger;
+ '420': BigInteger;
+ '421': BigInteger;
+ '422': BigInteger;
+ '423': BigInteger;
+ '424': BigInteger;
+ '425': BigInteger;
+ '426': BigInteger;
+ '427': BigInteger;
+ '428': BigInteger;
+ '429': BigInteger;
+ '430': BigInteger;
+ '431': BigInteger;
+ '432': BigInteger;
+ '433': BigInteger;
+ '434': BigInteger;
+ '435': BigInteger;
+ '436': BigInteger;
+ '437': BigInteger;
+ '438': BigInteger;
+ '439': BigInteger;
+ '440': BigInteger;
+ '441': BigInteger;
+ '442': BigInteger;
+ '443': BigInteger;
+ '444': BigInteger;
+ '445': BigInteger;
+ '446': BigInteger;
+ '447': BigInteger;
+ '448': BigInteger;
+ '449': BigInteger;
+ '450': BigInteger;
+ '451': BigInteger;
+ '452': BigInteger;
+ '453': BigInteger;
+ '454': BigInteger;
+ '455': BigInteger;
+ '456': BigInteger;
+ '457': BigInteger;
+ '458': BigInteger;
+ '459': BigInteger;
+ '460': BigInteger;
+ '461': BigInteger;
+ '462': BigInteger;
+ '463': BigInteger;
+ '464': BigInteger;
+ '465': BigInteger;
+ '466': BigInteger;
+ '467': BigInteger;
+ '468': BigInteger;
+ '469': BigInteger;
+ '470': BigInteger;
+ '471': BigInteger;
+ '472': BigInteger;
+ '473': BigInteger;
+ '474': BigInteger;
+ '475': BigInteger;
+ '476': BigInteger;
+ '477': BigInteger;
+ '478': BigInteger;
+ '479': BigInteger;
+ '480': BigInteger;
+ '481': BigInteger;
+ '482': BigInteger;
+ '483': BigInteger;
+ '484': BigInteger;
+ '485': BigInteger;
+ '486': BigInteger;
+ '487': BigInteger;
+ '488': BigInteger;
+ '489': BigInteger;
+ '490': BigInteger;
+ '491': BigInteger;
+ '492': BigInteger;
+ '493': BigInteger;
+ '494': BigInteger;
+ '495': BigInteger;
+ '496': BigInteger;
+ '497': BigInteger;
+ '498': BigInteger;
+ '499': BigInteger;
+ '500': BigInteger;
+ '501': BigInteger;
+ '502': BigInteger;
+ '503': BigInteger;
+ '504': BigInteger;
+ '505': BigInteger;
+ '506': BigInteger;
+ '507': BigInteger;
+ '508': BigInteger;
+ '509': BigInteger;
+ '510': BigInteger;
+ '511': BigInteger;
+ '512': BigInteger;
+ '513': BigInteger;
+ '514': BigInteger;
+ '515': BigInteger;
+ '516': BigInteger;
+ '517': BigInteger;
+ '518': BigInteger;
+ '519': BigInteger;
+ '520': BigInteger;
+ '521': BigInteger;
+ '522': BigInteger;
+ '523': BigInteger;
+ '524': BigInteger;
+ '525': BigInteger;
+ '526': BigInteger;
+ '527': BigInteger;
+ '528': BigInteger;
+ '529': BigInteger;
+ '530': BigInteger;
+ '531': BigInteger;
+ '532': BigInteger;
+ '533': BigInteger;
+ '534': BigInteger;
+ '535': BigInteger;
+ '536': BigInteger;
+ '537': BigInteger;
+ '538': BigInteger;
+ '539': BigInteger;
+ '540': BigInteger;
+ '541': BigInteger;
+ '542': BigInteger;
+ '543': BigInteger;
+ '544': BigInteger;
+ '545': BigInteger;
+ '546': BigInteger;
+ '547': BigInteger;
+ '548': BigInteger;
+ '549': BigInteger;
+ '550': BigInteger;
+ '551': BigInteger;
+ '552': BigInteger;
+ '553': BigInteger;
+ '554': BigInteger;
+ '555': BigInteger;
+ '556': BigInteger;
+ '557': BigInteger;
+ '558': BigInteger;
+ '559': BigInteger;
+ '560': BigInteger;
+ '561': BigInteger;
+ '562': BigInteger;
+ '563': BigInteger;
+ '564': BigInteger;
+ '565': BigInteger;
+ '566': BigInteger;
+ '567': BigInteger;
+ '568': BigInteger;
+ '569': BigInteger;
+ '570': BigInteger;
+ '571': BigInteger;
+ '572': BigInteger;
+ '573': BigInteger;
+ '574': BigInteger;
+ '575': BigInteger;
+ '576': BigInteger;
+ '577': BigInteger;
+ '578': BigInteger;
+ '579': BigInteger;
+ '580': BigInteger;
+ '581': BigInteger;
+ '582': BigInteger;
+ '583': BigInteger;
+ '584': BigInteger;
+ '585': BigInteger;
+ '586': BigInteger;
+ '587': BigInteger;
+ '588': BigInteger;
+ '589': BigInteger;
+ '590': BigInteger;
+ '591': BigInteger;
+ '592': BigInteger;
+ '593': BigInteger;
+ '594': BigInteger;
+ '595': BigInteger;
+ '596': BigInteger;
+ '597': BigInteger;
+ '598': BigInteger;
+ '599': BigInteger;
+ '600': BigInteger;
+ '601': BigInteger;
+ '602': BigInteger;
+ '603': BigInteger;
+ '604': BigInteger;
+ '605': BigInteger;
+ '606': BigInteger;
+ '607': BigInteger;
+ '608': BigInteger;
+ '609': BigInteger;
+ '610': BigInteger;
+ '611': BigInteger;
+ '612': BigInteger;
+ '613': BigInteger;
+ '614': BigInteger;
+ '615': BigInteger;
+ '616': BigInteger;
+ '617': BigInteger;
+ '618': BigInteger;
+ '619': BigInteger;
+ '620': BigInteger;
+ '621': BigInteger;
+ '622': BigInteger;
+ '623': BigInteger;
+ '624': BigInteger;
+ '625': BigInteger;
+ '626': BigInteger;
+ '627': BigInteger;
+ '628': BigInteger;
+ '629': BigInteger;
+ '630': BigInteger;
+ '631': BigInteger;
+ '632': BigInteger;
+ '633': BigInteger;
+ '634': BigInteger;
+ '635': BigInteger;
+ '636': BigInteger;
+ '637': BigInteger;
+ '638': BigInteger;
+ '639': BigInteger;
+ '640': BigInteger;
+ '641': BigInteger;
+ '642': BigInteger;
+ '643': BigInteger;
+ '644': BigInteger;
+ '645': BigInteger;
+ '646': BigInteger;
+ '647': BigInteger;
+ '648': BigInteger;
+ '649': BigInteger;
+ '650': BigInteger;
+ '651': BigInteger;
+ '652': BigInteger;
+ '653': BigInteger;
+ '654': BigInteger;
+ '655': BigInteger;
+ '656': BigInteger;
+ '657': BigInteger;
+ '658': BigInteger;
+ '659': BigInteger;
+ '660': BigInteger;
+ '661': BigInteger;
+ '662': BigInteger;
+ '663': BigInteger;
+ '664': BigInteger;
+ '665': BigInteger;
+ '666': BigInteger;
+ '667': BigInteger;
+ '668': BigInteger;
+ '669': BigInteger;
+ '670': BigInteger;
+ '671': BigInteger;
+ '672': BigInteger;
+ '673': BigInteger;
+ '674': BigInteger;
+ '675': BigInteger;
+ '676': BigInteger;
+ '677': BigInteger;
+ '678': BigInteger;
+ '679': BigInteger;
+ '680': BigInteger;
+ '681': BigInteger;
+ '682': BigInteger;
+ '683': BigInteger;
+ '684': BigInteger;
+ '685': BigInteger;
+ '686': BigInteger;
+ '687': BigInteger;
+ '688': BigInteger;
+ '689': BigInteger;
+ '690': BigInteger;
+ '691': BigInteger;
+ '692': BigInteger;
+ '693': BigInteger;
+ '694': BigInteger;
+ '695': BigInteger;
+ '696': BigInteger;
+ '697': BigInteger;
+ '698': BigInteger;
+ '699': BigInteger;
+ '700': BigInteger;
+ '701': BigInteger;
+ '702': BigInteger;
+ '703': BigInteger;
+ '704': BigInteger;
+ '705': BigInteger;
+ '706': BigInteger;
+ '707': BigInteger;
+ '708': BigInteger;
+ '709': BigInteger;
+ '710': BigInteger;
+ '711': BigInteger;
+ '712': BigInteger;
+ '713': BigInteger;
+ '714': BigInteger;
+ '715': BigInteger;
+ '716': BigInteger;
+ '717': BigInteger;
+ '718': BigInteger;
+ '719': BigInteger;
+ '720': BigInteger;
+ '721': BigInteger;
+ '722': BigInteger;
+ '723': BigInteger;
+ '724': BigInteger;
+ '725': BigInteger;
+ '726': BigInteger;
+ '727': BigInteger;
+ '728': BigInteger;
+ '729': BigInteger;
+ '730': BigInteger;
+ '731': BigInteger;
+ '732': BigInteger;
+ '733': BigInteger;
+ '734': BigInteger;
+ '735': BigInteger;
+ '736': BigInteger;
+ '737': BigInteger;
+ '738': BigInteger;
+ '739': BigInteger;
+ '740': BigInteger;
+ '741': BigInteger;
+ '742': BigInteger;
+ '743': BigInteger;
+ '744': BigInteger;
+ '745': BigInteger;
+ '746': BigInteger;
+ '747': BigInteger;
+ '748': BigInteger;
+ '749': BigInteger;
+ '750': BigInteger;
+ '751': BigInteger;
+ '752': BigInteger;
+ '753': BigInteger;
+ '754': BigInteger;
+ '755': BigInteger;
+ '756': BigInteger;
+ '757': BigInteger;
+ '758': BigInteger;
+ '759': BigInteger;
+ '760': BigInteger;
+ '761': BigInteger;
+ '762': BigInteger;
+ '763': BigInteger;
+ '764': BigInteger;
+ '765': BigInteger;
+ '766': BigInteger;
+ '767': BigInteger;
+ '768': BigInteger;
+ '769': BigInteger;
+ '770': BigInteger;
+ '771': BigInteger;
+ '772': BigInteger;
+ '773': BigInteger;
+ '774': BigInteger;
+ '775': BigInteger;
+ '776': BigInteger;
+ '777': BigInteger;
+ '778': BigInteger;
+ '779': BigInteger;
+ '780': BigInteger;
+ '781': BigInteger;
+ '782': BigInteger;
+ '783': BigInteger;
+ '784': BigInteger;
+ '785': BigInteger;
+ '786': BigInteger;
+ '787': BigInteger;
+ '788': BigInteger;
+ '789': BigInteger;
+ '790': BigInteger;
+ '791': BigInteger;
+ '792': BigInteger;
+ '793': BigInteger;
+ '794': BigInteger;
+ '795': BigInteger;
+ '796': BigInteger;
+ '797': BigInteger;
+ '798': BigInteger;
+ '799': BigInteger;
+ '800': BigInteger;
+ '801': BigInteger;
+ '802': BigInteger;
+ '803': BigInteger;
+ '804': BigInteger;
+ '805': BigInteger;
+ '806': BigInteger;
+ '807': BigInteger;
+ '808': BigInteger;
+ '809': BigInteger;
+ '810': BigInteger;
+ '811': BigInteger;
+ '812': BigInteger;
+ '813': BigInteger;
+ '814': BigInteger;
+ '815': BigInteger;
+ '816': BigInteger;
+ '817': BigInteger;
+ '818': BigInteger;
+ '819': BigInteger;
+ '820': BigInteger;
+ '821': BigInteger;
+ '822': BigInteger;
+ '823': BigInteger;
+ '824': BigInteger;
+ '825': BigInteger;
+ '826': BigInteger;
+ '827': BigInteger;
+ '828': BigInteger;
+ '829': BigInteger;
+ '830': BigInteger;
+ '831': BigInteger;
+ '832': BigInteger;
+ '833': BigInteger;
+ '834': BigInteger;
+ '835': BigInteger;
+ '836': BigInteger;
+ '837': BigInteger;
+ '838': BigInteger;
+ '839': BigInteger;
+ '840': BigInteger;
+ '841': BigInteger;
+ '842': BigInteger;
+ '843': BigInteger;
+ '844': BigInteger;
+ '845': BigInteger;
+ '846': BigInteger;
+ '847': BigInteger;
+ '848': BigInteger;
+ '849': BigInteger;
+ '850': BigInteger;
+ '851': BigInteger;
+ '852': BigInteger;
+ '853': BigInteger;
+ '854': BigInteger;
+ '855': BigInteger;
+ '856': BigInteger;
+ '857': BigInteger;
+ '858': BigInteger;
+ '859': BigInteger;
+ '860': BigInteger;
+ '861': BigInteger;
+ '862': BigInteger;
+ '863': BigInteger;
+ '864': BigInteger;
+ '865': BigInteger;
+ '866': BigInteger;
+ '867': BigInteger;
+ '868': BigInteger;
+ '869': BigInteger;
+ '870': BigInteger;
+ '871': BigInteger;
+ '872': BigInteger;
+ '873': BigInteger;
+ '874': BigInteger;
+ '875': BigInteger;
+ '876': BigInteger;
+ '877': BigInteger;
+ '878': BigInteger;
+ '879': BigInteger;
+ '880': BigInteger;
+ '881': BigInteger;
+ '882': BigInteger;
+ '883': BigInteger;
+ '884': BigInteger;
+ '885': BigInteger;
+ '886': BigInteger;
+ '887': BigInteger;
+ '888': BigInteger;
+ '889': BigInteger;
+ '890': BigInteger;
+ '891': BigInteger;
+ '892': BigInteger;
+ '893': BigInteger;
+ '894': BigInteger;
+ '895': BigInteger;
+ '896': BigInteger;
+ '897': BigInteger;
+ '898': BigInteger;
+ '899': BigInteger;
+ '900': BigInteger;
+ '901': BigInteger;
+ '902': BigInteger;
+ '903': BigInteger;
+ '904': BigInteger;
+ '905': BigInteger;
+ '906': BigInteger;
+ '907': BigInteger;
+ '908': BigInteger;
+ '909': BigInteger;
+ '910': BigInteger;
+ '911': BigInteger;
+ '912': BigInteger;
+ '913': BigInteger;
+ '914': BigInteger;
+ '915': BigInteger;
+ '916': BigInteger;
+ '917': BigInteger;
+ '918': BigInteger;
+ '919': BigInteger;
+ '920': BigInteger;
+ '921': BigInteger;
+ '922': BigInteger;
+ '923': BigInteger;
+ '924': BigInteger;
+ '925': BigInteger;
+ '926': BigInteger;
+ '927': BigInteger;
+ '928': BigInteger;
+ '929': BigInteger;
+ '930': BigInteger;
+ '931': BigInteger;
+ '932': BigInteger;
+ '933': BigInteger;
+ '934': BigInteger;
+ '935': BigInteger;
+ '936': BigInteger;
+ '937': BigInteger;
+ '938': BigInteger;
+ '939': BigInteger;
+ '940': BigInteger;
+ '941': BigInteger;
+ '942': BigInteger;
+ '943': BigInteger;
+ '944': BigInteger;
+ '945': BigInteger;
+ '946': BigInteger;
+ '947': BigInteger;
+ '948': BigInteger;
+ '949': BigInteger;
+ '950': BigInteger;
+ '951': BigInteger;
+ '952': BigInteger;
+ '953': BigInteger;
+ '954': BigInteger;
+ '955': BigInteger;
+ '956': BigInteger;
+ '957': BigInteger;
+ '958': BigInteger;
+ '959': BigInteger;
+ '960': BigInteger;
+ '961': BigInteger;
+ '962': BigInteger;
+ '963': BigInteger;
+ '964': BigInteger;
+ '965': BigInteger;
+ '966': BigInteger;
+ '967': BigInteger;
+ '968': BigInteger;
+ '969': BigInteger;
+ '970': BigInteger;
+ '971': BigInteger;
+ '972': BigInteger;
+ '973': BigInteger;
+ '974': BigInteger;
+ '975': BigInteger;
+ '976': BigInteger;
+ '977': BigInteger;
+ '978': BigInteger;
+ '979': BigInteger;
+ '980': BigInteger;
+ '981': BigInteger;
+ '982': BigInteger;
+ '983': BigInteger;
+ '984': BigInteger;
+ '985': BigInteger;
+ '986': BigInteger;
+ '987': BigInteger;
+ '988': BigInteger;
+ '989': BigInteger;
+ '990': BigInteger;
+ '991': BigInteger;
+ '992': BigInteger;
+ '993': BigInteger;
+ '994': BigInteger;
+ '995': BigInteger;
+ '996': BigInteger;
+ '997': BigInteger;
+ '998': BigInteger;
+ '999': BigInteger;
+ }
+
+ interface BaseArray {
+ value: number[],
+ isNegative: boolean
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/big-integer/BigInteger.js b/temporary_modules/trezor-connect/node_modules/big-integer/BigInteger.js
new file mode 100644
index 00000000..ecda792d
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/big-integer/BigInteger.js
@@ -0,0 +1,1453 @@
+var bigInt = (function (undefined) {
+ "use strict";
+
+ var BASE = 1e7,
+ LOG_BASE = 7,
+ MAX_INT = 9007199254740992,
+ MAX_INT_ARR = smallToArray(MAX_INT),
+ DEFAULT_ALPHABET = "0123456789abcdefghijklmnopqrstuvwxyz";
+
+ var supportsNativeBigInt = typeof BigInt === "function";
+
+ function Integer(v, radix, alphabet, caseSensitive) {
+ if (typeof v === "undefined") return Integer[0];
+ if (typeof radix !== "undefined") return +radix === 10 && !alphabet ? parseValue(v) : parseBase(v, radix, alphabet, caseSensitive);
+ return parseValue(v);
+ }
+
+ function BigInteger(value, sign) {
+ this.value = value;
+ this.sign = sign;
+ this.isSmall = false;
+ }
+ BigInteger.prototype = Object.create(Integer.prototype);
+
+ function SmallInteger(value) {
+ this.value = value;
+ this.sign = value < 0;
+ this.isSmall = true;
+ }
+ SmallInteger.prototype = Object.create(Integer.prototype);
+
+ function NativeBigInt(value) {
+ this.value = value;
+ }
+ NativeBigInt.prototype = Object.create(Integer.prototype);
+
+ function isPrecise(n) {
+ return -MAX_INT < n && n < MAX_INT;
+ }
+
+ function smallToArray(n) { // For performance reasons doesn't reference BASE, need to change this function if BASE changes
+ if (n < 1e7)
+ return [n];
+ if (n < 1e14)
+ return [n % 1e7, Math.floor(n / 1e7)];
+ return [n % 1e7, Math.floor(n / 1e7) % 1e7, Math.floor(n / 1e14)];
+ }
+
+ function arrayToSmall(arr) { // If BASE changes this function may need to change
+ trim(arr);
+ var length = arr.length;
+ if (length < 4 && compareAbs(arr, MAX_INT_ARR) < 0) {
+ switch (length) {
+ case 0: return 0;
+ case 1: return arr[0];
+ case 2: return arr[0] + arr[1] * BASE;
+ default: return arr[0] + (arr[1] + arr[2] * BASE) * BASE;
+ }
+ }
+ return arr;
+ }
+
+ function trim(v) {
+ var i = v.length;
+ while (v[--i] === 0);
+ v.length = i + 1;
+ }
+
+ function createArray(length) { // function shamelessly stolen from Yaffle's library https://github.com/Yaffle/BigInteger
+ var x = new Array(length);
+ var i = -1;
+ while (++i < length) {
+ x[i] = 0;
+ }
+ return x;
+ }
+
+ function truncate(n) {
+ if (n > 0) return Math.floor(n);
+ return Math.ceil(n);
+ }
+
+ function add(a, b) { // assumes a and b are arrays with a.length >= b.length
+ var l_a = a.length,
+ l_b = b.length,
+ r = new Array(l_a),
+ carry = 0,
+ base = BASE,
+ sum, i;
+ for (i = 0; i < l_b; i++) {
+ sum = a[i] + b[i] + carry;
+ carry = sum >= base ? 1 : 0;
+ r[i] = sum - carry * base;
+ }
+ while (i < l_a) {
+ sum = a[i] + carry;
+ carry = sum === base ? 1 : 0;
+ r[i++] = sum - carry * base;
+ }
+ if (carry > 0) r.push(carry);
+ return r;
+ }
+
+ function addAny(a, b) {
+ if (a.length >= b.length) return add(a, b);
+ return add(b, a);
+ }
+
+ function addSmall(a, carry) { // assumes a is array, carry is number with 0 <= carry < MAX_INT
+ var l = a.length,
+ r = new Array(l),
+ base = BASE,
+ sum, i;
+ for (i = 0; i < l; i++) {
+ sum = a[i] - base + carry;
+ carry = Math.floor(sum / base);
+ r[i] = sum - carry * base;
+ carry += 1;
+ }
+ while (carry > 0) {
+ r[i++] = carry % base;
+ carry = Math.floor(carry / base);
+ }
+ return r;
+ }
+
+ BigInteger.prototype.add = function (v) {
+ var n = parseValue(v);
+ if (this.sign !== n.sign) {
+ return this.subtract(n.negate());
+ }
+ var a = this.value, b = n.value;
+ if (n.isSmall) {
+ return new BigInteger(addSmall(a, Math.abs(b)), this.sign);
+ }
+ return new BigInteger(addAny(a, b), this.sign);
+ };
+ BigInteger.prototype.plus = BigInteger.prototype.add;
+
+ SmallInteger.prototype.add = function (v) {
+ var n = parseValue(v);
+ var a = this.value;
+ if (a < 0 !== n.sign) {
+ return this.subtract(n.negate());
+ }
+ var b = n.value;
+ if (n.isSmall) {
+ if (isPrecise(a + b)) return new SmallInteger(a + b);
+ b = smallToArray(Math.abs(b));
+ }
+ return new BigInteger(addSmall(b, Math.abs(a)), a < 0);
+ };
+ SmallInteger.prototype.plus = SmallInteger.prototype.add;
+
+ NativeBigInt.prototype.add = function (v) {
+ return new NativeBigInt(this.value + parseValue(v).value);
+ }
+ NativeBigInt.prototype.plus = NativeBigInt.prototype.add;
+
+ function subtract(a, b) { // assumes a and b are arrays with a >= b
+ var a_l = a.length,
+ b_l = b.length,
+ r = new Array(a_l),
+ borrow = 0,
+ base = BASE,
+ i, difference;
+ for (i = 0; i < b_l; i++) {
+ difference = a[i] - borrow - b[i];
+ if (difference < 0) {
+ difference += base;
+ borrow = 1;
+ } else borrow = 0;
+ r[i] = difference;
+ }
+ for (i = b_l; i < a_l; i++) {
+ difference = a[i] - borrow;
+ if (difference < 0) difference += base;
+ else {
+ r[i++] = difference;
+ break;
+ }
+ r[i] = difference;
+ }
+ for (; i < a_l; i++) {
+ r[i] = a[i];
+ }
+ trim(r);
+ return r;
+ }
+
+ function subtractAny(a, b, sign) {
+ var value;
+ if (compareAbs(a, b) >= 0) {
+ value = subtract(a, b);
+ } else {
+ value = subtract(b, a);
+ sign = !sign;
+ }
+ value = arrayToSmall(value);
+ if (typeof value === "number") {
+ if (sign) value = -value;
+ return new SmallInteger(value);
+ }
+ return new BigInteger(value, sign);
+ }
+
+ function subtractSmall(a, b, sign) { // assumes a is array, b is number with 0 <= b < MAX_INT
+ var l = a.length,
+ r = new Array(l),
+ carry = -b,
+ base = BASE,
+ i, difference;
+ for (i = 0; i < l; i++) {
+ difference = a[i] + carry;
+ carry = Math.floor(difference / base);
+ difference %= base;
+ r[i] = difference < 0 ? difference + base : difference;
+ }
+ r = arrayToSmall(r);
+ if (typeof r === "number") {
+ if (sign) r = -r;
+ return new SmallInteger(r);
+ } return new BigInteger(r, sign);
+ }
+
+ BigInteger.prototype.subtract = function (v) {
+ var n = parseValue(v);
+ if (this.sign !== n.sign) {
+ return this.add(n.negate());
+ }
+ var a = this.value, b = n.value;
+ if (n.isSmall)
+ return subtractSmall(a, Math.abs(b), this.sign);
+ return subtractAny(a, b, this.sign);
+ };
+ BigInteger.prototype.minus = BigInteger.prototype.subtract;
+
+ SmallInteger.prototype.subtract = function (v) {
+ var n = parseValue(v);
+ var a = this.value;
+ if (a < 0 !== n.sign) {
+ return this.add(n.negate());
+ }
+ var b = n.value;
+ if (n.isSmall) {
+ return new SmallInteger(a - b);
+ }
+ return subtractSmall(b, Math.abs(a), a >= 0);
+ };
+ SmallInteger.prototype.minus = SmallInteger.prototype.subtract;
+
+ NativeBigInt.prototype.subtract = function (v) {
+ return new NativeBigInt(this.value - parseValue(v).value);
+ }
+ NativeBigInt.prototype.minus = NativeBigInt.prototype.subtract;
+
+ BigInteger.prototype.negate = function () {
+ return new BigInteger(this.value, !this.sign);
+ };
+ SmallInteger.prototype.negate = function () {
+ var sign = this.sign;
+ var small = new SmallInteger(-this.value);
+ small.sign = !sign;
+ return small;
+ };
+ NativeBigInt.prototype.negate = function () {
+ return new NativeBigInt(-this.value);
+ }
+
+ BigInteger.prototype.abs = function () {
+ return new BigInteger(this.value, false);
+ };
+ SmallInteger.prototype.abs = function () {
+ return new SmallInteger(Math.abs(this.value));
+ };
+ NativeBigInt.prototype.abs = function () {
+ return new NativeBigInt(this.value >= 0 ? this.value : -this.value);
+ }
+
+
+ function multiplyLong(a, b) {
+ var a_l = a.length,
+ b_l = b.length,
+ l = a_l + b_l,
+ r = createArray(l),
+ base = BASE,
+ product, carry, i, a_i, b_j;
+ for (i = 0; i < a_l; ++i) {
+ a_i = a[i];
+ for (var j = 0; j < b_l; ++j) {
+ b_j = b[j];
+ product = a_i * b_j + r[i + j];
+ carry = Math.floor(product / base);
+ r[i + j] = product - carry * base;
+ r[i + j + 1] += carry;
+ }
+ }
+ trim(r);
+ return r;
+ }
+
+ function multiplySmall(a, b) { // assumes a is array, b is number with |b| < BASE
+ var l = a.length,
+ r = new Array(l),
+ base = BASE,
+ carry = 0,
+ product, i;
+ for (i = 0; i < l; i++) {
+ product = a[i] * b + carry;
+ carry = Math.floor(product / base);
+ r[i] = product - carry * base;
+ }
+ while (carry > 0) {
+ r[i++] = carry % base;
+ carry = Math.floor(carry / base);
+ }
+ return r;
+ }
+
+ function shiftLeft(x, n) {
+ var r = [];
+ while (n-- > 0) r.push(0);
+ return r.concat(x);
+ }
+
+ function multiplyKaratsuba(x, y) {
+ var n = Math.max(x.length, y.length);
+
+ if (n <= 30) return multiplyLong(x, y);
+ n = Math.ceil(n / 2);
+
+ var b = x.slice(n),
+ a = x.slice(0, n),
+ d = y.slice(n),
+ c = y.slice(0, n);
+
+ var ac = multiplyKaratsuba(a, c),
+ bd = multiplyKaratsuba(b, d),
+ abcd = multiplyKaratsuba(addAny(a, b), addAny(c, d));
+
+ var product = addAny(addAny(ac, shiftLeft(subtract(subtract(abcd, ac), bd), n)), shiftLeft(bd, 2 * n));
+ trim(product);
+ return product;
+ }
+
+ // The following function is derived from a surface fit of a graph plotting the performance difference
+ // between long multiplication and karatsuba multiplication versus the lengths of the two arrays.
+ function useKaratsuba(l1, l2) {
+ return -0.012 * l1 - 0.012 * l2 + 0.000015 * l1 * l2 > 0;
+ }
+
+ BigInteger.prototype.multiply = function (v) {
+ var n = parseValue(v),
+ a = this.value, b = n.value,
+ sign = this.sign !== n.sign,
+ abs;
+ if (n.isSmall) {
+ if (b === 0) return Integer[0];
+ if (b === 1) return this;
+ if (b === -1) return this.negate();
+ abs = Math.abs(b);
+ if (abs < BASE) {
+ return new BigInteger(multiplySmall(a, abs), sign);
+ }
+ b = smallToArray(abs);
+ }
+ if (useKaratsuba(a.length, b.length)) // Karatsuba is only faster for certain array sizes
+ return new BigInteger(multiplyKaratsuba(a, b), sign);
+ return new BigInteger(multiplyLong(a, b), sign);
+ };
+
+ BigInteger.prototype.times = BigInteger.prototype.multiply;
+
+ function multiplySmallAndArray(a, b, sign) { // a >= 0
+ if (a < BASE) {
+ return new BigInteger(multiplySmall(b, a), sign);
+ }
+ return new BigInteger(multiplyLong(b, smallToArray(a)), sign);
+ }
+ SmallInteger.prototype._multiplyBySmall = function (a) {
+ if (isPrecise(a.value * this.value)) {
+ return new SmallInteger(a.value * this.value);
+ }
+ return multiplySmallAndArray(Math.abs(a.value), smallToArray(Math.abs(this.value)), this.sign !== a.sign);
+ };
+ BigInteger.prototype._multiplyBySmall = function (a) {
+ if (a.value === 0) return Integer[0];
+ if (a.value === 1) return this;
+ if (a.value === -1) return this.negate();
+ return multiplySmallAndArray(Math.abs(a.value), this.value, this.sign !== a.sign);
+ };
+ SmallInteger.prototype.multiply = function (v) {
+ return parseValue(v)._multiplyBySmall(this);
+ };
+ SmallInteger.prototype.times = SmallInteger.prototype.multiply;
+
+ NativeBigInt.prototype.multiply = function (v) {
+ return new NativeBigInt(this.value * parseValue(v).value);
+ }
+ NativeBigInt.prototype.times = NativeBigInt.prototype.multiply;
+
+ function square(a) {
+ //console.assert(2 * BASE * BASE < MAX_INT);
+ var l = a.length,
+ r = createArray(l + l),
+ base = BASE,
+ product, carry, i, a_i, a_j;
+ for (i = 0; i < l; i++) {
+ a_i = a[i];
+ carry = 0 - a_i * a_i;
+ for (var j = i; j < l; j++) {
+ a_j = a[j];
+ product = 2 * (a_i * a_j) + r[i + j] + carry;
+ carry = Math.floor(product / base);
+ r[i + j] = product - carry * base;
+ }
+ r[i + l] = carry;
+ }
+ trim(r);
+ return r;
+ }
+
+ BigInteger.prototype.square = function () {
+ return new BigInteger(square(this.value), false);
+ };
+
+ SmallInteger.prototype.square = function () {
+ var value = this.value * this.value;
+ if (isPrecise(value)) return new SmallInteger(value);
+ return new BigInteger(square(smallToArray(Math.abs(this.value))), false);
+ };
+
+ NativeBigInt.prototype.square = function (v) {
+ return new NativeBigInt(this.value * this.value);
+ }
+
+ function divMod1(a, b) { // Left over from previous version. Performs faster than divMod2 on smaller input sizes.
+ var a_l = a.length,
+ b_l = b.length,
+ base = BASE,
+ result = createArray(b.length),
+ divisorMostSignificantDigit = b[b_l - 1],
+ // normalization
+ lambda = Math.ceil(base / (2 * divisorMostSignificantDigit)),
+ remainder = multiplySmall(a, lambda),
+ divisor = multiplySmall(b, lambda),
+ quotientDigit, shift, carry, borrow, i, l, q;
+ if (remainder.length <= a_l) remainder.push(0);
+ divisor.push(0);
+ divisorMostSignificantDigit = divisor[b_l - 1];
+ for (shift = a_l - b_l; shift >= 0; shift--) {
+ quotientDigit = base - 1;
+ if (remainder[shift + b_l] !== divisorMostSignificantDigit) {
+ quotientDigit = Math.floor((remainder[shift + b_l] * base + remainder[shift + b_l - 1]) / divisorMostSignificantDigit);
+ }
+ // quotientDigit <= base - 1
+ carry = 0;
+ borrow = 0;
+ l = divisor.length;
+ for (i = 0; i < l; i++) {
+ carry += quotientDigit * divisor[i];
+ q = Math.floor(carry / base);
+ borrow += remainder[shift + i] - (carry - q * base);
+ carry = q;
+ if (borrow < 0) {
+ remainder[shift + i] = borrow + base;
+ borrow = -1;
+ } else {
+ remainder[shift + i] = borrow;
+ borrow = 0;
+ }
+ }
+ while (borrow !== 0) {
+ quotientDigit -= 1;
+ carry = 0;
+ for (i = 0; i < l; i++) {
+ carry += remainder[shift + i] - base + divisor[i];
+ if (carry < 0) {
+ remainder[shift + i] = carry + base;
+ carry = 0;
+ } else {
+ remainder[shift + i] = carry;
+ carry = 1;
+ }
+ }
+ borrow += carry;
+ }
+ result[shift] = quotientDigit;
+ }
+ // denormalization
+ remainder = divModSmall(remainder, lambda)[0];
+ return [arrayToSmall(result), arrayToSmall(remainder)];
+ }
+
+ function divMod2(a, b) { // Implementation idea shamelessly stolen from Silent Matt's library http://silentmatt.com/biginteger/
+ // Performs faster than divMod1 on larger input sizes.
+ var a_l = a.length,
+ b_l = b.length,
+ result = [],
+ part = [],
+ base = BASE,
+ guess, xlen, highx, highy, check;
+ while (a_l) {
+ part.unshift(a[--a_l]);
+ trim(part);
+ if (compareAbs(part, b) < 0) {
+ result.push(0);
+ continue;
+ }
+ xlen = part.length;
+ highx = part[xlen - 1] * base + part[xlen - 2];
+ highy = b[b_l - 1] * base + b[b_l - 2];
+ if (xlen > b_l) {
+ highx = (highx + 1) * base;
+ }
+ guess = Math.ceil(highx / highy);
+ do {
+ check = multiplySmall(b, guess);
+ if (compareAbs(check, part) <= 0) break;
+ guess--;
+ } while (guess);
+ result.push(guess);
+ part = subtract(part, check);
+ }
+ result.reverse();
+ return [arrayToSmall(result), arrayToSmall(part)];
+ }
+
+ function divModSmall(value, lambda) {
+ var length = value.length,
+ quotient = createArray(length),
+ base = BASE,
+ i, q, remainder, divisor;
+ remainder = 0;
+ for (i = length - 1; i >= 0; --i) {
+ divisor = remainder * base + value[i];
+ q = truncate(divisor / lambda);
+ remainder = divisor - q * lambda;
+ quotient[i] = q | 0;
+ }
+ return [quotient, remainder | 0];
+ }
+
+ function divModAny(self, v) {
+ var value, n = parseValue(v);
+ if (supportsNativeBigInt) {
+ return [new NativeBigInt(self.value / n.value), new NativeBigInt(self.value % n.value)];
+ }
+ var a = self.value, b = n.value;
+ var quotient;
+ if (b === 0) throw new Error("Cannot divide by zero");
+ if (self.isSmall) {
+ if (n.isSmall) {
+ return [new SmallInteger(truncate(a / b)), new SmallInteger(a % b)];
+ }
+ return [Integer[0], self];
+ }
+ if (n.isSmall) {
+ if (b === 1) return [self, Integer[0]];
+ if (b == -1) return [self.negate(), Integer[0]];
+ var abs = Math.abs(b);
+ if (abs < BASE) {
+ value = divModSmall(a, abs);
+ quotient = arrayToSmall(value[0]);
+ var remainder = value[1];
+ if (self.sign) remainder = -remainder;
+ if (typeof quotient === "number") {
+ if (self.sign !== n.sign) quotient = -quotient;
+ return [new SmallInteger(quotient), new SmallInteger(remainder)];
+ }
+ return [new BigInteger(quotient, self.sign !== n.sign), new SmallInteger(remainder)];
+ }
+ b = smallToArray(abs);
+ }
+ var comparison = compareAbs(a, b);
+ if (comparison === -1) return [Integer[0], self];
+ if (comparison === 0) return [Integer[self.sign === n.sign ? 1 : -1], Integer[0]];
+
+ // divMod1 is faster on smaller input sizes
+ if (a.length + b.length <= 200)
+ value = divMod1(a, b);
+ else value = divMod2(a, b);
+
+ quotient = value[0];
+ var qSign = self.sign !== n.sign,
+ mod = value[1],
+ mSign = self.sign;
+ if (typeof quotient === "number") {
+ if (qSign) quotient = -quotient;
+ quotient = new SmallInteger(quotient);
+ } else quotient = new BigInteger(quotient, qSign);
+ if (typeof mod === "number") {
+ if (mSign) mod = -mod;
+ mod = new SmallInteger(mod);
+ } else mod = new BigInteger(mod, mSign);
+ return [quotient, mod];
+ }
+
+ BigInteger.prototype.divmod = function (v) {
+ var result = divModAny(this, v);
+ return {
+ quotient: result[0],
+ remainder: result[1]
+ };
+ };
+ NativeBigInt.prototype.divmod = SmallInteger.prototype.divmod = BigInteger.prototype.divmod;
+
+
+ BigInteger.prototype.divide = function (v) {
+ return divModAny(this, v)[0];
+ };
+ NativeBigInt.prototype.over = NativeBigInt.prototype.divide = function (v) {
+ return new NativeBigInt(this.value / parseValue(v).value);
+ };
+ SmallInteger.prototype.over = SmallInteger.prototype.divide = BigInteger.prototype.over = BigInteger.prototype.divide;
+
+ BigInteger.prototype.mod = function (v) {
+ return divModAny(this, v)[1];
+ };
+ NativeBigInt.prototype.mod = NativeBigInt.prototype.remainder = function (v) {
+ return new NativeBigInt(this.value % parseValue(v).value);
+ };
+ SmallInteger.prototype.remainder = SmallInteger.prototype.mod = BigInteger.prototype.remainder = BigInteger.prototype.mod;
+
+ BigInteger.prototype.pow = function (v) {
+ var n = parseValue(v),
+ a = this.value,
+ b = n.value,
+ value, x, y;
+ if (b === 0) return Integer[1];
+ if (a === 0) return Integer[0];
+ if (a === 1) return Integer[1];
+ if (a === -1) return n.isEven() ? Integer[1] : Integer[-1];
+ if (n.sign) {
+ return Integer[0];
+ }
+ if (!n.isSmall) throw new Error("The exponent " + n.toString() + " is too large.");
+ if (this.isSmall) {
+ if (isPrecise(value = Math.pow(a, b)))
+ return new SmallInteger(truncate(value));
+ }
+ x = this;
+ y = Integer[1];
+ while (true) {
+ if (b & 1 === 1) {
+ y = y.times(x);
+ --b;
+ }
+ if (b === 0) break;
+ b /= 2;
+ x = x.square();
+ }
+ return y;
+ };
+ SmallInteger.prototype.pow = BigInteger.prototype.pow;
+
+ NativeBigInt.prototype.pow = function (v) {
+ var n = parseValue(v);
+ var a = this.value, b = n.value;
+ var _0 = BigInt(0), _1 = BigInt(1), _2 = BigInt(2);
+ if (b === _0) return Integer[1];
+ if (a === _0) return Integer[0];
+ if (a === _1) return Integer[1];
+ if (a === BigInt(-1)) return n.isEven() ? Integer[1] : Integer[-1];
+ if (n.isNegative()) return new NativeBigInt(_0);
+ var x = this;
+ var y = Integer[1];
+ while (true) {
+ if ((b & _1) === _1) {
+ y = y.times(x);
+ --b;
+ }
+ if (b === _0) break;
+ b /= _2;
+ x = x.square();
+ }
+ return y;
+ }
+
+ BigInteger.prototype.modPow = function (exp, mod) {
+ exp = parseValue(exp);
+ mod = parseValue(mod);
+ if (mod.isZero()) throw new Error("Cannot take modPow with modulus 0");
+ var r = Integer[1],
+ base = this.mod(mod);
+ if (exp.isNegative()) {
+ exp = exp.multiply(Integer[-1]);
+ base = base.modInv(mod);
+ }
+ while (exp.isPositive()) {
+ if (base.isZero()) return Integer[0];
+ if (exp.isOdd()) r = r.multiply(base).mod(mod);
+ exp = exp.divide(2);
+ base = base.square().mod(mod);
+ }
+ return r;
+ };
+ NativeBigInt.prototype.modPow = SmallInteger.prototype.modPow = BigInteger.prototype.modPow;
+
+ function compareAbs(a, b) {
+ if (a.length !== b.length) {
+ return a.length > b.length ? 1 : -1;
+ }
+ for (var i = a.length - 1; i >= 0; i--) {
+ if (a[i] !== b[i]) return a[i] > b[i] ? 1 : -1;
+ }
+ return 0;
+ }
+
+ BigInteger.prototype.compareAbs = function (v) {
+ var n = parseValue(v),
+ a = this.value,
+ b = n.value;
+ if (n.isSmall) return 1;
+ return compareAbs(a, b);
+ };
+ SmallInteger.prototype.compareAbs = function (v) {
+ var n = parseValue(v),
+ a = Math.abs(this.value),
+ b = n.value;
+ if (n.isSmall) {
+ b = Math.abs(b);
+ return a === b ? 0 : a > b ? 1 : -1;
+ }
+ return -1;
+ };
+ NativeBigInt.prototype.compareAbs = function (v) {
+ var a = this.value;
+ var b = parseValue(v).value;
+ a = a >= 0 ? a : -a;
+ b = b >= 0 ? b : -b;
+ return a === b ? 0 : a > b ? 1 : -1;
+ }
+
+ BigInteger.prototype.compare = function (v) {
+ // See discussion about comparison with Infinity:
+ // https://github.com/peterolson/BigInteger.js/issues/61
+ if (v === Infinity) {
+ return -1;
+ }
+ if (v === -Infinity) {
+ return 1;
+ }
+
+ var n = parseValue(v),
+ a = this.value,
+ b = n.value;
+ if (this.sign !== n.sign) {
+ return n.sign ? 1 : -1;
+ }
+ if (n.isSmall) {
+ return this.sign ? -1 : 1;
+ }
+ return compareAbs(a, b) * (this.sign ? -1 : 1);
+ };
+ BigInteger.prototype.compareTo = BigInteger.prototype.compare;
+
+ SmallInteger.prototype.compare = function (v) {
+ if (v === Infinity) {
+ return -1;
+ }
+ if (v === -Infinity) {
+ return 1;
+ }
+
+ var n = parseValue(v),
+ a = this.value,
+ b = n.value;
+ if (n.isSmall) {
+ return a == b ? 0 : a > b ? 1 : -1;
+ }
+ if (a < 0 !== n.sign) {
+ return a < 0 ? -1 : 1;
+ }
+ return a < 0 ? 1 : -1;
+ };
+ SmallInteger.prototype.compareTo = SmallInteger.prototype.compare;
+
+ NativeBigInt.prototype.compare = function (v) {
+ if (v === Infinity) {
+ return -1;
+ }
+ if (v === -Infinity) {
+ return 1;
+ }
+ var a = this.value;
+ var b = parseValue(v).value;
+ return a === b ? 0 : a > b ? 1 : -1;
+ }
+ NativeBigInt.prototype.compareTo = NativeBigInt.prototype.compare;
+
+ BigInteger.prototype.equals = function (v) {
+ return this.compare(v) === 0;
+ };
+ NativeBigInt.prototype.eq = NativeBigInt.prototype.equals = SmallInteger.prototype.eq = SmallInteger.prototype.equals = BigInteger.prototype.eq = BigInteger.prototype.equals;
+
+ BigInteger.prototype.notEquals = function (v) {
+ return this.compare(v) !== 0;
+ };
+ NativeBigInt.prototype.neq = NativeBigInt.prototype.notEquals = SmallInteger.prototype.neq = SmallInteger.prototype.notEquals = BigInteger.prototype.neq = BigInteger.prototype.notEquals;
+
+ BigInteger.prototype.greater = function (v) {
+ return this.compare(v) > 0;
+ };
+ NativeBigInt.prototype.gt = NativeBigInt.prototype.greater = SmallInteger.prototype.gt = SmallInteger.prototype.greater = BigInteger.prototype.gt = BigInteger.prototype.greater;
+
+ BigInteger.prototype.lesser = function (v) {
+ return this.compare(v) < 0;
+ };
+ NativeBigInt.prototype.lt = NativeBigInt.prototype.lesser = SmallInteger.prototype.lt = SmallInteger.prototype.lesser = BigInteger.prototype.lt = BigInteger.prototype.lesser;
+
+ BigInteger.prototype.greaterOrEquals = function (v) {
+ return this.compare(v) >= 0;
+ };
+ NativeBigInt.prototype.geq = NativeBigInt.prototype.greaterOrEquals = SmallInteger.prototype.geq = SmallInteger.prototype.greaterOrEquals = BigInteger.prototype.geq = BigInteger.prototype.greaterOrEquals;
+
+ BigInteger.prototype.lesserOrEquals = function (v) {
+ return this.compare(v) <= 0;
+ };
+ NativeBigInt.prototype.leq = NativeBigInt.prototype.lesserOrEquals = SmallInteger.prototype.leq = SmallInteger.prototype.lesserOrEquals = BigInteger.prototype.leq = BigInteger.prototype.lesserOrEquals;
+
+ BigInteger.prototype.isEven = function () {
+ return (this.value[0] & 1) === 0;
+ };
+ SmallInteger.prototype.isEven = function () {
+ return (this.value & 1) === 0;
+ };
+ NativeBigInt.prototype.isEven = function () {
+ return (this.value & BigInt(1)) === BigInt(0);
+ }
+
+ BigInteger.prototype.isOdd = function () {
+ return (this.value[0] & 1) === 1;
+ };
+ SmallInteger.prototype.isOdd = function () {
+ return (this.value & 1) === 1;
+ };
+ NativeBigInt.prototype.isOdd = function () {
+ return (this.value & BigInt(1)) === BigInt(1);
+ }
+
+ BigInteger.prototype.isPositive = function () {
+ return !this.sign;
+ };
+ SmallInteger.prototype.isPositive = function () {
+ return this.value > 0;
+ };
+ NativeBigInt.prototype.isPositive = SmallInteger.prototype.isPositive;
+
+ BigInteger.prototype.isNegative = function () {
+ return this.sign;
+ };
+ SmallInteger.prototype.isNegative = function () {
+ return this.value < 0;
+ };
+ NativeBigInt.prototype.isNegative = SmallInteger.prototype.isNegative;
+
+ BigInteger.prototype.isUnit = function () {
+ return false;
+ };
+ SmallInteger.prototype.isUnit = function () {
+ return Math.abs(this.value) === 1;
+ };
+ NativeBigInt.prototype.isUnit = function () {
+ return this.abs().value === BigInt(1);
+ }
+
+ BigInteger.prototype.isZero = function () {
+ return false;
+ };
+ SmallInteger.prototype.isZero = function () {
+ return this.value === 0;
+ };
+ NativeBigInt.prototype.isZero = function () {
+ return this.value === BigInt(0);
+ }
+
+ BigInteger.prototype.isDivisibleBy = function (v) {
+ var n = parseValue(v);
+ if (n.isZero()) return false;
+ if (n.isUnit()) return true;
+ if (n.compareAbs(2) === 0) return this.isEven();
+ return this.mod(n).isZero();
+ };
+ NativeBigInt.prototype.isDivisibleBy = SmallInteger.prototype.isDivisibleBy = BigInteger.prototype.isDivisibleBy;
+
+ function isBasicPrime(v) {
+ var n = v.abs();
+ if (n.isUnit()) return false;
+ if (n.equals(2) || n.equals(3) || n.equals(5)) return true;
+ if (n.isEven() || n.isDivisibleBy(3) || n.isDivisibleBy(5)) return false;
+ if (n.lesser(49)) return true;
+ // we don't know if it's prime: let the other functions figure it out
+ }
+
+ function millerRabinTest(n, a) {
+ var nPrev = n.prev(),
+ b = nPrev,
+ r = 0,
+ d, t, i, x;
+ while (b.isEven()) b = b.divide(2), r++;
+ next: for (i = 0; i < a.length; i++) {
+ if (n.lesser(a[i])) continue;
+ x = bigInt(a[i]).modPow(b, n);
+ if (x.isUnit() || x.equals(nPrev)) continue;
+ for (d = r - 1; d != 0; d--) {
+ x = x.square().mod(n);
+ if (x.isUnit()) return false;
+ if (x.equals(nPrev)) continue next;
+ }
+ return false;
+ }
+ return true;
+ }
+
+ // Set "strict" to true to force GRH-supported lower bound of 2*log(N)^2
+ BigInteger.prototype.isPrime = function (strict) {
+ var isPrime = isBasicPrime(this);
+ if (isPrime !== undefined) return isPrime;
+ var n = this.abs();
+ var bits = n.bitLength();
+ if (bits <= 64)
+ return millerRabinTest(n, [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37]);
+ var logN = Math.log(2) * bits.toJSNumber();
+ var t = Math.ceil((strict === true) ? (2 * Math.pow(logN, 2)) : logN);
+ for (var a = [], i = 0; i < t; i++) {
+ a.push(bigInt(i + 2));
+ }
+ return millerRabinTest(n, a);
+ };
+ NativeBigInt.prototype.isPrime = SmallInteger.prototype.isPrime = BigInteger.prototype.isPrime;
+
+ BigInteger.prototype.isProbablePrime = function (iterations, rng) {
+ var isPrime = isBasicPrime(this);
+ if (isPrime !== undefined) return isPrime;
+ var n = this.abs();
+ var t = iterations === undefined ? 5 : iterations;
+ for (var a = [], i = 0; i < t; i++) {
+ a.push(bigInt.randBetween(2, n.minus(2), rng));
+ }
+ return millerRabinTest(n, a);
+ };
+ NativeBigInt.prototype.isProbablePrime = SmallInteger.prototype.isProbablePrime = BigInteger.prototype.isProbablePrime;
+
+ BigInteger.prototype.modInv = function (n) {
+ var t = bigInt.zero, newT = bigInt.one, r = parseValue(n), newR = this.abs(), q, lastT, lastR;
+ while (!newR.isZero()) {
+ q = r.divide(newR);
+ lastT = t;
+ lastR = r;
+ t = newT;
+ r = newR;
+ newT = lastT.subtract(q.multiply(newT));
+ newR = lastR.subtract(q.multiply(newR));
+ }
+ if (!r.isUnit()) throw new Error(this.toString() + " and " + n.toString() + " are not co-prime");
+ if (t.compare(0) === -1) {
+ t = t.add(n);
+ }
+ if (this.isNegative()) {
+ return t.negate();
+ }
+ return t;
+ };
+
+ NativeBigInt.prototype.modInv = SmallInteger.prototype.modInv = BigInteger.prototype.modInv;
+
+ BigInteger.prototype.next = function () {
+ var value = this.value;
+ if (this.sign) {
+ return subtractSmall(value, 1, this.sign);
+ }
+ return new BigInteger(addSmall(value, 1), this.sign);
+ };
+ SmallInteger.prototype.next = function () {
+ var value = this.value;
+ if (value + 1 < MAX_INT) return new SmallInteger(value + 1);
+ return new BigInteger(MAX_INT_ARR, false);
+ };
+ NativeBigInt.prototype.next = function () {
+ return new NativeBigInt(this.value + BigInt(1));
+ }
+
+ BigInteger.prototype.prev = function () {
+ var value = this.value;
+ if (this.sign) {
+ return new BigInteger(addSmall(value, 1), true);
+ }
+ return subtractSmall(value, 1, this.sign);
+ };
+ SmallInteger.prototype.prev = function () {
+ var value = this.value;
+ if (value - 1 > -MAX_INT) return new SmallInteger(value - 1);
+ return new BigInteger(MAX_INT_ARR, true);
+ };
+ NativeBigInt.prototype.prev = function () {
+ return new NativeBigInt(this.value - BigInt(1));
+ }
+
+ var powersOfTwo = [1];
+ while (2 * powersOfTwo[powersOfTwo.length - 1] <= BASE) powersOfTwo.push(2 * powersOfTwo[powersOfTwo.length - 1]);
+ var powers2Length = powersOfTwo.length, highestPower2 = powersOfTwo[powers2Length - 1];
+
+ function shift_isSmall(n) {
+ return Math.abs(n) <= BASE;
+ }
+
+ BigInteger.prototype.shiftLeft = function (v) {
+ var n = parseValue(v).toJSNumber();
+ if (!shift_isSmall(n)) {
+ throw new Error(String(n) + " is too large for shifting.");
+ }
+ if (n < 0) return this.shiftRight(-n);
+ var result = this;
+ if (result.isZero()) return result;
+ while (n >= powers2Length) {
+ result = result.multiply(highestPower2);
+ n -= powers2Length - 1;
+ }
+ return result.multiply(powersOfTwo[n]);
+ };
+ NativeBigInt.prototype.shiftLeft = SmallInteger.prototype.shiftLeft = BigInteger.prototype.shiftLeft;
+
+ BigInteger.prototype.shiftRight = function (v) {
+ var remQuo;
+ var n = parseValue(v).toJSNumber();
+ if (!shift_isSmall(n)) {
+ throw new Error(String(n) + " is too large for shifting.");
+ }
+ if (n < 0) return this.shiftLeft(-n);
+ var result = this;
+ while (n >= powers2Length) {
+ if (result.isZero() || (result.isNegative() && result.isUnit())) return result;
+ remQuo = divModAny(result, highestPower2);
+ result = remQuo[1].isNegative() ? remQuo[0].prev() : remQuo[0];
+ n -= powers2Length - 1;
+ }
+ remQuo = divModAny(result, powersOfTwo[n]);
+ return remQuo[1].isNegative() ? remQuo[0].prev() : remQuo[0];
+ };
+ NativeBigInt.prototype.shiftRight = SmallInteger.prototype.shiftRight = BigInteger.prototype.shiftRight;
+
+ function bitwise(x, y, fn) {
+ y = parseValue(y);
+ var xSign = x.isNegative(), ySign = y.isNegative();
+ var xRem = xSign ? x.not() : x,
+ yRem = ySign ? y.not() : y;
+ var xDigit = 0, yDigit = 0;
+ var xDivMod = null, yDivMod = null;
+ var result = [];
+ while (!xRem.isZero() || !yRem.isZero()) {
+ xDivMod = divModAny(xRem, highestPower2);
+ xDigit = xDivMod[1].toJSNumber();
+ if (xSign) {
+ xDigit = highestPower2 - 1 - xDigit; // two's complement for negative numbers
+ }
+
+ yDivMod = divModAny(yRem, highestPower2);
+ yDigit = yDivMod[1].toJSNumber();
+ if (ySign) {
+ yDigit = highestPower2 - 1 - yDigit; // two's complement for negative numbers
+ }
+
+ xRem = xDivMod[0];
+ yRem = yDivMod[0];
+ result.push(fn(xDigit, yDigit));
+ }
+ var sum = fn(xSign ? 1 : 0, ySign ? 1 : 0) !== 0 ? bigInt(-1) : bigInt(0);
+ for (var i = result.length - 1; i >= 0; i -= 1) {
+ sum = sum.multiply(highestPower2).add(bigInt(result[i]));
+ }
+ return sum;
+ }
+
+ BigInteger.prototype.not = function () {
+ return this.negate().prev();
+ };
+ NativeBigInt.prototype.not = SmallInteger.prototype.not = BigInteger.prototype.not;
+
+ BigInteger.prototype.and = function (n) {
+ return bitwise(this, n, function (a, b) { return a & b; });
+ };
+ NativeBigInt.prototype.and = SmallInteger.prototype.and = BigInteger.prototype.and;
+
+ BigInteger.prototype.or = function (n) {
+ return bitwise(this, n, function (a, b) { return a | b; });
+ };
+ NativeBigInt.prototype.or = SmallInteger.prototype.or = BigInteger.prototype.or;
+
+ BigInteger.prototype.xor = function (n) {
+ return bitwise(this, n, function (a, b) { return a ^ b; });
+ };
+ NativeBigInt.prototype.xor = SmallInteger.prototype.xor = BigInteger.prototype.xor;
+
+ var LOBMASK_I = 1 << 30, LOBMASK_BI = (BASE & -BASE) * (BASE & -BASE) | LOBMASK_I;
+ function roughLOB(n) { // get lowestOneBit (rough)
+ // SmallInteger: return Min(lowestOneBit(n), 1 << 30)
+ // BigInteger: return Min(lowestOneBit(n), 1 << 14) [BASE=1e7]
+ var v = n.value,
+ x = typeof v === "number" ? v | LOBMASK_I :
+ typeof v === "bigint" ? v | BigInt(LOBMASK_I) :
+ v[0] + v[1] * BASE | LOBMASK_BI;
+ return x & -x;
+ }
+
+ function integerLogarithm(value, base) {
+ if (base.compareTo(value) <= 0) {
+ var tmp = integerLogarithm(value, base.square(base));
+ var p = tmp.p;
+ var e = tmp.e;
+ var t = p.multiply(base);
+ return t.compareTo(value) <= 0 ? { p: t, e: e * 2 + 1 } : { p: p, e: e * 2 };
+ }
+ return { p: bigInt(1), e: 0 };
+ }
+
+ BigInteger.prototype.bitLength = function () {
+ var n = this;
+ if (n.compareTo(bigInt(0)) < 0) {
+ n = n.negate().subtract(bigInt(1));
+ }
+ if (n.compareTo(bigInt(0)) === 0) {
+ return bigInt(0);
+ }
+ return bigInt(integerLogarithm(n, bigInt(2)).e).add(bigInt(1));
+ }
+ NativeBigInt.prototype.bitLength = SmallInteger.prototype.bitLength = BigInteger.prototype.bitLength;
+
+ function max(a, b) {
+ a = parseValue(a);
+ b = parseValue(b);
+ return a.greater(b) ? a : b;
+ }
+ function min(a, b) {
+ a = parseValue(a);
+ b = parseValue(b);
+ return a.lesser(b) ? a : b;
+ }
+ function gcd(a, b) {
+ a = parseValue(a).abs();
+ b = parseValue(b).abs();
+ if (a.equals(b)) return a;
+ if (a.isZero()) return b;
+ if (b.isZero()) return a;
+ var c = Integer[1], d, t;
+ while (a.isEven() && b.isEven()) {
+ d = min(roughLOB(a), roughLOB(b));
+ a = a.divide(d);
+ b = b.divide(d);
+ c = c.multiply(d);
+ }
+ while (a.isEven()) {
+ a = a.divide(roughLOB(a));
+ }
+ do {
+ while (b.isEven()) {
+ b = b.divide(roughLOB(b));
+ }
+ if (a.greater(b)) {
+ t = b; b = a; a = t;
+ }
+ b = b.subtract(a);
+ } while (!b.isZero());
+ return c.isUnit() ? a : a.multiply(c);
+ }
+ function lcm(a, b) {
+ a = parseValue(a).abs();
+ b = parseValue(b).abs();
+ return a.divide(gcd(a, b)).multiply(b);
+ }
+ function randBetween(a, b, rng) {
+ a = parseValue(a);
+ b = parseValue(b);
+ var usedRNG = rng || Math.random;
+ var low = min(a, b), high = max(a, b);
+ var range = high.subtract(low).add(1);
+ if (range.isSmall) return low.add(Math.floor(usedRNG() * range));
+ var digits = toBase(range, BASE).value;
+ var result = [], restricted = true;
+ for (var i = 0; i < digits.length; i++) {
+ var top = restricted ? digits[i] + (i + 1 < digits.length ? digits[i + 1] / BASE : 0) : BASE;
+ var digit = truncate(usedRNG() * top);
+ result.push(digit);
+ if (digit < digits[i]) restricted = false;
+ }
+ return low.add(Integer.fromArray(result, BASE, false));
+ }
+
+ var parseBase = function (text, base, alphabet, caseSensitive) {
+ alphabet = alphabet || DEFAULT_ALPHABET;
+ text = String(text);
+ if (!caseSensitive) {
+ text = text.toLowerCase();
+ alphabet = alphabet.toLowerCase();
+ }
+ var length = text.length;
+ var i;
+ var absBase = Math.abs(base);
+ var alphabetValues = {};
+ for (i = 0; i < alphabet.length; i++) {
+ alphabetValues[alphabet[i]] = i;
+ }
+ for (i = 0; i < length; i++) {
+ var c = text[i];
+ if (c === "-") continue;
+ if (c in alphabetValues) {
+ if (alphabetValues[c] >= absBase) {
+ if (c === "1" && absBase === 1) continue;
+ throw new Error(c + " is not a valid digit in base " + base + ".");
+ }
+ }
+ }
+ base = parseValue(base);
+ var digits = [];
+ var isNegative = text[0] === "-";
+ for (i = isNegative ? 1 : 0; i < text.length; i++) {
+ var c = text[i];
+ if (c in alphabetValues) digits.push(parseValue(alphabetValues[c]));
+ else if (c === "<") {
+ var start = i;
+ do { i++; } while (text[i] !== ">" && i < text.length);
+ digits.push(parseValue(text.slice(start + 1, i)));
+ }
+ else throw new Error(c + " is not a valid character");
+ }
+ return parseBaseFromArray(digits, base, isNegative);
+ };
+
+ function parseBaseFromArray(digits, base, isNegative) {
+ var val = Integer[0], pow = Integer[1], i;
+ for (i = digits.length - 1; i >= 0; i--) {
+ val = val.add(digits[i].times(pow));
+ pow = pow.times(base);
+ }
+ return isNegative ? val.negate() : val;
+ }
+
+ function stringify(digit, alphabet) {
+ alphabet = alphabet || DEFAULT_ALPHABET;
+ if (digit < alphabet.length) {
+ return alphabet[digit];
+ }
+ return "<" + digit + ">";
+ }
+
+ function toBase(n, base) {
+ base = bigInt(base);
+ if (base.isZero()) {
+ if (n.isZero()) return { value: [0], isNegative: false };
+ throw new Error("Cannot convert nonzero numbers to base 0.");
+ }
+ if (base.equals(-1)) {
+ if (n.isZero()) return { value: [0], isNegative: false };
+ if (n.isNegative())
+ return {
+ value: [].concat.apply([], Array.apply(null, Array(-n.toJSNumber()))
+ .map(Array.prototype.valueOf, [1, 0])
+ ),
+ isNegative: false
+ };
+
+ var arr = Array.apply(null, Array(n.toJSNumber() - 1))
+ .map(Array.prototype.valueOf, [0, 1]);
+ arr.unshift([1]);
+ return {
+ value: [].concat.apply([], arr),
+ isNegative: false
+ };
+ }
+
+ var neg = false;
+ if (n.isNegative() && base.isPositive()) {
+ neg = true;
+ n = n.abs();
+ }
+ if (base.isUnit()) {
+ if (n.isZero()) return { value: [0], isNegative: false };
+
+ return {
+ value: Array.apply(null, Array(n.toJSNumber()))
+ .map(Number.prototype.valueOf, 1),
+ isNegative: neg
+ };
+ }
+ var out = [];
+ var left = n, divmod;
+ while (left.isNegative() || left.compareAbs(base) >= 0) {
+ divmod = left.divmod(base);
+ left = divmod.quotient;
+ var digit = divmod.remainder;
+ if (digit.isNegative()) {
+ digit = base.minus(digit).abs();
+ left = left.next();
+ }
+ out.push(digit.toJSNumber());
+ }
+ out.push(left.toJSNumber());
+ return { value: out.reverse(), isNegative: neg };
+ }
+
+ function toBaseString(n, base, alphabet) {
+ var arr = toBase(n, base);
+ return (arr.isNegative ? "-" : "") + arr.value.map(function (x) {
+ return stringify(x, alphabet);
+ }).join('');
+ }
+
+ BigInteger.prototype.toArray = function (radix) {
+ return toBase(this, radix);
+ };
+
+ SmallInteger.prototype.toArray = function (radix) {
+ return toBase(this, radix);
+ };
+
+ NativeBigInt.prototype.toArray = function (radix) {
+ return toBase(this, radix);
+ };
+
+ BigInteger.prototype.toString = function (radix, alphabet) {
+ if (radix === undefined) radix = 10;
+ if (radix !== 10) return toBaseString(this, radix, alphabet);
+ var v = this.value, l = v.length, str = String(v[--l]), zeros = "0000000", digit;
+ while (--l >= 0) {
+ digit = String(v[l]);
+ str += zeros.slice(digit.length) + digit;
+ }
+ var sign = this.sign ? "-" : "";
+ return sign + str;
+ };
+
+ SmallInteger.prototype.toString = function (radix, alphabet) {
+ if (radix === undefined) radix = 10;
+ if (radix != 10) return toBaseString(this, radix, alphabet);
+ return String(this.value);
+ };
+
+ NativeBigInt.prototype.toString = SmallInteger.prototype.toString;
+
+ NativeBigInt.prototype.toJSON = BigInteger.prototype.toJSON = SmallInteger.prototype.toJSON = function () { return this.toString(); }
+
+ BigInteger.prototype.valueOf = function () {
+ return parseInt(this.toString(), 10);
+ };
+ BigInteger.prototype.toJSNumber = BigInteger.prototype.valueOf;
+
+ SmallInteger.prototype.valueOf = function () {
+ return this.value;
+ };
+ SmallInteger.prototype.toJSNumber = SmallInteger.prototype.valueOf;
+ NativeBigInt.prototype.valueOf = NativeBigInt.prototype.toJSNumber = function () {
+ return parseInt(this.toString(), 10);
+ }
+
+ function parseStringValue(v) {
+ if (isPrecise(+v)) {
+ var x = +v;
+ if (x === truncate(x))
+ return supportsNativeBigInt ? new NativeBigInt(BigInt(x)) : new SmallInteger(x);
+ throw new Error("Invalid integer: " + v);
+ }
+ var sign = v[0] === "-";
+ if (sign) v = v.slice(1);
+ var split = v.split(/e/i);
+ if (split.length > 2) throw new Error("Invalid integer: " + split.join("e"));
+ if (split.length === 2) {
+ var exp = split[1];
+ if (exp[0] === "+") exp = exp.slice(1);
+ exp = +exp;
+ if (exp !== truncate(exp) || !isPrecise(exp)) throw new Error("Invalid integer: " + exp + " is not a valid exponent.");
+ var text = split[0];
+ var decimalPlace = text.indexOf(".");
+ if (decimalPlace >= 0) {
+ exp -= text.length - decimalPlace - 1;
+ text = text.slice(0, decimalPlace) + text.slice(decimalPlace + 1);
+ }
+ if (exp < 0) throw new Error("Cannot include negative exponent part for integers");
+ text += (new Array(exp + 1)).join("0");
+ v = text;
+ }
+ var isValid = /^([0-9][0-9]*)$/.test(v);
+ if (!isValid) throw new Error("Invalid integer: " + v);
+ if (supportsNativeBigInt) {
+ return new NativeBigInt(BigInt(sign ? "-" + v : v));
+ }
+ var r = [], max = v.length, l = LOG_BASE, min = max - l;
+ while (max > 0) {
+ r.push(+v.slice(min, max));
+ min -= l;
+ if (min < 0) min = 0;
+ max -= l;
+ }
+ trim(r);
+ return new BigInteger(r, sign);
+ }
+
+ function parseNumberValue(v) {
+ if (supportsNativeBigInt) {
+ return new NativeBigInt(BigInt(v));
+ }
+ if (isPrecise(v)) {
+ if (v !== truncate(v)) throw new Error(v + " is not an integer.");
+ return new SmallInteger(v);
+ }
+ return parseStringValue(v.toString());
+ }
+
+ function parseValue(v) {
+ if (typeof v === "number") {
+ return parseNumberValue(v);
+ }
+ if (typeof v === "string") {
+ return parseStringValue(v);
+ }
+ if (typeof v === "bigint") {
+ return new NativeBigInt(v);
+ }
+ return v;
+ }
+ // Pre-define numbers in range [-999,999]
+ for (var i = 0; i < 1000; i++) {
+ Integer[i] = parseValue(i);
+ if (i > 0) Integer[-i] = parseValue(-i);
+ }
+ // Backwards compatibility
+ Integer.one = Integer[1];
+ Integer.zero = Integer[0];
+ Integer.minusOne = Integer[-1];
+ Integer.max = max;
+ Integer.min = min;
+ Integer.gcd = gcd;
+ Integer.lcm = lcm;
+ Integer.isInstance = function (x) { return x instanceof BigInteger || x instanceof SmallInteger || x instanceof NativeBigInt; };
+ Integer.randBetween = randBetween;
+
+ Integer.fromArray = function (digits, base, isNegative) {
+ return parseBaseFromArray(digits.map(parseValue), parseValue(base || 10), isNegative);
+ };
+
+ return Integer;
+})();
+
+// Node.js check
+if (typeof module !== "undefined" && module.hasOwnProperty("exports")) {
+ module.exports = bigInt;
+}
+
+//amd check
+if (typeof define === "function" && define.amd) {
+ define( function () {
+ return bigInt;
+ });
+}
diff --git a/temporary_modules/trezor-connect/node_modules/big-integer/BigInteger.min.js b/temporary_modules/trezor-connect/node_modules/big-integer/BigInteger.min.js
new file mode 100644
index 00000000..09835af1
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/big-integer/BigInteger.min.js
@@ -0,0 +1 @@
+var bigInt=function(t){"use strict";var e=1e7,r=9007199254740992,o=f(r),n="0123456789abcdefghijklmnopqrstuvwxyz",i="function"==typeof BigInt;function u(t,e,r,o){return void 0===t?u[0]:void 0!==e&&(10!=+e||r)?_(t,e,r,o):K(t)}function p(t,e){this.value=t,this.sign=e,this.isSmall=!1}function a(t){this.value=t,this.sign=t<0,this.isSmall=!0}function s(t){this.value=t}function l(t){return-r0?Math.floor(t):Math.ceil(t)}function c(t,r){var o,n,i=t.length,u=r.length,p=new Array(i),a=0,s=e;for(n=0;n=s?1:0,p[n]=o-a*s;for(;n0&&p.push(a),p}function m(t,e){return t.length>=e.length?c(t,e):c(e,t)}function d(t,r){var o,n,i=t.length,u=new Array(i),p=e;for(n=0;n0;)u[n++]=r%p,r=Math.floor(r/p);return u}function b(t,r){var o,n,i=t.length,u=r.length,p=new Array(i),a=0,s=e;for(o=0;o0;)u[n++]=a%p,a=Math.floor(a/p);return u}function q(t,e){for(var r=[];e-- >0;)r.push(0);return r.concat(t)}function M(t,e){var r=Math.max(t.length,e.length);if(r<=30)return S(t,e);r=Math.ceil(r/2);var o=t.slice(r),n=t.slice(0,r),i=e.slice(r),u=e.slice(0,r),p=M(n,u),a=M(o,i),s=M(m(n,o),m(u,i)),l=m(m(p,q(b(b(s,p),a),r)),q(a,2*r));return h(l),l}function N(t,r,o){return new p(t=0;--r)n=(i=1e7*n+t[r])-(o=g(i/e))*e,p[r]=0|o;return[p,0|n]}function B(t,r){var o,n=K(r);if(i)return[new s(t.value/n.value),new s(t.value%n.value)];var l,c=t.value,m=n.value;if(0===m)throw new Error("Cannot divide by zero");if(t.isSmall)return n.isSmall?[new a(g(c/m)),new a(c%m)]:[u[0],t];if(n.isSmall){if(1===m)return[t,u[0]];if(-1==m)return[t.negate(),u[0]];var d=Math.abs(m);if(d=0;n--){for(o=h-1,d[n+f]!==c&&(o=Math.floor((d[n+f]*h+d[n+f-1])/c)),i=0,u=0,a=b.length,p=0;ps&&(i=(i+1)*y),o=Math.ceil(i/u);do{if(A(p=I(r,o),f)<=0)break;o--}while(o);l.push(o),f=b(f,p)}return l.reverse(),[v(l),v(f)]}(c,m),l=o[0];var q=t.sign!==n.sign,M=o[1],N=t.sign;return"number"==typeof l?(q&&(l=-l),l=new a(l)):l=new p(l,q),"number"==typeof M?(N&&(M=-M),M=new a(M)):M=new p(M,N),[l,M]}function A(t,e){if(t.length!==e.length)return t.length>e.length?1:-1;for(var r=t.length-1;r>=0;r--)if(t[r]!==e[r])return t[r]>e[r]?1:-1;return 0}function P(t){var e=t.abs();return!e.isUnit()&&(!!(e.equals(2)||e.equals(3)||e.equals(5))||!(e.isEven()||e.isDivisibleBy(3)||e.isDivisibleBy(5))&&(!!e.lesser(49)||void 0))}function Z(t,e){for(var r,o,n,i=t.prev(),u=i,p=0;u.isEven();)u=u.divide(2),p++;t:for(o=0;o=0?o=b(t,e):(o=b(e,t),r=!r),"number"==typeof(o=v(o))?(r&&(o=-o),new a(o)):new p(o,r)}(r,o,this.sign)},p.prototype.minus=p.prototype.subtract,a.prototype.subtract=function(t){var e=K(t),r=this.value;if(r<0!==e.sign)return this.add(e.negate());var o=e.value;return e.isSmall?new a(r-o):w(o,Math.abs(r),r>=0)},a.prototype.minus=a.prototype.subtract,s.prototype.subtract=function(t){return new s(this.value-K(t).value)},s.prototype.minus=s.prototype.subtract,p.prototype.negate=function(){return new p(this.value,!this.sign)},a.prototype.negate=function(){var t=this.sign,e=new a(-this.value);return e.sign=!t,e},s.prototype.negate=function(){return new s(-this.value)},p.prototype.abs=function(){return new p(this.value,!1)},a.prototype.abs=function(){return new a(Math.abs(this.value))},s.prototype.abs=function(){return new s(this.value>=0?this.value:-this.value)},p.prototype.multiply=function(t){var r,o,n,i=K(t),a=this.value,s=i.value,l=this.sign!==i.sign;if(i.isSmall){if(0===s)return u[0];if(1===s)return this;if(-1===s)return this.negate();if((r=Math.abs(s))0?M(a,s):S(a,s),l)},p.prototype.times=p.prototype.multiply,a.prototype._multiplyBySmall=function(t){return l(t.value*this.value)?new a(t.value*this.value):N(Math.abs(t.value),f(Math.abs(this.value)),this.sign!==t.sign)},p.prototype._multiplyBySmall=function(t){return 0===t.value?u[0]:1===t.value?this:-1===t.value?this.negate():N(Math.abs(t.value),this.value,this.sign!==t.sign)},a.prototype.multiply=function(t){return K(t)._multiplyBySmall(this)},a.prototype.times=a.prototype.multiply,s.prototype.multiply=function(t){return new s(this.value*K(t).value)},s.prototype.times=s.prototype.multiply,p.prototype.square=function(){return new p(E(this.value),!1)},a.prototype.square=function(){var t=this.value*this.value;return l(t)?new a(t):new p(E(f(Math.abs(this.value))),!1)},s.prototype.square=function(t){return new s(this.value*this.value)},p.prototype.divmod=function(t){var e=B(this,t);return{quotient:e[0],remainder:e[1]}},s.prototype.divmod=a.prototype.divmod=p.prototype.divmod,p.prototype.divide=function(t){return B(this,t)[0]},s.prototype.over=s.prototype.divide=function(t){return new s(this.value/K(t).value)},a.prototype.over=a.prototype.divide=p.prototype.over=p.prototype.divide,p.prototype.mod=function(t){return B(this,t)[1]},s.prototype.mod=s.prototype.remainder=function(t){return new s(this.value%K(t).value)},a.prototype.remainder=a.prototype.mod=p.prototype.remainder=p.prototype.mod,p.prototype.pow=function(t){var e,r,o,n=K(t),i=this.value,p=n.value;if(0===p)return u[1];if(0===i)return u[0];if(1===i)return u[1];if(-1===i)return n.isEven()?u[1]:u[-1];if(n.sign)return u[0];if(!n.isSmall)throw new Error("The exponent "+n.toString()+" is too large.");if(this.isSmall&&l(e=Math.pow(i,p)))return new a(g(e));for(r=this,o=u[1];!0&p&&(o=o.times(r),--p),0!==p;)p/=2,r=r.square();return o},a.prototype.pow=p.prototype.pow,s.prototype.pow=function(t){var e=K(t),r=this.value,o=e.value,n=BigInt(0),i=BigInt(1),p=BigInt(2);if(o===n)return u[1];if(r===n)return u[0];if(r===i)return u[1];if(r===BigInt(-1))return e.isEven()?u[1]:u[-1];if(e.isNegative())return new s(n);for(var a=this,l=u[1];(o&i)===i&&(l=l.times(a),--o),o!==n;)o/=p,a=a.square();return l},p.prototype.modPow=function(t,e){if(t=K(t),(e=K(e)).isZero())throw new Error("Cannot take modPow with modulus 0");var r=u[1],o=this.mod(e);for(t.isNegative()&&(t=t.multiply(u[-1]),o=o.modInv(e));t.isPositive();){if(o.isZero())return u[0];t.isOdd()&&(r=r.multiply(o).mod(e)),t=t.divide(2),o=o.square().mod(e)}return r},s.prototype.modPow=a.prototype.modPow=p.prototype.modPow,p.prototype.compareAbs=function(t){var e=K(t),r=this.value,o=e.value;return e.isSmall?1:A(r,o)},a.prototype.compareAbs=function(t){var e=K(t),r=Math.abs(this.value),o=e.value;return e.isSmall?r===(o=Math.abs(o))?0:r>o?1:-1:-1},s.prototype.compareAbs=function(t){var e=this.value,r=K(t).value;return(e=e>=0?e:-e)===(r=r>=0?r:-r)?0:e>r?1:-1},p.prototype.compare=function(t){if(t===1/0)return-1;if(t===-1/0)return 1;var e=K(t),r=this.value,o=e.value;return this.sign!==e.sign?e.sign?1:-1:e.isSmall?this.sign?-1:1:A(r,o)*(this.sign?-1:1)},p.prototype.compareTo=p.prototype.compare,a.prototype.compare=function(t){if(t===1/0)return-1;if(t===-1/0)return 1;var e=K(t),r=this.value,o=e.value;return e.isSmall?r==o?0:r>o?1:-1:r<0!==e.sign?r<0?-1:1:r<0?1:-1},a.prototype.compareTo=a.prototype.compare,s.prototype.compare=function(t){if(t===1/0)return-1;if(t===-1/0)return 1;var e=this.value,r=K(t).value;return e===r?0:e>r?1:-1},s.prototype.compareTo=s.prototype.compare,p.prototype.equals=function(t){return 0===this.compare(t)},s.prototype.eq=s.prototype.equals=a.prototype.eq=a.prototype.equals=p.prototype.eq=p.prototype.equals,p.prototype.notEquals=function(t){return 0!==this.compare(t)},s.prototype.neq=s.prototype.notEquals=a.prototype.neq=a.prototype.notEquals=p.prototype.neq=p.prototype.notEquals,p.prototype.greater=function(t){return this.compare(t)>0},s.prototype.gt=s.prototype.greater=a.prototype.gt=a.prototype.greater=p.prototype.gt=p.prototype.greater,p.prototype.lesser=function(t){return this.compare(t)<0},s.prototype.lt=s.prototype.lesser=a.prototype.lt=a.prototype.lesser=p.prototype.lt=p.prototype.lesser,p.prototype.greaterOrEquals=function(t){return this.compare(t)>=0},s.prototype.geq=s.prototype.greaterOrEquals=a.prototype.geq=a.prototype.greaterOrEquals=p.prototype.geq=p.prototype.greaterOrEquals,p.prototype.lesserOrEquals=function(t){return this.compare(t)<=0},s.prototype.leq=s.prototype.lesserOrEquals=a.prototype.leq=a.prototype.lesserOrEquals=p.prototype.leq=p.prototype.lesserOrEquals,p.prototype.isEven=function(){return 0==(1&this.value[0])},a.prototype.isEven=function(){return 0==(1&this.value)},s.prototype.isEven=function(){return(this.value&BigInt(1))===BigInt(0)},p.prototype.isOdd=function(){return 1==(1&this.value[0])},a.prototype.isOdd=function(){return 1==(1&this.value)},s.prototype.isOdd=function(){return(this.value&BigInt(1))===BigInt(1)},p.prototype.isPositive=function(){return!this.sign},a.prototype.isPositive=function(){return this.value>0},s.prototype.isPositive=a.prototype.isPositive,p.prototype.isNegative=function(){return this.sign},a.prototype.isNegative=function(){return this.value<0},s.prototype.isNegative=a.prototype.isNegative,p.prototype.isUnit=function(){return!1},a.prototype.isUnit=function(){return 1===Math.abs(this.value)},s.prototype.isUnit=function(){return this.abs().value===BigInt(1)},p.prototype.isZero=function(){return!1},a.prototype.isZero=function(){return 0===this.value},s.prototype.isZero=function(){return this.value===BigInt(0)},p.prototype.isDivisibleBy=function(t){var e=K(t);return!e.isZero()&&(!!e.isUnit()||(0===e.compareAbs(2)?this.isEven():this.mod(e).isZero()))},s.prototype.isDivisibleBy=a.prototype.isDivisibleBy=p.prototype.isDivisibleBy,p.prototype.isPrime=function(e){var r=P(this);if(r!==t)return r;var o=this.abs(),n=o.bitLength();if(n<=64)return Z(o,[2,3,5,7,11,13,17,19,23,29,31,37]);for(var i=Math.log(2)*n.toJSNumber(),u=Math.ceil(!0===e?2*Math.pow(i,2):i),p=[],a=0;a-r?new a(t-1):new p(o,!0)},s.prototype.prev=function(){return new s(this.value-BigInt(1))};for(var x=[1];2*x[x.length-1]<=e;)x.push(2*x[x.length-1]);var J=x.length,L=x[J-1];function U(t){return Math.abs(t)<=e}function T(t,e,r){e=K(e);for(var o=t.isNegative(),n=e.isNegative(),i=o?t.not():t,u=n?e.not():e,p=0,a=0,s=null,l=null,f=[];!i.isZero()||!u.isZero();)p=(s=B(i,L))[1].toJSNumber(),o&&(p=L-1-p),a=(l=B(u,L))[1].toJSNumber(),n&&(a=L-1-a),i=s[0],u=l[0],f.push(r(p,a));for(var v=0!==r(o?1:0,n?1:0)?bigInt(-1):bigInt(0),h=f.length-1;h>=0;h-=1)v=v.multiply(L).add(bigInt(f[h]));return v}p.prototype.shiftLeft=function(t){var e=K(t).toJSNumber();if(!U(e))throw new Error(String(e)+" is too large for shifting.");if(e<0)return this.shiftRight(-e);var r=this;if(r.isZero())return r;for(;e>=J;)r=r.multiply(L),e-=J-1;return r.multiply(x[e])},s.prototype.shiftLeft=a.prototype.shiftLeft=p.prototype.shiftLeft,p.prototype.shiftRight=function(t){var e,r=K(t).toJSNumber();if(!U(r))throw new Error(String(r)+" is too large for shifting.");if(r<0)return this.shiftLeft(-r);for(var o=this;r>=J;){if(o.isZero()||o.isNegative()&&o.isUnit())return o;o=(e=B(o,L))[1].isNegative()?e[0].prev():e[0],r-=J-1}return(e=B(o,x[r]))[1].isNegative()?e[0].prev():e[0]},s.prototype.shiftRight=a.prototype.shiftRight=p.prototype.shiftRight,p.prototype.not=function(){return this.negate().prev()},s.prototype.not=a.prototype.not=p.prototype.not,p.prototype.and=function(t){return T(this,t,(function(t,e){return t&e}))},s.prototype.and=a.prototype.and=p.prototype.and,p.prototype.or=function(t){return T(this,t,(function(t,e){return t|e}))},s.prototype.or=a.prototype.or=p.prototype.or,p.prototype.xor=function(t){return T(this,t,(function(t,e){return t^e}))},s.prototype.xor=a.prototype.xor=p.prototype.xor;var j=1<<30;function C(t){var r=t.value,o="number"==typeof r?r|j:"bigint"==typeof r?r|BigInt(j):r[0]+r[1]*e|1073758208;return o&-o}function D(t,e){if(e.compareTo(t)<=0){var r=D(t,e.square(e)),o=r.p,n=r.e,i=o.multiply(e);return i.compareTo(t)<=0?{p:i,e:2*n+1}:{p:o,e:2*n}}return{p:bigInt(1),e:0}}function z(t,e){return t=K(t),e=K(e),t.greater(e)?t:e}function R(t,e){return t=K(t),e=K(e),t.lesser(e)?t:e}function k(t,e){if(t=K(t).abs(),e=K(e).abs(),t.equals(e))return t;if(t.isZero())return e;if(e.isZero())return t;for(var r,o,n=u[1];t.isEven()&&e.isEven();)r=R(C(t),C(e)),t=t.divide(r),e=e.divide(r),n=n.multiply(r);for(;t.isEven();)t=t.divide(C(t));do{for(;e.isEven();)e=e.divide(C(e));t.greater(e)&&(o=e,e=t,t=o),e=e.subtract(t)}while(!e.isZero());return n.isUnit()?t:t.multiply(n)}p.prototype.bitLength=function(){var t=this;return t.compareTo(bigInt(0))<0&&(t=t.negate().subtract(bigInt(1))),0===t.compareTo(bigInt(0))?bigInt(0):bigInt(D(t,bigInt(2)).e).add(bigInt(1))},s.prototype.bitLength=a.prototype.bitLength=p.prototype.bitLength;var _=function(t,e,r,o){r=r||n,t=String(t),o||(t=t.toLowerCase(),r=r.toLowerCase());var i,u=t.length,p=Math.abs(e),a={};for(i=0;i=p)){if("1"===f&&1===p)continue;throw new Error(f+" is not a valid digit in base "+e+".")}}e=K(e);var s=[],l="-"===t[0];for(i=l?1:0;i"!==t[i]&&i=0;o--)n=n.add(t[o].times(i)),i=i.times(e);return r?n.negate():n}function F(t,e){if((e=bigInt(e)).isZero()){if(t.isZero())return{value:[0],isNegative:!1};throw new Error("Cannot convert nonzero numbers to base 0.")}if(e.equals(-1)){if(t.isZero())return{value:[0],isNegative:!1};if(t.isNegative())return{value:[].concat.apply([],Array.apply(null,Array(-t.toJSNumber())).map(Array.prototype.valueOf,[1,0])),isNegative:!1};var r=Array.apply(null,Array(t.toJSNumber()-1)).map(Array.prototype.valueOf,[0,1]);return r.unshift([1]),{value:[].concat.apply([],r),isNegative:!1}}var o=!1;if(t.isNegative()&&e.isPositive()&&(o=!0,t=t.abs()),e.isUnit())return t.isZero()?{value:[0],isNegative:!1}:{value:Array.apply(null,Array(t.toJSNumber())).map(Number.prototype.valueOf,1),isNegative:o};for(var n,i=[],u=t;u.isNegative()||u.compareAbs(e)>=0;){n=u.divmod(e),u=n.quotient;var p=n.remainder;p.isNegative()&&(p=e.minus(p).abs(),u=u.next()),i.push(p.toJSNumber())}return i.push(u.toJSNumber()),{value:i.reverse(),isNegative:o}}function G(t,e,r){var o=F(t,e);return(o.isNegative?"-":"")+o.value.map((function(t){return function(t,e){return t<(e=e||n).length?e[t]:"<"+t+">"}(t,r)})).join("")}function H(t){if(l(+t)){var e=+t;if(e===g(e))return i?new s(BigInt(e)):new a(e);throw new Error("Invalid integer: "+t)}var r="-"===t[0];r&&(t=t.slice(1));var o=t.split(/e/i);if(o.length>2)throw new Error("Invalid integer: "+o.join("e"));if(2===o.length){var n=o[1];if("+"===n[0]&&(n=n.slice(1)),(n=+n)!==g(n)||!l(n))throw new Error("Invalid integer: "+n+" is not a valid exponent.");var u=o[0],f=u.indexOf(".");if(f>=0&&(n-=u.length-f-1,u=u.slice(0,f)+u.slice(f+1)),n<0)throw new Error("Cannot include negative exponent part for integers");t=u+=new Array(n+1).join("0")}if(!/^([0-9][0-9]*)$/.test(t))throw new Error("Invalid integer: "+t);if(i)return new s(BigInt(r?"-"+t:t));for(var v=[],y=t.length,c=y-7;y>0;)v.push(+t.slice(c,y)),(c-=7)<0&&(c=0),y-=7;return h(v),new p(v,r)}function K(t){return"number"==typeof t?function(t){if(i)return new s(BigInt(t));if(l(t)){if(t!==g(t))throw new Error(t+" is not an integer.");return new a(t)}return H(t.toString())}(t):"string"==typeof t?H(t):"bigint"==typeof t?new s(t):t}p.prototype.toArray=function(t){return F(this,t)},a.prototype.toArray=function(t){return F(this,t)},s.prototype.toArray=function(t){return F(this,t)},p.prototype.toString=function(e,r){if(e===t&&(e=10),10!==e)return G(this,e,r);for(var o,n=this.value,i=n.length,u=String(n[--i]);--i>=0;)o=String(n[i]),u+="0000000".slice(o.length)+o;return(this.sign?"-":"")+u},a.prototype.toString=function(e,r){return e===t&&(e=10),10!=e?G(this,e,r):String(this.value)},s.prototype.toString=a.prototype.toString,s.prototype.toJSON=p.prototype.toJSON=a.prototype.toJSON=function(){return this.toString()},p.prototype.valueOf=function(){return parseInt(this.toString(),10)},p.prototype.toJSNumber=p.prototype.valueOf,a.prototype.valueOf=function(){return this.value},a.prototype.toJSNumber=a.prototype.valueOf,s.prototype.valueOf=s.prototype.toJSNumber=function(){return parseInt(this.toString(),10)};for(var Q=0;Q<1e3;Q++)u[Q]=K(Q),Q>0&&(u[-Q]=K(-Q));return u.one=u[1],u.zero=u[0],u.minusOne=u[-1],u.max=z,u.min=R,u.gcd=k,u.lcm=function(t,e){return t=K(t).abs(),e=K(e).abs(),t.divide(k(t,e)).multiply(e)},u.isInstance=function(t){return t instanceof p||t instanceof a||t instanceof s},u.randBetween=function(t,r,o){t=K(t),r=K(r);var n=o||Math.random,i=R(t,r),p=z(t,r).subtract(i).add(1);if(p.isSmall)return i.add(Math.floor(n()*p));for(var a=F(p,e).value,s=[],l=!0,f=0;f
diff --git a/temporary_modules/trezor-connect/node_modules/big-integer/README.md b/temporary_modules/trezor-connect/node_modules/big-integer/README.md
new file mode 100644
index 00000000..d72420fb
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/big-integer/README.md
@@ -0,0 +1,589 @@
+# BigInteger.js [![Build Status][travis-img]][travis-url] [![Coverage Status][coveralls-img]][coveralls-url] [![Monthly Downloads][downloads-img]][downloads-url]
+
+[travis-url]: https://travis-ci.org/peterolson/BigInteger.js
+[travis-img]: https://travis-ci.org/peterolson/BigInteger.js.svg?branch=master
+[coveralls-url]: https://coveralls.io/github/peterolson/BigInteger.js?branch=master
+[coveralls-img]: https://coveralls.io/repos/peterolson/BigInteger.js/badge.svg?branch=master&service=github
+[downloads-url]: https://www.npmjs.com/package/big-integer
+[downloads-img]: https://img.shields.io/npm/dm/big-integer.svg
+
+**BigInteger.js** is an arbitrary-length integer library for Javascript, allowing arithmetic operations on integers of unlimited size, notwithstanding memory and time limitations.
+
+**Update (December 2, 2018):** [`BigInt` is being added as a native feature of JavaScript](https://tc39.github.io/proposal-bigint/). This library now works as a polyfill: if the environment supports the native `BigInt`, this library acts as a thin wrapper over the native implementation.
+
+## Installation
+
+If you are using a browser, you can download [BigInteger.js from GitHub](http://peterolson.github.com/BigInteger.js/BigInteger.min.js) or just hotlink to it:
+
+
+
+If you are using node, you can install BigInteger with [npm](https://npmjs.org/).
+
+ npm install big-integer
+
+Then you can include it in your code:
+
+ var bigInt = require("big-integer");
+
+
+## Usage
+### `bigInt(number, [base], [alphabet], [caseSensitive])`
+
+You can create a bigInt by calling the `bigInt` function. You can pass in
+
+ - a string, which it will parse as an bigInt and throw an `"Invalid integer"` error if the parsing fails.
+ - a Javascript number, which it will parse as an bigInt and throw an `"Invalid integer"` error if the parsing fails.
+ - another bigInt.
+ - nothing, and it will return `bigInt.zero`.
+
+ If you provide a second parameter, then it will parse `number` as a number in base `base`. Note that `base` can be any bigInt (even negative or zero). The letters "a-z" and "A-Z" will be interpreted as the numbers 10 to 35. Higher digits can be specified in angle brackets (`<` and `>`). The default `base` is `10`.
+
+ You can specify a custom alphabet for base conversion with the third parameter. The default `alphabet` is `"0123456789abcdefghijklmnopqrstuvwxyz"`.
+
+ The fourth parameter specifies whether or not the number string should be case-sensitive, i.e. whether `a` and `A` should be treated as different digits. By default `caseSensitive` is `false`.
+
+Examples:
+
+ var zero = bigInt();
+ var ninetyThree = bigInt(93);
+ var largeNumber = bigInt("75643564363473453456342378564387956906736546456235345");
+ var googol = bigInt("1e100");
+ var bigNumber = bigInt(largeNumber);
+
+ var maximumByte = bigInt("FF", 16);
+ var fiftyFiveGoogol = bigInt("<55>0", googol);
+
+Note that Javascript numbers larger than `9007199254740992` and smaller than `-9007199254740992` are not precisely represented numbers and will not produce exact results. If you are dealing with numbers outside that range, it is better to pass in strings.
+
+### Method Chaining
+
+Note that bigInt operations return bigInts, which allows you to chain methods, for example:
+
+ var salary = bigInt(dollarsPerHour).times(hoursWorked).plus(randomBonuses)
+
+### Constants
+
+There are three named constants already stored that you do not have to construct with the `bigInt` function yourself:
+
+ - `bigInt.one`, equivalent to `bigInt(1)`
+ - `bigInt.zero`, equivalent to `bigInt(0)`
+ - `bigInt.minusOne`, equivalent to `bigInt(-1)`
+
+The numbers from -999 to 999 are also already prestored and can be accessed using `bigInt[index]`, for example:
+
+ - `bigInt[-999]`, equivalent to `bigInt(-999)`
+ - `bigInt[256]`, equivalent to `bigInt(256)`
+
+### Methods
+
+#### `abs()`
+
+Returns the absolute value of a bigInt.
+
+ - `bigInt(-45).abs()` => `45`
+ - `bigInt(45).abs()` => `45`
+
+#### `add(number)`
+
+Performs addition.
+
+ - `bigInt(5).add(7)` => `12`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Addition)
+
+#### `and(number)`
+
+Performs the bitwise AND operation. The operands are treated as if they were represented using [two's complement representation](http://en.wikipedia.org/wiki/Two%27s_complement).
+
+ - `bigInt(6).and(3)` => `2`
+ - `bigInt(6).and(-3)` => `4`
+
+#### `bitLength()`
+
+Returns the number of digits required to represent a bigInt in binary.
+
+ - `bigInt(5)` => `3` (since 5 is `101` in binary, which is three digits long)
+
+#### `compare(number)`
+
+Performs a comparison between two numbers. If the numbers are equal, it returns `0`. If the first number is greater, it returns `1`. If the first number is lesser, it returns `-1`.
+
+ - `bigInt(5).compare(5)` => `0`
+ - `bigInt(5).compare(4)` => `1`
+ - `bigInt(4).compare(5)` => `-1`
+
+#### `compareAbs(number)`
+
+Performs a comparison between the absolute value of two numbers.
+
+ - `bigInt(5).compareAbs(-5)` => `0`
+ - `bigInt(5).compareAbs(4)` => `1`
+ - `bigInt(4).compareAbs(-5)` => `-1`
+
+#### `compareTo(number)`
+
+Alias for the `compare` method.
+
+#### `divide(number)`
+
+Performs integer division, disregarding the remainder.
+
+ - `bigInt(59).divide(5)` => `11`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Division)
+
+#### `divmod(number)`
+
+Performs division and returns an object with two properties: `quotient` and `remainder`. The sign of the remainder will match the sign of the dividend.
+
+ - `bigInt(59).divmod(5)` => `{quotient: bigInt(11), remainder: bigInt(4) }`
+ - `bigInt(-5).divmod(2)` => `{quotient: bigInt(-2), remainder: bigInt(-1) }`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Division)
+
+#### `eq(number)`
+
+Alias for the `equals` method.
+
+#### `equals(number)`
+
+Checks if two numbers are equal.
+
+ - `bigInt(5).equals(5)` => `true`
+ - `bigInt(4).equals(7)` => `false`
+
+#### `geq(number)`
+
+Alias for the `greaterOrEquals` method.
+
+
+#### `greater(number)`
+
+Checks if the first number is greater than the second.
+
+ - `bigInt(5).greater(6)` => `false`
+ - `bigInt(5).greater(5)` => `false`
+ - `bigInt(5).greater(4)` => `true`
+
+#### `greaterOrEquals(number)`
+
+Checks if the first number is greater than or equal to the second.
+
+ - `bigInt(5).greaterOrEquals(6)` => `false`
+ - `bigInt(5).greaterOrEquals(5)` => `true`
+ - `bigInt(5).greaterOrEquals(4)` => `true`
+
+#### `gt(number)`
+
+Alias for the `greater` method.
+
+#### `isDivisibleBy(number)`
+
+Returns `true` if the first number is divisible by the second number, `false` otherwise.
+
+ - `bigInt(999).isDivisibleBy(333)` => `true`
+ - `bigInt(99).isDivisibleBy(5)` => `false`
+
+#### `isEven()`
+
+Returns `true` if the number is even, `false` otherwise.
+
+ - `bigInt(6).isEven()` => `true`
+ - `bigInt(3).isEven()` => `false`
+
+#### `isNegative()`
+
+Returns `true` if the number is negative, `false` otherwise.
+Returns `false` for `0` and `-0`.
+
+ - `bigInt(-23).isNegative()` => `true`
+ - `bigInt(50).isNegative()` => `false`
+
+#### `isOdd()`
+
+Returns `true` if the number is odd, `false` otherwise.
+
+ - `bigInt(13).isOdd()` => `true`
+ - `bigInt(40).isOdd()` => `false`
+
+#### `isPositive()`
+
+Return `true` if the number is positive, `false` otherwise.
+Returns `false` for `0` and `-0`.
+
+ - `bigInt(54).isPositive()` => `true`
+ - `bigInt(-1).isPositive()` => `false`
+
+#### `isPrime(strict?)`
+
+Returns `true` if the number is prime, `false` otherwise.
+Set "strict" boolean to true to force GRH-supported lower bound of 2*log(N)^2.
+
+ - `bigInt(5).isPrime()` => `true`
+ - `bigInt(6).isPrime()` => `false`
+
+#### `isProbablePrime([iterations], [rng])`
+
+Returns `true` if the number is very likely to be prime, `false` otherwise.
+Supplying `iterations` is optional - it determines the number of iterations of the test (default: `5`). The more iterations, the lower chance of getting a false positive.
+This uses the [Miller Rabin test](https://en.wikipedia.org/wiki/Miller%E2%80%93Rabin_primality_test).
+
+ - `bigInt(5).isProbablePrime()` => `true`
+ - `bigInt(49).isProbablePrime()` => `false`
+ - `bigInt(1729).isProbablePrime()` => `false`
+
+Note that this function is not deterministic, since it relies on random sampling of factors, so the result for some numbers is not always the same - unless you pass a predictable random number generator as `rng`. The behavior and requirements are the same as with `randBetween`.
+
+ - `bigInt(1729).isProbablePrime(1, () => 0.1)` => `false`
+ - `bigInt(1729).isProbablePrime(1, () => 0.2)` => `true`
+
+If the number is composite then the Miller–Rabin primality test declares the number probably prime with a probability at most `4` to the power `−iterations`.
+If the number is prime, this function always returns `true`.
+
+#### `isUnit()`
+
+Returns `true` if the number is `1` or `-1`, `false` otherwise.
+
+ - `bigInt.one.isUnit()` => `true`
+ - `bigInt.minusOne.isUnit()` => `true`
+ - `bigInt(5).isUnit()` => `false`
+
+#### `isZero()`
+
+Return `true` if the number is `0` or `-0`, `false` otherwise.
+
+ - `bigInt.zero.isZero()` => `true`
+ - `bigInt("-0").isZero()` => `true`
+ - `bigInt(50).isZero()` => `false`
+
+#### `leq(number)`
+
+Alias for the `lesserOrEquals` method.
+
+#### `lesser(number)`
+
+Checks if the first number is lesser than the second.
+
+ - `bigInt(5).lesser(6)` => `true`
+ - `bigInt(5).lesser(5)` => `false`
+ - `bigInt(5).lesser(4)` => `false`
+
+#### `lesserOrEquals(number)`
+
+Checks if the first number is less than or equal to the second.
+
+ - `bigInt(5).lesserOrEquals(6)` => `true`
+ - `bigInt(5).lesserOrEquals(5)` => `true`
+ - `bigInt(5).lesserOrEquals(4)` => `false`
+
+#### `lt(number)`
+
+Alias for the `lesser` method.
+
+#### `minus(number)`
+
+Alias for the `subtract` method.
+
+ - `bigInt(3).minus(5)` => `-2`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Subtraction)
+
+#### `mod(number)`
+
+Performs division and returns the remainder, disregarding the quotient. The sign of the remainder will match the sign of the dividend.
+
+ - `bigInt(59).mod(5)` => `4`
+ - `bigInt(-5).mod(2)` => `-1`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Division)
+
+#### `modInv(mod)`
+
+Finds the [multiplicative inverse](https://en.wikipedia.org/wiki/Modular_multiplicative_inverse) of the number modulo `mod`.
+
+ - `bigInt(3).modInv(11)` => `4`
+ - `bigInt(42).modInv(2017)` => `1969`
+
+#### `modPow(exp, mod)`
+
+Takes the number to the power `exp` modulo `mod`.
+
+ - `bigInt(10).modPow(3, 30)` => `10`
+
+#### `multiply(number)`
+
+Performs multiplication.
+
+ - `bigInt(111).multiply(111)` => `12321`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Multiplication)
+
+#### `neq(number)`
+
+Alias for the `notEquals` method.
+
+#### `next()`
+
+Adds one to the number.
+
+ - `bigInt(6).next()` => `7`
+
+#### `not()`
+
+Performs the bitwise NOT operation. The operands are treated as if they were represented using [two's complement representation](http://en.wikipedia.org/wiki/Two%27s_complement).
+
+ - `bigInt(10).not()` => `-11`
+ - `bigInt(0).not()` => `-1`
+
+#### `notEquals(number)`
+
+Checks if two numbers are not equal.
+
+ - `bigInt(5).notEquals(5)` => `false`
+ - `bigInt(4).notEquals(7)` => `true`
+
+#### `or(number)`
+
+Performs the bitwise OR operation. The operands are treated as if they were represented using [two's complement representation](http://en.wikipedia.org/wiki/Two%27s_complement).
+
+ - `bigInt(13).or(10)` => `15`
+ - `bigInt(13).or(-8)` => `-3`
+
+#### `over(number)`
+
+Alias for the `divide` method.
+
+ - `bigInt(59).over(5)` => `11`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Division)
+
+#### `plus(number)`
+
+Alias for the `add` method.
+
+ - `bigInt(5).plus(7)` => `12`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Addition)
+
+#### `pow(number)`
+
+Performs exponentiation. If the exponent is less than `0`, `pow` returns `0`. `bigInt.zero.pow(0)` returns `1`.
+
+ - `bigInt(16).pow(16)` => `18446744073709551616`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Exponentiation)
+
+#### `prev(number)`
+
+Subtracts one from the number.
+
+ - `bigInt(6).prev()` => `5`
+
+#### `remainder(number)`
+
+Alias for the `mod` method.
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Division)
+
+#### `shiftLeft(n)`
+
+Shifts the number left by `n` places in its binary representation. If a negative number is provided, it will shift right. Throws an error if `n` is outside of the range `[-9007199254740992, 9007199254740992]`.
+
+ - `bigInt(8).shiftLeft(2)` => `32`
+ - `bigInt(8).shiftLeft(-2)` => `2`
+
+#### `shiftRight(n)`
+
+Shifts the number right by `n` places in its binary representation. If a negative number is provided, it will shift left. Throws an error if `n` is outside of the range `[-9007199254740992, 9007199254740992]`.
+
+ - `bigInt(8).shiftRight(2)` => `2`
+ - `bigInt(8).shiftRight(-2)` => `32`
+
+#### `square()`
+
+Squares the number
+
+ - `bigInt(3).square()` => `9`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Squaring)
+
+#### `subtract(number)`
+
+Performs subtraction.
+
+ - `bigInt(3).subtract(5)` => `-2`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Subtraction)
+
+#### `times(number)`
+
+Alias for the `multiply` method.
+
+ - `bigInt(111).times(111)` => `12321`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#Multiplication)
+
+#### `toArray(radix)`
+
+Converts a bigInt into an object with the properties "value" and "isNegative." "Value" is an array of integers modulo the given radix. "isNegative" is a boolean that represents the sign of the result.
+
+ - `bigInt("1e9").toArray(10)` => {
+ value: [1, 0, 0, 0, 0, 0, 0, 0, 0, 0],
+ isNegative: false
+ }
+ - `bigInt("1e9").toArray(16)` => {
+ value: [3, 11, 9, 10, 12, 10, 0, 0],
+ isNegative: false
+ }
+ - `bigInt(567890).toArray(100)` => {
+ value: [56, 78, 90],
+ isNegative: false
+ }
+
+Negative bases are supported.
+
+ - `bigInt(12345).toArray(-10)` => {
+ value: [2, 8, 4, 6, 5],
+ isNegative: false
+ }
+
+Base 1 and base -1 are also supported.
+
+ - `bigInt(-15).toArray(1)` => {
+ value: [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1],
+ isNegative: true
+ }
+ - `bigInt(-15).toArray(-1)` => {
+ value: [1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1,
+ 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0],
+ isNegative: false
+ }
+
+Base 0 is only allowed for the number zero.
+
+ - `bigInt(0).toArray(0)` => {
+ value: [0],
+ isNegative: false
+ }
+ - `bigInt(1).toArray(0)` => `Error: Cannot convert nonzero numbers to base 0.`
+
+#### `toJSNumber()`
+
+Converts a bigInt into a native Javascript number. Loses precision for numbers outside the range `[-9007199254740992, 9007199254740992]`.
+
+ - `bigInt("18446744073709551616").toJSNumber()` => `18446744073709552000`
+
+#### `xor(number)`
+
+Performs the bitwise XOR operation. The operands are treated as if they were represented using [two's complement representation](http://en.wikipedia.org/wiki/Two%27s_complement).
+
+ - `bigInt(12).xor(5)` => `9`
+ - `bigInt(12).xor(-5)` => `-9`
+
+### Static Methods
+
+#### `fromArray(digits, base = 10, isNegative?)`
+
+Constructs a bigInt from an array of digits in base `base`. The optional `isNegative` flag will make the number negative.
+
+ - `bigInt.fromArray([1, 2, 3, 4, 5], 10)` => `12345`
+ - `bigInt.fromArray([1, 0, 0], 2, true)` => `-4`
+
+#### `gcd(a, b)`
+
+Finds the greatest common denominator of `a` and `b`.
+
+ - `bigInt.gcd(42,56)` => `14`
+
+#### `isInstance(x)`
+
+Returns `true` if `x` is a BigInteger, `false` otherwise.
+
+ - `bigInt.isInstance(bigInt(14))` => `true`
+ - `bigInt.isInstance(14)` => `false`
+
+#### `lcm(a,b)`
+
+Finds the least common multiple of `a` and `b`.
+
+ - `bigInt.lcm(21, 6)` => `42`
+
+#### `max(a,b)`
+
+Returns the largest of `a` and `b`.
+
+ - `bigInt.max(77, 432)` => `432`
+
+#### `min(a,b)`
+
+Returns the smallest of `a` and `b`.
+
+ - `bigInt.min(77, 432)` => `77`
+
+#### `randBetween(min, max, [rng])`
+
+Returns a random number between `min` and `max`, optionally using `rng` to generate randomness.
+
+ - `bigInt.randBetween("-1e100", "1e100")` => (for example) `8494907165436643479673097939554427056789510374838494147955756275846226209006506706784609314471378745`
+
+`rng` should take no arguments and return a `number` between 0 and 1. It defaults to `Math.random`.
+
+ - `bigInt.randBetween("-1e100", "1e100", () => 0.5)` => (always) `50000005000000500000050000005000000500000050000005000000500000050000005000000500000050000005000000`
+
+
+### Override Methods
+
+#### `toString(radix = 10, [alphabet])`
+
+Converts a bigInt to a string. There is an optional radix parameter (which defaults to 10) that converts the number to the given radix. Digits in the range `10-35` will use the letters `a-z`.
+
+ - `bigInt("1e9").toString()` => `"1000000000"`
+ - `bigInt("1e9").toString(16)` => `"3b9aca00"`
+
+ You can use a custom base alphabet with the second parameter. The default `alphabet` is `"0123456789abcdefghijklmnopqrstuvwxyz"`.
+
+ - `bigInt("5").toString(2, "aA")` => `"AaA"`
+
+**Note that arithmetical operators will trigger the `valueOf` function rather than the `toString` function.** When converting a bigInteger to a string, you should use the `toString` method or the `String` function instead of adding the empty string.
+
+ - `bigInt("999999999999999999").toString()` => `"999999999999999999"`
+ - `String(bigInt("999999999999999999"))` => `"999999999999999999"`
+ - `bigInt("999999999999999999") + ""` => `1000000000000000000`
+
+Bases larger than 36 are supported. If a digit is greater than or equal to 36, it will be enclosed in angle brackets.
+
+ - `bigInt(567890).toString(100)` => `"<56><78><90>"`
+
+Negative bases are also supported.
+
+ - `bigInt(12345).toString(-10)` => `"28465"`
+
+Base 1 and base -1 are also supported.
+
+ - `bigInt(-15).toString(1)` => `"-111111111111111"`
+ - `bigInt(-15).toString(-1)` => `"101010101010101010101010101010"`
+
+Base 0 is only allowed for the number zero.
+
+ - `bigInt(0).toString(0)` => `0`
+ - `bigInt(1).toString(0)` => `Error: Cannot convert nonzero numbers to base 0.`
+
+[View benchmarks for this method](http://peterolson.github.io/BigInteger.js/benchmark/#toString)
+
+#### `valueOf()`
+
+Converts a bigInt to a native Javascript number. This override allows you to use native arithmetic operators without explicit conversion:
+
+ - `bigInt("100") + bigInt("200") === 300; //true`
+
+## Contributors
+
+To contribute, just fork the project, make some changes, and submit a pull request. Please verify that the unit tests pass before submitting.
+
+The unit tests are contained in the `spec/spec.js` file. You can run them locally by opening the `spec/SpecRunner.html` or file or running `npm test`. You can also [run the tests online from GitHub](http://peterolson.github.io/BigInteger.js/spec/SpecRunner.html).
+
+There are performance benchmarks that can be viewed from the `benchmarks/index.html` page. You can [run them online from GitHub](http://peterolson.github.io/BigInteger.js/benchmark/).
+
+## License
+
+This project is public domain. For more details, read about the [Unlicense](http://unlicense.org/).
diff --git a/temporary_modules/trezor-connect/node_modules/big-integer/bower.json b/temporary_modules/trezor-connect/node_modules/big-integer/bower.json
new file mode 100644
index 00000000..22dc58f5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/big-integer/bower.json
@@ -0,0 +1,29 @@
+{
+ "name": "big-integer",
+ "description": "An arbitrary length integer library for Javascript",
+ "main": "./BigInteger.js",
+ "authors": [
+ "Peter Olson"
+ ],
+ "license": "Unlicense",
+ "keywords": [
+ "math",
+ "big",
+ "bignum",
+ "bigint",
+ "biginteger",
+ "integer",
+ "arbitrary",
+ "precision",
+ "arithmetic"
+ ],
+ "homepage": "https://github.com/peterolson/BigInteger.js",
+ "ignore": [
+ "**/.*",
+ "node_modules",
+ "bower_components",
+ "test",
+ "coverage",
+ "tests"
+ ]
+}
diff --git a/temporary_modules/trezor-connect/node_modules/big-integer/package.json b/temporary_modules/trezor-connect/node_modules/big-integer/package.json
new file mode 100644
index 00000000..a6eb2011
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/big-integer/package.json
@@ -0,0 +1,48 @@
+{
+ "name": "big-integer",
+ "version": "1.6.51",
+ "author": "Peter Olson ",
+ "description": "An arbitrary length integer library for Javascript",
+ "contributors": [],
+ "bin": {},
+ "scripts": {
+ "test": "tsc && karma start my.conf.js && node spec/tsDefinitions.js",
+ "minify": "uglifyjs BigInteger.js -o BigInteger.min.js"
+ },
+ "main": "./BigInteger",
+ "repository": {
+ "type": "git",
+ "url": "git@github.com:peterolson/BigInteger.js.git"
+ },
+ "keywords": [
+ "math",
+ "big",
+ "bignum",
+ "bigint",
+ "biginteger",
+ "integer",
+ "arbitrary",
+ "precision",
+ "arithmetic"
+ ],
+ "devDependencies": {
+ "@types/lodash": "^4.14.175",
+ "@types/node": "^7.10.2",
+ "coveralls": "^3.0.6",
+ "jasmine": "3.5.0",
+ "jasmine-core": "^3.5.0",
+ "karma": "^6.3.4",
+ "karma-cli": "^2.0.0",
+ "karma-coverage": "^2.0.3",
+ "karma-jasmine": "^4.0.1",
+ "karma-phantomjs-launcher": "^1.0.4",
+ "lodash": "^4.17.21",
+ "typescript": "^3.6.3",
+ "uglifyjs": "^2.4.10"
+ },
+ "license": "Unlicense",
+ "engines": {
+ "node": ">=0.6"
+ },
+ "typings": "./BigInteger.d.ts"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/big-integer/tsconfig.json b/temporary_modules/trezor-connect/node_modules/big-integer/tsconfig.json
new file mode 100644
index 00000000..dae01d4f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/big-integer/tsconfig.json
@@ -0,0 +1,26 @@
+{
+ "compilerOptions": {
+ "target": "esnext",
+ "module": "commonjs",
+ "lib": [
+ "es6"
+ ],
+ "noImplicitAny": true,
+ "noImplicitThis": true,
+ "strictNullChecks": false,
+ "baseUrl": "./",
+ "moduleResolution": "node",
+ "allowJs": true,
+ "typeRoots": [
+ "./"
+ ],
+ "types": [
+ "node"
+ ],
+ "forceConsistentCasingInFileNames": true
+ },
+ "files": [
+ "BigInteger.d.ts",
+ "spec/tsDefinitions.ts"
+ ]
+}
diff --git a/temporary_modules/trezor-connect/node_modules/bplist-parser/.editorconfig b/temporary_modules/trezor-connect/node_modules/bplist-parser/.editorconfig
new file mode 100644
index 00000000..c6812c16
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/bplist-parser/.editorconfig
@@ -0,0 +1,12 @@
+; EditorConfig file: https://EditorConfig.org
+; Install the "EditorConfig" plugin into your editor to use
+
+root = true
+
+[*]
+charset = utf-8
+end_of_line = lf
+insert_final_newline = true
+indent_style = space
+indent_size = 2
+trim_trailing_whitespace = true
diff --git a/temporary_modules/trezor-connect/node_modules/bplist-parser/.eslintignore b/temporary_modules/trezor-connect/node_modules/bplist-parser/.eslintignore
new file mode 100644
index 00000000..3c3629e6
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/bplist-parser/.eslintignore
@@ -0,0 +1 @@
+node_modules
diff --git a/temporary_modules/trezor-connect/node_modules/bplist-parser/.eslintrc.js b/temporary_modules/trezor-connect/node_modules/bplist-parser/.eslintrc.js
new file mode 100644
index 00000000..8ee3b33f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/bplist-parser/.eslintrc.js
@@ -0,0 +1,295 @@
+module.exports = {
+ "env": {
+ "node": true,
+ "commonjs": true,
+ "es6": true
+ },
+ "extends": "eslint:recommended",
+ "globals": {
+ "Atomics": "readonly",
+ "SharedArrayBuffer": "readonly"
+ },
+ "parserOptions": {
+ "ecmaVersion": 2018
+ },
+ "rules": {
+ "accessor-pairs": "error",
+ "array-bracket-newline": "error",
+ "array-bracket-spacing": "off",
+ "array-callback-return": "error",
+ "array-element-newline": "off",
+ "arrow-body-style": "error",
+ "arrow-parens": "error",
+ "arrow-spacing": "error",
+ "block-scoped-var": "error",
+ "block-spacing": "error",
+ "brace-style": [
+ "error",
+ "1tbs"
+ ],
+ "callback-return": "off",
+ "camelcase": "off",
+ "capitalized-comments": "off",
+ "class-methods-use-this": "error",
+ "comma-dangle": "error",
+ "comma-spacing": [
+ "error",
+ {
+ "after": true,
+ "before": false
+ }
+ ],
+ "comma-style": "error",
+ "complexity": "error",
+ "computed-property-spacing": [
+ "error",
+ "never"
+ ],
+ "consistent-return": "off",
+ "consistent-this": "error",
+ "curly": "off",
+ "default-case": "error",
+ "dot-location": "error",
+ "dot-notation": "off",
+ "eol-last": "error",
+ "eqeqeq": "off",
+ "func-call-spacing": "error",
+ "func-name-matching": "error",
+ "func-names": "off",
+ "func-style": [
+ "error",
+ "declaration"
+ ],
+ "function-paren-newline": "error",
+ "generator-star-spacing": "error",
+ "global-require": "error",
+ "guard-for-in": "error",
+ "handle-callback-err": "error",
+ "id-blacklist": "error",
+ "id-length": "off",
+ "id-match": "error",
+ "implicit-arrow-linebreak": "error",
+ "indent": "off",
+ "indent-legacy": "off",
+ "init-declarations": "off",
+ "jsx-quotes": "error",
+ "key-spacing": "off",
+ "keyword-spacing": [
+ "error",
+ {
+ "after": true,
+ "before": true
+ }
+ ],
+ "line-comment-position": "off",
+ "linebreak-style": [
+ "error",
+ "unix"
+ ],
+ "lines-around-comment": "error",
+ "lines-around-directive": "error",
+ "lines-between-class-members": "error",
+ "max-classes-per-file": "error",
+ "max-depth": "error",
+ "max-len": "off",
+ "max-lines": "off",
+ "max-lines-per-function": "off",
+ "max-nested-callbacks": "error",
+ "max-params": "error",
+ "max-statements": "off",
+ "max-statements-per-line": "error",
+ "multiline-comment-style": [
+ "error",
+ "separate-lines"
+ ],
+ "multiline-ternary": "error",
+ "new-cap": "error",
+ "new-parens": "error",
+ "newline-after-var": "off",
+ "newline-before-return": "off",
+ "newline-per-chained-call": "error",
+ "no-alert": "error",
+ "no-array-constructor": "error",
+ "no-async-promise-executor": "error",
+ "no-await-in-loop": "error",
+ "no-bitwise": "off",
+ "no-buffer-constructor": "error",
+ "no-caller": "error",
+ "no-catch-shadow": "error",
+ "no-confusing-arrow": "error",
+ "no-continue": "error",
+ "no-div-regex": "error",
+ "no-duplicate-imports": "error",
+ "no-else-return": "error",
+ "no-empty-function": "error",
+ "no-eq-null": "error",
+ "no-eval": "error",
+ "no-extend-native": "error",
+ "no-extra-bind": "error",
+ "no-extra-label": "error",
+ "no-extra-parens": "off",
+ "no-floating-decimal": "error",
+ "no-implicit-coercion": "error",
+ "no-implicit-globals": "error",
+ "no-implied-eval": "error",
+ "no-inline-comments": "off",
+ "no-invalid-this": "error",
+ "no-iterator": "error",
+ "no-label-var": "error",
+ "no-labels": "error",
+ "no-lone-blocks": "error",
+ "no-lonely-if": "error",
+ "no-loop-func": "error",
+ "no-magic-numbers": "off",
+ "no-misleading-character-class": "error",
+ "no-mixed-operators": "off",
+ "no-mixed-requires": "error",
+ "no-multi-assign": "off",
+ "no-multi-spaces": [
+ "error",
+ {
+ "ignoreEOLComments": true
+ }
+ ],
+ "no-multi-str": "error",
+ "no-multiple-empty-lines": "error",
+ "no-native-reassign": "error",
+ "no-negated-condition": "error",
+ "no-negated-in-lhs": "error",
+ "no-nested-ternary": "error",
+ "no-new": "error",
+ "no-new-func": "error",
+ "no-new-object": "error",
+ "no-new-require": "error",
+ "no-new-wrappers": "error",
+ "no-octal-escape": "error",
+ "no-param-reassign": "off",
+ "no-path-concat": "error",
+ "no-plusplus": [
+ "error",
+ {
+ "allowForLoopAfterthoughts": true
+ }
+ ],
+ "no-process-env": "error",
+ "no-process-exit": "error",
+ "no-proto": "error",
+ "no-prototype-builtins": "error",
+ "no-restricted-globals": "error",
+ "no-restricted-imports": "error",
+ "no-restricted-modules": "error",
+ "no-restricted-properties": "error",
+ "no-restricted-syntax": "error",
+ "no-return-assign": "error",
+ "no-return-await": "error",
+ "no-script-url": "error",
+ "no-self-compare": "error",
+ "no-sequences": "error",
+ "no-shadow": "off",
+ "no-shadow-restricted-names": "error",
+ "no-spaced-func": "error",
+ "no-sync": "error",
+ "no-tabs": "error",
+ "no-template-curly-in-string": "error",
+ "no-ternary": "error",
+ "no-throw-literal": "error",
+ "no-trailing-spaces": "error",
+ "no-undef-init": "error",
+ "no-undefined": "error",
+ "no-underscore-dangle": "error",
+ "no-unmodified-loop-condition": "error",
+ "no-unneeded-ternary": "error",
+ "no-unused-expressions": "error",
+ "no-use-before-define": "off",
+ "no-useless-call": "error",
+ "no-useless-catch": "error",
+ "no-useless-computed-key": "error",
+ "no-useless-concat": "error",
+ "no-useless-constructor": "error",
+ "no-useless-rename": "error",
+ "no-useless-return": "error",
+ "no-var": "error",
+ "no-void": "error",
+ "no-warning-comments": "error",
+ "no-whitespace-before-property": "error",
+ "no-with": "error",
+ "nonblock-statement-body-position": "error",
+ "object-curly-newline": "error",
+ "object-curly-spacing": [
+ "error",
+ "never"
+ ],
+ "object-property-newline": "error",
+ "object-shorthand": "error",
+ "one-var": "off",
+ "one-var-declaration-per-line": "error",
+ "operator-assignment": [
+ "error",
+ "always"
+ ],
+ "operator-linebreak": "error",
+ "padded-blocks": "off",
+ "padding-line-between-statements": "error",
+ "prefer-arrow-callback": "off",
+ "prefer-const": "error",
+ "prefer-destructuring": "error",
+ "prefer-named-capture-group": "error",
+ "prefer-numeric-literals": "error",
+ "prefer-object-spread": "error",
+ "prefer-promise-reject-errors": "error",
+ "prefer-reflect": "error",
+ "prefer-rest-params": "error",
+ "prefer-spread": "error",
+ "prefer-template": "off",
+ "quote-props": "off",
+ "quotes": "off",
+ "radix": "error",
+ "require-atomic-updates": "error",
+ "require-await": "error",
+ "require-jsdoc": "off",
+ "require-unicode-regexp": "error",
+ "rest-spread-spacing": "error",
+ "semi": "error",
+ "semi-spacing": [
+ "error",
+ {
+ "after": true,
+ "before": false
+ }
+ ],
+ "semi-style": [
+ "error",
+ "last"
+ ],
+ "sort-imports": "error",
+ "sort-keys": "error",
+ "sort-vars": "error",
+ "space-before-blocks": "error",
+ "space-before-function-paren": "off",
+ "space-in-parens": [
+ "error",
+ "never"
+ ],
+ "space-infix-ops": "off",
+ "space-unary-ops": "error",
+ "spaced-comment": "off",
+ "strict": "error",
+ "switch-colon-spacing": "error",
+ "symbol-description": "error",
+ "template-curly-spacing": "error",
+ "template-tag-spacing": "error",
+ "unicode-bom": [
+ "error",
+ "never"
+ ],
+ "valid-jsdoc": "error",
+ "vars-on-top": "error",
+ "wrap-iife": "error",
+ "wrap-regex": "error",
+ "yield-star-spacing": "error",
+ "yoda": [
+ "error",
+ "never"
+ ]
+ }
+};
diff --git a/temporary_modules/trezor-connect/node_modules/bplist-parser/README.md b/temporary_modules/trezor-connect/node_modules/bplist-parser/README.md
new file mode 100644
index 00000000..eb540642
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/bplist-parser/README.md
@@ -0,0 +1,48 @@
+# bplist-parser
+
+Binary Mac OS X Plist (property list) parser.
+
+## Installation
+
+```bash
+$ npm install bplist-parser
+```
+
+## Quick Examples
+
+```javascript
+const bplist = require('bplist-parser');
+
+(async () => {
+
+ const obj = await bplist.parseFile('myPlist.bplist');
+
+ console.log(JSON.stringify(obj));
+
+})();
+```
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2012 Near Infinity Corporation
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/bplist-parser/bplistParser.d.ts b/temporary_modules/trezor-connect/node_modules/bplist-parser/bplistParser.d.ts
new file mode 100644
index 00000000..dd38a7e0
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/bplist-parser/bplistParser.d.ts
@@ -0,0 +1,6 @@
+declare namespace bPlistParser {
+ type CallbackFunction = (error: Error|null, result: [T]) => void
+ export function parseFile(fileNameOrBuffer: string|Buffer, callback?: CallbackFunction): Promise<[T]>
+}
+
+export = bPlistParser
diff --git a/temporary_modules/trezor-connect/node_modules/bplist-parser/bplistParser.js b/temporary_modules/trezor-connect/node_modules/bplist-parser/bplistParser.js
new file mode 100644
index 00000000..3956a290
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/bplist-parser/bplistParser.js
@@ -0,0 +1,366 @@
+/* eslint-disable no-console */
+
+'use strict';
+
+// adapted from https://github.com/3breadt/dd-plist
+
+const fs = require('fs');
+const bigInt = require('big-integer');
+const debug = false;
+
+exports.maxObjectSize = 100 * 1000 * 1000; // 100Meg
+exports.maxObjectCount = 32768;
+
+// EPOCH = new SimpleDateFormat("yyyy MM dd zzz").parse("2001 01 01 GMT").getTime();
+// ...but that's annoying in a static initializer because it can throw exceptions, ick.
+// So we just hardcode the correct value.
+const EPOCH = 978307200000;
+
+// UID object definition
+const UID = exports.UID = function(id) {
+ this.UID = id;
+};
+
+exports.parseFile = function (fileNameOrBuffer, callback) {
+ return new Promise(function (resolve, reject) {
+ function tryParseBuffer(buffer) {
+ let err = null;
+ let result;
+ try {
+ result = parseBuffer(buffer);
+ resolve(result);
+ } catch (ex) {
+ err = ex;
+ reject(err);
+ } finally {
+ if (callback) callback(err, result);
+ }
+ }
+
+ if (Buffer.isBuffer(fileNameOrBuffer)) {
+ return tryParseBuffer(fileNameOrBuffer);
+ }
+ fs.readFile(fileNameOrBuffer, function (err, data) {
+ if (err) {
+ reject(err);
+ return callback(err);
+ }
+ tryParseBuffer(data);
+ });
+ });
+};
+
+const parseBuffer = exports.parseBuffer = function (buffer) {
+ // check header
+ const header = buffer.slice(0, 'bplist'.length).toString('utf8');
+ if (header !== 'bplist') {
+ throw new Error("Invalid binary plist. Expected 'bplist' at offset 0.");
+ }
+
+ // Handle trailer, last 32 bytes of the file
+ const trailer = buffer.slice(buffer.length - 32, buffer.length);
+ // 6 null bytes (index 0 to 5)
+ const offsetSize = trailer.readUInt8(6);
+ if (debug) {
+ console.log("offsetSize: " + offsetSize);
+ }
+ const objectRefSize = trailer.readUInt8(7);
+ if (debug) {
+ console.log("objectRefSize: " + objectRefSize);
+ }
+ const numObjects = readUInt64BE(trailer, 8);
+ if (debug) {
+ console.log("numObjects: " + numObjects);
+ }
+ const topObject = readUInt64BE(trailer, 16);
+ if (debug) {
+ console.log("topObject: " + topObject);
+ }
+ const offsetTableOffset = readUInt64BE(trailer, 24);
+ if (debug) {
+ console.log("offsetTableOffset: " + offsetTableOffset);
+ }
+
+ if (numObjects > exports.maxObjectCount) {
+ throw new Error("maxObjectCount exceeded");
+ }
+
+ // Handle offset table
+ const offsetTable = [];
+
+ for (let i = 0; i < numObjects; i++) {
+ const offsetBytes = buffer.slice(offsetTableOffset + i * offsetSize, offsetTableOffset + (i + 1) * offsetSize);
+ offsetTable[i] = readUInt(offsetBytes, 0);
+ if (debug) {
+ console.log("Offset for Object #" + i + " is " + offsetTable[i] + " [" + offsetTable[i].toString(16) + "]");
+ }
+ }
+
+ // Parses an object inside the currently parsed binary property list.
+ // For the format specification check
+ //
+ // Apple's binary property list parser implementation.
+ function parseObject(tableOffset) {
+ const offset = offsetTable[tableOffset];
+ const type = buffer[offset];
+ const objType = (type & 0xF0) >> 4; //First 4 bits
+ const objInfo = (type & 0x0F); //Second 4 bits
+ switch (objType) {
+ case 0x0:
+ return parseSimple();
+ case 0x1:
+ return parseInteger();
+ case 0x8:
+ return parseUID();
+ case 0x2:
+ return parseReal();
+ case 0x3:
+ return parseDate();
+ case 0x4:
+ return parseData();
+ case 0x5: // ASCII
+ return parsePlistString();
+ case 0x6: // UTF-16
+ return parsePlistString(true);
+ case 0xA:
+ return parseArray();
+ case 0xD:
+ return parseDictionary();
+ default:
+ throw new Error("Unhandled type 0x" + objType.toString(16));
+ }
+
+ function parseSimple() {
+ //Simple
+ switch (objInfo) {
+ case 0x0: // null
+ return null;
+ case 0x8: // false
+ return false;
+ case 0x9: // true
+ return true;
+ case 0xF: // filler byte
+ return null;
+ default:
+ throw new Error("Unhandled simple type 0x" + objType.toString(16));
+ }
+ }
+
+ function bufferToHexString(buffer) {
+ let str = '';
+ let i;
+ for (i = 0; i < buffer.length; i++) {
+ if (buffer[i] != 0x00) {
+ break;
+ }
+ }
+ for (; i < buffer.length; i++) {
+ const part = '00' + buffer[i].toString(16);
+ str += part.substr(part.length - 2);
+ }
+ return str;
+ }
+
+ function parseInteger() {
+ const length = Math.pow(2, objInfo);
+ if (length < exports.maxObjectSize) {
+ const data = buffer.slice(offset + 1, offset + 1 + length);
+ if (length === 16) {
+ const str = bufferToHexString(data);
+ return bigInt(str, 16);
+ }
+ return data.reduce((acc, curr) => {
+ acc <<= 8;
+ acc |= curr & 255;
+ return acc;
+ });
+ } else {
+ throw new Error("Too little heap space available! Wanted to read " + length + " bytes, but only " + exports.maxObjectSize + " are available.");
+ }
+ }
+
+ function parseUID() {
+ const length = objInfo + 1;
+ if (length < exports.maxObjectSize) {
+ return new UID(readUInt(buffer.slice(offset + 1, offset + 1 + length)));
+ }
+ throw new Error("Too little heap space available! Wanted to read " + length + " bytes, but only " + exports.maxObjectSize + " are available.");
+ }
+
+ function parseReal() {
+ const length = Math.pow(2, objInfo);
+ if (length < exports.maxObjectSize) {
+ const realBuffer = buffer.slice(offset + 1, offset + 1 + length);
+ if (length === 4) {
+ return realBuffer.readFloatBE(0);
+ }
+ if (length === 8) {
+ return realBuffer.readDoubleBE(0);
+ }
+ } else {
+ throw new Error("Too little heap space available! Wanted to read " + length + " bytes, but only " + exports.maxObjectSize + " are available.");
+ }
+ }
+
+ function parseDate() {
+ if (objInfo != 0x3) {
+ console.error("Unknown date type :" + objInfo + ". Parsing anyway...");
+ }
+ const dateBuffer = buffer.slice(offset + 1, offset + 9);
+ return new Date(EPOCH + (1000 * dateBuffer.readDoubleBE(0)));
+ }
+
+ function parseData() {
+ let dataoffset = 1;
+ let length = objInfo;
+ if (objInfo == 0xF) {
+ const int_type = buffer[offset + 1];
+ const intType = (int_type & 0xF0) / 0x10;
+ if (intType != 0x1) {
+ console.error("0x4: UNEXPECTED LENGTH-INT TYPE! " + intType);
+ }
+ const intInfo = int_type & 0x0F;
+ const intLength = Math.pow(2, intInfo);
+ dataoffset = 2 + intLength;
+ if (intLength < 3) {
+ length = readUInt(buffer.slice(offset + 2, offset + 2 + intLength));
+ } else {
+ length = readUInt(buffer.slice(offset + 2, offset + 2 + intLength));
+ }
+ }
+ if (length < exports.maxObjectSize) {
+ return buffer.slice(offset + dataoffset, offset + dataoffset + length);
+ }
+ throw new Error("Too little heap space available! Wanted to read " + length + " bytes, but only " + exports.maxObjectSize + " are available.");
+ }
+
+ function parsePlistString (isUtf16) {
+ isUtf16 = isUtf16 || 0;
+ let enc = "utf8";
+ let length = objInfo;
+ let stroffset = 1;
+ if (objInfo == 0xF) {
+ const int_type = buffer[offset + 1];
+ const intType = (int_type & 0xF0) / 0x10;
+ if (intType != 0x1) {
+ console.error("UNEXPECTED LENGTH-INT TYPE! " + intType);
+ }
+ const intInfo = int_type & 0x0F;
+ const intLength = Math.pow(2, intInfo);
+ stroffset = 2 + intLength;
+ if (intLength < 3) {
+ length = readUInt(buffer.slice(offset + 2, offset + 2 + intLength));
+ } else {
+ length = readUInt(buffer.slice(offset + 2, offset + 2 + intLength));
+ }
+ }
+ // length is String length -> to get byte length multiply by 2, as 1 character takes 2 bytes in UTF-16
+ length *= (isUtf16 + 1);
+ if (length < exports.maxObjectSize) {
+ let plistString = Buffer.from(buffer.slice(offset + stroffset, offset + stroffset + length));
+ if (isUtf16) {
+ plistString = swapBytes(plistString);
+ enc = "ucs2";
+ }
+ return plistString.toString(enc);
+ }
+ throw new Error("Too little heap space available! Wanted to read " + length + " bytes, but only " + exports.maxObjectSize + " are available.");
+ }
+
+ function parseArray() {
+ let length = objInfo;
+ let arrayoffset = 1;
+ if (objInfo == 0xF) {
+ const int_type = buffer[offset + 1];
+ const intType = (int_type & 0xF0) / 0x10;
+ if (intType != 0x1) {
+ console.error("0xa: UNEXPECTED LENGTH-INT TYPE! " + intType);
+ }
+ const intInfo = int_type & 0x0F;
+ const intLength = Math.pow(2, intInfo);
+ arrayoffset = 2 + intLength;
+ if (intLength < 3) {
+ length = readUInt(buffer.slice(offset + 2, offset + 2 + intLength));
+ } else {
+ length = readUInt(buffer.slice(offset + 2, offset + 2 + intLength));
+ }
+ }
+ if (length * objectRefSize > exports.maxObjectSize) {
+ throw new Error("Too little heap space available!");
+ }
+ const array = [];
+ for (let i = 0; i < length; i++) {
+ const objRef = readUInt(buffer.slice(offset + arrayoffset + i * objectRefSize, offset + arrayoffset + (i + 1) * objectRefSize));
+ array[i] = parseObject(objRef);
+ }
+ return array;
+ }
+
+ function parseDictionary() {
+ let length = objInfo;
+ let dictoffset = 1;
+ if (objInfo == 0xF) {
+ const int_type = buffer[offset + 1];
+ const intType = (int_type & 0xF0) / 0x10;
+ if (intType != 0x1) {
+ console.error("0xD: UNEXPECTED LENGTH-INT TYPE! " + intType);
+ }
+ const intInfo = int_type & 0x0F;
+ const intLength = Math.pow(2, intInfo);
+ dictoffset = 2 + intLength;
+ if (intLength < 3) {
+ length = readUInt(buffer.slice(offset + 2, offset + 2 + intLength));
+ } else {
+ length = readUInt(buffer.slice(offset + 2, offset + 2 + intLength));
+ }
+ }
+ if (length * 2 * objectRefSize > exports.maxObjectSize) {
+ throw new Error("Too little heap space available!");
+ }
+ if (debug) {
+ console.log("Parsing dictionary #" + tableOffset);
+ }
+ const dict = {};
+ for (let i = 0; i < length; i++) {
+ const keyRef = readUInt(buffer.slice(offset + dictoffset + i * objectRefSize, offset + dictoffset + (i + 1) * objectRefSize));
+ const valRef = readUInt(buffer.slice(offset + dictoffset + (length * objectRefSize) + i * objectRefSize, offset + dictoffset + (length * objectRefSize) + (i + 1) * objectRefSize));
+ const key = parseObject(keyRef);
+ const val = parseObject(valRef);
+ if (debug) {
+ console.log(" DICT #" + tableOffset + ": Mapped " + key + " to " + val);
+ }
+ dict[key] = val;
+ }
+ return dict;
+ }
+ }
+
+ return [ parseObject(topObject) ];
+};
+
+function readUInt(buffer, start) {
+ start = start || 0;
+
+ let l = 0;
+ for (let i = start; i < buffer.length; i++) {
+ l <<= 8;
+ l |= buffer[i] & 0xFF;
+ }
+ return l;
+}
+
+// we're just going to toss the high order bits because javascript doesn't have 64-bit ints
+function readUInt64BE(buffer, start) {
+ const data = buffer.slice(start, start + 8);
+ return data.readUInt32BE(4, 8);
+}
+
+function swapBytes(buffer) {
+ const len = buffer.length;
+ for (let i = 0; i < len; i += 2) {
+ const a = buffer[i];
+ buffer[i] = buffer[i+1];
+ buffer[i+1] = a;
+ }
+ return buffer;
+}
diff --git a/temporary_modules/trezor-connect/node_modules/bplist-parser/package.json b/temporary_modules/trezor-connect/node_modules/bplist-parser/package.json
new file mode 100644
index 00000000..fd6bdd05
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/bplist-parser/package.json
@@ -0,0 +1,35 @@
+{
+ "name": "bplist-parser",
+ "version": "0.3.1",
+ "description": "Binary plist parser.",
+ "main": "bplistParser.js",
+ "scripts": {
+ "test": "mocha test"
+ },
+ "keywords": [
+ "bplist",
+ "plist",
+ "parser"
+ ],
+ "author": "Joe Ferner ",
+ "contributors": [
+ "Brett Zamir"
+ ],
+ "license": "MIT",
+ "devDependencies": {
+ "eslint": "6.5.x",
+ "mocha": "6.2.x"
+ },
+ "homepage": "https://github.com/nearinfinity/node-bplist-parser",
+ "bugs": "https://github.com/nearinfinity/node-bplist-parser/issues",
+ "engines": {
+ "node": ">= 5.10.0"
+ },
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/nearinfinity/node-bplist-parser.git"
+ },
+ "dependencies": {
+ "big-integer": "1.6.x"
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/buffer-crc32/LICENSE b/temporary_modules/trezor-connect/node_modules/buffer-crc32/LICENSE
new file mode 100644
index 00000000..4cef10eb
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/buffer-crc32/LICENSE
@@ -0,0 +1,19 @@
+The MIT License
+
+Copyright (c) 2013 Brian J. Brennan
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to use,
+copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the
+Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
+INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR
+PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE
+FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/buffer-crc32/README.md b/temporary_modules/trezor-connect/node_modules/buffer-crc32/README.md
new file mode 100644
index 00000000..0d9d8b83
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/buffer-crc32/README.md
@@ -0,0 +1,47 @@
+# buffer-crc32
+
+[](http://travis-ci.org/brianloveswords/buffer-crc32)
+
+crc32 that works with binary data and fancy character sets, outputs
+buffer, signed or unsigned data and has tests.
+
+Derived from the sample CRC implementation in the PNG specification: http://www.w3.org/TR/PNG/#D-CRCAppendix
+
+# install
+```
+npm install buffer-crc32
+```
+
+# example
+```js
+var crc32 = require('buffer-crc32');
+// works with buffers
+var buf = Buffer([0x00, 0x73, 0x75, 0x70, 0x20, 0x62, 0x72, 0x6f, 0x00])
+crc32(buf) // ->
+
+// has convenience methods for getting signed or unsigned ints
+crc32.signed(buf) // -> -1805997238
+crc32.unsigned(buf) // -> 2488970058
+
+// will cast to buffer if given a string, so you can
+// directly use foreign characters safely
+crc32('自動販売機') // ->
+
+// and works in append mode too
+var partialCrc = crc32('hey');
+var partialCrc = crc32(' ', partialCrc);
+var partialCrc = crc32('sup', partialCrc);
+var partialCrc = crc32(' ', partialCrc);
+var finalCrc = crc32('bros', partialCrc); // ->
+```
+
+# tests
+This was tested against the output of zlib's crc32 method. You can run
+the tests with`npm test` (requires tap)
+
+# see also
+https://github.com/alexgorbatchev/node-crc, `crc.buffer.crc32` also
+supports buffer inputs and return unsigned ints (thanks @tjholowaychuk).
+
+# license
+MIT/X11
diff --git a/temporary_modules/trezor-connect/node_modules/buffer-crc32/index.js b/temporary_modules/trezor-connect/node_modules/buffer-crc32/index.js
new file mode 100644
index 00000000..6727dd39
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/buffer-crc32/index.js
@@ -0,0 +1,111 @@
+var Buffer = require('buffer').Buffer;
+
+var CRC_TABLE = [
+ 0x00000000, 0x77073096, 0xee0e612c, 0x990951ba, 0x076dc419,
+ 0x706af48f, 0xe963a535, 0x9e6495a3, 0x0edb8832, 0x79dcb8a4,
+ 0xe0d5e91e, 0x97d2d988, 0x09b64c2b, 0x7eb17cbd, 0xe7b82d07,
+ 0x90bf1d91, 0x1db71064, 0x6ab020f2, 0xf3b97148, 0x84be41de,
+ 0x1adad47d, 0x6ddde4eb, 0xf4d4b551, 0x83d385c7, 0x136c9856,
+ 0x646ba8c0, 0xfd62f97a, 0x8a65c9ec, 0x14015c4f, 0x63066cd9,
+ 0xfa0f3d63, 0x8d080df5, 0x3b6e20c8, 0x4c69105e, 0xd56041e4,
+ 0xa2677172, 0x3c03e4d1, 0x4b04d447, 0xd20d85fd, 0xa50ab56b,
+ 0x35b5a8fa, 0x42b2986c, 0xdbbbc9d6, 0xacbcf940, 0x32d86ce3,
+ 0x45df5c75, 0xdcd60dcf, 0xabd13d59, 0x26d930ac, 0x51de003a,
+ 0xc8d75180, 0xbfd06116, 0x21b4f4b5, 0x56b3c423, 0xcfba9599,
+ 0xb8bda50f, 0x2802b89e, 0x5f058808, 0xc60cd9b2, 0xb10be924,
+ 0x2f6f7c87, 0x58684c11, 0xc1611dab, 0xb6662d3d, 0x76dc4190,
+ 0x01db7106, 0x98d220bc, 0xefd5102a, 0x71b18589, 0x06b6b51f,
+ 0x9fbfe4a5, 0xe8b8d433, 0x7807c9a2, 0x0f00f934, 0x9609a88e,
+ 0xe10e9818, 0x7f6a0dbb, 0x086d3d2d, 0x91646c97, 0xe6635c01,
+ 0x6b6b51f4, 0x1c6c6162, 0x856530d8, 0xf262004e, 0x6c0695ed,
+ 0x1b01a57b, 0x8208f4c1, 0xf50fc457, 0x65b0d9c6, 0x12b7e950,
+ 0x8bbeb8ea, 0xfcb9887c, 0x62dd1ddf, 0x15da2d49, 0x8cd37cf3,
+ 0xfbd44c65, 0x4db26158, 0x3ab551ce, 0xa3bc0074, 0xd4bb30e2,
+ 0x4adfa541, 0x3dd895d7, 0xa4d1c46d, 0xd3d6f4fb, 0x4369e96a,
+ 0x346ed9fc, 0xad678846, 0xda60b8d0, 0x44042d73, 0x33031de5,
+ 0xaa0a4c5f, 0xdd0d7cc9, 0x5005713c, 0x270241aa, 0xbe0b1010,
+ 0xc90c2086, 0x5768b525, 0x206f85b3, 0xb966d409, 0xce61e49f,
+ 0x5edef90e, 0x29d9c998, 0xb0d09822, 0xc7d7a8b4, 0x59b33d17,
+ 0x2eb40d81, 0xb7bd5c3b, 0xc0ba6cad, 0xedb88320, 0x9abfb3b6,
+ 0x03b6e20c, 0x74b1d29a, 0xead54739, 0x9dd277af, 0x04db2615,
+ 0x73dc1683, 0xe3630b12, 0x94643b84, 0x0d6d6a3e, 0x7a6a5aa8,
+ 0xe40ecf0b, 0x9309ff9d, 0x0a00ae27, 0x7d079eb1, 0xf00f9344,
+ 0x8708a3d2, 0x1e01f268, 0x6906c2fe, 0xf762575d, 0x806567cb,
+ 0x196c3671, 0x6e6b06e7, 0xfed41b76, 0x89d32be0, 0x10da7a5a,
+ 0x67dd4acc, 0xf9b9df6f, 0x8ebeeff9, 0x17b7be43, 0x60b08ed5,
+ 0xd6d6a3e8, 0xa1d1937e, 0x38d8c2c4, 0x4fdff252, 0xd1bb67f1,
+ 0xa6bc5767, 0x3fb506dd, 0x48b2364b, 0xd80d2bda, 0xaf0a1b4c,
+ 0x36034af6, 0x41047a60, 0xdf60efc3, 0xa867df55, 0x316e8eef,
+ 0x4669be79, 0xcb61b38c, 0xbc66831a, 0x256fd2a0, 0x5268e236,
+ 0xcc0c7795, 0xbb0b4703, 0x220216b9, 0x5505262f, 0xc5ba3bbe,
+ 0xb2bd0b28, 0x2bb45a92, 0x5cb36a04, 0xc2d7ffa7, 0xb5d0cf31,
+ 0x2cd99e8b, 0x5bdeae1d, 0x9b64c2b0, 0xec63f226, 0x756aa39c,
+ 0x026d930a, 0x9c0906a9, 0xeb0e363f, 0x72076785, 0x05005713,
+ 0x95bf4a82, 0xe2b87a14, 0x7bb12bae, 0x0cb61b38, 0x92d28e9b,
+ 0xe5d5be0d, 0x7cdcefb7, 0x0bdbdf21, 0x86d3d2d4, 0xf1d4e242,
+ 0x68ddb3f8, 0x1fda836e, 0x81be16cd, 0xf6b9265b, 0x6fb077e1,
+ 0x18b74777, 0x88085ae6, 0xff0f6a70, 0x66063bca, 0x11010b5c,
+ 0x8f659eff, 0xf862ae69, 0x616bffd3, 0x166ccf45, 0xa00ae278,
+ 0xd70dd2ee, 0x4e048354, 0x3903b3c2, 0xa7672661, 0xd06016f7,
+ 0x4969474d, 0x3e6e77db, 0xaed16a4a, 0xd9d65adc, 0x40df0b66,
+ 0x37d83bf0, 0xa9bcae53, 0xdebb9ec5, 0x47b2cf7f, 0x30b5ffe9,
+ 0xbdbdf21c, 0xcabac28a, 0x53b39330, 0x24b4a3a6, 0xbad03605,
+ 0xcdd70693, 0x54de5729, 0x23d967bf, 0xb3667a2e, 0xc4614ab8,
+ 0x5d681b02, 0x2a6f2b94, 0xb40bbe37, 0xc30c8ea1, 0x5a05df1b,
+ 0x2d02ef8d
+];
+
+if (typeof Int32Array !== 'undefined') {
+ CRC_TABLE = new Int32Array(CRC_TABLE);
+}
+
+function ensureBuffer(input) {
+ if (Buffer.isBuffer(input)) {
+ return input;
+ }
+
+ var hasNewBufferAPI =
+ typeof Buffer.alloc === "function" &&
+ typeof Buffer.from === "function";
+
+ if (typeof input === "number") {
+ return hasNewBufferAPI ? Buffer.alloc(input) : new Buffer(input);
+ }
+ else if (typeof input === "string") {
+ return hasNewBufferAPI ? Buffer.from(input) : new Buffer(input);
+ }
+ else {
+ throw new Error("input must be buffer, number, or string, received " +
+ typeof input);
+ }
+}
+
+function bufferizeInt(num) {
+ var tmp = ensureBuffer(4);
+ tmp.writeInt32BE(num, 0);
+ return tmp;
+}
+
+function _crc32(buf, previous) {
+ buf = ensureBuffer(buf);
+ if (Buffer.isBuffer(previous)) {
+ previous = previous.readUInt32BE(0);
+ }
+ var crc = ~~previous ^ -1;
+ for (var n = 0; n < buf.length; n++) {
+ crc = CRC_TABLE[(crc ^ buf[n]) & 0xff] ^ (crc >>> 8);
+ }
+ return (crc ^ -1);
+}
+
+function crc32() {
+ return bufferizeInt(_crc32.apply(null, arguments));
+}
+crc32.signed = function () {
+ return _crc32.apply(null, arguments);
+};
+crc32.unsigned = function () {
+ return _crc32.apply(null, arguments) >>> 0;
+};
+
+module.exports = crc32;
diff --git a/temporary_modules/trezor-connect/node_modules/buffer-crc32/package.json b/temporary_modules/trezor-connect/node_modules/buffer-crc32/package.json
new file mode 100644
index 00000000..e896bec5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/buffer-crc32/package.json
@@ -0,0 +1,39 @@
+{
+ "author": "Brian J. Brennan ",
+ "name": "buffer-crc32",
+ "description": "A pure javascript CRC32 algorithm that plays nice with binary data",
+ "version": "0.2.13",
+ "licenses": [
+ {
+ "type": "MIT",
+ "url": "https://github.com/brianloveswords/buffer-crc32/raw/master/LICENSE"
+ }
+ ],
+ "contributors": [
+ {
+ "name": "Vladimir Kuznetsov",
+ "github": "mistakster"
+ }
+ ],
+ "homepage": "https://github.com/brianloveswords/buffer-crc32",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/brianloveswords/buffer-crc32.git"
+ },
+ "main": "index.js",
+ "scripts": {
+ "test": "./node_modules/.bin/tap tests/*.test.js"
+ },
+ "dependencies": {},
+ "devDependencies": {
+ "tap": "~0.2.5"
+ },
+ "optionalDependencies": {},
+ "engines": {
+ "node": "*"
+ },
+ "license": "MIT",
+ "files": [
+ "index.js"
+ ]
+}
diff --git a/temporary_modules/trezor-connect/node_modules/chownr/LICENSE b/temporary_modules/trezor-connect/node_modules/chownr/LICENSE
new file mode 100644
index 00000000..19129e31
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/chownr/LICENSE
@@ -0,0 +1,15 @@
+The ISC License
+
+Copyright (c) Isaac Z. Schlueter and Contributors
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted, provided that the above
+copyright notice and this permission notice appear in all copies.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR
+IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/chownr/README.md b/temporary_modules/trezor-connect/node_modules/chownr/README.md
new file mode 100644
index 00000000..70e9a54a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/chownr/README.md
@@ -0,0 +1,3 @@
+Like `chown -R`.
+
+Takes the same arguments as `fs.chown()`
diff --git a/temporary_modules/trezor-connect/node_modules/chownr/chownr.js b/temporary_modules/trezor-connect/node_modules/chownr/chownr.js
new file mode 100644
index 00000000..0d409321
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/chownr/chownr.js
@@ -0,0 +1,167 @@
+'use strict'
+const fs = require('fs')
+const path = require('path')
+
+/* istanbul ignore next */
+const LCHOWN = fs.lchown ? 'lchown' : 'chown'
+/* istanbul ignore next */
+const LCHOWNSYNC = fs.lchownSync ? 'lchownSync' : 'chownSync'
+
+/* istanbul ignore next */
+const needEISDIRHandled = fs.lchown &&
+ !process.version.match(/v1[1-9]+\./) &&
+ !process.version.match(/v10\.[6-9]/)
+
+const lchownSync = (path, uid, gid) => {
+ try {
+ return fs[LCHOWNSYNC](path, uid, gid)
+ } catch (er) {
+ if (er.code !== 'ENOENT')
+ throw er
+ }
+}
+
+/* istanbul ignore next */
+const chownSync = (path, uid, gid) => {
+ try {
+ return fs.chownSync(path, uid, gid)
+ } catch (er) {
+ if (er.code !== 'ENOENT')
+ throw er
+ }
+}
+
+/* istanbul ignore next */
+const handleEISDIR =
+ needEISDIRHandled ? (path, uid, gid, cb) => er => {
+ // Node prior to v10 had a very questionable implementation of
+ // fs.lchown, which would always try to call fs.open on a directory
+ // Fall back to fs.chown in those cases.
+ if (!er || er.code !== 'EISDIR')
+ cb(er)
+ else
+ fs.chown(path, uid, gid, cb)
+ }
+ : (_, __, ___, cb) => cb
+
+/* istanbul ignore next */
+const handleEISDirSync =
+ needEISDIRHandled ? (path, uid, gid) => {
+ try {
+ return lchownSync(path, uid, gid)
+ } catch (er) {
+ if (er.code !== 'EISDIR')
+ throw er
+ chownSync(path, uid, gid)
+ }
+ }
+ : (path, uid, gid) => lchownSync(path, uid, gid)
+
+// fs.readdir could only accept an options object as of node v6
+const nodeVersion = process.version
+let readdir = (path, options, cb) => fs.readdir(path, options, cb)
+let readdirSync = (path, options) => fs.readdirSync(path, options)
+/* istanbul ignore next */
+if (/^v4\./.test(nodeVersion))
+ readdir = (path, options, cb) => fs.readdir(path, cb)
+
+const chown = (cpath, uid, gid, cb) => {
+ fs[LCHOWN](cpath, uid, gid, handleEISDIR(cpath, uid, gid, er => {
+ // Skip ENOENT error
+ cb(er && er.code !== 'ENOENT' ? er : null)
+ }))
+}
+
+const chownrKid = (p, child, uid, gid, cb) => {
+ if (typeof child === 'string')
+ return fs.lstat(path.resolve(p, child), (er, stats) => {
+ // Skip ENOENT error
+ if (er)
+ return cb(er.code !== 'ENOENT' ? er : null)
+ stats.name = child
+ chownrKid(p, stats, uid, gid, cb)
+ })
+
+ if (child.isDirectory()) {
+ chownr(path.resolve(p, child.name), uid, gid, er => {
+ if (er)
+ return cb(er)
+ const cpath = path.resolve(p, child.name)
+ chown(cpath, uid, gid, cb)
+ })
+ } else {
+ const cpath = path.resolve(p, child.name)
+ chown(cpath, uid, gid, cb)
+ }
+}
+
+
+const chownr = (p, uid, gid, cb) => {
+ readdir(p, { withFileTypes: true }, (er, children) => {
+ // any error other than ENOTDIR or ENOTSUP means it's not readable,
+ // or doesn't exist. give up.
+ if (er) {
+ if (er.code === 'ENOENT')
+ return cb()
+ else if (er.code !== 'ENOTDIR' && er.code !== 'ENOTSUP')
+ return cb(er)
+ }
+ if (er || !children.length)
+ return chown(p, uid, gid, cb)
+
+ let len = children.length
+ let errState = null
+ const then = er => {
+ if (errState)
+ return
+ if (er)
+ return cb(errState = er)
+ if (-- len === 0)
+ return chown(p, uid, gid, cb)
+ }
+
+ children.forEach(child => chownrKid(p, child, uid, gid, then))
+ })
+}
+
+const chownrKidSync = (p, child, uid, gid) => {
+ if (typeof child === 'string') {
+ try {
+ const stats = fs.lstatSync(path.resolve(p, child))
+ stats.name = child
+ child = stats
+ } catch (er) {
+ if (er.code === 'ENOENT')
+ return
+ else
+ throw er
+ }
+ }
+
+ if (child.isDirectory())
+ chownrSync(path.resolve(p, child.name), uid, gid)
+
+ handleEISDirSync(path.resolve(p, child.name), uid, gid)
+}
+
+const chownrSync = (p, uid, gid) => {
+ let children
+ try {
+ children = readdirSync(p, { withFileTypes: true })
+ } catch (er) {
+ if (er.code === 'ENOENT')
+ return
+ else if (er.code === 'ENOTDIR' || er.code === 'ENOTSUP')
+ return handleEISDirSync(p, uid, gid)
+ else
+ throw er
+ }
+
+ if (children && children.length)
+ children.forEach(child => chownrKidSync(p, child, uid, gid))
+
+ return handleEISDirSync(p, uid, gid)
+}
+
+module.exports = chownr
+chownr.sync = chownrSync
diff --git a/temporary_modules/trezor-connect/node_modules/chownr/package.json b/temporary_modules/trezor-connect/node_modules/chownr/package.json
new file mode 100644
index 00000000..5b0214ca
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/chownr/package.json
@@ -0,0 +1,32 @@
+{
+ "author": "Isaac Z. Schlueter (http://blog.izs.me/)",
+ "name": "chownr",
+ "description": "like `chown -R`",
+ "version": "2.0.0",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/isaacs/chownr.git"
+ },
+ "main": "chownr.js",
+ "files": [
+ "chownr.js"
+ ],
+ "devDependencies": {
+ "mkdirp": "0.3",
+ "rimraf": "^2.7.1",
+ "tap": "^14.10.6"
+ },
+ "tap": {
+ "check-coverage": true
+ },
+ "scripts": {
+ "test": "tap",
+ "preversion": "npm test",
+ "postversion": "npm publish",
+ "prepublishOnly": "git push origin --follow-tags"
+ },
+ "license": "ISC",
+ "engines": {
+ "node": ">=10"
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/color-convert/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/color-convert/CHANGELOG.md
new file mode 100644
index 00000000..0a7bce4f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-convert/CHANGELOG.md
@@ -0,0 +1,54 @@
+# 1.0.0 - 2016-01-07
+
+- Removed: unused speed test
+- Added: Automatic routing between previously unsupported conversions
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Removed: `xxx2xxx()` and `xxx2xxxRaw()` functions
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Removed: `convert()` class
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Changed: all functions to lookup dictionary
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Changed: `ansi` to `ansi256`
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Fixed: argument grouping for functions requiring only one argument
+([#27](https://github.com/Qix-/color-convert/pull/27))
+
+# 0.6.0 - 2015-07-23
+
+- Added: methods to handle
+[ANSI](https://en.wikipedia.org/wiki/ANSI_escape_code#Colors) 16/256 colors:
+ - rgb2ansi16
+ - rgb2ansi
+ - hsl2ansi16
+ - hsl2ansi
+ - hsv2ansi16
+ - hsv2ansi
+ - hwb2ansi16
+ - hwb2ansi
+ - cmyk2ansi16
+ - cmyk2ansi
+ - keyword2ansi16
+ - keyword2ansi
+ - ansi162rgb
+ - ansi162hsl
+ - ansi162hsv
+ - ansi162hwb
+ - ansi162cmyk
+ - ansi162keyword
+ - ansi2rgb
+ - ansi2hsl
+ - ansi2hsv
+ - ansi2hwb
+ - ansi2cmyk
+ - ansi2keyword
+([#18](https://github.com/harthur/color-convert/pull/18))
+
+# 0.5.3 - 2015-06-02
+
+- Fixed: hsl2hsv does not return `NaN` anymore when using `[0,0,0]`
+([#15](https://github.com/harthur/color-convert/issues/15))
+
+---
+
+Check out commit logs for older releases
diff --git a/temporary_modules/trezor-connect/node_modules/color-convert/LICENSE b/temporary_modules/trezor-connect/node_modules/color-convert/LICENSE
new file mode 100644
index 00000000..5b4c386f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-convert/LICENSE
@@ -0,0 +1,21 @@
+Copyright (c) 2011-2016 Heather Arthur
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/temporary_modules/trezor-connect/node_modules/color-convert/README.md b/temporary_modules/trezor-connect/node_modules/color-convert/README.md
new file mode 100644
index 00000000..d4b08fc3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-convert/README.md
@@ -0,0 +1,68 @@
+# color-convert
+
+[](https://travis-ci.org/Qix-/color-convert)
+
+Color-convert is a color conversion library for JavaScript and node.
+It converts all ways between `rgb`, `hsl`, `hsv`, `hwb`, `cmyk`, `ansi`, `ansi16`, `hex` strings, and CSS `keyword`s (will round to closest):
+
+```js
+var convert = require('color-convert');
+
+convert.rgb.hsl(140, 200, 100); // [96, 48, 59]
+convert.keyword.rgb('blue'); // [0, 0, 255]
+
+var rgbChannels = convert.rgb.channels; // 3
+var cmykChannels = convert.cmyk.channels; // 4
+var ansiChannels = convert.ansi16.channels; // 1
+```
+
+# Install
+
+```console
+$ npm install color-convert
+```
+
+# API
+
+Simply get the property of the _from_ and _to_ conversion that you're looking for.
+
+All functions have a rounded and unrounded variant. By default, return values are rounded. To get the unrounded (raw) results, simply tack on `.raw` to the function.
+
+All 'from' functions have a hidden property called `.channels` that indicates the number of channels the function expects (not including alpha).
+
+```js
+var convert = require('color-convert');
+
+// Hex to LAB
+convert.hex.lab('DEADBF'); // [ 76, 21, -2 ]
+convert.hex.lab.raw('DEADBF'); // [ 75.56213190997677, 20.653827952644754, -2.290532499330533 ]
+
+// RGB to CMYK
+convert.rgb.cmyk(167, 255, 4); // [ 35, 0, 98, 0 ]
+convert.rgb.cmyk.raw(167, 255, 4); // [ 34.509803921568626, 0, 98.43137254901961, 0 ]
+```
+
+### Arrays
+All functions that accept multiple arguments also support passing an array.
+
+Note that this does **not** apply to functions that convert from a color that only requires one value (e.g. `keyword`, `ansi256`, `hex`, etc.)
+
+```js
+var convert = require('color-convert');
+
+convert.rgb.hex(123, 45, 67); // '7B2D43'
+convert.rgb.hex([123, 45, 67]); // '7B2D43'
+```
+
+## Routing
+
+Conversions that don't have an _explicitly_ defined conversion (in [conversions.js](conversions.js)), but can be converted by means of sub-conversions (e.g. XYZ -> **RGB** -> CMYK), are automatically routed together. This allows just about any color model supported by `color-convert` to be converted to any other model, so long as a sub-conversion path exists. This is also true for conversions requiring more than one step in between (e.g. LCH -> **LAB** -> **XYZ** -> **RGB** -> Hex).
+
+Keep in mind that extensive conversions _may_ result in a loss of precision, and exist only to be complete. For a list of "direct" (single-step) conversions, see [conversions.js](conversions.js).
+
+# Contribute
+
+If there is a new model you would like to support, or want to add a direct conversion between two existing models, please send us a pull request.
+
+# License
+Copyright © 2011-2016, Heather Arthur and Josh Junon. Licensed under the [MIT License](LICENSE).
diff --git a/temporary_modules/trezor-connect/node_modules/color-convert/conversions.js b/temporary_modules/trezor-connect/node_modules/color-convert/conversions.js
new file mode 100644
index 00000000..2657f265
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-convert/conversions.js
@@ -0,0 +1,839 @@
+/* MIT license */
+/* eslint-disable no-mixed-operators */
+const cssKeywords = require('color-name');
+
+// NOTE: conversions should only return primitive values (i.e. arrays, or
+// values that give correct `typeof` results).
+// do not use box values types (i.e. Number(), String(), etc.)
+
+const reverseKeywords = {};
+for (const key of Object.keys(cssKeywords)) {
+ reverseKeywords[cssKeywords[key]] = key;
+}
+
+const convert = {
+ rgb: {channels: 3, labels: 'rgb'},
+ hsl: {channels: 3, labels: 'hsl'},
+ hsv: {channels: 3, labels: 'hsv'},
+ hwb: {channels: 3, labels: 'hwb'},
+ cmyk: {channels: 4, labels: 'cmyk'},
+ xyz: {channels: 3, labels: 'xyz'},
+ lab: {channels: 3, labels: 'lab'},
+ lch: {channels: 3, labels: 'lch'},
+ hex: {channels: 1, labels: ['hex']},
+ keyword: {channels: 1, labels: ['keyword']},
+ ansi16: {channels: 1, labels: ['ansi16']},
+ ansi256: {channels: 1, labels: ['ansi256']},
+ hcg: {channels: 3, labels: ['h', 'c', 'g']},
+ apple: {channels: 3, labels: ['r16', 'g16', 'b16']},
+ gray: {channels: 1, labels: ['gray']}
+};
+
+module.exports = convert;
+
+// Hide .channels and .labels properties
+for (const model of Object.keys(convert)) {
+ if (!('channels' in convert[model])) {
+ throw new Error('missing channels property: ' + model);
+ }
+
+ if (!('labels' in convert[model])) {
+ throw new Error('missing channel labels property: ' + model);
+ }
+
+ if (convert[model].labels.length !== convert[model].channels) {
+ throw new Error('channel and label counts mismatch: ' + model);
+ }
+
+ const {channels, labels} = convert[model];
+ delete convert[model].channels;
+ delete convert[model].labels;
+ Object.defineProperty(convert[model], 'channels', {value: channels});
+ Object.defineProperty(convert[model], 'labels', {value: labels});
+}
+
+convert.rgb.hsl = function (rgb) {
+ const r = rgb[0] / 255;
+ const g = rgb[1] / 255;
+ const b = rgb[2] / 255;
+ const min = Math.min(r, g, b);
+ const max = Math.max(r, g, b);
+ const delta = max - min;
+ let h;
+ let s;
+
+ if (max === min) {
+ h = 0;
+ } else if (r === max) {
+ h = (g - b) / delta;
+ } else if (g === max) {
+ h = 2 + (b - r) / delta;
+ } else if (b === max) {
+ h = 4 + (r - g) / delta;
+ }
+
+ h = Math.min(h * 60, 360);
+
+ if (h < 0) {
+ h += 360;
+ }
+
+ const l = (min + max) / 2;
+
+ if (max === min) {
+ s = 0;
+ } else if (l <= 0.5) {
+ s = delta / (max + min);
+ } else {
+ s = delta / (2 - max - min);
+ }
+
+ return [h, s * 100, l * 100];
+};
+
+convert.rgb.hsv = function (rgb) {
+ let rdif;
+ let gdif;
+ let bdif;
+ let h;
+ let s;
+
+ const r = rgb[0] / 255;
+ const g = rgb[1] / 255;
+ const b = rgb[2] / 255;
+ const v = Math.max(r, g, b);
+ const diff = v - Math.min(r, g, b);
+ const diffc = function (c) {
+ return (v - c) / 6 / diff + 1 / 2;
+ };
+
+ if (diff === 0) {
+ h = 0;
+ s = 0;
+ } else {
+ s = diff / v;
+ rdif = diffc(r);
+ gdif = diffc(g);
+ bdif = diffc(b);
+
+ if (r === v) {
+ h = bdif - gdif;
+ } else if (g === v) {
+ h = (1 / 3) + rdif - bdif;
+ } else if (b === v) {
+ h = (2 / 3) + gdif - rdif;
+ }
+
+ if (h < 0) {
+ h += 1;
+ } else if (h > 1) {
+ h -= 1;
+ }
+ }
+
+ return [
+ h * 360,
+ s * 100,
+ v * 100
+ ];
+};
+
+convert.rgb.hwb = function (rgb) {
+ const r = rgb[0];
+ const g = rgb[1];
+ let b = rgb[2];
+ const h = convert.rgb.hsl(rgb)[0];
+ const w = 1 / 255 * Math.min(r, Math.min(g, b));
+
+ b = 1 - 1 / 255 * Math.max(r, Math.max(g, b));
+
+ return [h, w * 100, b * 100];
+};
+
+convert.rgb.cmyk = function (rgb) {
+ const r = rgb[0] / 255;
+ const g = rgb[1] / 255;
+ const b = rgb[2] / 255;
+
+ const k = Math.min(1 - r, 1 - g, 1 - b);
+ const c = (1 - r - k) / (1 - k) || 0;
+ const m = (1 - g - k) / (1 - k) || 0;
+ const y = (1 - b - k) / (1 - k) || 0;
+
+ return [c * 100, m * 100, y * 100, k * 100];
+};
+
+function comparativeDistance(x, y) {
+ /*
+ See https://en.m.wikipedia.org/wiki/Euclidean_distance#Squared_Euclidean_distance
+ */
+ return (
+ ((x[0] - y[0]) ** 2) +
+ ((x[1] - y[1]) ** 2) +
+ ((x[2] - y[2]) ** 2)
+ );
+}
+
+convert.rgb.keyword = function (rgb) {
+ const reversed = reverseKeywords[rgb];
+ if (reversed) {
+ return reversed;
+ }
+
+ let currentClosestDistance = Infinity;
+ let currentClosestKeyword;
+
+ for (const keyword of Object.keys(cssKeywords)) {
+ const value = cssKeywords[keyword];
+
+ // Compute comparative distance
+ const distance = comparativeDistance(rgb, value);
+
+ // Check if its less, if so set as closest
+ if (distance < currentClosestDistance) {
+ currentClosestDistance = distance;
+ currentClosestKeyword = keyword;
+ }
+ }
+
+ return currentClosestKeyword;
+};
+
+convert.keyword.rgb = function (keyword) {
+ return cssKeywords[keyword];
+};
+
+convert.rgb.xyz = function (rgb) {
+ let r = rgb[0] / 255;
+ let g = rgb[1] / 255;
+ let b = rgb[2] / 255;
+
+ // Assume sRGB
+ r = r > 0.04045 ? (((r + 0.055) / 1.055) ** 2.4) : (r / 12.92);
+ g = g > 0.04045 ? (((g + 0.055) / 1.055) ** 2.4) : (g / 12.92);
+ b = b > 0.04045 ? (((b + 0.055) / 1.055) ** 2.4) : (b / 12.92);
+
+ const x = (r * 0.4124) + (g * 0.3576) + (b * 0.1805);
+ const y = (r * 0.2126) + (g * 0.7152) + (b * 0.0722);
+ const z = (r * 0.0193) + (g * 0.1192) + (b * 0.9505);
+
+ return [x * 100, y * 100, z * 100];
+};
+
+convert.rgb.lab = function (rgb) {
+ const xyz = convert.rgb.xyz(rgb);
+ let x = xyz[0];
+ let y = xyz[1];
+ let z = xyz[2];
+
+ x /= 95.047;
+ y /= 100;
+ z /= 108.883;
+
+ x = x > 0.008856 ? (x ** (1 / 3)) : (7.787 * x) + (16 / 116);
+ y = y > 0.008856 ? (y ** (1 / 3)) : (7.787 * y) + (16 / 116);
+ z = z > 0.008856 ? (z ** (1 / 3)) : (7.787 * z) + (16 / 116);
+
+ const l = (116 * y) - 16;
+ const a = 500 * (x - y);
+ const b = 200 * (y - z);
+
+ return [l, a, b];
+};
+
+convert.hsl.rgb = function (hsl) {
+ const h = hsl[0] / 360;
+ const s = hsl[1] / 100;
+ const l = hsl[2] / 100;
+ let t2;
+ let t3;
+ let val;
+
+ if (s === 0) {
+ val = l * 255;
+ return [val, val, val];
+ }
+
+ if (l < 0.5) {
+ t2 = l * (1 + s);
+ } else {
+ t2 = l + s - l * s;
+ }
+
+ const t1 = 2 * l - t2;
+
+ const rgb = [0, 0, 0];
+ for (let i = 0; i < 3; i++) {
+ t3 = h + 1 / 3 * -(i - 1);
+ if (t3 < 0) {
+ t3++;
+ }
+
+ if (t3 > 1) {
+ t3--;
+ }
+
+ if (6 * t3 < 1) {
+ val = t1 + (t2 - t1) * 6 * t3;
+ } else if (2 * t3 < 1) {
+ val = t2;
+ } else if (3 * t3 < 2) {
+ val = t1 + (t2 - t1) * (2 / 3 - t3) * 6;
+ } else {
+ val = t1;
+ }
+
+ rgb[i] = val * 255;
+ }
+
+ return rgb;
+};
+
+convert.hsl.hsv = function (hsl) {
+ const h = hsl[0];
+ let s = hsl[1] / 100;
+ let l = hsl[2] / 100;
+ let smin = s;
+ const lmin = Math.max(l, 0.01);
+
+ l *= 2;
+ s *= (l <= 1) ? l : 2 - l;
+ smin *= lmin <= 1 ? lmin : 2 - lmin;
+ const v = (l + s) / 2;
+ const sv = l === 0 ? (2 * smin) / (lmin + smin) : (2 * s) / (l + s);
+
+ return [h, sv * 100, v * 100];
+};
+
+convert.hsv.rgb = function (hsv) {
+ const h = hsv[0] / 60;
+ const s = hsv[1] / 100;
+ let v = hsv[2] / 100;
+ const hi = Math.floor(h) % 6;
+
+ const f = h - Math.floor(h);
+ const p = 255 * v * (1 - s);
+ const q = 255 * v * (1 - (s * f));
+ const t = 255 * v * (1 - (s * (1 - f)));
+ v *= 255;
+
+ switch (hi) {
+ case 0:
+ return [v, t, p];
+ case 1:
+ return [q, v, p];
+ case 2:
+ return [p, v, t];
+ case 3:
+ return [p, q, v];
+ case 4:
+ return [t, p, v];
+ case 5:
+ return [v, p, q];
+ }
+};
+
+convert.hsv.hsl = function (hsv) {
+ const h = hsv[0];
+ const s = hsv[1] / 100;
+ const v = hsv[2] / 100;
+ const vmin = Math.max(v, 0.01);
+ let sl;
+ let l;
+
+ l = (2 - s) * v;
+ const lmin = (2 - s) * vmin;
+ sl = s * vmin;
+ sl /= (lmin <= 1) ? lmin : 2 - lmin;
+ sl = sl || 0;
+ l /= 2;
+
+ return [h, sl * 100, l * 100];
+};
+
+// http://dev.w3.org/csswg/css-color/#hwb-to-rgb
+convert.hwb.rgb = function (hwb) {
+ const h = hwb[0] / 360;
+ let wh = hwb[1] / 100;
+ let bl = hwb[2] / 100;
+ const ratio = wh + bl;
+ let f;
+
+ // Wh + bl cant be > 1
+ if (ratio > 1) {
+ wh /= ratio;
+ bl /= ratio;
+ }
+
+ const i = Math.floor(6 * h);
+ const v = 1 - bl;
+ f = 6 * h - i;
+
+ if ((i & 0x01) !== 0) {
+ f = 1 - f;
+ }
+
+ const n = wh + f * (v - wh); // Linear interpolation
+
+ let r;
+ let g;
+ let b;
+ /* eslint-disable max-statements-per-line,no-multi-spaces */
+ switch (i) {
+ default:
+ case 6:
+ case 0: r = v; g = n; b = wh; break;
+ case 1: r = n; g = v; b = wh; break;
+ case 2: r = wh; g = v; b = n; break;
+ case 3: r = wh; g = n; b = v; break;
+ case 4: r = n; g = wh; b = v; break;
+ case 5: r = v; g = wh; b = n; break;
+ }
+ /* eslint-enable max-statements-per-line,no-multi-spaces */
+
+ return [r * 255, g * 255, b * 255];
+};
+
+convert.cmyk.rgb = function (cmyk) {
+ const c = cmyk[0] / 100;
+ const m = cmyk[1] / 100;
+ const y = cmyk[2] / 100;
+ const k = cmyk[3] / 100;
+
+ const r = 1 - Math.min(1, c * (1 - k) + k);
+ const g = 1 - Math.min(1, m * (1 - k) + k);
+ const b = 1 - Math.min(1, y * (1 - k) + k);
+
+ return [r * 255, g * 255, b * 255];
+};
+
+convert.xyz.rgb = function (xyz) {
+ const x = xyz[0] / 100;
+ const y = xyz[1] / 100;
+ const z = xyz[2] / 100;
+ let r;
+ let g;
+ let b;
+
+ r = (x * 3.2406) + (y * -1.5372) + (z * -0.4986);
+ g = (x * -0.9689) + (y * 1.8758) + (z * 0.0415);
+ b = (x * 0.0557) + (y * -0.2040) + (z * 1.0570);
+
+ // Assume sRGB
+ r = r > 0.0031308
+ ? ((1.055 * (r ** (1.0 / 2.4))) - 0.055)
+ : r * 12.92;
+
+ g = g > 0.0031308
+ ? ((1.055 * (g ** (1.0 / 2.4))) - 0.055)
+ : g * 12.92;
+
+ b = b > 0.0031308
+ ? ((1.055 * (b ** (1.0 / 2.4))) - 0.055)
+ : b * 12.92;
+
+ r = Math.min(Math.max(0, r), 1);
+ g = Math.min(Math.max(0, g), 1);
+ b = Math.min(Math.max(0, b), 1);
+
+ return [r * 255, g * 255, b * 255];
+};
+
+convert.xyz.lab = function (xyz) {
+ let x = xyz[0];
+ let y = xyz[1];
+ let z = xyz[2];
+
+ x /= 95.047;
+ y /= 100;
+ z /= 108.883;
+
+ x = x > 0.008856 ? (x ** (1 / 3)) : (7.787 * x) + (16 / 116);
+ y = y > 0.008856 ? (y ** (1 / 3)) : (7.787 * y) + (16 / 116);
+ z = z > 0.008856 ? (z ** (1 / 3)) : (7.787 * z) + (16 / 116);
+
+ const l = (116 * y) - 16;
+ const a = 500 * (x - y);
+ const b = 200 * (y - z);
+
+ return [l, a, b];
+};
+
+convert.lab.xyz = function (lab) {
+ const l = lab[0];
+ const a = lab[1];
+ const b = lab[2];
+ let x;
+ let y;
+ let z;
+
+ y = (l + 16) / 116;
+ x = a / 500 + y;
+ z = y - b / 200;
+
+ const y2 = y ** 3;
+ const x2 = x ** 3;
+ const z2 = z ** 3;
+ y = y2 > 0.008856 ? y2 : (y - 16 / 116) / 7.787;
+ x = x2 > 0.008856 ? x2 : (x - 16 / 116) / 7.787;
+ z = z2 > 0.008856 ? z2 : (z - 16 / 116) / 7.787;
+
+ x *= 95.047;
+ y *= 100;
+ z *= 108.883;
+
+ return [x, y, z];
+};
+
+convert.lab.lch = function (lab) {
+ const l = lab[0];
+ const a = lab[1];
+ const b = lab[2];
+ let h;
+
+ const hr = Math.atan2(b, a);
+ h = hr * 360 / 2 / Math.PI;
+
+ if (h < 0) {
+ h += 360;
+ }
+
+ const c = Math.sqrt(a * a + b * b);
+
+ return [l, c, h];
+};
+
+convert.lch.lab = function (lch) {
+ const l = lch[0];
+ const c = lch[1];
+ const h = lch[2];
+
+ const hr = h / 360 * 2 * Math.PI;
+ const a = c * Math.cos(hr);
+ const b = c * Math.sin(hr);
+
+ return [l, a, b];
+};
+
+convert.rgb.ansi16 = function (args, saturation = null) {
+ const [r, g, b] = args;
+ let value = saturation === null ? convert.rgb.hsv(args)[2] : saturation; // Hsv -> ansi16 optimization
+
+ value = Math.round(value / 50);
+
+ if (value === 0) {
+ return 30;
+ }
+
+ let ansi = 30
+ + ((Math.round(b / 255) << 2)
+ | (Math.round(g / 255) << 1)
+ | Math.round(r / 255));
+
+ if (value === 2) {
+ ansi += 60;
+ }
+
+ return ansi;
+};
+
+convert.hsv.ansi16 = function (args) {
+ // Optimization here; we already know the value and don't need to get
+ // it converted for us.
+ return convert.rgb.ansi16(convert.hsv.rgb(args), args[2]);
+};
+
+convert.rgb.ansi256 = function (args) {
+ const r = args[0];
+ const g = args[1];
+ const b = args[2];
+
+ // We use the extended greyscale palette here, with the exception of
+ // black and white. normal palette only has 4 greyscale shades.
+ if (r === g && g === b) {
+ if (r < 8) {
+ return 16;
+ }
+
+ if (r > 248) {
+ return 231;
+ }
+
+ return Math.round(((r - 8) / 247) * 24) + 232;
+ }
+
+ const ansi = 16
+ + (36 * Math.round(r / 255 * 5))
+ + (6 * Math.round(g / 255 * 5))
+ + Math.round(b / 255 * 5);
+
+ return ansi;
+};
+
+convert.ansi16.rgb = function (args) {
+ let color = args % 10;
+
+ // Handle greyscale
+ if (color === 0 || color === 7) {
+ if (args > 50) {
+ color += 3.5;
+ }
+
+ color = color / 10.5 * 255;
+
+ return [color, color, color];
+ }
+
+ const mult = (~~(args > 50) + 1) * 0.5;
+ const r = ((color & 1) * mult) * 255;
+ const g = (((color >> 1) & 1) * mult) * 255;
+ const b = (((color >> 2) & 1) * mult) * 255;
+
+ return [r, g, b];
+};
+
+convert.ansi256.rgb = function (args) {
+ // Handle greyscale
+ if (args >= 232) {
+ const c = (args - 232) * 10 + 8;
+ return [c, c, c];
+ }
+
+ args -= 16;
+
+ let rem;
+ const r = Math.floor(args / 36) / 5 * 255;
+ const g = Math.floor((rem = args % 36) / 6) / 5 * 255;
+ const b = (rem % 6) / 5 * 255;
+
+ return [r, g, b];
+};
+
+convert.rgb.hex = function (args) {
+ const integer = ((Math.round(args[0]) & 0xFF) << 16)
+ + ((Math.round(args[1]) & 0xFF) << 8)
+ + (Math.round(args[2]) & 0xFF);
+
+ const string = integer.toString(16).toUpperCase();
+ return '000000'.substring(string.length) + string;
+};
+
+convert.hex.rgb = function (args) {
+ const match = args.toString(16).match(/[a-f0-9]{6}|[a-f0-9]{3}/i);
+ if (!match) {
+ return [0, 0, 0];
+ }
+
+ let colorString = match[0];
+
+ if (match[0].length === 3) {
+ colorString = colorString.split('').map(char => {
+ return char + char;
+ }).join('');
+ }
+
+ const integer = parseInt(colorString, 16);
+ const r = (integer >> 16) & 0xFF;
+ const g = (integer >> 8) & 0xFF;
+ const b = integer & 0xFF;
+
+ return [r, g, b];
+};
+
+convert.rgb.hcg = function (rgb) {
+ const r = rgb[0] / 255;
+ const g = rgb[1] / 255;
+ const b = rgb[2] / 255;
+ const max = Math.max(Math.max(r, g), b);
+ const min = Math.min(Math.min(r, g), b);
+ const chroma = (max - min);
+ let grayscale;
+ let hue;
+
+ if (chroma < 1) {
+ grayscale = min / (1 - chroma);
+ } else {
+ grayscale = 0;
+ }
+
+ if (chroma <= 0) {
+ hue = 0;
+ } else
+ if (max === r) {
+ hue = ((g - b) / chroma) % 6;
+ } else
+ if (max === g) {
+ hue = 2 + (b - r) / chroma;
+ } else {
+ hue = 4 + (r - g) / chroma;
+ }
+
+ hue /= 6;
+ hue %= 1;
+
+ return [hue * 360, chroma * 100, grayscale * 100];
+};
+
+convert.hsl.hcg = function (hsl) {
+ const s = hsl[1] / 100;
+ const l = hsl[2] / 100;
+
+ const c = l < 0.5 ? (2.0 * s * l) : (2.0 * s * (1.0 - l));
+
+ let f = 0;
+ if (c < 1.0) {
+ f = (l - 0.5 * c) / (1.0 - c);
+ }
+
+ return [hsl[0], c * 100, f * 100];
+};
+
+convert.hsv.hcg = function (hsv) {
+ const s = hsv[1] / 100;
+ const v = hsv[2] / 100;
+
+ const c = s * v;
+ let f = 0;
+
+ if (c < 1.0) {
+ f = (v - c) / (1 - c);
+ }
+
+ return [hsv[0], c * 100, f * 100];
+};
+
+convert.hcg.rgb = function (hcg) {
+ const h = hcg[0] / 360;
+ const c = hcg[1] / 100;
+ const g = hcg[2] / 100;
+
+ if (c === 0.0) {
+ return [g * 255, g * 255, g * 255];
+ }
+
+ const pure = [0, 0, 0];
+ const hi = (h % 1) * 6;
+ const v = hi % 1;
+ const w = 1 - v;
+ let mg = 0;
+
+ /* eslint-disable max-statements-per-line */
+ switch (Math.floor(hi)) {
+ case 0:
+ pure[0] = 1; pure[1] = v; pure[2] = 0; break;
+ case 1:
+ pure[0] = w; pure[1] = 1; pure[2] = 0; break;
+ case 2:
+ pure[0] = 0; pure[1] = 1; pure[2] = v; break;
+ case 3:
+ pure[0] = 0; pure[1] = w; pure[2] = 1; break;
+ case 4:
+ pure[0] = v; pure[1] = 0; pure[2] = 1; break;
+ default:
+ pure[0] = 1; pure[1] = 0; pure[2] = w;
+ }
+ /* eslint-enable max-statements-per-line */
+
+ mg = (1.0 - c) * g;
+
+ return [
+ (c * pure[0] + mg) * 255,
+ (c * pure[1] + mg) * 255,
+ (c * pure[2] + mg) * 255
+ ];
+};
+
+convert.hcg.hsv = function (hcg) {
+ const c = hcg[1] / 100;
+ const g = hcg[2] / 100;
+
+ const v = c + g * (1.0 - c);
+ let f = 0;
+
+ if (v > 0.0) {
+ f = c / v;
+ }
+
+ return [hcg[0], f * 100, v * 100];
+};
+
+convert.hcg.hsl = function (hcg) {
+ const c = hcg[1] / 100;
+ const g = hcg[2] / 100;
+
+ const l = g * (1.0 - c) + 0.5 * c;
+ let s = 0;
+
+ if (l > 0.0 && l < 0.5) {
+ s = c / (2 * l);
+ } else
+ if (l >= 0.5 && l < 1.0) {
+ s = c / (2 * (1 - l));
+ }
+
+ return [hcg[0], s * 100, l * 100];
+};
+
+convert.hcg.hwb = function (hcg) {
+ const c = hcg[1] / 100;
+ const g = hcg[2] / 100;
+ const v = c + g * (1.0 - c);
+ return [hcg[0], (v - c) * 100, (1 - v) * 100];
+};
+
+convert.hwb.hcg = function (hwb) {
+ const w = hwb[1] / 100;
+ const b = hwb[2] / 100;
+ const v = 1 - b;
+ const c = v - w;
+ let g = 0;
+
+ if (c < 1) {
+ g = (v - c) / (1 - c);
+ }
+
+ return [hwb[0], c * 100, g * 100];
+};
+
+convert.apple.rgb = function (apple) {
+ return [(apple[0] / 65535) * 255, (apple[1] / 65535) * 255, (apple[2] / 65535) * 255];
+};
+
+convert.rgb.apple = function (rgb) {
+ return [(rgb[0] / 255) * 65535, (rgb[1] / 255) * 65535, (rgb[2] / 255) * 65535];
+};
+
+convert.gray.rgb = function (args) {
+ return [args[0] / 100 * 255, args[0] / 100 * 255, args[0] / 100 * 255];
+};
+
+convert.gray.hsl = function (args) {
+ return [0, 0, args[0]];
+};
+
+convert.gray.hsv = convert.gray.hsl;
+
+convert.gray.hwb = function (gray) {
+ return [0, 100, gray[0]];
+};
+
+convert.gray.cmyk = function (gray) {
+ return [0, 0, 0, gray[0]];
+};
+
+convert.gray.lab = function (gray) {
+ return [gray[0], 0, 0];
+};
+
+convert.gray.hex = function (gray) {
+ const val = Math.round(gray[0] / 100 * 255) & 0xFF;
+ const integer = (val << 16) + (val << 8) + val;
+
+ const string = integer.toString(16).toUpperCase();
+ return '000000'.substring(string.length) + string;
+};
+
+convert.rgb.gray = function (rgb) {
+ const val = (rgb[0] + rgb[1] + rgb[2]) / 3;
+ return [val / 255 * 100];
+};
diff --git a/temporary_modules/trezor-connect/node_modules/color-convert/index.js b/temporary_modules/trezor-connect/node_modules/color-convert/index.js
new file mode 100644
index 00000000..b648e573
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-convert/index.js
@@ -0,0 +1,81 @@
+const conversions = require('./conversions');
+const route = require('./route');
+
+const convert = {};
+
+const models = Object.keys(conversions);
+
+function wrapRaw(fn) {
+ const wrappedFn = function (...args) {
+ const arg0 = args[0];
+ if (arg0 === undefined || arg0 === null) {
+ return arg0;
+ }
+
+ if (arg0.length > 1) {
+ args = arg0;
+ }
+
+ return fn(args);
+ };
+
+ // Preserve .conversion property if there is one
+ if ('conversion' in fn) {
+ wrappedFn.conversion = fn.conversion;
+ }
+
+ return wrappedFn;
+}
+
+function wrapRounded(fn) {
+ const wrappedFn = function (...args) {
+ const arg0 = args[0];
+
+ if (arg0 === undefined || arg0 === null) {
+ return arg0;
+ }
+
+ if (arg0.length > 1) {
+ args = arg0;
+ }
+
+ const result = fn(args);
+
+ // We're assuming the result is an array here.
+ // see notice in conversions.js; don't use box types
+ // in conversion functions.
+ if (typeof result === 'object') {
+ for (let len = result.length, i = 0; i < len; i++) {
+ result[i] = Math.round(result[i]);
+ }
+ }
+
+ return result;
+ };
+
+ // Preserve .conversion property if there is one
+ if ('conversion' in fn) {
+ wrappedFn.conversion = fn.conversion;
+ }
+
+ return wrappedFn;
+}
+
+models.forEach(fromModel => {
+ convert[fromModel] = {};
+
+ Object.defineProperty(convert[fromModel], 'channels', {value: conversions[fromModel].channels});
+ Object.defineProperty(convert[fromModel], 'labels', {value: conversions[fromModel].labels});
+
+ const routes = route(fromModel);
+ const routeModels = Object.keys(routes);
+
+ routeModels.forEach(toModel => {
+ const fn = routes[toModel];
+
+ convert[fromModel][toModel] = wrapRounded(fn);
+ convert[fromModel][toModel].raw = wrapRaw(fn);
+ });
+});
+
+module.exports = convert;
diff --git a/temporary_modules/trezor-connect/node_modules/color-convert/package.json b/temporary_modules/trezor-connect/node_modules/color-convert/package.json
new file mode 100644
index 00000000..6e48000c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-convert/package.json
@@ -0,0 +1,48 @@
+{
+ "name": "color-convert",
+ "description": "Plain color conversion functions",
+ "version": "2.0.1",
+ "author": "Heather Arthur ",
+ "license": "MIT",
+ "repository": "Qix-/color-convert",
+ "scripts": {
+ "pretest": "xo",
+ "test": "node test/basic.js"
+ },
+ "engines": {
+ "node": ">=7.0.0"
+ },
+ "keywords": [
+ "color",
+ "colour",
+ "convert",
+ "converter",
+ "conversion",
+ "rgb",
+ "hsl",
+ "hsv",
+ "hwb",
+ "cmyk",
+ "ansi",
+ "ansi16"
+ ],
+ "files": [
+ "index.js",
+ "conversions.js",
+ "route.js"
+ ],
+ "xo": {
+ "rules": {
+ "default-case": 0,
+ "no-inline-comments": 0,
+ "operator-linebreak": 0
+ }
+ },
+ "devDependencies": {
+ "chalk": "^2.4.2",
+ "xo": "^0.24.0"
+ },
+ "dependencies": {
+ "color-name": "~1.1.4"
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/color-convert/route.js b/temporary_modules/trezor-connect/node_modules/color-convert/route.js
new file mode 100644
index 00000000..1a08521b
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-convert/route.js
@@ -0,0 +1,97 @@
+const conversions = require('./conversions');
+
+/*
+ This function routes a model to all other models.
+
+ all functions that are routed have a property `.conversion` attached
+ to the returned synthetic function. This property is an array
+ of strings, each with the steps in between the 'from' and 'to'
+ color models (inclusive).
+
+ conversions that are not possible simply are not included.
+*/
+
+function buildGraph() {
+ const graph = {};
+ // https://jsperf.com/object-keys-vs-for-in-with-closure/3
+ const models = Object.keys(conversions);
+
+ for (let len = models.length, i = 0; i < len; i++) {
+ graph[models[i]] = {
+ // http://jsperf.com/1-vs-infinity
+ // micro-opt, but this is simple.
+ distance: -1,
+ parent: null
+ };
+ }
+
+ return graph;
+}
+
+// https://en.wikipedia.org/wiki/Breadth-first_search
+function deriveBFS(fromModel) {
+ const graph = buildGraph();
+ const queue = [fromModel]; // Unshift -> queue -> pop
+
+ graph[fromModel].distance = 0;
+
+ while (queue.length) {
+ const current = queue.pop();
+ const adjacents = Object.keys(conversions[current]);
+
+ for (let len = adjacents.length, i = 0; i < len; i++) {
+ const adjacent = adjacents[i];
+ const node = graph[adjacent];
+
+ if (node.distance === -1) {
+ node.distance = graph[current].distance + 1;
+ node.parent = current;
+ queue.unshift(adjacent);
+ }
+ }
+ }
+
+ return graph;
+}
+
+function link(from, to) {
+ return function (args) {
+ return to(from(args));
+ };
+}
+
+function wrapConversion(toModel, graph) {
+ const path = [graph[toModel].parent, toModel];
+ let fn = conversions[graph[toModel].parent][toModel];
+
+ let cur = graph[toModel].parent;
+ while (graph[cur].parent) {
+ path.unshift(graph[cur].parent);
+ fn = link(conversions[graph[cur].parent][cur], fn);
+ cur = graph[cur].parent;
+ }
+
+ fn.conversion = path;
+ return fn;
+}
+
+module.exports = function (fromModel) {
+ const graph = deriveBFS(fromModel);
+ const conversion = {};
+
+ const models = Object.keys(graph);
+ for (let len = models.length, i = 0; i < len; i++) {
+ const toModel = models[i];
+ const node = graph[toModel];
+
+ if (node.parent === null) {
+ // No possible conversion, or this node is the source model.
+ continue;
+ }
+
+ conversion[toModel] = wrapConversion(toModel, graph);
+ }
+
+ return conversion;
+};
+
diff --git a/temporary_modules/trezor-connect/node_modules/color-name/LICENSE b/temporary_modules/trezor-connect/node_modules/color-name/LICENSE
new file mode 100644
index 00000000..4d9802a8
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-name/LICENSE
@@ -0,0 +1,8 @@
+The MIT License (MIT)
+Copyright (c) 2015 Dmitry Ivanov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/temporary_modules/trezor-connect/node_modules/color-name/README.md b/temporary_modules/trezor-connect/node_modules/color-name/README.md
new file mode 100644
index 00000000..3611a6b5
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-name/README.md
@@ -0,0 +1,11 @@
+A JSON with color names and its values. Based on http://dev.w3.org/csswg/css-color/#named-colors.
+
+[](https://nodei.co/npm/color-name/)
+
+
+```js
+var colors = require('color-name');
+colors.red //[255,0,0]
+```
+
+
diff --git a/temporary_modules/trezor-connect/node_modules/color-name/index.js b/temporary_modules/trezor-connect/node_modules/color-name/index.js
new file mode 100644
index 00000000..e42aa68a
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-name/index.js
@@ -0,0 +1,152 @@
+'use strict'
+
+module.exports = {
+ "aliceblue": [240, 248, 255],
+ "antiquewhite": [250, 235, 215],
+ "aqua": [0, 255, 255],
+ "aquamarine": [127, 255, 212],
+ "azure": [240, 255, 255],
+ "beige": [245, 245, 220],
+ "bisque": [255, 228, 196],
+ "black": [0, 0, 0],
+ "blanchedalmond": [255, 235, 205],
+ "blue": [0, 0, 255],
+ "blueviolet": [138, 43, 226],
+ "brown": [165, 42, 42],
+ "burlywood": [222, 184, 135],
+ "cadetblue": [95, 158, 160],
+ "chartreuse": [127, 255, 0],
+ "chocolate": [210, 105, 30],
+ "coral": [255, 127, 80],
+ "cornflowerblue": [100, 149, 237],
+ "cornsilk": [255, 248, 220],
+ "crimson": [220, 20, 60],
+ "cyan": [0, 255, 255],
+ "darkblue": [0, 0, 139],
+ "darkcyan": [0, 139, 139],
+ "darkgoldenrod": [184, 134, 11],
+ "darkgray": [169, 169, 169],
+ "darkgreen": [0, 100, 0],
+ "darkgrey": [169, 169, 169],
+ "darkkhaki": [189, 183, 107],
+ "darkmagenta": [139, 0, 139],
+ "darkolivegreen": [85, 107, 47],
+ "darkorange": [255, 140, 0],
+ "darkorchid": [153, 50, 204],
+ "darkred": [139, 0, 0],
+ "darksalmon": [233, 150, 122],
+ "darkseagreen": [143, 188, 143],
+ "darkslateblue": [72, 61, 139],
+ "darkslategray": [47, 79, 79],
+ "darkslategrey": [47, 79, 79],
+ "darkturquoise": [0, 206, 209],
+ "darkviolet": [148, 0, 211],
+ "deeppink": [255, 20, 147],
+ "deepskyblue": [0, 191, 255],
+ "dimgray": [105, 105, 105],
+ "dimgrey": [105, 105, 105],
+ "dodgerblue": [30, 144, 255],
+ "firebrick": [178, 34, 34],
+ "floralwhite": [255, 250, 240],
+ "forestgreen": [34, 139, 34],
+ "fuchsia": [255, 0, 255],
+ "gainsboro": [220, 220, 220],
+ "ghostwhite": [248, 248, 255],
+ "gold": [255, 215, 0],
+ "goldenrod": [218, 165, 32],
+ "gray": [128, 128, 128],
+ "green": [0, 128, 0],
+ "greenyellow": [173, 255, 47],
+ "grey": [128, 128, 128],
+ "honeydew": [240, 255, 240],
+ "hotpink": [255, 105, 180],
+ "indianred": [205, 92, 92],
+ "indigo": [75, 0, 130],
+ "ivory": [255, 255, 240],
+ "khaki": [240, 230, 140],
+ "lavender": [230, 230, 250],
+ "lavenderblush": [255, 240, 245],
+ "lawngreen": [124, 252, 0],
+ "lemonchiffon": [255, 250, 205],
+ "lightblue": [173, 216, 230],
+ "lightcoral": [240, 128, 128],
+ "lightcyan": [224, 255, 255],
+ "lightgoldenrodyellow": [250, 250, 210],
+ "lightgray": [211, 211, 211],
+ "lightgreen": [144, 238, 144],
+ "lightgrey": [211, 211, 211],
+ "lightpink": [255, 182, 193],
+ "lightsalmon": [255, 160, 122],
+ "lightseagreen": [32, 178, 170],
+ "lightskyblue": [135, 206, 250],
+ "lightslategray": [119, 136, 153],
+ "lightslategrey": [119, 136, 153],
+ "lightsteelblue": [176, 196, 222],
+ "lightyellow": [255, 255, 224],
+ "lime": [0, 255, 0],
+ "limegreen": [50, 205, 50],
+ "linen": [250, 240, 230],
+ "magenta": [255, 0, 255],
+ "maroon": [128, 0, 0],
+ "mediumaquamarine": [102, 205, 170],
+ "mediumblue": [0, 0, 205],
+ "mediumorchid": [186, 85, 211],
+ "mediumpurple": [147, 112, 219],
+ "mediumseagreen": [60, 179, 113],
+ "mediumslateblue": [123, 104, 238],
+ "mediumspringgreen": [0, 250, 154],
+ "mediumturquoise": [72, 209, 204],
+ "mediumvioletred": [199, 21, 133],
+ "midnightblue": [25, 25, 112],
+ "mintcream": [245, 255, 250],
+ "mistyrose": [255, 228, 225],
+ "moccasin": [255, 228, 181],
+ "navajowhite": [255, 222, 173],
+ "navy": [0, 0, 128],
+ "oldlace": [253, 245, 230],
+ "olive": [128, 128, 0],
+ "olivedrab": [107, 142, 35],
+ "orange": [255, 165, 0],
+ "orangered": [255, 69, 0],
+ "orchid": [218, 112, 214],
+ "palegoldenrod": [238, 232, 170],
+ "palegreen": [152, 251, 152],
+ "paleturquoise": [175, 238, 238],
+ "palevioletred": [219, 112, 147],
+ "papayawhip": [255, 239, 213],
+ "peachpuff": [255, 218, 185],
+ "peru": [205, 133, 63],
+ "pink": [255, 192, 203],
+ "plum": [221, 160, 221],
+ "powderblue": [176, 224, 230],
+ "purple": [128, 0, 128],
+ "rebeccapurple": [102, 51, 153],
+ "red": [255, 0, 0],
+ "rosybrown": [188, 143, 143],
+ "royalblue": [65, 105, 225],
+ "saddlebrown": [139, 69, 19],
+ "salmon": [250, 128, 114],
+ "sandybrown": [244, 164, 96],
+ "seagreen": [46, 139, 87],
+ "seashell": [255, 245, 238],
+ "sienna": [160, 82, 45],
+ "silver": [192, 192, 192],
+ "skyblue": [135, 206, 235],
+ "slateblue": [106, 90, 205],
+ "slategray": [112, 128, 144],
+ "slategrey": [112, 128, 144],
+ "snow": [255, 250, 250],
+ "springgreen": [0, 255, 127],
+ "steelblue": [70, 130, 180],
+ "tan": [210, 180, 140],
+ "teal": [0, 128, 128],
+ "thistle": [216, 191, 216],
+ "tomato": [255, 99, 71],
+ "turquoise": [64, 224, 208],
+ "violet": [238, 130, 238],
+ "wheat": [245, 222, 179],
+ "white": [255, 255, 255],
+ "whitesmoke": [245, 245, 245],
+ "yellow": [255, 255, 0],
+ "yellowgreen": [154, 205, 50]
+};
diff --git a/temporary_modules/trezor-connect/node_modules/color-name/package.json b/temporary_modules/trezor-connect/node_modules/color-name/package.json
new file mode 100644
index 00000000..7acc9028
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/color-name/package.json
@@ -0,0 +1,28 @@
+{
+ "name": "color-name",
+ "version": "1.1.4",
+ "description": "A list of color names and its values",
+ "main": "index.js",
+ "files": [
+ "index.js"
+ ],
+ "scripts": {
+ "test": "node test.js"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git@github.com:colorjs/color-name.git"
+ },
+ "keywords": [
+ "color-name",
+ "color",
+ "color-keyword",
+ "keyword"
+ ],
+ "author": "DY ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/colorjs/color-name/issues"
+ },
+ "homepage": "https://github.com/colorjs/color-name"
+}
diff --git a/temporary_modules/trezor-connect/node_modules/commander/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/commander/CHANGELOG.md
new file mode 100644
index 00000000..9b8359bf
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/commander/CHANGELOG.md
@@ -0,0 +1,361 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](http://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](http://semver.org/spec/v2.0.0.html). (Format adopted after v3.0.0.)
+
+
+
+
+## [6.2.1] (2020-12-13)
+
+### Fixed
+
+- some tests failed if directory path included a space ([1390])
+
+## [6.2.0] (2020-10-25)
+
+### Added
+
+- added 'tsx' file extension for stand-alone executable subcommands ([#1368])
+- documented second parameter to `.description()` to describe command arguments ([#1353])
+- documentation of special cases with options taking varying numbers of option-arguments ([#1332])
+- documentation for terminology ([#1361])
+
+### Fixed
+
+- add missing TypeScript definition for `.addHelpCommand()' ([#1375])
+- removed blank line after "Arguments:" in help, to match "Options:" and "Commands:" ([#1360])
+
+### Changed
+
+- update dependencies
+
+## [6.1.0] (2020-08-28)
+
+### Added
+
+- include URL to relevant section of README for error for potential conflict between Command properties and option values ([#1306])
+- `.combineFlagAndOptionalValue(false)` to ease upgrade path from older versions of Commander ([#1326])
+- allow disabling the built-in help option using `.helpOption(false)` ([#1325])
+- allow just some arguments in `argumentDescription` to `.description()` ([#1323])
+
+### Changed
+
+- tidy async test and remove lint override ([#1312])
+
+### Fixed
+
+- executable subcommand launching when script path not known ([#1322])
+
+## [6.0.0] (2020-07-21)
+
+### Added
+
+- add support for variadic options ([#1250])
+- allow options to be added with just a short flag ([#1256])
+ - *Breaking* the option property has same case as flag. e.g. flag `-n` accessed as `opts().n` (previously uppercase)
+- *Breaking* throw an error if there might be a clash between option name and a Command property, with advice on how to resolve ([#1275])
+
+### Fixed
+
+- Options which contain -no- in the middle of the option flag should not be treated as negatable. ([#1301])
+
+## [6.0.0-0] (2020-06-20)
+
+(Released in 6.0.0)
+
+## [5.1.0] (2020-04-25)
+
+### Added
+
+- support for multiple command aliases, the first of which is shown in the auto-generated help ([#531], [#1236])
+- configuration support in `addCommand()` for `hidden` and `isDefault` ([#1232])
+
+### Fixed
+
+- omit masked help flags from the displayed help ([#645], [#1247])
+- remove old short help flag when change help flags using `helpOption` ([#1248])
+
+### Changed
+
+- remove use of `arguments` to improve auto-generated help in editors ([#1235])
+- rename `.command()` configuration `noHelp` to `hidden` (but not remove old support) ([#1232])
+- improvements to documentation
+- update dependencies
+- update tested versions of node
+- eliminate lint errors in TypeScript ([#1208])
+
+## [5.0.0] (2020-03-14)
+
+### Added
+
+* support for nested commands with action-handlers ([#1] [#764] [#1149])
+* `.addCommand()` for adding a separately configured command ([#764] [#1149])
+* allow a non-executable to be set as the default command ([#742] [#1149])
+* implicit help command when there are subcommands (previously only if executables) ([#1149])
+* customise implicit help command with `.addHelpCommand()` ([#1149])
+* display error message for unknown subcommand, by default ([#432] [#1088] [#1149])
+* display help for missing subcommand, by default ([#1088] [#1149])
+* combined short options as single argument may include boolean flags and value flag and value (e.g. `-a -b -p 80` can be written as `-abp80`) ([#1145])
+* `.parseOption()` includes short flag and long flag expansions ([#1145])
+* `.helpInformation()` returns help text as a string, previously a private routine ([#1169])
+* `.parse()` implicitly uses `process.argv` if arguments not specified ([#1172])
+* optionally specify where `.parse()` arguments "from", if not following node conventions ([#512] [#1172])
+* suggest help option along with unknown command error ([#1179])
+* TypeScript definition for `commands` property of `Command` ([#1184])
+* export `program` property ([#1195])
+* `createCommand` factory method to simplify subclassing ([#1191])
+
+### Fixed
+
+* preserve argument order in subcommands ([#508] [#962] [#1138])
+* do not emit `command:*` for executable subcommands ([#809] [#1149])
+* action handler called whether or not there are non-option arguments ([#1062] [#1149])
+* combining option short flag and value in single argument now works for subcommands ([#1145])
+* only add implicit help command when it will not conflict with other uses of argument ([#1153] [#1149])
+* implicit help command works with command aliases ([#948] [#1149])
+* options are validated whether or not there is an action handler ([#1149])
+
+### Changed
+
+* *Breaking* `.args` contains command arguments with just recognised options removed ([#1032] [#1138])
+* *Breaking* display error if required argument for command is missing ([#995] [#1149])
+* tighten TypeScript definition of custom option processing function passed to `.option()` ([#1119])
+* *Breaking* `.allowUnknownOption()` ([#802] [#1138])
+ * unknown options included in arguments passed to command action handler
+ * unknown options included in `.args`
+* only recognised option short flags and long flags are expanded (e.g. `-ab` or `--foo=bar`) ([#1145])
+* *Breaking* `.parseOptions()` ([#1138])
+ * `args` in returned result renamed `operands` and does not include anything after first unknown option
+ * `unknown` in returned result has arguments after first unknown option including operands, not just options and values
+* *Breaking* `.on('command:*', callback)` and other command events passed (changed) results from `.parseOptions`, i.e. operands and unknown ([#1138])
+* refactor Option from prototype to class ([#1133])
+* refactor Command from prototype to class ([#1159])
+* changes to error handling ([#1165])
+ * throw for author error, not just display message
+ * preflight for variadic error
+ * add tips to missing subcommand executable
+* TypeScript fluent return types changed to be more subclass friendly, return `this` rather than `Command` ([#1180])
+* `.parseAsync` returns `Promise` to be consistent with `.parse()` ([#1180])
+* update dependencies
+
+### Removed
+
+* removed EventEmitter from TypeScript definition for Command, eliminating implicit peer dependency on `@types/node` ([#1146])
+* removed private function `normalize` (the functionality has been integrated into `parseOptions`) ([#1145])
+* `parseExpectedArgs` is now private ([#1149])
+
+### Migration Tips
+
+If you use `.on('command:*')` or more complicated tests to detect an unrecognised subcommand, you may be able to delete the code and rely on the default behaviour.
+
+If you use `program.args` or more complicated tests to detect a missing subcommand, you may be able to delete the code and rely on the default behaviour.
+
+If you use `.command('*')` to add a default command, you may be be able to switch to `isDefault:true` with a named command.
+
+If you want to continue combining short options with optional values as though they were boolean flags, set `combineFlagAndOptionalValue(false)`
+to expand `-fb` to `-f -b` rather than `-f b`.
+
+## [5.0.0-4] (2020-03-03)
+
+(Released in 5.0.0)
+
+## [5.0.0-3] (2020-02-20)
+
+(Released in 5.0.0)
+
+## [5.0.0-2] (2020-02-10)
+
+(Released in 5.0.0)
+
+## [5.0.0-1] (2020-02-08)
+
+(Released in 5.0.0)
+
+## [5.0.0-0] (2020-02-02)
+
+(Released in 5.0.0)
+
+## [4.1.1] (2020-02-02)
+
+### Fixed
+
+* TypeScript definition for `.action()` should include Promise for async ([#1157])
+
+## [4.1.0] (2020-01-06)
+
+### Added
+
+* two routines to change how option values are handled, and eliminate name clashes with command properties ([#933] [#1102])
+ * see storeOptionsAsProperties and passCommandToAction in README
+* `.parseAsync` to use instead of `.parse` if supply async action handlers ([#806] [#1118])
+
+### Fixed
+
+* Remove trailing blanks from wrapped help text ([#1096])
+
+### Changed
+
+* update dependencies
+* extend security coverage for Commander 2.x to 2020-02-03
+* improvements to README
+* improvements to TypeScript definition documentation
+* move old versions out of main CHANGELOG
+* removed explicit use of `ts-node` in tests
+
+## [4.0.1] (2019-11-12)
+
+### Fixed
+
+* display help when requested, even if there are missing required options ([#1091])
+
+## [4.0.0] (2019-11-02)
+
+### Added
+
+* automatically wrap and indent help descriptions for options and commands ([#1051])
+* `.exitOverride()` allows override of calls to `process.exit` for additional error handling and to keep program running ([#1040])
+* support for declaring required options with `.requiredOptions()` ([#1071])
+* GitHub Actions support ([#1027])
+* translation links in README
+
+### Changed
+
+* dev: switch tests from Sinon+Should to Jest with major rewrite of tests ([#1035])
+* call default subcommand even when there are unknown options ([#1047])
+* *Breaking* Commander is only officially supported on Node 8 and above, and requires Node 6 ([#1053])
+
+### Fixed
+
+* *Breaking* keep command object out of program.args when action handler called ([#1048])
+ * also, action handler now passed array of unknown arguments
+* complain about unknown options when program argument supplied and action handler ([#1049])
+ * this changes parameters to `command:*` event to include unknown arguments
+* removed deprecated `customFds` option from call to `child_process.spawn` ([#1052])
+* rework TypeScript declarations to bring all types into imported namespace ([#1081])
+
+### Migration Tips
+
+#### Testing for no arguments
+
+If you were previously using code like:
+
+```js
+if (!program.args.length) ...
+```
+
+a partial replacement is:
+
+```js
+if (program.rawArgs.length < 3) ...
+```
+
+## [4.0.0-1] Prerelease (2019-10-08)
+
+(Released in 4.0.0)
+
+## [4.0.0-0] Prerelease (2019-10-01)
+
+(Released in 4.0.0)
+
+## Older versions
+
+* [3.x](./changelogs/CHANGELOG-3.md)
+* [2.x](./changelogs/CHANGELOG-2.md)
+* [1.x](./changelogs/CHANGELOG-1.md)
+* [0.x](./changelogs/CHANGELOG-0.md)
+
+[#1]: https://github.com/tj/commander.js/issues/1
+[#432]: https://github.com/tj/commander.js/issues/432
+[#508]: https://github.com/tj/commander.js/issues/508
+[#512]: https://github.com/tj/commander.js/issues/512
+[#531]: https://github.com/tj/commander.js/issues/531
+[#645]: https://github.com/tj/commander.js/issues/645
+[#742]: https://github.com/tj/commander.js/issues/742
+[#764]: https://github.com/tj/commander.js/issues/764
+[#802]: https://github.com/tj/commander.js/issues/802
+[#806]: https://github.com/tj/commander.js/issues/806
+[#809]: https://github.com/tj/commander.js/issues/809
+[#948]: https://github.com/tj/commander.js/issues/948
+[#962]: https://github.com/tj/commander.js/issues/962
+[#995]: https://github.com/tj/commander.js/issues/995
+[#1027]: https://github.com/tj/commander.js/pull/1027
+[#1032]: https://github.com/tj/commander.js/issues/1032
+[#1035]: https://github.com/tj/commander.js/pull/1035
+[#1040]: https://github.com/tj/commander.js/pull/1040
+[#1047]: https://github.com/tj/commander.js/pull/1047
+[#1048]: https://github.com/tj/commander.js/pull/1048
+[#1049]: https://github.com/tj/commander.js/pull/1049
+[#1051]: https://github.com/tj/commander.js/pull/1051
+[#1052]: https://github.com/tj/commander.js/pull/1052
+[#1053]: https://github.com/tj/commander.js/pull/1053
+[#1062]: https://github.com/tj/commander.js/pull/1062
+[#1071]: https://github.com/tj/commander.js/pull/1071
+[#1081]: https://github.com/tj/commander.js/pull/1081
+[#1088]: https://github.com/tj/commander.js/issues/1088
+[#1091]: https://github.com/tj/commander.js/pull/1091
+[#1096]: https://github.com/tj/commander.js/pull/1096
+[#1102]: https://github.com/tj/commander.js/pull/1102
+[#1118]: https://github.com/tj/commander.js/pull/1118
+[#1119]: https://github.com/tj/commander.js/pull/1119
+[#1133]: https://github.com/tj/commander.js/pull/1133
+[#1138]: https://github.com/tj/commander.js/pull/1138
+[#1145]: https://github.com/tj/commander.js/pull/1145
+[#1146]: https://github.com/tj/commander.js/pull/1146
+[#1149]: https://github.com/tj/commander.js/pull/1149
+[#1153]: https://github.com/tj/commander.js/issues/1153
+[#1157]: https://github.com/tj/commander.js/pull/1157
+[#1159]: https://github.com/tj/commander.js/pull/1159
+[#1165]: https://github.com/tj/commander.js/pull/1165
+[#1169]: https://github.com/tj/commander.js/pull/1169
+[#1172]: https://github.com/tj/commander.js/pull/1172
+[#1179]: https://github.com/tj/commander.js/pull/1179
+[#1180]: https://github.com/tj/commander.js/pull/1180
+[#1184]: https://github.com/tj/commander.js/pull/1184
+[#1191]: https://github.com/tj/commander.js/pull/1191
+[#1195]: https://github.com/tj/commander.js/pull/1195
+[#1208]: https://github.com/tj/commander.js/pull/1208
+[#1232]: https://github.com/tj/commander.js/pull/1232
+[#1235]: https://github.com/tj/commander.js/pull/1235
+[#1236]: https://github.com/tj/commander.js/pull/1236
+[#1247]: https://github.com/tj/commander.js/pull/1247
+[#1248]: https://github.com/tj/commander.js/pull/1248
+[#1250]: https://github.com/tj/commander.js/pull/1250
+[#1256]: https://github.com/tj/commander.js/pull/1256
+[#1275]: https://github.com/tj/commander.js/pull/1275
+[#1301]: https://github.com/tj/commander.js/issues/1301
+[#1306]: https://github.com/tj/commander.js/pull/1306
+[#1312]: https://github.com/tj/commander.js/pull/1312
+[#1322]: https://github.com/tj/commander.js/pull/1322
+[#1323]: https://github.com/tj/commander.js/pull/1323
+[#1325]: https://github.com/tj/commander.js/pull/1325
+[#1326]: https://github.com/tj/commander.js/pull/1326
+[#1332]: https://github.com/tj/commander.js/pull/1332
+[#1353]: https://github.com/tj/commander.js/pull/1353
+[#1360]: https://github.com/tj/commander.js/pull/1360
+[#1361]: https://github.com/tj/commander.js/pull/1361
+[#1368]: https://github.com/tj/commander.js/pull/1368
+[#1375]: https://github.com/tj/commander.js/pull/1375
+[#1390]: https://github.com/tj/commander.js/pull/1390
+
+[Unreleased]: https://github.com/tj/commander.js/compare/master...develop
+[6.2.1]: https://github.com/tj/commander.js/compare/v6.2.0..v6.2.1
+[6.2.0]: https://github.com/tj/commander.js/compare/v6.1.0..v6.2.0
+[6.1.0]: https://github.com/tj/commander.js/compare/v6.0.0..v6.1.0
+[6.0.0]: https://github.com/tj/commander.js/compare/v5.1.0..v6.0.0
+[6.0.0-0]: https://github.com/tj/commander.js/compare/v5.1.0..v6.0.0-0
+[5.1.0]: https://github.com/tj/commander.js/compare/v5.0.0..v5.1.0
+[5.0.0]: https://github.com/tj/commander.js/compare/v4.1.1..v5.0.0
+[5.0.0-4]: https://github.com/tj/commander.js/compare/v5.0.0-3..v5.0.0-4
+[5.0.0-3]: https://github.com/tj/commander.js/compare/v5.0.0-2..v5.0.0-3
+[5.0.0-2]: https://github.com/tj/commander.js/compare/v5.0.0-1..v5.0.0-2
+[5.0.0-1]: https://github.com/tj/commander.js/compare/v5.0.0-0..v5.0.0-1
+[5.0.0-0]: https://github.com/tj/commander.js/compare/v4.1.1..v5.0.0-0
+[4.1.1]: https://github.com/tj/commander.js/compare/v4.1.0..v4.1.1
+[4.1.0]: https://github.com/tj/commander.js/compare/v4.0.1..v4.1.0
+[4.0.1]: https://github.com/tj/commander.js/compare/v4.0.0..v4.0.1
+[4.0.0]: https://github.com/tj/commander.js/compare/v3.0.2..v4.0.0
+[4.0.0-1]: https://github.com/tj/commander.js/compare/v4.0.0-0..v4.0.0-1
+[4.0.0-0]: https://github.com/tj/commander.js/compare/v3.0.2...v4.0.0-0
diff --git a/temporary_modules/trezor-connect/node_modules/commander/LICENSE b/temporary_modules/trezor-connect/node_modules/commander/LICENSE
new file mode 100644
index 00000000..10f997ab
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/commander/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2011 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/commander/Readme.md b/temporary_modules/trezor-connect/node_modules/commander/Readme.md
new file mode 100644
index 00000000..45cd7553
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/commander/Readme.md
@@ -0,0 +1,791 @@
+# Commander.js
+
+[](http://travis-ci.org/tj/commander.js)
+[](https://www.npmjs.org/package/commander)
+[](https://npmcharts.com/compare/commander?minimal=true)
+[](https://packagephobia.now.sh/result?p=commander)
+
+The complete solution for [node.js](http://nodejs.org) command-line interfaces.
+
+Read this in other languages: English | [简体中文](./Readme_zh-CN.md)
+
+- [Commander.js](#commanderjs)
+ - [Installation](#installation)
+ - [Declaring _program_ variable](#declaring-program-variable)
+ - [Options](#options)
+ - [Common option types, boolean and value](#common-option-types-boolean-and-value)
+ - [Default option value](#default-option-value)
+ - [Other option types, negatable boolean and boolean|value](#other-option-types-negatable-boolean-and-booleanvalue)
+ - [Custom option processing](#custom-option-processing)
+ - [Required option](#required-option)
+ - [Variadic option](#variadic-option)
+ - [Version option](#version-option)
+ - [Commands](#commands)
+ - [Specify the argument syntax](#specify-the-argument-syntax)
+ - [Action handler (sub)commands](#action-handler-subcommands)
+ - [Stand-alone executable (sub)commands](#stand-alone-executable-subcommands)
+ - [Automated help](#automated-help)
+ - [Custom help](#custom-help)
+ - [.usage and .name](#usage-and-name)
+ - [.help(cb)](#helpcb)
+ - [.outputHelp(cb)](#outputhelpcb)
+ - [.helpInformation()](#helpinformation)
+ - [.helpOption(flags, description)](#helpoptionflags-description)
+ - [.addHelpCommand()](#addhelpcommand)
+ - [Custom event listeners](#custom-event-listeners)
+ - [Bits and pieces](#bits-and-pieces)
+ - [.parse() and .parseAsync()](#parse-and-parseasync)
+ - [Avoiding option name clashes](#avoiding-option-name-clashes)
+ - [TypeScript](#typescript)
+ - [createCommand()](#createcommand)
+ - [Import into ECMAScript Module](#import-into-ecmascript-module)
+ - [Node options such as `--harmony`](#node-options-such-as---harmony)
+ - [Debugging stand-alone executable subcommands](#debugging-stand-alone-executable-subcommands)
+ - [Override exit handling](#override-exit-handling)
+ - [Examples](#examples)
+ - [Support](#support)
+ - [Commander for enterprise](#commander-for-enterprise)
+
+For information about terms used in this document see: [terminology](./docs/terminology.md)
+
+## Installation
+
+```bash
+npm install commander
+```
+
+## Declaring _program_ variable
+
+Commander exports a global object which is convenient for quick programs.
+This is used in the examples in this README for brevity.
+
+```js
+const { program } = require('commander');
+program.version('0.0.1');
+```
+
+For larger programs which may use commander in multiple ways, including unit testing, it is better to create a local Command object to use.
+
+```js
+const { Command } = require('commander');
+const program = new Command();
+program.version('0.0.1');
+```
+
+## Options
+
+Options are defined with the `.option()` method, also serving as documentation for the options. Each option can have a short flag (single character) and a long name, separated by a comma or space or vertical bar ('|').
+
+The options can be accessed as properties on the Command object. Multi-word options such as "--template-engine" are camel-cased, becoming `program.templateEngine` etc. See also optional new behaviour to [avoid name clashes](#avoiding-option-name-clashes).
+
+Multiple short flags may optionally be combined in a single argument following the dash: boolean flags, followed by a single option taking a value (possibly followed by the value).
+For example `-a -b -p 80` may be written as `-ab -p80` or even `-abp80`.
+
+You can use `--` to indicate the end of the options, and any remaining arguments will be used without being interpreted.
+
+Options on the command line are not positional, and can be specified before or after other arguments.
+
+### Common option types, boolean and value
+
+The two most used option types are a boolean option, and an option which takes its value
+from the following argument (declared with angle brackets like `--expect `). Both are `undefined` unless specified on command line.
+
+Example file: [options-common.js](./examples/options-common.js)
+
+```js
+program
+ .option('-d, --debug', 'output extra debugging')
+ .option('-s, --small', 'small pizza size')
+ .option('-p, --pizza-type ', 'flavour of pizza');
+
+program.parse(process.argv);
+
+if (program.debug) console.log(program.opts());
+console.log('pizza details:');
+if (program.small) console.log('- small pizza size');
+if (program.pizzaType) console.log(`- ${program.pizzaType}`);
+```
+
+```bash
+$ pizza-options -d
+{ debug: true, small: undefined, pizzaType: undefined }
+pizza details:
+$ pizza-options -p
+error: option '-p, --pizza-type ' argument missing
+$ pizza-options -ds -p vegetarian
+{ debug: true, small: true, pizzaType: 'vegetarian' }
+pizza details:
+- small pizza size
+- vegetarian
+$ pizza-options --pizza-type=cheese
+pizza details:
+- cheese
+```
+
+`program.parse(arguments)` processes the arguments, leaving any args not consumed by the program options in the `program.args` array.
+
+### Default option value
+
+You can specify a default value for an option which takes a value.
+
+Example file: [options-defaults.js](./examples/options-defaults.js)
+
+```js
+program
+ .option('-c, --cheese ', 'add the specified type of cheese', 'blue');
+
+program.parse(process.argv);
+
+console.log(`cheese: ${program.cheese}`);
+```
+
+```bash
+$ pizza-options
+cheese: blue
+$ pizza-options --cheese stilton
+cheese: stilton
+```
+
+### Other option types, negatable boolean and boolean|value
+
+You can define a boolean option long name with a leading `no-` to set the option value to false when used.
+Defined alone this also makes the option true by default.
+
+If you define `--foo` first, adding `--no-foo` does not change the default value from what it would
+otherwise be. You can specify a default boolean value for a boolean option and it can be overridden on command line.
+
+Example file: [options-negatable.js](./examples/options-negatable.js)
+
+```js
+program
+ .option('--no-sauce', 'Remove sauce')
+ .option('--cheese ', 'cheese flavour', 'mozzarella')
+ .option('--no-cheese', 'plain with no cheese')
+ .parse(process.argv);
+
+const sauceStr = program.sauce ? 'sauce' : 'no sauce';
+const cheeseStr = (program.cheese === false) ? 'no cheese' : `${program.cheese} cheese`;
+console.log(`You ordered a pizza with ${sauceStr} and ${cheeseStr}`);
+```
+
+```bash
+$ pizza-options
+You ordered a pizza with sauce and mozzarella cheese
+$ pizza-options --sauce
+error: unknown option '--sauce'
+$ pizza-options --cheese=blue
+You ordered a pizza with sauce and blue cheese
+$ pizza-options --no-sauce --no-cheese
+You ordered a pizza with no sauce and no cheese
+```
+
+You can specify an option which may be used as a boolean option but may optionally take an option-argument
+(declared with square brackets like `--optional [value]`).
+
+Example file: [options-boolean-or-value.js](./examples/options-boolean-or-value.js)
+
+```js
+program
+ .option('-c, --cheese [type]', 'Add cheese with optional type');
+
+program.parse(process.argv);
+
+if (program.cheese === undefined) console.log('no cheese');
+else if (program.cheese === true) console.log('add cheese');
+else console.log(`add cheese type ${program.cheese}`);
+```
+
+```bash
+$ pizza-options
+no cheese
+$ pizza-options --cheese
+add cheese
+$ pizza-options --cheese mozzarella
+add cheese type mozzarella
+```
+
+For information about possible ambiguous cases, see [options taking varying arguments](./docs/options-taking-varying-arguments.md).
+
+### Custom option processing
+
+You may specify a function to do custom processing of option-arguments. The callback function receives two parameters,
+the user specified option-argument and the previous value for the option. It returns the new value for the option.
+
+This allows you to coerce the option-argument to the desired type, or accumulate values, or do entirely custom processing.
+
+You can optionally specify the default/starting value for the option after the function parameter.
+
+Example file: [options-custom-processing.js](./examples/options-custom-processing.js)
+
+```js
+function myParseInt(value, dummyPrevious) {
+ // parseInt takes a string and an optional radix
+ return parseInt(value);
+}
+
+function increaseVerbosity(dummyValue, previous) {
+ return previous + 1;
+}
+
+function collect(value, previous) {
+ return previous.concat([value]);
+}
+
+function commaSeparatedList(value, dummyPrevious) {
+ return value.split(',');
+}
+
+program
+ .option('-f, --float ', 'float argument', parseFloat)
+ .option('-i, --integer ', 'integer argument', myParseInt)
+ .option('-v, --verbose', 'verbosity that can be increased', increaseVerbosity, 0)
+ .option('-c, --collect ', 'repeatable value', collect, [])
+ .option('-l, --list ', 'comma separated list', commaSeparatedList)
+;
+
+program.parse(process.argv);
+
+if (program.float !== undefined) console.log(`float: ${program.float}`);
+if (program.integer !== undefined) console.log(`integer: ${program.integer}`);
+if (program.verbose > 0) console.log(`verbosity: ${program.verbose}`);
+if (program.collect.length > 0) console.log(program.collect);
+if (program.list !== undefined) console.log(program.list);
+```
+
+```bash
+$ custom -f 1e2
+float: 100
+$ custom --integer 2
+integer: 2
+$ custom -v -v -v
+verbose: 3
+$ custom -c a -c b -c c
+[ 'a', 'b', 'c' ]
+$ custom --list x,y,z
+[ 'x', 'y', 'z' ]
+```
+
+### Required option
+
+You may specify a required (mandatory) option using `.requiredOption`. The option must have a value after parsing, usually specified on the command line, or perhaps from a default value (say from environment). The method is otherwise the same as `.option` in format, taking flags and description, and optional default value or custom processing.
+
+Example file: [options-required.js](./examples/options-required.js)
+
+```js
+program
+ .requiredOption('-c, --cheese ', 'pizza must have cheese');
+
+program.parse(process.argv);
+```
+
+```bash
+$ pizza
+error: required option '-c, --cheese ' not specified
+```
+
+### Variadic option
+
+You may make an option variadic by appending `...` to the value placeholder when declaring the option. On the command line you
+can then specify multiple option-arguments, and the parsed option value will be an array. The extra arguments
+are read until the first argument starting with a dash. The special argument `--` stops option processing entirely. If a value
+is specified in the same argument as the option then no further values are read.
+
+Example file: [options-variadic.js](./examples/options-variadic.js)
+
+```js
+program
+ .option('-n, --number ', 'specify numbers')
+ .option('-l, --letter [letters...]', 'specify letters');
+
+program.parse();
+
+console.log('Options: ', program.opts());
+console.log('Remaining arguments: ', program.args);
+```
+
+```bash
+$ collect -n 1 2 3 --letter a b c
+Options: { number: [ '1', '2', '3' ], letter: [ 'a', 'b', 'c' ] }
+Remaining arguments: []
+$ collect --letter=A -n80 operand
+Options: { number: [ '80' ], letter: [ 'A' ] }
+Remaining arguments: [ 'operand' ]
+$ collect --letter -n 1 -n 2 3 -- operand
+Options: { number: [ '1', '2', '3' ], letter: true }
+Remaining arguments: [ 'operand' ]
+```
+
+For information about possible ambiguous cases, see [options taking varying arguments](./docs/options-taking-varying-arguments.md).
+
+### Version option
+
+The optional `version` method adds handling for displaying the command version. The default option flags are `-V` and `--version`, and when present the command prints the version number and exits.
+
+```js
+program.version('0.0.1');
+```
+
+```bash
+$ ./examples/pizza -V
+0.0.1
+```
+
+You may change the flags and description by passing additional parameters to the `version` method, using
+the same syntax for flags as the `option` method.
+
+```js
+program.version('0.0.1', '-v, --vers', 'output the current version');
+```
+
+## Commands
+
+You can specify (sub)commands using `.command()` or `.addCommand()`. There are two ways these can be implemented: using an action handler attached to the command, or as a stand-alone executable file (described in more detail later). The subcommands may be nested ([example](./examples/nestedCommands.js)).
+
+In the first parameter to `.command()` you specify the command name and any command-arguments. The arguments may be `` or `[optional]`, and the last argument may also be `variadic...`.
+
+You can use `.addCommand()` to add an already configured subcommand to the program.
+
+For example:
+
+```js
+// Command implemented using action handler (description is supplied separately to `.command`)
+// Returns new command for configuring.
+program
+ .command('clone [destination]')
+ .description('clone a repository into a newly created directory')
+ .action((source, destination) => {
+ console.log('clone command called');
+ });
+
+// Command implemented using stand-alone executable file (description is second parameter to `.command`)
+// Returns `this` for adding more commands.
+program
+ .command('start ', 'start named service')
+ .command('stop [service]', 'stop named service, or all if no name supplied');
+
+// Command prepared separately.
+// Returns `this` for adding more commands.
+program
+ .addCommand(build.makeBuildCommand());
+```
+
+Configuration options can be passed with the call to `.command()` and `.addCommand()`. Specifying `hidden: true` will
+remove the command from the generated help output. Specifying `isDefault: true` will run the subcommand if no other
+subcommand is specified ([example](./examples/defaultCommand.js)).
+
+### Specify the argument syntax
+
+You use `.arguments` to specify the expected command-arguments for the top-level command, and for subcommands they are usually
+included in the `.command` call. Angled brackets (e.g. ``) indicate required command-arguments.
+Square brackets (e.g. `[optional]`) indicate optional command-arguments.
+You can optionally describe the arguments in the help by supplying a hash as second parameter to `.description()`.
+
+Example file: [env](./examples/env)
+
+```js
+program
+ .version('0.1.0')
+ .arguments(' [env]')
+ .description('test command', {
+ cmd: 'command to run',
+ env: 'environment to run test in'
+ })
+ .action(function (cmd, env) {
+ console.log('command:', cmd);
+ console.log('environment:', env || 'no environment given');
+ });
+
+program.parse(process.argv);
+```
+
+ The last argument of a command can be variadic, and only the last argument. To make an argument variadic you
+ append `...` to the argument name. For example:
+
+```js
+const { program } = require('commander');
+
+program
+ .version('0.1.0')
+ .command('rmdir [otherDirs...]')
+ .action(function (dir, otherDirs) {
+ console.log('rmdir %s', dir);
+ if (otherDirs) {
+ otherDirs.forEach(function (oDir) {
+ console.log('rmdir %s', oDir);
+ });
+ }
+ });
+
+program.parse(process.argv);
+```
+
+The variadic argument is passed to the action handler as an array.
+
+### Action handler (sub)commands
+
+You can add options to a command that uses an action handler.
+The action handler gets passed a parameter for each argument you declared, and one additional argument which is the
+command object itself. This command argument has the values for the command-specific options added as properties.
+
+```js
+const { program } = require('commander');
+
+program
+ .command('rm ')
+ .option('-r, --recursive', 'Remove recursively')
+ .action(function (dir, cmdObj) {
+ console.log('remove ' + dir + (cmdObj.recursive ? ' recursively' : ''))
+ })
+
+program.parse(process.argv)
+```
+
+You may supply an `async` action handler, in which case you call `.parseAsync` rather than `.parse`.
+
+```js
+async function run() { /* code goes here */ }
+
+async function main() {
+ program
+ .command('run')
+ .action(run);
+ await program.parseAsync(process.argv);
+}
+```
+
+A command's options on the command line are validated when the command is used. Any unknown options will be reported as an error.
+
+### Stand-alone executable (sub)commands
+
+When `.command()` is invoked with a description argument, this tells Commander that you're going to use stand-alone executables for subcommands.
+Commander will search the executables in the directory of the entry script (like `./examples/pm`) with the name `program-subcommand`, like `pm-install`, `pm-search`.
+You can specify a custom name with the `executableFile` configuration option.
+
+You handle the options for an executable (sub)command in the executable, and don't declare them at the top-level.
+
+Example file: [pm](./examples/pm)
+
+```js
+program
+ .version('0.1.0')
+ .command('install [name]', 'install one or more packages')
+ .command('search [query]', 'search with optional query')
+ .command('update', 'update installed packages', { executableFile: 'myUpdateSubCommand' })
+ .command('list', 'list packages installed', { isDefault: true });
+
+program.parse(process.argv);
+```
+
+If the program is designed to be installed globally, make sure the executables have proper modes, like `755`.
+
+## Automated help
+
+The help information is auto-generated based on the information commander already knows about your program. The default
+help option is `-h,--help`.
+
+Example file: [pizza](./examples/pizza)
+
+```bash
+$ node ./examples/pizza --help
+Usage: pizza [options]
+
+An application for pizzas ordering
+
+Options:
+ -V, --version output the version number
+ -p, --peppers Add peppers
+ -c, --cheese Add the specified type of cheese (default: "marble")
+ -C, --no-cheese You do not want any cheese
+ -h, --help display help for command
+```
+
+A `help` command is added by default if your command has subcommands. It can be used alone, or with a subcommand name to show
+further help for the subcommand. These are effectively the same if the `shell` program has implicit help:
+
+```bash
+shell help
+shell --help
+
+shell help spawn
+shell spawn --help
+```
+
+### Custom help
+
+You can display extra information by listening for "--help".
+
+Example file: [custom-help](./examples/custom-help)
+
+```js
+program
+ .option('-f, --foo', 'enable some foo');
+
+// must be before .parse()
+program.on('--help', () => {
+ console.log('');
+ console.log('Example call:');
+ console.log(' $ custom-help --help');
+});
+```
+
+Yields the following help output:
+
+```Text
+Usage: custom-help [options]
+
+Options:
+ -f, --foo enable some foo
+ -h, --help display help for command
+
+Example call:
+ $ custom-help --help
+```
+
+### .usage and .name
+
+These allow you to customise the usage description in the first line of the help. The name is otherwise
+deduced from the (full) program arguments. Given:
+
+```js
+program
+ .name("my-command")
+ .usage("[global options] command")
+```
+
+The help will start with:
+
+```Text
+Usage: my-command [global options] command
+```
+
+### .help(cb)
+
+Output help information and exit immediately. Optional callback cb allows post-processing of help text before it is displayed.
+
+### .outputHelp(cb)
+
+Output help information without exiting.
+Optional callback cb allows post-processing of help text before it is displayed.
+
+### .helpInformation()
+
+Get the command help information as a string for processing or displaying yourself. (The text does not include the custom help
+from `--help` listeners.)
+
+### .helpOption(flags, description)
+
+Override the default help flags and description. Pass false to disable the built-in help option.
+
+```js
+program
+ .helpOption('-e, --HELP', 'read more information');
+```
+
+### .addHelpCommand()
+
+You can explicitly turn on or off the implicit help command with `.addHelpCommand()` and `.addHelpCommand(false)`.
+
+You can both turn on and customise the help command by supplying the name and description:
+
+```js
+program.addHelpCommand('assist [command]', 'show assistance');
+```
+
+## Custom event listeners
+
+You can execute custom actions by listening to command and option events.
+
+```js
+program.on('option:verbose', function () {
+ process.env.VERBOSE = this.verbose;
+});
+
+program.on('command:*', function (operands) {
+ console.error(`error: unknown command '${operands[0]}'`);
+ const availableCommands = program.commands.map(cmd => cmd.name());
+ mySuggestBestMatch(operands[0], availableCommands);
+ process.exitCode = 1;
+});
+```
+
+## Bits and pieces
+
+### .parse() and .parseAsync()
+
+The first argument to `.parse` is the array of strings to parse. You may omit the parameter to implicitly use `process.argv`.
+
+If the arguments follow different conventions than node you can pass a `from` option in the second parameter:
+
+- 'node': default, `argv[0]` is the application and `argv[1]` is the script being run, with user parameters after that
+- 'electron': `argv[1]` varies depending on whether the electron application is packaged
+- 'user': all of the arguments from the user
+
+For example:
+
+```js
+program.parse(process.argv); // Explicit, node conventions
+program.parse(); // Implicit, and auto-detect electron
+program.parse(['-f', 'filename'], { from: 'user' });
+```
+
+### Avoiding option name clashes
+
+The original and default behaviour is that the option values are stored
+as properties on the program, and the action handler is passed a
+command object with the options values stored as properties.
+This is very convenient to code, but the downside is possible clashes with
+existing properties of Command.
+
+There are two new routines to change the behaviour, and the default behaviour may change in the future:
+
+- `storeOptionsAsProperties`: whether to store option values as properties on command object, or store separately (specify false) and access using `.opts()`
+- `passCommandToAction`: whether to pass command to action handler,
+or just the options (specify false)
+
+Example file: [storeOptionsAsProperties-action.js](./examples/storeOptionsAsProperties-action.js)
+
+```js
+program
+ .storeOptionsAsProperties(false)
+ .passCommandToAction(false);
+
+program
+ .name('my-program-name')
+ .option('-n,--name ');
+
+program
+ .command('show')
+ .option('-a,--action ')
+ .action((options) => {
+ console.log(options.action);
+ });
+
+program.parse(process.argv);
+
+const programOptions = program.opts();
+console.log(programOptions.name);
+```
+
+### TypeScript
+
+The Commander package includes its TypeScript Definition file.
+
+If you use `ts-node` and stand-alone executable subcommands written as `.ts` files, you need to call your program through node to get the subcommands called correctly. e.g.
+
+```bash
+node -r ts-node/register pm.ts
+```
+
+### createCommand()
+
+This factory function creates a new command. It is exported and may be used instead of using `new`, like:
+
+```js
+const { createCommand } = require('commander');
+const program = createCommand();
+```
+
+`createCommand` is also a method of the Command object, and creates a new command rather than a subcommand. This gets used internally
+when creating subcommands using `.command()`, and you may override it to
+customise the new subcommand (examples using [subclass](./examples/custom-command-class.js) and [function](./examples/custom-command-function.js)).
+
+### Import into ECMAScript Module
+
+Commander is currently a CommonJS package, and the default export can be imported into an ES Module:
+
+```js
+// index.mjs
+import commander from 'commander';
+const program = commander.program;
+const newCommand = new commander.Command();
+```
+
+### Node options such as `--harmony`
+
+You can enable `--harmony` option in two ways:
+
+- Use `#! /usr/bin/env node --harmony` in the subcommands scripts. (Note Windows does not support this pattern.)
+- Use the `--harmony` option when call the command, like `node --harmony examples/pm publish`. The `--harmony` option will be preserved when spawning subcommand process.
+
+### Debugging stand-alone executable subcommands
+
+An executable subcommand is launched as a separate child process.
+
+If you are using the node inspector for [debugging](https://nodejs.org/en/docs/guides/debugging-getting-started/) executable subcommands using `node --inspect` et al,
+the inspector port is incremented by 1 for the spawned subcommand.
+
+If you are using VSCode to debug executable subcommands you need to set the `"autoAttachChildProcesses": true` flag in your launch.json configuration.
+
+### Override exit handling
+
+By default Commander calls `process.exit` when it detects errors, or after displaying the help or version. You can override
+this behaviour and optionally supply a callback. The default override throws a `CommanderError`.
+
+The override callback is passed a `CommanderError` with properties `exitCode` number, `code` string, and `message`. The default override behaviour is to throw the error, except for async handling of executable subcommand completion which carries on. The normal display of error messages or version or help
+is not affected by the override which is called after the display.
+
+```js
+program.exitOverride();
+
+try {
+ program.parse(process.argv);
+} catch (err) {
+ // custom processing...
+}
+```
+
+## Examples
+
+Example file: [deploy](./examples/deploy)
+
+```js
+const { program } = require('commander');
+
+program
+ .version('0.1.0')
+ .option('-C, --chdir ', 'change the working directory')
+ .option('-c, --config ', 'set config path. defaults to ./deploy.conf')
+ .option('-T, --no-tests', 'ignore test hook');
+
+program
+ .command('setup [env]')
+ .description('run setup commands for all envs')
+ .option("-s, --setup_mode [mode]", "Which setup mode to use")
+ .action(function(env, options){
+ const mode = options.setup_mode || "normal";
+ env = env || 'all';
+ console.log('setup for %s env(s) with %s mode', env, mode);
+ });
+
+program
+ .command('exec ')
+ .alias('ex')
+ .description('execute the given remote cmd')
+ .option("-e, --exec_mode ", "Which exec mode to use")
+ .action(function(cmd, options){
+ console.log('exec "%s" using %s mode', cmd, options.exec_mode);
+ }).on('--help', function() {
+ console.log('');
+ console.log('Examples:');
+ console.log('');
+ console.log(' $ deploy exec sequential');
+ console.log(' $ deploy exec async');
+ });
+
+program.parse(process.argv);
+```
+
+More Demos can be found in the [examples](https://github.com/tj/commander.js/tree/master/examples) directory.
+
+## Support
+
+The current version of Commander is fully supported on Long Term Support versions of Node, and is likely to work with Node 6 but not tested.
+(For versions of Node below Node 6, use Commander 3.x or 2.x.)
+
+The main forum for free and community support is the project [Issues](https://github.com/tj/commander.js/issues) on GitHub.
+
+### Commander for enterprise
+
+Available as part of the Tidelift Subscription
+
+The maintainers of Commander and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-commander?utm_source=npm-commander&utm_medium=referral&utm_campaign=enterprise&utm_term=repo)
diff --git a/temporary_modules/trezor-connect/node_modules/commander/index.js b/temporary_modules/trezor-connect/node_modules/commander/index.js
new file mode 100644
index 00000000..c85f7255
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/commander/index.js
@@ -0,0 +1,1881 @@
+/**
+ * Module dependencies.
+ */
+
+const EventEmitter = require('events').EventEmitter;
+const spawn = require('child_process').spawn;
+const path = require('path');
+const fs = require('fs');
+
+// @ts-check
+
+class Option {
+ /**
+ * Initialize a new `Option` with the given `flags` and `description`.
+ *
+ * @param {string} flags
+ * @param {string} description
+ * @api public
+ */
+
+ constructor(flags, description) {
+ this.flags = flags;
+ this.required = flags.includes('<'); // A value must be supplied when the option is specified.
+ this.optional = flags.includes('['); // A value is optional when the option is specified.
+ // variadic test ignores et al which might be used to describe custom splitting of single argument
+ this.variadic = /\w\.\.\.[>\]]$/.test(flags); // The option can take multiple values.
+ this.mandatory = false; // The option must have a value after parsing, which usually means it must be specified on command line.
+ const optionFlags = _parseOptionFlags(flags);
+ this.short = optionFlags.shortFlag;
+ this.long = optionFlags.longFlag;
+ this.negate = false;
+ if (this.long) {
+ this.negate = this.long.startsWith('--no-');
+ }
+ this.description = description || '';
+ this.defaultValue = undefined;
+ }
+
+ /**
+ * Return option name.
+ *
+ * @return {string}
+ * @api private
+ */
+
+ name() {
+ if (this.long) {
+ return this.long.replace(/^--/, '');
+ }
+ return this.short.replace(/^-/, '');
+ };
+
+ /**
+ * Return option name, in a camelcase format that can be used
+ * as a object attribute key.
+ *
+ * @return {string}
+ * @api private
+ */
+
+ attributeName() {
+ return camelcase(this.name().replace(/^no-/, ''));
+ };
+
+ /**
+ * Check if `arg` matches the short or long flag.
+ *
+ * @param {string} arg
+ * @return {boolean}
+ * @api private
+ */
+
+ is(arg) {
+ return this.short === arg || this.long === arg;
+ };
+}
+
+/**
+ * CommanderError class
+ * @class
+ */
+class CommanderError extends Error {
+ /**
+ * Constructs the CommanderError class
+ * @param {number} exitCode suggested exit code which could be used with process.exit
+ * @param {string} code an id string representing the error
+ * @param {string} message human-readable description of the error
+ * @constructor
+ */
+ constructor(exitCode, code, message) {
+ super(message);
+ // properly capture stack trace in Node.js
+ Error.captureStackTrace(this, this.constructor);
+ this.name = this.constructor.name;
+ this.code = code;
+ this.exitCode = exitCode;
+ this.nestedError = undefined;
+ }
+}
+
+class Command extends EventEmitter {
+ /**
+ * Initialize a new `Command`.
+ *
+ * @param {string} [name]
+ * @api public
+ */
+
+ constructor(name) {
+ super();
+ this.commands = [];
+ this.options = [];
+ this.parent = null;
+ this._allowUnknownOption = false;
+ this._args = [];
+ this.rawArgs = null;
+ this._scriptPath = null;
+ this._name = name || '';
+ this._optionValues = {};
+ this._storeOptionsAsProperties = true; // backwards compatible by default
+ this._storeOptionsAsPropertiesCalled = false;
+ this._passCommandToAction = true; // backwards compatible by default
+ this._actionResults = [];
+ this._actionHandler = null;
+ this._executableHandler = false;
+ this._executableFile = null; // custom name for executable
+ this._defaultCommandName = null;
+ this._exitCallback = null;
+ this._aliases = [];
+ this._combineFlagAndOptionalValue = true;
+
+ this._hidden = false;
+ this._hasHelpOption = true;
+ this._helpFlags = '-h, --help';
+ this._helpDescription = 'display help for command';
+ this._helpShortFlag = '-h';
+ this._helpLongFlag = '--help';
+ this._hasImplicitHelpCommand = undefined; // Deliberately undefined, not decided whether true or false
+ this._helpCommandName = 'help';
+ this._helpCommandnameAndArgs = 'help [command]';
+ this._helpCommandDescription = 'display help for command';
+ }
+
+ /**
+ * Define a command.
+ *
+ * There are two styles of command: pay attention to where to put the description.
+ *
+ * Examples:
+ *
+ * // Command implemented using action handler (description is supplied separately to `.command`)
+ * program
+ * .command('clone [destination]')
+ * .description('clone a repository into a newly created directory')
+ * .action((source, destination) => {
+ * console.log('clone command called');
+ * });
+ *
+ * // Command implemented using separate executable file (description is second parameter to `.command`)
+ * program
+ * .command('start ', 'start named service')
+ * .command('stop [service]', 'stop named service, or all if no name supplied');
+ *
+ * @param {string} nameAndArgs - command name and arguments, args are `` or `[optional]` and last may also be `variadic...`
+ * @param {Object|string} [actionOptsOrExecDesc] - configuration options (for action), or description (for executable)
+ * @param {Object} [execOpts] - configuration options (for executable)
+ * @return {Command} returns new command for action handler, or `this` for executable command
+ * @api public
+ */
+
+ command(nameAndArgs, actionOptsOrExecDesc, execOpts) {
+ let desc = actionOptsOrExecDesc;
+ let opts = execOpts;
+ if (typeof desc === 'object' && desc !== null) {
+ opts = desc;
+ desc = null;
+ }
+ opts = opts || {};
+ const args = nameAndArgs.split(/ +/);
+ const cmd = this.createCommand(args.shift());
+
+ if (desc) {
+ cmd.description(desc);
+ cmd._executableHandler = true;
+ }
+ if (opts.isDefault) this._defaultCommandName = cmd._name;
+
+ cmd._hidden = !!(opts.noHelp || opts.hidden);
+ cmd._hasHelpOption = this._hasHelpOption;
+ cmd._helpFlags = this._helpFlags;
+ cmd._helpDescription = this._helpDescription;
+ cmd._helpShortFlag = this._helpShortFlag;
+ cmd._helpLongFlag = this._helpLongFlag;
+ cmd._helpCommandName = this._helpCommandName;
+ cmd._helpCommandnameAndArgs = this._helpCommandnameAndArgs;
+ cmd._helpCommandDescription = this._helpCommandDescription;
+ cmd._exitCallback = this._exitCallback;
+ cmd._storeOptionsAsProperties = this._storeOptionsAsProperties;
+ cmd._passCommandToAction = this._passCommandToAction;
+ cmd._combineFlagAndOptionalValue = this._combineFlagAndOptionalValue;
+
+ cmd._executableFile = opts.executableFile || null; // Custom name for executable file, set missing to null to match constructor
+ this.commands.push(cmd);
+ cmd._parseExpectedArgs(args);
+ cmd.parent = this;
+
+ if (desc) return this;
+ return cmd;
+ };
+
+ /**
+ * Factory routine to create a new unattached command.
+ *
+ * See .command() for creating an attached subcommand, which uses this routine to
+ * create the command. You can override createCommand to customise subcommands.
+ *
+ * @param {string} [name]
+ * @return {Command} new command
+ * @api public
+ */
+
+ createCommand(name) {
+ return new Command(name);
+ };
+
+ /**
+ * Add a prepared subcommand.
+ *
+ * See .command() for creating an attached subcommand which inherits settings from its parent.
+ *
+ * @param {Command} cmd - new subcommand
+ * @param {Object} [opts] - configuration options
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ addCommand(cmd, opts) {
+ if (!cmd._name) throw new Error('Command passed to .addCommand() must have a name');
+
+ // To keep things simple, block automatic name generation for deeply nested executables.
+ // Fail fast and detect when adding rather than later when parsing.
+ function checkExplicitNames(commandArray) {
+ commandArray.forEach((cmd) => {
+ if (cmd._executableHandler && !cmd._executableFile) {
+ throw new Error(`Must specify executableFile for deeply nested executable: ${cmd.name()}`);
+ }
+ checkExplicitNames(cmd.commands);
+ });
+ }
+ checkExplicitNames(cmd.commands);
+
+ opts = opts || {};
+ if (opts.isDefault) this._defaultCommandName = cmd._name;
+ if (opts.noHelp || opts.hidden) cmd._hidden = true; // modifying passed command due to existing implementation
+
+ this.commands.push(cmd);
+ cmd.parent = this;
+ return this;
+ };
+
+ /**
+ * Define argument syntax for the command.
+ *
+ * @api public
+ */
+
+ arguments(desc) {
+ return this._parseExpectedArgs(desc.split(/ +/));
+ };
+
+ /**
+ * Override default decision whether to add implicit help command.
+ *
+ * addHelpCommand() // force on
+ * addHelpCommand(false); // force off
+ * addHelpCommand('help [cmd]', 'display help for [cmd]'); // force on with custom details
+ *
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ addHelpCommand(enableOrNameAndArgs, description) {
+ if (enableOrNameAndArgs === false) {
+ this._hasImplicitHelpCommand = false;
+ } else {
+ this._hasImplicitHelpCommand = true;
+ if (typeof enableOrNameAndArgs === 'string') {
+ this._helpCommandName = enableOrNameAndArgs.split(' ')[0];
+ this._helpCommandnameAndArgs = enableOrNameAndArgs;
+ }
+ this._helpCommandDescription = description || this._helpCommandDescription;
+ }
+ return this;
+ };
+
+ /**
+ * @return {boolean}
+ * @api private
+ */
+
+ _lazyHasImplicitHelpCommand() {
+ if (this._hasImplicitHelpCommand === undefined) {
+ this._hasImplicitHelpCommand = this.commands.length && !this._actionHandler && !this._findCommand('help');
+ }
+ return this._hasImplicitHelpCommand;
+ };
+
+ /**
+ * Parse expected `args`.
+ *
+ * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`.
+ *
+ * @param {Array} args
+ * @return {Command} `this` command for chaining
+ * @api private
+ */
+
+ _parseExpectedArgs(args) {
+ if (!args.length) return;
+ args.forEach((arg) => {
+ const argDetails = {
+ required: false,
+ name: '',
+ variadic: false
+ };
+
+ switch (arg[0]) {
+ case '<':
+ argDetails.required = true;
+ argDetails.name = arg.slice(1, -1);
+ break;
+ case '[':
+ argDetails.name = arg.slice(1, -1);
+ break;
+ }
+
+ if (argDetails.name.length > 3 && argDetails.name.slice(-3) === '...') {
+ argDetails.variadic = true;
+ argDetails.name = argDetails.name.slice(0, -3);
+ }
+ if (argDetails.name) {
+ this._args.push(argDetails);
+ }
+ });
+ this._args.forEach((arg, i) => {
+ if (arg.variadic && i < this._args.length - 1) {
+ throw new Error(`only the last argument can be variadic '${arg.name}'`);
+ }
+ });
+ return this;
+ };
+
+ /**
+ * Register callback to use as replacement for calling process.exit.
+ *
+ * @param {Function} [fn] optional callback which will be passed a CommanderError, defaults to throwing
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ exitOverride(fn) {
+ if (fn) {
+ this._exitCallback = fn;
+ } else {
+ this._exitCallback = (err) => {
+ if (err.code !== 'commander.executeSubCommandAsync') {
+ throw err;
+ } else {
+ // Async callback from spawn events, not useful to throw.
+ }
+ };
+ }
+ return this;
+ };
+
+ /**
+ * Call process.exit, and _exitCallback if defined.
+ *
+ * @param {number} exitCode exit code for using with process.exit
+ * @param {string} code an id string representing the error
+ * @param {string} message human-readable description of the error
+ * @return never
+ * @api private
+ */
+
+ _exit(exitCode, code, message) {
+ if (this._exitCallback) {
+ this._exitCallback(new CommanderError(exitCode, code, message));
+ // Expecting this line is not reached.
+ }
+ process.exit(exitCode);
+ };
+
+ /**
+ * Register callback `fn` for the command.
+ *
+ * Examples:
+ *
+ * program
+ * .command('help')
+ * .description('display verbose help')
+ * .action(function() {
+ * // output help here
+ * });
+ *
+ * @param {Function} fn
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ action(fn) {
+ const listener = (args) => {
+ // The .action callback takes an extra parameter which is the command or options.
+ const expectedArgsCount = this._args.length;
+ const actionArgs = args.slice(0, expectedArgsCount);
+ if (this._passCommandToAction) {
+ actionArgs[expectedArgsCount] = this;
+ } else {
+ actionArgs[expectedArgsCount] = this.opts();
+ }
+ // Add the extra arguments so available too.
+ if (args.length > expectedArgsCount) {
+ actionArgs.push(args.slice(expectedArgsCount));
+ }
+
+ const actionResult = fn.apply(this, actionArgs);
+ // Remember result in case it is async. Assume parseAsync getting called on root.
+ let rootCommand = this;
+ while (rootCommand.parent) {
+ rootCommand = rootCommand.parent;
+ }
+ rootCommand._actionResults.push(actionResult);
+ };
+ this._actionHandler = listener;
+ return this;
+ };
+
+ /**
+ * Internal routine to check whether there is a clash storing option value with a Command property.
+ *
+ * @param {Option} option
+ * @api private
+ */
+
+ _checkForOptionNameClash(option) {
+ if (!this._storeOptionsAsProperties || this._storeOptionsAsPropertiesCalled) {
+ // Storing options safely, or user has been explicit and up to them.
+ return;
+ }
+ // User may override help, and hard to tell if worth warning.
+ if (option.name() === 'help') {
+ return;
+ }
+
+ const commandProperty = this._getOptionValue(option.attributeName());
+ if (commandProperty === undefined) {
+ // no clash
+ return;
+ }
+
+ let foundClash = true;
+ if (option.negate) {
+ // It is ok if define foo before --no-foo.
+ const positiveLongFlag = option.long.replace(/^--no-/, '--');
+ foundClash = !this._findOption(positiveLongFlag);
+ } else if (option.long) {
+ const negativeLongFlag = option.long.replace(/^--/, '--no-');
+ foundClash = !this._findOption(negativeLongFlag);
+ }
+
+ if (foundClash) {
+ throw new Error(`option '${option.name()}' clashes with existing property '${option.attributeName()}' on Command
+- call storeOptionsAsProperties(false) to store option values safely,
+- or call storeOptionsAsProperties(true) to suppress this check,
+- or change option name
+
+Read more on https://git.io/JJc0W`);
+ }
+ };
+
+ /**
+ * Internal implementation shared by .option() and .requiredOption()
+ *
+ * @param {Object} config
+ * @param {string} flags
+ * @param {string} description
+ * @param {Function|*} [fn] - custom option processing function or default value
+ * @param {*} [defaultValue]
+ * @return {Command} `this` command for chaining
+ * @api private
+ */
+
+ _optionEx(config, flags, description, fn, defaultValue) {
+ const option = new Option(flags, description);
+ const oname = option.name();
+ const name = option.attributeName();
+ option.mandatory = !!config.mandatory;
+
+ this._checkForOptionNameClash(option);
+
+ // default as 3rd arg
+ if (typeof fn !== 'function') {
+ if (fn instanceof RegExp) {
+ // This is a bit simplistic (especially no error messages), and probably better handled by caller using custom option processing.
+ // No longer documented in README, but still present for backwards compatibility.
+ const regex = fn;
+ fn = (val, def) => {
+ const m = regex.exec(val);
+ return m ? m[0] : def;
+ };
+ } else {
+ defaultValue = fn;
+ fn = null;
+ }
+ }
+
+ // preassign default value for --no-*, [optional], , or plain flag if boolean value
+ if (option.negate || option.optional || option.required || typeof defaultValue === 'boolean') {
+ // when --no-foo we make sure default is true, unless a --foo option is already defined
+ if (option.negate) {
+ const positiveLongFlag = option.long.replace(/^--no-/, '--');
+ defaultValue = this._findOption(positiveLongFlag) ? this._getOptionValue(name) : true;
+ }
+ // preassign only if we have a default
+ if (defaultValue !== undefined) {
+ this._setOptionValue(name, defaultValue);
+ option.defaultValue = defaultValue;
+ }
+ }
+
+ // register the option
+ this.options.push(option);
+
+ // when it's passed assign the value
+ // and conditionally invoke the callback
+ this.on('option:' + oname, (val) => {
+ const oldValue = this._getOptionValue(name);
+
+ // custom processing
+ if (val !== null && fn) {
+ val = fn(val, oldValue === undefined ? defaultValue : oldValue);
+ } else if (val !== null && option.variadic) {
+ if (oldValue === defaultValue || !Array.isArray(oldValue)) {
+ val = [val];
+ } else {
+ val = oldValue.concat(val);
+ }
+ }
+
+ // unassigned or boolean value
+ if (typeof oldValue === 'boolean' || typeof oldValue === 'undefined') {
+ // if no value, negate false, and we have a default, then use it!
+ if (val == null) {
+ this._setOptionValue(name, option.negate
+ ? false
+ : defaultValue || true);
+ } else {
+ this._setOptionValue(name, val);
+ }
+ } else if (val !== null) {
+ // reassign
+ this._setOptionValue(name, option.negate ? false : val);
+ }
+ });
+
+ return this;
+ };
+
+ /**
+ * Define option with `flags`, `description` and optional
+ * coercion `fn`.
+ *
+ * The `flags` string should contain both the short and long flags,
+ * separated by comma, a pipe or space. The following are all valid
+ * all will output this way when `--help` is used.
+ *
+ * "-p, --pepper"
+ * "-p|--pepper"
+ * "-p --pepper"
+ *
+ * Examples:
+ *
+ * // simple boolean defaulting to undefined
+ * program.option('-p, --pepper', 'add pepper');
+ *
+ * program.pepper
+ * // => undefined
+ *
+ * --pepper
+ * program.pepper
+ * // => true
+ *
+ * // simple boolean defaulting to true (unless non-negated option is also defined)
+ * program.option('-C, --no-cheese', 'remove cheese');
+ *
+ * program.cheese
+ * // => true
+ *
+ * --no-cheese
+ * program.cheese
+ * // => false
+ *
+ * // required argument
+ * program.option('-C, --chdir ', 'change the working directory');
+ *
+ * --chdir /tmp
+ * program.chdir
+ * // => "/tmp"
+ *
+ * // optional argument
+ * program.option('-c, --cheese [type]', 'add cheese [marble]');
+ *
+ * @param {string} flags
+ * @param {string} description
+ * @param {Function|*} [fn] - custom option processing function or default value
+ * @param {*} [defaultValue]
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ option(flags, description, fn, defaultValue) {
+ return this._optionEx({}, flags, description, fn, defaultValue);
+ };
+
+ /**
+ * Add a required option which must have a value after parsing. This usually means
+ * the option must be specified on the command line. (Otherwise the same as .option().)
+ *
+ * The `flags` string should contain both the short and long flags, separated by comma, a pipe or space.
+ *
+ * @param {string} flags
+ * @param {string} description
+ * @param {Function|*} [fn] - custom option processing function or default value
+ * @param {*} [defaultValue]
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ requiredOption(flags, description, fn, defaultValue) {
+ return this._optionEx({ mandatory: true }, flags, description, fn, defaultValue);
+ };
+
+ /**
+ * Alter parsing of short flags with optional values.
+ *
+ * Examples:
+ *
+ * // for `.option('-f,--flag [value]'):
+ * .combineFlagAndOptionalValue(true) // `-f80` is treated like `--flag=80`, this is the default behaviour
+ * .combineFlagAndOptionalValue(false) // `-fb` is treated like `-f -b`
+ *
+ * @param {Boolean} [arg] - if `true` or omitted, an optional value can be specified directly after the flag.
+ * @api public
+ */
+ combineFlagAndOptionalValue(arg) {
+ this._combineFlagAndOptionalValue = (arg === undefined) || arg;
+ return this;
+ };
+
+ /**
+ * Allow unknown options on the command line.
+ *
+ * @param {Boolean} [arg] - if `true` or omitted, no error will be thrown
+ * for unknown options.
+ * @api public
+ */
+ allowUnknownOption(arg) {
+ this._allowUnknownOption = (arg === undefined) || arg;
+ return this;
+ };
+
+ /**
+ * Whether to store option values as properties on command object,
+ * or store separately (specify false). In both cases the option values can be accessed using .opts().
+ *
+ * @param {boolean} value
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ storeOptionsAsProperties(value) {
+ this._storeOptionsAsPropertiesCalled = true;
+ this._storeOptionsAsProperties = (value === undefined) || value;
+ if (this.options.length) {
+ throw new Error('call .storeOptionsAsProperties() before adding options');
+ }
+ return this;
+ };
+
+ /**
+ * Whether to pass command to action handler,
+ * or just the options (specify false).
+ *
+ * @param {boolean} value
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ passCommandToAction(value) {
+ this._passCommandToAction = (value === undefined) || value;
+ return this;
+ };
+
+ /**
+ * Store option value
+ *
+ * @param {string} key
+ * @param {Object} value
+ * @api private
+ */
+
+ _setOptionValue(key, value) {
+ if (this._storeOptionsAsProperties) {
+ this[key] = value;
+ } else {
+ this._optionValues[key] = value;
+ }
+ };
+
+ /**
+ * Retrieve option value
+ *
+ * @param {string} key
+ * @return {Object} value
+ * @api private
+ */
+
+ _getOptionValue(key) {
+ if (this._storeOptionsAsProperties) {
+ return this[key];
+ }
+ return this._optionValues[key];
+ };
+
+ /**
+ * Parse `argv`, setting options and invoking commands when defined.
+ *
+ * The default expectation is that the arguments are from node and have the application as argv[0]
+ * and the script being run in argv[1], with user parameters after that.
+ *
+ * Examples:
+ *
+ * program.parse(process.argv);
+ * program.parse(); // implicitly use process.argv and auto-detect node vs electron conventions
+ * program.parse(my-args, { from: 'user' }); // just user supplied arguments, nothing special about argv[0]
+ *
+ * @param {string[]} [argv] - optional, defaults to process.argv
+ * @param {Object} [parseOptions] - optionally specify style of options with from: node/user/electron
+ * @param {string} [parseOptions.from] - where the args are from: 'node', 'user', 'electron'
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ parse(argv, parseOptions) {
+ if (argv !== undefined && !Array.isArray(argv)) {
+ throw new Error('first parameter to parse must be array or undefined');
+ }
+ parseOptions = parseOptions || {};
+
+ // Default to using process.argv
+ if (argv === undefined) {
+ argv = process.argv;
+ // @ts-ignore
+ if (process.versions && process.versions.electron) {
+ parseOptions.from = 'electron';
+ }
+ }
+ this.rawArgs = argv.slice();
+
+ // make it a little easier for callers by supporting various argv conventions
+ let userArgs;
+ switch (parseOptions.from) {
+ case undefined:
+ case 'node':
+ this._scriptPath = argv[1];
+ userArgs = argv.slice(2);
+ break;
+ case 'electron':
+ // @ts-ignore
+ if (process.defaultApp) {
+ this._scriptPath = argv[1];
+ userArgs = argv.slice(2);
+ } else {
+ userArgs = argv.slice(1);
+ }
+ break;
+ case 'user':
+ userArgs = argv.slice(0);
+ break;
+ default:
+ throw new Error(`unexpected parse option { from: '${parseOptions.from}' }`);
+ }
+ if (!this._scriptPath && process.mainModule) {
+ this._scriptPath = process.mainModule.filename;
+ }
+
+ // Guess name, used in usage in help.
+ this._name = this._name || (this._scriptPath && path.basename(this._scriptPath, path.extname(this._scriptPath)));
+
+ // Let's go!
+ this._parseCommand([], userArgs);
+
+ return this;
+ };
+
+ /**
+ * Parse `argv`, setting options and invoking commands when defined.
+ *
+ * Use parseAsync instead of parse if any of your action handlers are async. Returns a Promise.
+ *
+ * The default expectation is that the arguments are from node and have the application as argv[0]
+ * and the script being run in argv[1], with user parameters after that.
+ *
+ * Examples:
+ *
+ * program.parseAsync(process.argv);
+ * program.parseAsync(); // implicitly use process.argv and auto-detect node vs electron conventions
+ * program.parseAsync(my-args, { from: 'user' }); // just user supplied arguments, nothing special about argv[0]
+ *
+ * @param {string[]} [argv]
+ * @param {Object} [parseOptions]
+ * @param {string} parseOptions.from - where the args are from: 'node', 'user', 'electron'
+ * @return {Promise}
+ * @api public
+ */
+
+ parseAsync(argv, parseOptions) {
+ this.parse(argv, parseOptions);
+ return Promise.all(this._actionResults).then(() => this);
+ };
+
+ /**
+ * Execute a sub-command executable.
+ *
+ * @api private
+ */
+
+ _executeSubCommand(subcommand, args) {
+ args = args.slice();
+ let launchWithNode = false; // Use node for source targets so do not need to get permissions correct, and on Windows.
+ const sourceExt = ['.js', '.ts', '.tsx', '.mjs'];
+
+ // Not checking for help first. Unlikely to have mandatory and executable, and can't robustly test for help flags in external command.
+ this._checkForMissingMandatoryOptions();
+
+ // Want the entry script as the reference for command name and directory for searching for other files.
+ let scriptPath = this._scriptPath;
+ // Fallback in case not set, due to how Command created or called.
+ if (!scriptPath && process.mainModule) {
+ scriptPath = process.mainModule.filename;
+ }
+
+ let baseDir;
+ try {
+ const resolvedLink = fs.realpathSync(scriptPath);
+ baseDir = path.dirname(resolvedLink);
+ } catch (e) {
+ baseDir = '.'; // dummy, probably not going to find executable!
+ }
+
+ // name of the subcommand, like `pm-install`
+ let bin = path.basename(scriptPath, path.extname(scriptPath)) + '-' + subcommand._name;
+ if (subcommand._executableFile) {
+ bin = subcommand._executableFile;
+ }
+
+ const localBin = path.join(baseDir, bin);
+ if (fs.existsSync(localBin)) {
+ // prefer local `./` to bin in the $PATH
+ bin = localBin;
+ } else {
+ // Look for source files.
+ sourceExt.forEach((ext) => {
+ if (fs.existsSync(`${localBin}${ext}`)) {
+ bin = `${localBin}${ext}`;
+ }
+ });
+ }
+ launchWithNode = sourceExt.includes(path.extname(bin));
+
+ let proc;
+ if (process.platform !== 'win32') {
+ if (launchWithNode) {
+ args.unshift(bin);
+ // add executable arguments to spawn
+ args = incrementNodeInspectorPort(process.execArgv).concat(args);
+
+ proc = spawn(process.argv[0], args, { stdio: 'inherit' });
+ } else {
+ proc = spawn(bin, args, { stdio: 'inherit' });
+ }
+ } else {
+ args.unshift(bin);
+ // add executable arguments to spawn
+ args = incrementNodeInspectorPort(process.execArgv).concat(args);
+ proc = spawn(process.execPath, args, { stdio: 'inherit' });
+ }
+
+ const signals = ['SIGUSR1', 'SIGUSR2', 'SIGTERM', 'SIGINT', 'SIGHUP'];
+ signals.forEach((signal) => {
+ // @ts-ignore
+ process.on(signal, () => {
+ if (proc.killed === false && proc.exitCode === null) {
+ proc.kill(signal);
+ }
+ });
+ });
+
+ // By default terminate process when spawned process terminates.
+ // Suppressing the exit if exitCallback defined is a bit messy and of limited use, but does allow process to stay running!
+ const exitCallback = this._exitCallback;
+ if (!exitCallback) {
+ proc.on('close', process.exit.bind(process));
+ } else {
+ proc.on('close', () => {
+ exitCallback(new CommanderError(process.exitCode || 0, 'commander.executeSubCommandAsync', '(close)'));
+ });
+ }
+ proc.on('error', (err) => {
+ // @ts-ignore
+ if (err.code === 'ENOENT') {
+ const executableMissing = `'${bin}' does not exist
+ - if '${subcommand._name}' is not meant to be an executable command, remove description parameter from '.command()' and use '.description()' instead
+ - if the default executable name is not suitable, use the executableFile option to supply a custom name`;
+ throw new Error(executableMissing);
+ // @ts-ignore
+ } else if (err.code === 'EACCES') {
+ throw new Error(`'${bin}' not executable`);
+ }
+ if (!exitCallback) {
+ process.exit(1);
+ } else {
+ const wrappedError = new CommanderError(1, 'commander.executeSubCommandAsync', '(error)');
+ wrappedError.nestedError = err;
+ exitCallback(wrappedError);
+ }
+ });
+
+ // Store the reference to the child process
+ this.runningCommand = proc;
+ };
+
+ /**
+ * @api private
+ */
+ _dispatchSubcommand(commandName, operands, unknown) {
+ const subCommand = this._findCommand(commandName);
+ if (!subCommand) this._helpAndError();
+
+ if (subCommand._executableHandler) {
+ this._executeSubCommand(subCommand, operands.concat(unknown));
+ } else {
+ subCommand._parseCommand(operands, unknown);
+ }
+ };
+
+ /**
+ * Process arguments in context of this command.
+ *
+ * @api private
+ */
+
+ _parseCommand(operands, unknown) {
+ const parsed = this.parseOptions(unknown);
+ operands = operands.concat(parsed.operands);
+ unknown = parsed.unknown;
+ this.args = operands.concat(unknown);
+
+ if (operands && this._findCommand(operands[0])) {
+ this._dispatchSubcommand(operands[0], operands.slice(1), unknown);
+ } else if (this._lazyHasImplicitHelpCommand() && operands[0] === this._helpCommandName) {
+ if (operands.length === 1) {
+ this.help();
+ } else {
+ this._dispatchSubcommand(operands[1], [], [this._helpLongFlag]);
+ }
+ } else if (this._defaultCommandName) {
+ outputHelpIfRequested(this, unknown); // Run the help for default command from parent rather than passing to default command
+ this._dispatchSubcommand(this._defaultCommandName, operands, unknown);
+ } else {
+ if (this.commands.length && this.args.length === 0 && !this._actionHandler && !this._defaultCommandName) {
+ // probably missing subcommand and no handler, user needs help
+ this._helpAndError();
+ }
+
+ outputHelpIfRequested(this, parsed.unknown);
+ this._checkForMissingMandatoryOptions();
+ if (parsed.unknown.length > 0) {
+ this.unknownOption(parsed.unknown[0]);
+ }
+
+ if (this._actionHandler) {
+ const args = this.args.slice();
+ this._args.forEach((arg, i) => {
+ if (arg.required && args[i] == null) {
+ this.missingArgument(arg.name);
+ } else if (arg.variadic) {
+ args[i] = args.splice(i);
+ }
+ });
+
+ this._actionHandler(args);
+ this.emit('command:' + this.name(), operands, unknown);
+ } else if (operands.length) {
+ if (this._findCommand('*')) {
+ this._dispatchSubcommand('*', operands, unknown);
+ } else if (this.listenerCount('command:*')) {
+ this.emit('command:*', operands, unknown);
+ } else if (this.commands.length) {
+ this.unknownCommand();
+ }
+ } else if (this.commands.length) {
+ // This command has subcommands and nothing hooked up at this level, so display help.
+ this._helpAndError();
+ } else {
+ // fall through for caller to handle after calling .parse()
+ }
+ }
+ };
+
+ /**
+ * Find matching command.
+ *
+ * @api private
+ */
+ _findCommand(name) {
+ if (!name) return undefined;
+ return this.commands.find(cmd => cmd._name === name || cmd._aliases.includes(name));
+ };
+
+ /**
+ * Return an option matching `arg` if any.
+ *
+ * @param {string} arg
+ * @return {Option}
+ * @api private
+ */
+
+ _findOption(arg) {
+ return this.options.find(option => option.is(arg));
+ };
+
+ /**
+ * Display an error message if a mandatory option does not have a value.
+ * Lazy calling after checking for help flags from leaf subcommand.
+ *
+ * @api private
+ */
+
+ _checkForMissingMandatoryOptions() {
+ // Walk up hierarchy so can call in subcommand after checking for displaying help.
+ for (let cmd = this; cmd; cmd = cmd.parent) {
+ cmd.options.forEach((anOption) => {
+ if (anOption.mandatory && (cmd._getOptionValue(anOption.attributeName()) === undefined)) {
+ cmd.missingMandatoryOptionValue(anOption);
+ }
+ });
+ }
+ };
+
+ /**
+ * Parse options from `argv` removing known options,
+ * and return argv split into operands and unknown arguments.
+ *
+ * Examples:
+ *
+ * argv => operands, unknown
+ * --known kkk op => [op], []
+ * op --known kkk => [op], []
+ * sub --unknown uuu op => [sub], [--unknown uuu op]
+ * sub -- --unknown uuu op => [sub --unknown uuu op], []
+ *
+ * @param {String[]} argv
+ * @return {{operands: String[], unknown: String[]}}
+ * @api public
+ */
+
+ parseOptions(argv) {
+ const operands = []; // operands, not options or values
+ const unknown = []; // first unknown option and remaining unknown args
+ let dest = operands;
+ const args = argv.slice();
+
+ function maybeOption(arg) {
+ return arg.length > 1 && arg[0] === '-';
+ }
+
+ // parse options
+ let activeVariadicOption = null;
+ while (args.length) {
+ const arg = args.shift();
+
+ // literal
+ if (arg === '--') {
+ if (dest === unknown) dest.push(arg);
+ dest.push(...args);
+ break;
+ }
+
+ if (activeVariadicOption && !maybeOption(arg)) {
+ this.emit(`option:${activeVariadicOption.name()}`, arg);
+ continue;
+ }
+ activeVariadicOption = null;
+
+ if (maybeOption(arg)) {
+ const option = this._findOption(arg);
+ // recognised option, call listener to assign value with possible custom processing
+ if (option) {
+ if (option.required) {
+ const value = args.shift();
+ if (value === undefined) this.optionMissingArgument(option);
+ this.emit(`option:${option.name()}`, value);
+ } else if (option.optional) {
+ let value = null;
+ // historical behaviour is optional value is following arg unless an option
+ if (args.length > 0 && !maybeOption(args[0])) {
+ value = args.shift();
+ }
+ this.emit(`option:${option.name()}`, value);
+ } else { // boolean flag
+ this.emit(`option:${option.name()}`);
+ }
+ activeVariadicOption = option.variadic ? option : null;
+ continue;
+ }
+ }
+
+ // Look for combo options following single dash, eat first one if known.
+ if (arg.length > 2 && arg[0] === '-' && arg[1] !== '-') {
+ const option = this._findOption(`-${arg[1]}`);
+ if (option) {
+ if (option.required || (option.optional && this._combineFlagAndOptionalValue)) {
+ // option with value following in same argument
+ this.emit(`option:${option.name()}`, arg.slice(2));
+ } else {
+ // boolean option, emit and put back remainder of arg for further processing
+ this.emit(`option:${option.name()}`);
+ args.unshift(`-${arg.slice(2)}`);
+ }
+ continue;
+ }
+ }
+
+ // Look for known long flag with value, like --foo=bar
+ if (/^--[^=]+=/.test(arg)) {
+ const index = arg.indexOf('=');
+ const option = this._findOption(arg.slice(0, index));
+ if (option && (option.required || option.optional)) {
+ this.emit(`option:${option.name()}`, arg.slice(index + 1));
+ continue;
+ }
+ }
+
+ // looks like an option but unknown, unknowns from here
+ if (arg.length > 1 && arg[0] === '-') {
+ dest = unknown;
+ }
+
+ // add arg
+ dest.push(arg);
+ }
+
+ return { operands, unknown };
+ };
+
+ /**
+ * Return an object containing options as key-value pairs
+ *
+ * @return {Object}
+ * @api public
+ */
+ opts() {
+ if (this._storeOptionsAsProperties) {
+ // Preserve original behaviour so backwards compatible when still using properties
+ const result = {};
+ const len = this.options.length;
+
+ for (let i = 0; i < len; i++) {
+ const key = this.options[i].attributeName();
+ result[key] = key === this._versionOptionName ? this._version : this[key];
+ }
+ return result;
+ }
+
+ return this._optionValues;
+ };
+
+ /**
+ * Argument `name` is missing.
+ *
+ * @param {string} name
+ * @api private
+ */
+
+ missingArgument(name) {
+ const message = `error: missing required argument '${name}'`;
+ console.error(message);
+ this._exit(1, 'commander.missingArgument', message);
+ };
+
+ /**
+ * `Option` is missing an argument, but received `flag` or nothing.
+ *
+ * @param {Option} option
+ * @param {string} [flag]
+ * @api private
+ */
+
+ optionMissingArgument(option, flag) {
+ let message;
+ if (flag) {
+ message = `error: option '${option.flags}' argument missing, got '${flag}'`;
+ } else {
+ message = `error: option '${option.flags}' argument missing`;
+ }
+ console.error(message);
+ this._exit(1, 'commander.optionMissingArgument', message);
+ };
+
+ /**
+ * `Option` does not have a value, and is a mandatory option.
+ *
+ * @param {Option} option
+ * @api private
+ */
+
+ missingMandatoryOptionValue(option) {
+ const message = `error: required option '${option.flags}' not specified`;
+ console.error(message);
+ this._exit(1, 'commander.missingMandatoryOptionValue', message);
+ };
+
+ /**
+ * Unknown option `flag`.
+ *
+ * @param {string} flag
+ * @api private
+ */
+
+ unknownOption(flag) {
+ if (this._allowUnknownOption) return;
+ const message = `error: unknown option '${flag}'`;
+ console.error(message);
+ this._exit(1, 'commander.unknownOption', message);
+ };
+
+ /**
+ * Unknown command.
+ *
+ * @api private
+ */
+
+ unknownCommand() {
+ const partCommands = [this.name()];
+ for (let parentCmd = this.parent; parentCmd; parentCmd = parentCmd.parent) {
+ partCommands.unshift(parentCmd.name());
+ }
+ const fullCommand = partCommands.join(' ');
+ const message = `error: unknown command '${this.args[0]}'.` +
+ (this._hasHelpOption ? ` See '${fullCommand} ${this._helpLongFlag}'.` : '');
+ console.error(message);
+ this._exit(1, 'commander.unknownCommand', message);
+ };
+
+ /**
+ * Set the program version to `str`.
+ *
+ * This method auto-registers the "-V, --version" flag
+ * which will print the version number when passed.
+ *
+ * You can optionally supply the flags and description to override the defaults.
+ *
+ * @param {string} str
+ * @param {string} [flags]
+ * @param {string} [description]
+ * @return {this | string} `this` command for chaining, or version string if no arguments
+ * @api public
+ */
+
+ version(str, flags, description) {
+ if (str === undefined) return this._version;
+ this._version = str;
+ flags = flags || '-V, --version';
+ description = description || 'output the version number';
+ const versionOption = new Option(flags, description);
+ this._versionOptionName = versionOption.attributeName();
+ this.options.push(versionOption);
+ this.on('option:' + versionOption.name(), () => {
+ process.stdout.write(str + '\n');
+ this._exit(0, 'commander.version', str);
+ });
+ return this;
+ };
+
+ /**
+ * Set the description to `str`.
+ *
+ * @param {string} str
+ * @param {Object} [argsDescription]
+ * @return {string|Command}
+ * @api public
+ */
+
+ description(str, argsDescription) {
+ if (str === undefined && argsDescription === undefined) return this._description;
+ this._description = str;
+ this._argsDescription = argsDescription;
+ return this;
+ };
+
+ /**
+ * Set an alias for the command.
+ *
+ * You may call more than once to add multiple aliases. Only the first alias is shown in the auto-generated help.
+ *
+ * @param {string} [alias]
+ * @return {string|Command}
+ * @api public
+ */
+
+ alias(alias) {
+ if (alias === undefined) return this._aliases[0]; // just return first, for backwards compatibility
+
+ let command = this;
+ if (this.commands.length !== 0 && this.commands[this.commands.length - 1]._executableHandler) {
+ // assume adding alias for last added executable subcommand, rather than this
+ command = this.commands[this.commands.length - 1];
+ }
+
+ if (alias === command._name) throw new Error('Command alias can\'t be the same as its name');
+
+ command._aliases.push(alias);
+ return this;
+ };
+
+ /**
+ * Set aliases for the command.
+ *
+ * Only the first alias is shown in the auto-generated help.
+ *
+ * @param {string[]} [aliases]
+ * @return {string[]|Command}
+ * @api public
+ */
+
+ aliases(aliases) {
+ // Getter for the array of aliases is the main reason for having aliases() in addition to alias().
+ if (aliases === undefined) return this._aliases;
+
+ aliases.forEach((alias) => this.alias(alias));
+ return this;
+ };
+
+ /**
+ * Set / get the command usage `str`.
+ *
+ * @param {string} [str]
+ * @return {String|Command}
+ * @api public
+ */
+
+ usage(str) {
+ if (str === undefined) {
+ if (this._usage) return this._usage;
+
+ const args = this._args.map((arg) => {
+ return humanReadableArgName(arg);
+ });
+ return [].concat(
+ (this.options.length || this._hasHelpOption ? '[options]' : []),
+ (this.commands.length ? '[command]' : []),
+ (this._args.length ? args : [])
+ ).join(' ');
+ }
+
+ this._usage = str;
+ return this;
+ };
+
+ /**
+ * Get or set the name of the command
+ *
+ * @param {string} [str]
+ * @return {String|Command}
+ * @api public
+ */
+
+ name(str) {
+ if (str === undefined) return this._name;
+ this._name = str;
+ return this;
+ };
+
+ /**
+ * Return prepared commands.
+ *
+ * @return {Array}
+ * @api private
+ */
+
+ prepareCommands() {
+ const commandDetails = this.commands.filter((cmd) => {
+ return !cmd._hidden;
+ }).map((cmd) => {
+ const args = cmd._args.map((arg) => {
+ return humanReadableArgName(arg);
+ }).join(' ');
+
+ return [
+ cmd._name +
+ (cmd._aliases[0] ? '|' + cmd._aliases[0] : '') +
+ (cmd.options.length ? ' [options]' : '') +
+ (args ? ' ' + args : ''),
+ cmd._description
+ ];
+ });
+
+ if (this._lazyHasImplicitHelpCommand()) {
+ commandDetails.push([this._helpCommandnameAndArgs, this._helpCommandDescription]);
+ }
+ return commandDetails;
+ };
+
+ /**
+ * Return the largest command length.
+ *
+ * @return {number}
+ * @api private
+ */
+
+ largestCommandLength() {
+ const commands = this.prepareCommands();
+ return commands.reduce((max, command) => {
+ return Math.max(max, command[0].length);
+ }, 0);
+ };
+
+ /**
+ * Return the largest option length.
+ *
+ * @return {number}
+ * @api private
+ */
+
+ largestOptionLength() {
+ const options = [].slice.call(this.options);
+ options.push({
+ flags: this._helpFlags
+ });
+
+ return options.reduce((max, option) => {
+ return Math.max(max, option.flags.length);
+ }, 0);
+ };
+
+ /**
+ * Return the largest arg length.
+ *
+ * @return {number}
+ * @api private
+ */
+
+ largestArgLength() {
+ return this._args.reduce((max, arg) => {
+ return Math.max(max, arg.name.length);
+ }, 0);
+ };
+
+ /**
+ * Return the pad width.
+ *
+ * @return {number}
+ * @api private
+ */
+
+ padWidth() {
+ let width = this.largestOptionLength();
+ if (this._argsDescription && this._args.length) {
+ if (this.largestArgLength() > width) {
+ width = this.largestArgLength();
+ }
+ }
+
+ if (this.commands && this.commands.length) {
+ if (this.largestCommandLength() > width) {
+ width = this.largestCommandLength();
+ }
+ }
+
+ return width;
+ };
+
+ /**
+ * Return help for options.
+ *
+ * @return {string}
+ * @api private
+ */
+
+ optionHelp() {
+ const width = this.padWidth();
+ const columns = process.stdout.columns || 80;
+ const descriptionWidth = columns - width - 4;
+ function padOptionDetails(flags, description) {
+ return pad(flags, width) + ' ' + optionalWrap(description, descriptionWidth, width + 2);
+ };
+
+ // Explicit options (including version)
+ const help = this.options.map((option) => {
+ const fullDesc = option.description +
+ ((!option.negate && option.defaultValue !== undefined) ? ' (default: ' + JSON.stringify(option.defaultValue) + ')' : '');
+ return padOptionDetails(option.flags, fullDesc);
+ });
+
+ // Implicit help
+ const showShortHelpFlag = this._hasHelpOption && this._helpShortFlag && !this._findOption(this._helpShortFlag);
+ const showLongHelpFlag = this._hasHelpOption && !this._findOption(this._helpLongFlag);
+ if (showShortHelpFlag || showLongHelpFlag) {
+ let helpFlags = this._helpFlags;
+ if (!showShortHelpFlag) {
+ helpFlags = this._helpLongFlag;
+ } else if (!showLongHelpFlag) {
+ helpFlags = this._helpShortFlag;
+ }
+ help.push(padOptionDetails(helpFlags, this._helpDescription));
+ }
+
+ return help.join('\n');
+ };
+
+ /**
+ * Return command help documentation.
+ *
+ * @return {string}
+ * @api private
+ */
+
+ commandHelp() {
+ if (!this.commands.length && !this._lazyHasImplicitHelpCommand()) return '';
+
+ const commands = this.prepareCommands();
+ const width = this.padWidth();
+
+ const columns = process.stdout.columns || 80;
+ const descriptionWidth = columns - width - 4;
+
+ return [
+ 'Commands:',
+ commands.map((cmd) => {
+ const desc = cmd[1] ? ' ' + cmd[1] : '';
+ return (desc ? pad(cmd[0], width) : cmd[0]) + optionalWrap(desc, descriptionWidth, width + 2);
+ }).join('\n').replace(/^/gm, ' '),
+ ''
+ ].join('\n');
+ };
+
+ /**
+ * Return program help documentation.
+ *
+ * @return {string}
+ * @api public
+ */
+
+ helpInformation() {
+ let desc = [];
+ if (this._description) {
+ desc = [
+ this._description,
+ ''
+ ];
+
+ const argsDescription = this._argsDescription;
+ if (argsDescription && this._args.length) {
+ const width = this.padWidth();
+ const columns = process.stdout.columns || 80;
+ const descriptionWidth = columns - width - 5;
+ desc.push('Arguments:');
+ this._args.forEach((arg) => {
+ desc.push(' ' + pad(arg.name, width) + ' ' + wrap(argsDescription[arg.name] || '', descriptionWidth, width + 4));
+ });
+ desc.push('');
+ }
+ }
+
+ let cmdName = this._name;
+ if (this._aliases[0]) {
+ cmdName = cmdName + '|' + this._aliases[0];
+ }
+ let parentCmdNames = '';
+ for (let parentCmd = this.parent; parentCmd; parentCmd = parentCmd.parent) {
+ parentCmdNames = parentCmd.name() + ' ' + parentCmdNames;
+ }
+ const usage = [
+ 'Usage: ' + parentCmdNames + cmdName + ' ' + this.usage(),
+ ''
+ ];
+
+ let cmds = [];
+ const commandHelp = this.commandHelp();
+ if (commandHelp) cmds = [commandHelp];
+
+ let options = [];
+ if (this._hasHelpOption || this.options.length > 0) {
+ options = [
+ 'Options:',
+ '' + this.optionHelp().replace(/^/gm, ' '),
+ ''
+ ];
+ }
+
+ return usage
+ .concat(desc)
+ .concat(options)
+ .concat(cmds)
+ .join('\n');
+ };
+
+ /**
+ * Output help information for this command.
+ *
+ * When listener(s) are available for the helpLongFlag
+ * those callbacks are invoked.
+ *
+ * @api public
+ */
+
+ outputHelp(cb) {
+ if (!cb) {
+ cb = (passthru) => {
+ return passthru;
+ };
+ }
+ const cbOutput = cb(this.helpInformation());
+ if (typeof cbOutput !== 'string' && !Buffer.isBuffer(cbOutput)) {
+ throw new Error('outputHelp callback must return a string or a Buffer');
+ }
+ process.stdout.write(cbOutput);
+ this.emit(this._helpLongFlag);
+ };
+
+ /**
+ * You can pass in flags and a description to override the help
+ * flags and help description for your command. Pass in false to
+ * disable the built-in help option.
+ *
+ * @param {string | boolean} [flags]
+ * @param {string} [description]
+ * @return {Command} `this` command for chaining
+ * @api public
+ */
+
+ helpOption(flags, description) {
+ if (typeof flags === 'boolean') {
+ this._hasHelpOption = flags;
+ return this;
+ }
+ this._helpFlags = flags || this._helpFlags;
+ this._helpDescription = description || this._helpDescription;
+
+ const helpFlags = _parseOptionFlags(this._helpFlags);
+ this._helpShortFlag = helpFlags.shortFlag;
+ this._helpLongFlag = helpFlags.longFlag;
+
+ return this;
+ };
+
+ /**
+ * Output help information and exit.
+ *
+ * @param {Function} [cb]
+ * @api public
+ */
+
+ help(cb) {
+ this.outputHelp(cb);
+ // exitCode: preserving original behaviour which was calling process.exit()
+ // message: do not have all displayed text available so only passing placeholder.
+ this._exit(process.exitCode || 0, 'commander.help', '(outputHelp)');
+ };
+
+ /**
+ * Output help information and exit. Display for error situations.
+ *
+ * @api private
+ */
+
+ _helpAndError() {
+ this.outputHelp();
+ // message: do not have all displayed text available so only passing placeholder.
+ this._exit(1, 'commander.help', '(outputHelp)');
+ };
+};
+
+/**
+ * Expose the root command.
+ */
+
+exports = module.exports = new Command();
+exports.program = exports; // More explicit access to global command.
+
+/**
+ * Expose classes
+ */
+
+exports.Command = Command;
+exports.Option = Option;
+exports.CommanderError = CommanderError;
+
+/**
+ * Camel-case the given `flag`
+ *
+ * @param {string} flag
+ * @return {string}
+ * @api private
+ */
+
+function camelcase(flag) {
+ return flag.split('-').reduce((str, word) => {
+ return str + word[0].toUpperCase() + word.slice(1);
+ });
+}
+
+/**
+ * Pad `str` to `width`.
+ *
+ * @param {string} str
+ * @param {number} width
+ * @return {string}
+ * @api private
+ */
+
+function pad(str, width) {
+ const len = Math.max(0, width - str.length);
+ return str + Array(len + 1).join(' ');
+}
+
+/**
+ * Wraps the given string with line breaks at the specified width while breaking
+ * words and indenting every but the first line on the left.
+ *
+ * @param {string} str
+ * @param {number} width
+ * @param {number} indent
+ * @return {string}
+ * @api private
+ */
+function wrap(str, width, indent) {
+ const regex = new RegExp('.{1,' + (width - 1) + '}([\\s\u200B]|$)|[^\\s\u200B]+?([\\s\u200B]|$)', 'g');
+ const lines = str.match(regex) || [];
+ return lines.map((line, i) => {
+ if (line.slice(-1) === '\n') {
+ line = line.slice(0, line.length - 1);
+ }
+ return ((i > 0 && indent) ? Array(indent + 1).join(' ') : '') + line.trimRight();
+ }).join('\n');
+}
+
+/**
+ * Optionally wrap the given str to a max width of width characters per line
+ * while indenting with indent spaces. Do not wrap if insufficient width or
+ * string is manually formatted.
+ *
+ * @param {string} str
+ * @param {number} width
+ * @param {number} indent
+ * @return {string}
+ * @api private
+ */
+function optionalWrap(str, width, indent) {
+ // Detect manually wrapped and indented strings by searching for line breaks
+ // followed by multiple spaces/tabs.
+ if (str.match(/[\n]\s+/)) return str;
+ // Do not wrap to narrow columns (or can end up with a word per line).
+ const minWidth = 40;
+ if (width < minWidth) return str;
+
+ return wrap(str, width, indent);
+}
+
+/**
+ * Output help information if help flags specified
+ *
+ * @param {Command} cmd - command to output help for
+ * @param {Array} args - array of options to search for help flags
+ * @api private
+ */
+
+function outputHelpIfRequested(cmd, args) {
+ const helpOption = cmd._hasHelpOption && args.find(arg => arg === cmd._helpLongFlag || arg === cmd._helpShortFlag);
+ if (helpOption) {
+ cmd.outputHelp();
+ // (Do not have all displayed text available so only passing placeholder.)
+ cmd._exit(0, 'commander.helpDisplayed', '(outputHelp)');
+ }
+}
+
+/**
+ * Takes an argument and returns its human readable equivalent for help usage.
+ *
+ * @param {Object} arg
+ * @return {string}
+ * @api private
+ */
+
+function humanReadableArgName(arg) {
+ const nameOutput = arg.name + (arg.variadic === true ? '...' : '');
+
+ return arg.required
+ ? '<' + nameOutput + '>'
+ : '[' + nameOutput + ']';
+}
+
+/**
+ * Parse the short and long flag out of something like '-m,--mixed '
+ *
+ * @api private
+ */
+
+function _parseOptionFlags(flags) {
+ let shortFlag;
+ let longFlag;
+ // Use original very loose parsing to maintain backwards compatibility for now,
+ // which allowed for example unintended `-sw, --short-word` [sic].
+ const flagParts = flags.split(/[ |,]+/);
+ if (flagParts.length > 1 && !/^[[<]/.test(flagParts[1])) shortFlag = flagParts.shift();
+ longFlag = flagParts.shift();
+ // Add support for lone short flag without significantly changing parsing!
+ if (!shortFlag && /^-[^-]$/.test(longFlag)) {
+ shortFlag = longFlag;
+ longFlag = undefined;
+ }
+ return { shortFlag, longFlag };
+}
+
+/**
+ * Scan arguments and increment port number for inspect calls (to avoid conflicts when spawning new command).
+ *
+ * @param {string[]} args - array of arguments from node.execArgv
+ * @returns {string[]}
+ * @api private
+ */
+
+function incrementNodeInspectorPort(args) {
+ // Testing for these options:
+ // --inspect[=[host:]port]
+ // --inspect-brk[=[host:]port]
+ // --inspect-port=[host:]port
+ return args.map((arg) => {
+ if (!arg.startsWith('--inspect')) {
+ return arg;
+ }
+ let debugOption;
+ let debugHost = '127.0.0.1';
+ let debugPort = '9229';
+ let match;
+ if ((match = arg.match(/^(--inspect(-brk)?)$/)) !== null) {
+ // e.g. --inspect
+ debugOption = match[1];
+ } else if ((match = arg.match(/^(--inspect(-brk|-port)?)=([^:]+)$/)) !== null) {
+ debugOption = match[1];
+ if (/^\d+$/.test(match[3])) {
+ // e.g. --inspect=1234
+ debugPort = match[3];
+ } else {
+ // e.g. --inspect=localhost
+ debugHost = match[3];
+ }
+ } else if ((match = arg.match(/^(--inspect(-brk|-port)?)=([^:]+):(\d+)$/)) !== null) {
+ // e.g. --inspect=localhost:1234
+ debugOption = match[1];
+ debugHost = match[3];
+ debugPort = match[4];
+ }
+
+ if (debugOption && debugPort !== '0') {
+ return `${debugOption}=${debugHost}:${parseInt(debugPort) + 1}`;
+ }
+ return arg;
+ });
+}
diff --git a/temporary_modules/trezor-connect/node_modules/commander/package.json b/temporary_modules/trezor-connect/node_modules/commander/package.json
new file mode 100644
index 00000000..69a67b90
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/commander/package.json
@@ -0,0 +1,51 @@
+{
+ "name": "commander",
+ "version": "6.2.1",
+ "description": "the complete solution for node.js command-line programs",
+ "keywords": [
+ "commander",
+ "command",
+ "option",
+ "parser",
+ "cli",
+ "argument",
+ "args",
+ "argv"
+ ],
+ "author": "TJ Holowaychuk ",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/tj/commander.js.git"
+ },
+ "scripts": {
+ "lint": "eslint index.js \"tests/**/*.js\"",
+ "typescript-lint": "eslint typings/*.ts",
+ "test": "jest && npm run test-typings",
+ "test-typings": "tsc -p tsconfig.json"
+ },
+ "main": "index",
+ "files": [
+ "index.js",
+ "typings/index.d.ts"
+ ],
+ "dependencies": {},
+ "devDependencies": {
+ "@types/jest": "^26.0.15",
+ "@types/node": "^14.14.2",
+ "@typescript-eslint/eslint-plugin": "^4.5.0",
+ "eslint": "^7.11.0",
+ "eslint-config-standard-with-typescript": "^19.0.1",
+ "eslint-plugin-jest": "^24.1.0",
+ "jest": "^26.6.0",
+ "standard": "^15.0.0",
+ "typescript": "^4.0.3"
+ },
+ "typings": "typings/index.d.ts",
+ "jest": {
+ "collectCoverage": true
+ },
+ "engines": {
+ "node": ">= 6"
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/commander/typings/index.d.ts b/temporary_modules/trezor-connect/node_modules/commander/typings/index.d.ts
new file mode 100644
index 00000000..479446d3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/commander/typings/index.d.ts
@@ -0,0 +1,410 @@
+// Type definitions for commander
+// Original definitions by: Alan Agius , Marcelo Dezem , vvakame , Jules Randolph
+
+declare namespace commander {
+
+ interface CommanderError extends Error {
+ code: string;
+ exitCode: number;
+ message: string;
+ nestedError?: string;
+ }
+ type CommanderErrorConstructor = new (exitCode: number, code: string, message: string) => CommanderError;
+
+ interface Option {
+ flags: string;
+ required: boolean; // A value must be supplied when the option is specified.
+ optional: boolean; // A value is optional when the option is specified.
+ mandatory: boolean; // The option must have a value after parsing, which usually means it must be specified on command line.
+ bool: boolean;
+ short?: string;
+ long: string;
+ description: string;
+ }
+ type OptionConstructor = new (flags: string, description?: string) => Option;
+
+ interface ParseOptions {
+ from: 'node' | 'electron' | 'user';
+ }
+
+ interface Command {
+ [key: string]: any; // options as properties
+
+ args: string[];
+
+ commands: Command[];
+
+ /**
+ * Set the program version to `str`.
+ *
+ * This method auto-registers the "-V, --version" flag
+ * which will print the version number when passed.
+ *
+ * You can optionally supply the flags and description to override the defaults.
+ */
+ version(str: string, flags?: string, description?: string): this;
+
+ /**
+ * Define a command, implemented using an action handler.
+ *
+ * @remarks
+ * The command description is supplied using `.description`, not as a parameter to `.command`.
+ *
+ * @example
+ * ```ts
+ * program
+ * .command('clone [destination]')
+ * .description('clone a repository into a newly created directory')
+ * .action((source, destination) => {
+ * console.log('clone command called');
+ * });
+ * ```
+ *
+ * @param nameAndArgs - command name and arguments, args are `` or `[optional]` and last may also be `variadic...`
+ * @param opts - configuration options
+ * @returns new command
+ */
+ command(nameAndArgs: string, opts?: CommandOptions): ReturnType;
+ /**
+ * Define a command, implemented in a separate executable file.
+ *
+ * @remarks
+ * The command description is supplied as the second parameter to `.command`.
+ *
+ * @example
+ * ```ts
+ * program
+ * .command('start ', 'start named service')
+ * .command('stop [service]', 'stop named service, or all if no name supplied');
+ * ```
+ *
+ * @param nameAndArgs - command name and arguments, args are `` or `[optional]` and last may also be `variadic...`
+ * @param description - description of executable command
+ * @param opts - configuration options
+ * @returns `this` command for chaining
+ */
+ command(nameAndArgs: string, description: string, opts?: commander.ExecutableCommandOptions): this;
+
+ /**
+ * Factory routine to create a new unattached command.
+ *
+ * See .command() for creating an attached subcommand, which uses this routine to
+ * create the command. You can override createCommand to customise subcommands.
+ */
+ createCommand(name?: string): Command;
+
+ /**
+ * Add a prepared subcommand.
+ *
+ * See .command() for creating an attached subcommand which inherits settings from its parent.
+ *
+ * @returns `this` command for chaining
+ */
+ addCommand(cmd: Command, opts?: CommandOptions): this;
+
+ /**
+ * Define argument syntax for command.
+ *
+ * @returns `this` command for chaining
+ */
+ arguments(desc: string): this;
+
+ /**
+ * Override default decision whether to add implicit help command.
+ *
+ * addHelpCommand() // force on
+ * addHelpCommand(false); // force off
+ * addHelpCommand('help [cmd]', 'display help for [cmd]'); // force on with custom details
+ *
+ * @returns `this` command for chaining
+ */
+ addHelpCommand(enableOrNameAndArgs?: string | boolean, description?: string): this;
+
+ /**
+ * Register callback to use as replacement for calling process.exit.
+ */
+ exitOverride(callback?: (err: CommanderError) => never|void): this;
+
+ /**
+ * Register callback `fn` for the command.
+ *
+ * @example
+ * program
+ * .command('help')
+ * .description('display verbose help')
+ * .action(function() {
+ * // output help here
+ * });
+ *
+ * @returns `this` command for chaining
+ */
+ action(fn: (...args: any[]) => void | Promise): this;
+
+ /**
+ * Define option with `flags`, `description` and optional
+ * coercion `fn`.
+ *
+ * The `flags` string should contain both the short and long flags,
+ * separated by comma, a pipe or space. The following are all valid
+ * all will output this way when `--help` is used.
+ *
+ * "-p, --pepper"
+ * "-p|--pepper"
+ * "-p --pepper"
+ *
+ * @example
+ * // simple boolean defaulting to false
+ * program.option('-p, --pepper', 'add pepper');
+ *
+ * --pepper
+ * program.pepper
+ * // => Boolean
+ *
+ * // simple boolean defaulting to true
+ * program.option('-C, --no-cheese', 'remove cheese');
+ *
+ * program.cheese
+ * // => true
+ *
+ * --no-cheese
+ * program.cheese
+ * // => false
+ *
+ * // required argument
+ * program.option('-C, --chdir ', 'change the working directory');
+ *
+ * --chdir /tmp
+ * program.chdir
+ * // => "/tmp"
+ *
+ * // optional argument
+ * program.option('-c, --cheese [type]', 'add cheese [marble]');
+ *
+ * @returns `this` command for chaining
+ */
+ option(flags: string, description?: string, defaultValue?: string | boolean): this;
+ option(flags: string, description: string, regexp: RegExp, defaultValue?: string | boolean): this;
+ option(flags: string, description: string, fn: (value: string, previous: T) => T, defaultValue?: T): this;
+
+ /**
+ * Define a required option, which must have a value after parsing. This usually means
+ * the option must be specified on the command line. (Otherwise the same as .option().)
+ *
+ * The `flags` string should contain both the short and long flags, separated by comma, a pipe or space.
+ */
+ requiredOption(flags: string, description?: string, defaultValue?: string | boolean): this;
+ requiredOption(flags: string, description: string, regexp: RegExp, defaultValue?: string | boolean): this;
+ requiredOption(flags: string, description: string, fn: (value: string, previous: T) => T, defaultValue?: T): this;
+
+ /**
+ * Whether to store option values as properties on command object,
+ * or store separately (specify false). In both cases the option values can be accessed using .opts().
+ *
+ * @returns `this` command for chaining
+ */
+ storeOptionsAsProperties(value?: boolean): this;
+
+ /**
+ * Whether to pass command to action handler,
+ * or just the options (specify false).
+ *
+ * @returns `this` command for chaining
+ */
+ passCommandToAction(value?: boolean): this;
+
+ /**
+ * Alter parsing of short flags with optional values.
+ *
+ * @example
+ * // for `.option('-f,--flag [value]'):
+ * .combineFlagAndOptionalValue(true) // `-f80` is treated like `--flag=80`, this is the default behaviour
+ * .combineFlagAndOptionalValue(false) // `-fb` is treated like `-f -b`
+ *
+ * @returns `this` command for chaining
+ */
+ combineFlagAndOptionalValue(arg?: boolean): this;
+
+ /**
+ * Allow unknown options on the command line.
+ *
+ * @param [arg] if `true` or omitted, no error will be thrown for unknown options.
+ * @returns `this` command for chaining
+ */
+ allowUnknownOption(arg?: boolean): this;
+
+ /**
+ * Parse `argv`, setting options and invoking commands when defined.
+ *
+ * The default expectation is that the arguments are from node and have the application as argv[0]
+ * and the script being run in argv[1], with user parameters after that.
+ *
+ * Examples:
+ *
+ * program.parse(process.argv);
+ * program.parse(); // implicitly use process.argv and auto-detect node vs electron conventions
+ * program.parse(my-args, { from: 'user' }); // just user supplied arguments, nothing special about argv[0]
+ *
+ * @returns `this` command for chaining
+ */
+ parse(argv?: string[], options?: ParseOptions): this;
+
+ /**
+ * Parse `argv`, setting options and invoking commands when defined.
+ *
+ * Use parseAsync instead of parse if any of your action handlers are async. Returns a Promise.
+ *
+ * The default expectation is that the arguments are from node and have the application as argv[0]
+ * and the script being run in argv[1], with user parameters after that.
+ *
+ * Examples:
+ *
+ * program.parseAsync(process.argv);
+ * program.parseAsync(); // implicitly use process.argv and auto-detect node vs electron conventions
+ * program.parseAsync(my-args, { from: 'user' }); // just user supplied arguments, nothing special about argv[0]
+ *
+ * @returns Promise
+ */
+ parseAsync(argv?: string[], options?: ParseOptions): Promise;
+
+ /**
+ * Parse options from `argv` removing known options,
+ * and return argv split into operands and unknown arguments.
+ *
+ * @example
+ * argv => operands, unknown
+ * --known kkk op => [op], []
+ * op --known kkk => [op], []
+ * sub --unknown uuu op => [sub], [--unknown uuu op]
+ * sub -- --unknown uuu op => [sub --unknown uuu op], []
+ */
+ parseOptions(argv: string[]): commander.ParseOptionsResult;
+
+ /**
+ * Return an object containing options as key-value pairs
+ */
+ opts(): { [key: string]: any };
+
+ /**
+ * Set the description.
+ *
+ * @returns `this` command for chaining
+ */
+ description(str: string, argsDescription?: {[argName: string]: string}): this;
+ /**
+ * Get the description.
+ */
+ description(): string;
+
+ /**
+ * Set an alias for the command.
+ *
+ * You may call more than once to add multiple aliases. Only the first alias is shown in the auto-generated help.
+ *
+ * @returns `this` command for chaining
+ */
+ alias(alias: string): this;
+ /**
+ * Get alias for the command.
+ */
+ alias(): string;
+
+ /**
+ * Set aliases for the command.
+ *
+ * Only the first alias is shown in the auto-generated help.
+ *
+ * @returns `this` command for chaining
+ */
+ aliases(aliases: string[]): this;
+ /**
+ * Get aliases for the command.
+ */
+ aliases(): string[];
+
+ /**
+ * Set the command usage.
+ *
+ * @returns `this` command for chaining
+ */
+ usage(str: string): this;
+ /**
+ * Get the command usage.
+ */
+ usage(): string;
+
+ /**
+ * Set the name of the command.
+ *
+ * @returns `this` command for chaining
+ */
+ name(str: string): this;
+ /**
+ * Get the name of the command.
+ */
+ name(): string;
+
+ /**
+ * Output help information for this command.
+ *
+ * When listener(s) are available for the helpLongFlag
+ * those callbacks are invoked.
+ */
+ outputHelp(cb?: (str: string) => string): void;
+
+ /**
+ * Return command help documentation.
+ */
+ helpInformation(): string;
+
+ /**
+ * You can pass in flags and a description to override the help
+ * flags and help description for your command. Pass in false
+ * to disable the built-in help option.
+ */
+ helpOption(flags?: string | boolean, description?: string): this;
+
+ /**
+ * Output help information and exit.
+ */
+ help(cb?: (str: string) => string): never;
+
+ /**
+ * Add a listener (callback) for when events occur. (Implemented using EventEmitter.)
+ *
+ * @example
+ * program
+ * .on('--help', () -> {
+ * console.log('See web site for more information.');
+ * });
+ */
+ on(event: string | symbol, listener: (...args: any[]) => void): this;
+ }
+ type CommandConstructor = new (name?: string) => Command;
+
+ interface CommandOptions {
+ noHelp?: boolean; // old name for hidden
+ hidden?: boolean;
+ isDefault?: boolean;
+ }
+ interface ExecutableCommandOptions extends CommandOptions {
+ executableFile?: string;
+ }
+
+ interface ParseOptionsResult {
+ operands: string[];
+ unknown: string[];
+ }
+
+ interface CommanderStatic extends Command {
+ program: Command;
+ Command: CommandConstructor;
+ Option: OptionConstructor;
+ CommanderError: CommanderErrorConstructor;
+ }
+
+}
+
+// Declaring namespace AND global
+// eslint-disable-next-line @typescript-eslint/no-redeclare
+declare const commander: commander.CommanderStatic;
+export = commander;
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/CHANGELOG.md b/temporary_modules/trezor-connect/node_modules/cross-spawn/CHANGELOG.md
new file mode 100644
index 00000000..d07c9e5c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/CHANGELOG.md
@@ -0,0 +1,130 @@
+# Changelog
+
+All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines.
+
+### [7.0.3](https://github.com/moxystudio/node-cross-spawn/compare/v7.0.2...v7.0.3) (2020-05-25)
+
+
+### Bug Fixes
+
+* detect path key based on correct environment ([#133](https://github.com/moxystudio/node-cross-spawn/issues/133)) ([159e7e9](https://github.com/moxystudio/node-cross-spawn/commit/159e7e9785e57451cba034ae51719f97135074ae))
+
+### [7.0.2](https://github.com/moxystudio/node-cross-spawn/compare/v7.0.1...v7.0.2) (2020-04-04)
+
+
+### Bug Fixes
+
+* fix worker threads in Node >=11.10.0 ([#132](https://github.com/moxystudio/node-cross-spawn/issues/132)) ([6c5b4f0](https://github.com/moxystudio/node-cross-spawn/commit/6c5b4f015814a6c4f6b33230dfd1a860aedc0aaf))
+
+### [7.0.1](https://github.com/moxystudio/node-cross-spawn/compare/v7.0.0...v7.0.1) (2019-10-07)
+
+
+### Bug Fixes
+
+* **core:** support worker threads ([#127](https://github.com/moxystudio/node-cross-spawn/issues/127)) ([cfd49c9](https://github.com/moxystudio/node-cross-spawn/commit/cfd49c9))
+
+## [7.0.0](https://github.com/moxystudio/node-cross-spawn/compare/v6.0.5...v7.0.0) (2019-09-03)
+
+
+### ⚠ BREAKING CHANGES
+
+* drop support for Node.js < 8
+
+* drop support for versions below Node.js 8 ([#125](https://github.com/moxystudio/node-cross-spawn/issues/125)) ([16feb53](https://github.com/moxystudio/node-cross-spawn/commit/16feb53))
+
+
+## [6.0.5](https://github.com/moxystudio/node-cross-spawn/compare/v6.0.4...v6.0.5) (2018-03-02)
+
+
+### Bug Fixes
+
+* avoid using deprecated Buffer constructor ([#94](https://github.com/moxystudio/node-cross-spawn/issues/94)) ([d5770df](https://github.com/moxystudio/node-cross-spawn/commit/d5770df)), closes [/nodejs.org/api/deprecations.html#deprecations_dep0005](https://github.com//nodejs.org/api/deprecations.html/issues/deprecations_dep0005)
+
+
+
+
+## [6.0.4](https://github.com/moxystudio/node-cross-spawn/compare/v6.0.3...v6.0.4) (2018-01-31)
+
+
+### Bug Fixes
+
+* fix paths being incorrectly normalized on unix ([06ee3c6](https://github.com/moxystudio/node-cross-spawn/commit/06ee3c6)), closes [#90](https://github.com/moxystudio/node-cross-spawn/issues/90)
+
+
+
+
+## [6.0.3](https://github.com/moxystudio/node-cross-spawn/compare/v6.0.2...v6.0.3) (2018-01-23)
+
+
+
+
+## [6.0.2](https://github.com/moxystudio/node-cross-spawn/compare/v6.0.1...v6.0.2) (2018-01-23)
+
+
+
+
+## [6.0.1](https://github.com/moxystudio/node-cross-spawn/compare/v6.0.0...v6.0.1) (2018-01-23)
+
+
+
+
+# [6.0.0](https://github.com/moxystudio/node-cross-spawn/compare/5.1.0...6.0.0) (2018-01-23)
+
+
+### Bug Fixes
+
+* fix certain arguments not being correctly escaped or causing batch syntax error ([900cf10](https://github.com/moxystudio/node-cross-spawn/commit/900cf10)), closes [#82](https://github.com/moxystudio/node-cross-spawn/issues/82) [#51](https://github.com/moxystudio/node-cross-spawn/issues/51)
+* fix commands as posix relatixe paths not working correctly, e.g.: `./my-command` ([900cf10](https://github.com/moxystudio/node-cross-spawn/commit/900cf10))
+* fix `options` argument being mutated ([900cf10](https://github.com/moxystudio/node-cross-spawn/commit/900cf10))
+* fix commands resolution when PATH was actually Path ([900cf10](https://github.com/moxystudio/node-cross-spawn/commit/900cf10))
+
+
+### Features
+
+* improve compliance with node's ENOENT errors ([900cf10](https://github.com/moxystudio/node-cross-spawn/commit/900cf10))
+* improve detection of node's shell option support ([900cf10](https://github.com/moxystudio/node-cross-spawn/commit/900cf10))
+
+
+### Chores
+
+* upgrade tooling
+* upgrate project to es6 (node v4)
+
+
+### BREAKING CHANGES
+
+* remove support for older nodejs versions, only `node >= 4` is supported
+
+
+
+## [5.1.0](https://github.com/moxystudio/node-cross-spawn/compare/5.0.1...5.1.0) (2017-02-26)
+
+
+### Bug Fixes
+
+* fix `options.shell` support for NodeJS [v4.8](https://github.com/nodejs/node/blob/master/doc/changelogs/CHANGELOG_V4.md#4.8.0)
+
+
+
+## [5.0.1](https://github.com/moxystudio/node-cross-spawn/compare/5.0.0...5.0.1) (2016-11-04)
+
+
+### Bug Fixes
+
+* fix `options.shell` support for NodeJS v7
+
+
+
+# [5.0.0](https://github.com/moxystudio/node-cross-spawn/compare/4.0.2...5.0.0) (2016-10-30)
+
+
+## Features
+
+* add support for `options.shell`
+* improve parsing of shebangs by using [`shebang-command`](https://github.com/kevva/shebang-command) module
+
+
+## Chores
+
+* refactor some code to make it more clear
+* update README caveats
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/LICENSE b/temporary_modules/trezor-connect/node_modules/cross-spawn/LICENSE
new file mode 100644
index 00000000..8407b9a3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2018 Made With MOXY Lda
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/README.md b/temporary_modules/trezor-connect/node_modules/cross-spawn/README.md
new file mode 100644
index 00000000..c4a4da84
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/README.md
@@ -0,0 +1,96 @@
+# cross-spawn
+
+[![NPM version][npm-image]][npm-url] [![Downloads][downloads-image]][npm-url] [![Build Status][travis-image]][travis-url] [![Build status][appveyor-image]][appveyor-url] [![Coverage Status][codecov-image]][codecov-url] [![Dependency status][david-dm-image]][david-dm-url] [![Dev Dependency status][david-dm-dev-image]][david-dm-dev-url]
+
+[npm-url]:https://npmjs.org/package/cross-spawn
+[downloads-image]:https://img.shields.io/npm/dm/cross-spawn.svg
+[npm-image]:https://img.shields.io/npm/v/cross-spawn.svg
+[travis-url]:https://travis-ci.org/moxystudio/node-cross-spawn
+[travis-image]:https://img.shields.io/travis/moxystudio/node-cross-spawn/master.svg
+[appveyor-url]:https://ci.appveyor.com/project/satazor/node-cross-spawn
+[appveyor-image]:https://img.shields.io/appveyor/ci/satazor/node-cross-spawn/master.svg
+[codecov-url]:https://codecov.io/gh/moxystudio/node-cross-spawn
+[codecov-image]:https://img.shields.io/codecov/c/github/moxystudio/node-cross-spawn/master.svg
+[david-dm-url]:https://david-dm.org/moxystudio/node-cross-spawn
+[david-dm-image]:https://img.shields.io/david/moxystudio/node-cross-spawn.svg
+[david-dm-dev-url]:https://david-dm.org/moxystudio/node-cross-spawn?type=dev
+[david-dm-dev-image]:https://img.shields.io/david/dev/moxystudio/node-cross-spawn.svg
+
+A cross platform solution to node's spawn and spawnSync.
+
+
+## Installation
+
+Node.js version 8 and up:
+`$ npm install cross-spawn`
+
+Node.js version 7 and under:
+`$ npm install cross-spawn@6`
+
+## Why
+
+Node has issues when using spawn on Windows:
+
+- It ignores [PATHEXT](https://github.com/joyent/node/issues/2318)
+- It does not support [shebangs](https://en.wikipedia.org/wiki/Shebang_(Unix))
+- Has problems running commands with [spaces](https://github.com/nodejs/node/issues/7367)
+- Has problems running commands with posix relative paths (e.g.: `./my-folder/my-executable`)
+- Has an [issue](https://github.com/moxystudio/node-cross-spawn/issues/82) with command shims (files in `node_modules/.bin/`), where arguments with quotes and parenthesis would result in [invalid syntax error](https://github.com/moxystudio/node-cross-spawn/blob/e77b8f22a416db46b6196767bcd35601d7e11d54/test/index.test.js#L149)
+- No `options.shell` support on node `` where `` must not contain any arguments.
+If you would like to have the shebang support improved, feel free to contribute via a pull-request.
+
+Remember to always test your code on Windows!
+
+
+## Tests
+
+`$ npm test`
+`$ npm test -- --watch` during development
+
+
+## License
+
+Released under the [MIT License](https://www.opensource.org/licenses/mit-license.php).
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/index.js b/temporary_modules/trezor-connect/node_modules/cross-spawn/index.js
new file mode 100644
index 00000000..5509742c
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/index.js
@@ -0,0 +1,39 @@
+'use strict';
+
+const cp = require('child_process');
+const parse = require('./lib/parse');
+const enoent = require('./lib/enoent');
+
+function spawn(command, args, options) {
+ // Parse the arguments
+ const parsed = parse(command, args, options);
+
+ // Spawn the child process
+ const spawned = cp.spawn(parsed.command, parsed.args, parsed.options);
+
+ // Hook into child process "exit" event to emit an error if the command
+ // does not exists, see: https://github.com/IndigoUnited/node-cross-spawn/issues/16
+ enoent.hookChildProcess(spawned, parsed);
+
+ return spawned;
+}
+
+function spawnSync(command, args, options) {
+ // Parse the arguments
+ const parsed = parse(command, args, options);
+
+ // Spawn the child process
+ const result = cp.spawnSync(parsed.command, parsed.args, parsed.options);
+
+ // Analyze if the command does not exist, see: https://github.com/IndigoUnited/node-cross-spawn/issues/16
+ result.error = result.error || enoent.verifyENOENTSync(result.status, parsed);
+
+ return result;
+}
+
+module.exports = spawn;
+module.exports.spawn = spawn;
+module.exports.sync = spawnSync;
+
+module.exports._parse = parse;
+module.exports._enoent = enoent;
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/enoent.js b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/enoent.js
new file mode 100644
index 00000000..14df9b62
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/enoent.js
@@ -0,0 +1,59 @@
+'use strict';
+
+const isWin = process.platform === 'win32';
+
+function notFoundError(original, syscall) {
+ return Object.assign(new Error(`${syscall} ${original.command} ENOENT`), {
+ code: 'ENOENT',
+ errno: 'ENOENT',
+ syscall: `${syscall} ${original.command}`,
+ path: original.command,
+ spawnargs: original.args,
+ });
+}
+
+function hookChildProcess(cp, parsed) {
+ if (!isWin) {
+ return;
+ }
+
+ const originalEmit = cp.emit;
+
+ cp.emit = function (name, arg1) {
+ // If emitting "exit" event and exit code is 1, we need to check if
+ // the command exists and emit an "error" instead
+ // See https://github.com/IndigoUnited/node-cross-spawn/issues/16
+ if (name === 'exit') {
+ const err = verifyENOENT(arg1, parsed, 'spawn');
+
+ if (err) {
+ return originalEmit.call(cp, 'error', err);
+ }
+ }
+
+ return originalEmit.apply(cp, arguments); // eslint-disable-line prefer-rest-params
+ };
+}
+
+function verifyENOENT(status, parsed) {
+ if (isWin && status === 1 && !parsed.file) {
+ return notFoundError(parsed.original, 'spawn');
+ }
+
+ return null;
+}
+
+function verifyENOENTSync(status, parsed) {
+ if (isWin && status === 1 && !parsed.file) {
+ return notFoundError(parsed.original, 'spawnSync');
+ }
+
+ return null;
+}
+
+module.exports = {
+ hookChildProcess,
+ verifyENOENT,
+ verifyENOENTSync,
+ notFoundError,
+};
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/parse.js b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/parse.js
new file mode 100644
index 00000000..0129d747
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/parse.js
@@ -0,0 +1,91 @@
+'use strict';
+
+const path = require('path');
+const resolveCommand = require('./util/resolveCommand');
+const escape = require('./util/escape');
+const readShebang = require('./util/readShebang');
+
+const isWin = process.platform === 'win32';
+const isExecutableRegExp = /\.(?:com|exe)$/i;
+const isCmdShimRegExp = /node_modules[\\/].bin[\\/][^\\/]+\.cmd$/i;
+
+function detectShebang(parsed) {
+ parsed.file = resolveCommand(parsed);
+
+ const shebang = parsed.file && readShebang(parsed.file);
+
+ if (shebang) {
+ parsed.args.unshift(parsed.file);
+ parsed.command = shebang;
+
+ return resolveCommand(parsed);
+ }
+
+ return parsed.file;
+}
+
+function parseNonShell(parsed) {
+ if (!isWin) {
+ return parsed;
+ }
+
+ // Detect & add support for shebangs
+ const commandFile = detectShebang(parsed);
+
+ // We don't need a shell if the command filename is an executable
+ const needsShell = !isExecutableRegExp.test(commandFile);
+
+ // If a shell is required, use cmd.exe and take care of escaping everything correctly
+ // Note that `forceShell` is an hidden option used only in tests
+ if (parsed.options.forceShell || needsShell) {
+ // Need to double escape meta chars if the command is a cmd-shim located in `node_modules/.bin/`
+ // The cmd-shim simply calls execute the package bin file with NodeJS, proxying any argument
+ // Because the escape of metachars with ^ gets interpreted when the cmd.exe is first called,
+ // we need to double escape them
+ const needsDoubleEscapeMetaChars = isCmdShimRegExp.test(commandFile);
+
+ // Normalize posix paths into OS compatible paths (e.g.: foo/bar -> foo\bar)
+ // This is necessary otherwise it will always fail with ENOENT in those cases
+ parsed.command = path.normalize(parsed.command);
+
+ // Escape command & arguments
+ parsed.command = escape.command(parsed.command);
+ parsed.args = parsed.args.map((arg) => escape.argument(arg, needsDoubleEscapeMetaChars));
+
+ const shellCommand = [parsed.command].concat(parsed.args).join(' ');
+
+ parsed.args = ['/d', '/s', '/c', `"${shellCommand}"`];
+ parsed.command = process.env.comspec || 'cmd.exe';
+ parsed.options.windowsVerbatimArguments = true; // Tell node's spawn that the arguments are already escaped
+ }
+
+ return parsed;
+}
+
+function parse(command, args, options) {
+ // Normalize arguments, similar to nodejs
+ if (args && !Array.isArray(args)) {
+ options = args;
+ args = null;
+ }
+
+ args = args ? args.slice(0) : []; // Clone array to avoid changing the original
+ options = Object.assign({}, options); // Clone object to avoid changing the original
+
+ // Build our parsed object
+ const parsed = {
+ command,
+ args,
+ options,
+ file: undefined,
+ original: {
+ command,
+ args,
+ },
+ };
+
+ // Delegate further parsing to shell or non-shell
+ return options.shell ? parsed : parseNonShell(parsed);
+}
+
+module.exports = parse;
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/util/escape.js b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/util/escape.js
new file mode 100644
index 00000000..b0bb84c3
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/util/escape.js
@@ -0,0 +1,45 @@
+'use strict';
+
+// See http://www.robvanderwoude.com/escapechars.php
+const metaCharsRegExp = /([()\][%!^"`<>&|;, *?])/g;
+
+function escapeCommand(arg) {
+ // Escape meta chars
+ arg = arg.replace(metaCharsRegExp, '^$1');
+
+ return arg;
+}
+
+function escapeArgument(arg, doubleEscapeMetaChars) {
+ // Convert to string
+ arg = `${arg}`;
+
+ // Algorithm below is based on https://qntm.org/cmd
+
+ // Sequence of backslashes followed by a double quote:
+ // double up all the backslashes and escape the double quote
+ arg = arg.replace(/(\\*)"/g, '$1$1\\"');
+
+ // Sequence of backslashes followed by the end of the string
+ // (which will become a double quote later):
+ // double up all the backslashes
+ arg = arg.replace(/(\\*)$/, '$1$1');
+
+ // All other backslashes occur literally
+
+ // Quote the whole thing:
+ arg = `"${arg}"`;
+
+ // Escape meta chars
+ arg = arg.replace(metaCharsRegExp, '^$1');
+
+ // Double escape meta chars if necessary
+ if (doubleEscapeMetaChars) {
+ arg = arg.replace(metaCharsRegExp, '^$1');
+ }
+
+ return arg;
+}
+
+module.exports.command = escapeCommand;
+module.exports.argument = escapeArgument;
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/util/readShebang.js b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/util/readShebang.js
new file mode 100644
index 00000000..5e83733f
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/util/readShebang.js
@@ -0,0 +1,23 @@
+'use strict';
+
+const fs = require('fs');
+const shebangCommand = require('shebang-command');
+
+function readShebang(command) {
+ // Read the first 150 bytes from the file
+ const size = 150;
+ const buffer = Buffer.alloc(size);
+
+ let fd;
+
+ try {
+ fd = fs.openSync(command, 'r');
+ fs.readSync(fd, buffer, 0, size, 0);
+ fs.closeSync(fd);
+ } catch (e) { /* Empty */ }
+
+ // Attempt to extract shebang (null is returned if not a shebang)
+ return shebangCommand(buffer.toString());
+}
+
+module.exports = readShebang;
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/util/resolveCommand.js b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/util/resolveCommand.js
new file mode 100644
index 00000000..79724550
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/lib/util/resolveCommand.js
@@ -0,0 +1,52 @@
+'use strict';
+
+const path = require('path');
+const which = require('which');
+const getPathKey = require('path-key');
+
+function resolveCommandAttempt(parsed, withoutPathExt) {
+ const env = parsed.options.env || process.env;
+ const cwd = process.cwd();
+ const hasCustomCwd = parsed.options.cwd != null;
+ // Worker threads do not have process.chdir()
+ const shouldSwitchCwd = hasCustomCwd && process.chdir !== undefined && !process.chdir.disabled;
+
+ // If a custom `cwd` was specified, we need to change the process cwd
+ // because `which` will do stat calls but does not support a custom cwd
+ if (shouldSwitchCwd) {
+ try {
+ process.chdir(parsed.options.cwd);
+ } catch (err) {
+ /* Empty */
+ }
+ }
+
+ let resolved;
+
+ try {
+ resolved = which.sync(parsed.command, {
+ path: env[getPathKey({ env })],
+ pathExt: withoutPathExt ? path.delimiter : undefined,
+ });
+ } catch (e) {
+ /* Empty */
+ } finally {
+ if (shouldSwitchCwd) {
+ process.chdir(cwd);
+ }
+ }
+
+ // If we successfully resolved, ensure that an absolute path is returned
+ // Note that when a custom `cwd` was used, we need to resolve to an absolute path based on it
+ if (resolved) {
+ resolved = path.resolve(hasCustomCwd ? parsed.options.cwd : '', resolved);
+ }
+
+ return resolved;
+}
+
+function resolveCommand(parsed) {
+ return resolveCommandAttempt(parsed) || resolveCommandAttempt(parsed, true);
+}
+
+module.exports = resolveCommand;
diff --git a/temporary_modules/trezor-connect/node_modules/cross-spawn/package.json b/temporary_modules/trezor-connect/node_modules/cross-spawn/package.json
new file mode 100644
index 00000000..232ff97e
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/cross-spawn/package.json
@@ -0,0 +1,73 @@
+{
+ "name": "cross-spawn",
+ "version": "7.0.3",
+ "description": "Cross platform child_process#spawn and child_process#spawnSync",
+ "keywords": [
+ "spawn",
+ "spawnSync",
+ "windows",
+ "cross-platform",
+ "path-ext",
+ "shebang",
+ "cmd",
+ "execute"
+ ],
+ "author": "André Cruz ",
+ "homepage": "https://github.com/moxystudio/node-cross-spawn",
+ "repository": {
+ "type": "git",
+ "url": "git@github.com:moxystudio/node-cross-spawn.git"
+ },
+ "license": "MIT",
+ "main": "index.js",
+ "files": [
+ "lib"
+ ],
+ "scripts": {
+ "lint": "eslint .",
+ "test": "jest --env node --coverage",
+ "prerelease": "npm t && npm run lint",
+ "release": "standard-version",
+ "postrelease": "git push --follow-tags origin HEAD && npm publish"
+ },
+ "husky": {
+ "hooks": {
+ "commit-msg": "commitlint -E HUSKY_GIT_PARAMS",
+ "pre-commit": "lint-staged"
+ }
+ },
+ "lint-staged": {
+ "*.js": [
+ "eslint --fix",
+ "git add"
+ ]
+ },
+ "commitlint": {
+ "extends": [
+ "@commitlint/config-conventional"
+ ]
+ },
+ "dependencies": {
+ "path-key": "^3.1.0",
+ "shebang-command": "^2.0.0",
+ "which": "^2.0.1"
+ },
+ "devDependencies": {
+ "@commitlint/cli": "^8.1.0",
+ "@commitlint/config-conventional": "^8.1.0",
+ "babel-core": "^6.26.3",
+ "babel-jest": "^24.9.0",
+ "babel-preset-moxy": "^3.1.0",
+ "eslint": "^5.16.0",
+ "eslint-config-moxy": "^7.1.0",
+ "husky": "^3.0.5",
+ "jest": "^24.9.0",
+ "lint-staged": "^9.2.5",
+ "mkdirp": "^0.5.1",
+ "rimraf": "^3.0.0",
+ "standard-version": "^7.0.0"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+}
diff --git a/temporary_modules/trezor-connect/node_modules/debug/LICENSE b/temporary_modules/trezor-connect/node_modules/debug/LICENSE
new file mode 100644
index 00000000..1a9820e2
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/debug/LICENSE
@@ -0,0 +1,20 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk
+Copyright (c) 2018-2021 Josh Junon
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software
+and associated documentation files (the 'Software'), to deal in the Software without restriction,
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/temporary_modules/trezor-connect/node_modules/debug/README.md b/temporary_modules/trezor-connect/node_modules/debug/README.md
new file mode 100644
index 00000000..e9c3e047
--- /dev/null
+++ b/temporary_modules/trezor-connect/node_modules/debug/README.md
@@ -0,0 +1,481 @@
+# debug
+[](https://travis-ci.org/debug-js/debug) [](https://coveralls.io/github/debug-js/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers)
+[](#sponsors)
+
+
+
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example [_app.js_](./examples/node/app.js):
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %o', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example [_worker.js_](./examples/node/worker.js):
+
+```js
+var a = require('debug')('worker:a')
+ , b = require('debug')('worker:b');
+
+function work() {
+ a('doing lots of uninteresting work');
+ setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+ b('doing some work');
+ setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
+```
+
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
+
+Here are some examples:
+
+
+
+
+
+#### Windows command prompt notes
+
+##### CMD
+
+On Windows the environment variable is set using the `set` command.
+
+```cmd
+set DEBUG=*,-not_this
+```
+
+Example:
+
+```cmd
+set DEBUG=* & node app.js
+```
+
+##### PowerShell (VS Code default)
+
+PowerShell uses different syntax to set environment variables.
+
+```cmd
+$env:DEBUG = "*,-not_this"
+```
+
+Example:
+
+```cmd
+$env:DEBUG='app';node app.js
+```
+
+Then, run the program to be debugged as usual.
+
+npm script example:
+```js
+ "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
+```
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+
+
+
+## Millisecond diff
+
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+
+
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
+
+
+
+
+## Conventions
+
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output.
+
+## Wildcards
+
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
+
+## Environment Variables
+
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
+
+| Name | Purpose |
+|-----------|-------------------------------------------------|
+| `DEBUG` | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
+
+## Formatters
+
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O` | Pretty-print an Object on multiple lines. |
+| `%o` | Pretty-print an Object all on a single line. |
+| `%s` | String. |
+| `%d` | Number (both integer and float). |
+| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%` | Single percent sign ('%'). This does not consume an argument. |
+
+
+### Custom formatters
+
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+ return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+// foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_.
+
+
+
+## Output streams
+
+ By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example [_stdout.js_](./examples/node/stdout.js):
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Extend
+You can simply extend debugger
+```js
+const log = require('debug')('auth');
+
+//creates new debug instance with extended namespace
+const logSign = log.extend('sign');
+const logLogin = log.extend('login');
+
+log('hello'); // auth hello
+logSign('hello'); //auth:sign hello
+logLogin('hello'); //auth:login hello
+```
+
+## Set dynamically
+
+You can also enable debug dynamically by calling the `enable()` method :
+
+```js
+let debug = require('debug');
+
+console.log(1, debug.enabled('test'));
+
+debug.enable('test');
+console.log(2, debug.enabled('test'));
+
+debug.disable();
+console.log(3, debug.enabled('test'));
+
+```
+
+print :
+```
+1 false
+2 true
+3 false
+```
+
+Usage :
+`enable(namespaces)`
+`namespaces` can include modes separated by a colon and wildcards.
+
+Note that calling `enable()` completely overrides previously set DEBUG variable :
+
+```
+$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
+=> false
+```
+
+`disable()`
+
+Will disable all namespaces. The functions returns the namespaces currently
+enabled (and skipped). This can be useful if you want to disable debugging
+temporarily without knowing what was enabled to begin with.
+
+For example:
+
+```js
+let debug = require('debug');
+debug.enable('foo:*,-foo:bar');
+let namespaces = debug.disable();
+debug.enable(namespaces);
+```
+
+Note: There is no guarantee that the string will be identical to the initial
+enable string, but semantically they will be identical.
+
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+ // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
+## Usage in child processes
+
+Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process.
+For example:
+
+```javascript
+worker = fork(WORKER_WRAP_PATH, [workerPath], {
+ stdio: [
+ /* stdin: */ 0,
+ /* stdout: */ 'pipe',
+ /* stderr: */ 'pipe',
+ 'ipc',
+ ],
+ env: Object.assign({}, process.env, {
+ DEBUG_COLORS: 1 // without this settings, colors won't be shown
+ }),
+});
+
+worker.stderr.pipe(process.stderr, { end: false });
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+ - Josh Junon
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+